Log In
This page is currently not sponsored. Click here to sponsor this page.
Get Involved with mindat.org
Mindat.org has grown through countless contributions from mineral enthusiasts, collectors, researchers and experts around the world — people just like you.
Want to take part?
1
2
3
4
Contribute
Add photos, locality information and knowledge
Every contribution helps make mindat.org better for everyone.
Area:
52,072 km2
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Hamar | 29,479 (2016) |
| Lillehammer | 19,096 (2017) |
| Gjøvik | 17,596 (2017) |
| Elverum | 12,490 (2010) |
| Kongsvinger | 11,181 (2016) |
| Brumunddal | 8,441 (2010) |
Other Languages:
French:
Oppland, Norvège
German:
Oppland, Norwegen
Italian:
Oppland, Norvegia
Norwegian:
Oppland, Norge
Russian:
Оппланн, Норвегия
Simplified Chinese:
奥普兰郡, 挪威
Spanish:
Oppland, Noruega
Afar:
Innlandet
Afrikaans:
Oppland, Noorweë
Akan:
Innlandet, Norway
Albanian:
Oppland, Norvegjia
Anglo-Saxon:
Innlandet, Norþƿeȝ
Arabic:
أوبلاند, النرويج
Aragonese:
Innlandet, Noruega
Armenian:
Օփլան, Նորվեգիա
Aromanian:
Innlandet, Norveghia
Asturian:
Oppland, Noruega
Aymara:
Innlandet, Nurweka
Azeri:
Innlandet, Norveç
Bambara:
Innlandet, Norwij
Basque:
Oppland, Norvegia
Bavarian:
Oppland, Norwegn
Belarusian:
Оплан, Нарвегія
Belarusian (Tarashkevitsa):
Оплан, Нарвэгія
Bengali:
অপল্যান্ড, নরওয়ে
Bishnupriya Manipuri:
ওপল্যান্ড, নরৱে
Bislama:
Innlandet, Norway
Bosnian:
Oppland, Norveška
Breton:
Oppland, Norvegia
Bulgarian:
Оплан, Норвегия
Catalan:
Oppland, Noruega
Cebuano:
Oppland fylke, Norway
Central Bikol:
Innlandet, Norwey
Chamorro:
Innlandet, Norge
Chavacano:
Innlandet, Noruega
Cherokee:
Innlandet, ᏃᏪ
Chewa:
Innlandet, Norge
Cheyenne:
Innlandet, Norway
Cornish:
Oppland, Norgagh
Corsican:
Innlandet, Nurvegia
Cree:
Innlandet, Norway
Croatian:
Oppland, Norveška
Czech:
Oppland, Norsko
Danish:
Oppland, Norge
Dutch:
Oppland, Noorwegen
Dutch Low Saxon:
Innlandet, Noorwegen
Emilian-Romagnol:
Innlandet, Nurvégia
Esperanto:
Oppland, Norvegio
Estonian:
Oppland, Norra
Ewe:
Innlandet, Norway
Extremaduran:
Innlandet, Noruega
Faroese:
Oppland fylke, Noreg
Farsi/Persian:
اوپلاند , نروژ
Fijian:
Innlandet, Norge
Finnish:
Opplandin lääni, Norja
Franco-Provençal:
Innlandet, Norvèg·e
Friulian:
Innlandet, Norvegje
Fula:
Innlandet, Norwees
Gagauz:
Innlandet, Norvegiya
Galician:
Innlandet, Noruega
Georgian:
ოპლანი, ნორვეგია
Greek:
Όπλαντ, Νορβηγία
Greenlandic:
Innlandet, Norge
Guarani:
Innlandet, Noruega
Gujarati:
ઓપ્પલેન્ડ, નોર્વે
Haitian:
Innlandet, Nòvèj
Hakka:
Innlandet, Nò-vî
Hausa:
Innlandet, Norway
Hawaiian:
Innlandet, Nolewai
Hebrew:
אופלנד , נורבגיה
Hindi:
ओपलैंड, नॉर्वे
Hungarian:
Oppland megye, Norvégia
Icelandic:
Upplönd, Noregur
Ido:
Innlandet, Norvegia
Igbo:
Innlandet, Norway
Iloko:
Innlandet, Norwega
Indonesian:
Oppland, Norwegia
Interlingua:
Innlandet, Norvegia
Interlingue:
Innlandet, Norvegia
Inuktitut:
Innlandet, ᓄᕐᒋ/nurgi
Inupiaq:
Innlandet, Norge
Irish Gaelic:
Innlandet, An Iorua
Jamaican Patois:
Innlandet, Naawie
Japanese:
オップラン県, ノルウェー
Javanese:
Innlandet, Norwégia
Judaeo-Spanish:
Innlandet, Norvejia
Kabyle:
Innlandet, Nurvij
Kannada:
ಆಪ್ಲಾಂಡ್, ಕಾಮೌ
Kapampangan:
Innlandet, Norwega
Karakalpak:
Innlandet, Norvegiya
Kashubian:
Innlandet, Norweskô
Kikuyu:
Innlandet, Nowĩ
Kinyarwanda:
Innlandet, Noruveje
Kongo:
Innlandet, Norge
Korean:
오플란주, 노르웨이
Kurdish (Latin Script):
Innlandet, Norwêc
Latgalian:
Innlandet, Norvegeja
Latin:
Oppland, Norvegia
Latvian:
Oplanne, Norvēģija
Ligurian:
Innlandet, Nòrvexa
Limburgian:
Oppland, Noorwege
Lingala:
Innlandet, Norvej
Lingua Franca Nova:
Innlandet, Noria
Lithuanian:
Oplandas, Norvegija
Lojban:
Innlandet, noreg
Lombard:
Innlandet, Nurvegia
Low Saxon/Low German:
Amt Oppland, Norwegen
Lower Sorbian:
Innlandet, Norwegska
Luxembourgish:
Innlandet, Norwegen
Macedonian:
Оплан, Норвешка
Malay:
Oppland, Norway
Maltese:
Innlandet, Norveġja
Maori:
Innlandet, Nōwei
Marathi:
ऑप्पलँड, नॉर्वे
Min Dong Chinese:
Innlandet, Nò̤-ŭi
Minangkabau:
Innlandet, Norwegia
Minnan / Hokkien-Taiwanese:
Oppland, Lo̍k-ui
Mirandese:
Innlandet, Noruega
Nahuatl:
Innlandet, Noruega
Narom:
Innlandet, Norouague
Nauruan:
Oppland, Norwei
Navajo:
Innlandet, Kinghą́ą́ʼ Haltsooí Dineʼé Bikéyah
Neapolitan:
Innlandet, Norvegia
Norfolk:
Innlandet, Norwaii
Northern Frisian:
Innlandet, Norweegen
Northern Sami:
Opplándda fylka, Norga
Northern Sotho:
Innlandet, Norge
Norwegian (Nynorsk):
Oppland fylke, Noreg
Novial:
Innlandet, Norvegia
Occitan:
Oppland, Norvègia
Oromo:
Innlandet, Norway
Ossetian:
Опланн, Норвеги
Pangasinan:
Innlandet, Noruéga
Pashto:
اينلانه, ناروې
Pennsylvania German:
Innlandet, Norwegen
Pfaelzisch:
Innlandet, Norwege
Picard:
Innlandet, Norvège
Piedmontese:
Innlandet, Norvegia
Plautdietsch:
Innlandet
Polish:
Oppland, Norwegia
Portuguese:
Oppland, Noruega
Quechua:
Innlandet, Nurwiga
Ripuarian:
Innlandet, Norweje
Romanian:
Oppland, Norvegia
Romansh:
Innlandet, Norvegia
Rundi:
Innlandet, Norway
Samoan:
Innlandet, Norge
Samogitian:
Uoplands, Nuorvegėjė
Sango:
Innlandet, Nörvêzi
Sardinian:
Innlandet, Norvegia
Saterland Frisian:
Innlandet, Norwegen
Scots:
Oppland, Norawa
Scottish Gaelic:
Innlandet, Nirribhidh
Serbian:
Опланд, Норвешка
Serbo-Croatian:
Oppland, Norveška
Sesotho:
Innlandet, Norge
Shona:
Innlandet, Norway
Sicilian:
Innlandet, Nurveggia
Silesian:
Innlandet, Norwygijo
Silesian German:
Innlandet
Sinhalese:
ඔප්ලන්ඩ්, නෝර්වේ
Slovak:
Oppland, Nórsko
Slovenian:
Oppland, Norveška
Somali:
Innlandet, Norway
South Azerbaijani:
اوپلاند, نوروژ
Sranan Tongo:
Innlandet, Norvegikondre
Swahili:
Oppland, Norwei
Swedish:
Oppland, Norge
Tagalog:
Innlandet, Noruwega
Tahitian:
Innlandet, Norvège
Tajik (Cyrillic Script):
Ҳедмарк, Норвеж
Tamil:
ஒப்பிலான்ட், நோர்வே
Tarantino:
Innlandet, Norveggie
Tatar:
Һедмарк, Норвегия
Telugu:
ఆప్లాండ్, నార్వే
Tetum:
Innlandet, Noruega
Thai:
เทศบาลเมืองโคการ์, นอร์เวย์
Tok Pisin:
Innlandet, Nowe
Tongan:
Innlandet, Noaue
Tsonga:
Innlandet, Norge
Tumbuka:
Innlandet, Norway
Turkish:
Oppland, Norveç
Turkmen:
Innlandet, Norwegiýa
Ukrainian:
Опплан, Норвегія
Upper Sorbian:
Innlandet, Norwegska
Urdu:
اوپلان, ناروے
Uzbek (Latin Script):
Innlandet, Norvegiya
Venetian:
Innlandet, Norveja
Veps:
Innlandet, Norvegii
Vietnamese:
Oppland, Na Uy
Vlax Romani:
Innlandet, Norvejiya
Volapük:
Innlandet, Norgän
Walloon:
Innlandet, Norvedje
Waray:
Oppland, Noruega
Welsh:
Innlandet, Norwy
West Flemish:
Innlandet, Nôorweegn
West Frisian:
Innlandet, Noarwegen
Western Punjabi:
اوپلینڈ, ناروے
Wolof:
Innlandet, Noorwees
Xhosa:
Innlandet
Yoruba:
Innlandet, Nọ́rwèy
Zazaki:
Innlandet, Norwec
Zeelandic:
Innlandet, Noorwegen
Zhuang:
Innlandet, Nozveih
Zulu:
Innlandet, INoki
"Innlandet is a county in Norway. It was created on 1 January 2020 with the merger of the old counties of Oppland and Hedmark (the municipalities of Jevnaker and Lunner were transferred to the neighboring county of Viken on the same date). The new county has an area of 52,113 square kilometres (20,121 sq mi), making it the second largest county in Norway after Troms og Finnmark county." (Wikipedia)
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities153 valid minerals. 1 (TL) - type locality of valid minerals.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ Aegirine-augite ? Formula: (NaaCabFe2+cMgd)(Fe3+eAlfFe2+gMgh)Si2O6 Locality: Vassbråa, Gran, Innlandet, Norway |
| ⓘ Albite Formula: Na(AlSi3O8) Localities: Reported from at least 12 localities in this region. |
| ⓘ 'Allanite Group' Formula: (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) Localities: Reported from at least 7 localities in this region. |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 |
| ⓘ Altaite Formula: PbTe |
| ⓘ Amarantite Formula: Fe3+2(SO4)2O · 7H2O |
| ⓘ 'Amphibole Supergroup' Formula: AB2C5(T8O22)W2 Localities: Reported from at least 22 localities in this region. |
| ⓘ 'Amphibole Supergroup var. Uralite' Formula: AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ Analcime Formula: Na(AlSi2O6) · H2O |
| ⓘ Anatase Formula: TiO2 Localities: Reported from at least 31 localities in this region. |
| ⓘ Andalusite Formula: Al2(SiO4)O |
| ⓘ Anhydrite Formula: CaSO4 |
| ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 |
| ⓘ Anorthite ? Formula: Ca(Al2Si2O8) |
| ⓘ Anorthite var. Labradorite ? Formula: (Ca,Na)[Al(Al,Si)Si2O8] |
| ⓘ Anthophyllite Formula: ◻Mg2Mg5(Si8O22)(OH)2 Habit: slender prisms, 0,1-1mm in length Description: as |
| ⓘ Antigorite Formula: Mg3(Si2O5)(OH)4 Locality: Framruste, Skjåk, Innlandet, Norway |
| ⓘ 'Apatite' Formula: Ca5(PO4)3A Localities: Reported from at least 15 localities in this region. |
| ⓘ 'Apophyllite Group' Formula: AB4[Si8O20]X · 8H2O |
| ⓘ Aragonite Formula: CaCO3 |
| ⓘ Arsenopyrite Formula: FeAsS |
| ⓘ Atacamite Formula: Cu2(OH)3Cl |
| ⓘ Augite Formula: (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ Axinite-(Fe) Formula: Ca2Fe2+Al2BSi4O15OH Description: The mineral was first found by Hans Christian Olsen and identified by SEM/EDS and PXRD ved Naturhistorisk museum in Oslo |
| ⓘ Babingtonite Formula: Ca2Fe2+Fe3+Si5O14(OH) Locality: Framruste, Skjåk, Innlandet, Norway |
| ⓘ Baryte Formula: BaSO4 Localities: Reported from at least 15 localities in this region. |
| ⓘ 'Bastnäsite' Formula: (Ce/Nd/Y/REE)(CO3)F |
| ⓘ Bementite Formula: Mn7Si6O15(OH)8 Locality: Roadcut Lom, Lom, Innlandet, Norway |
| ⓘ Beryl Formula: Be3Al2(Si6O18) |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 Localities: Reported from at least 22 localities in this region. |
| ⓘ Birnessite Formula: (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O Locality: Fåberg, Lillehammer, Innlandet, Norway References: |
| ⓘ Bornite Formula: Cu5FeS4 Localities: Reported from at least 8 localities in this region. |
| ⓘ Brewsterite-Ba Formula: Ba(Al2Si6)O16 · 5H2O Locality: Åmot, Sjoa, Sel, Innlandet, Norway Description: Up to 3mm broad waterclear crystals. The crystals are stronlgy zonated with brewsterite-Ba in the rims and strontian brewsterite-Ba between the rim and the core, and with a core of brewsterite-Sr. |
| ⓘ Brewsterite-Sr Formula: Sr(Al2Si6)O16 · 5H2O Locality: Åmot, Sjoa, Sel, Innlandet, Norway Description: Up to 3mm broad waterclear crystals. The crystals are stronlgy zonated with brewsterite-Ba in the rims and strontian brewsterite-Ba between the rim and the core, and with a core of brewsterite-Sr |
| ⓘ 'Brewsterite Subgroup' Locality: Sjoa, Sel, Innlandet, Norway |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 Locality: Krokåfaret, Lom, Innlandet, Norway |
| ⓘ Brookite Formula: TiO2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Calcite Formula: CaCO3 Localities: Reported from at least 28 localities in this region. |
| ⓘ 'Chabazite' |
| ⓘ Chalcanthite Formula: CuSO4 · 5H2O |
| ⓘ Chalcocite Formula: Cu2S |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 44 localities in this region. |
| ⓘ 'Chlorite Group' Localities: Reported from at least 33 localities in this region. |
| ⓘ Chromite Formula: Fe2+Cr3+2O4 Localities: Reported from at least 9 localities in this region. |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ Chrysotile Formula: Mg3(Si2O5)(OH)4 Locality: Framruste, Skjåk, Innlandet, Norway |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ Clinochlore var. Chromium-bearing Clinochlore Formula: Mg5(Al,Cr)2Si3O10(OH)8 Locality: Framruste, Skjåk, Innlandet, Norway |
| ⓘ 'Clinopyroxene Subgroup' |
| ⓘ Clinozoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) Localities: Reported from at least 11 localities in this region. |
| ⓘ 'Coal blend' |
| ⓘ Cobaltpentlandite Formula: Co9S8 |
| ⓘ 'Columbite-(Fe)-Columbite-(Mn) Series' |
| ⓘ Copiapite Formula: Fe2+Fe3+4(SO4)6(OH)2 · 20H2O |
| ⓘ Cordierite Formula: Mg2Al4Si5O18 |
| ⓘ Covellite Formula: CuS |
| ⓘ Crandallite Formula: CaAl3(PO4)(PO3OH)(OH)6 |
| ⓘ Cubanite Formula: CuFe2S3 Localities: Reported from at least 6 localities in this region. |
| ⓘ Cummingtonite Formula: ◻Mg2Mg5(Si8O22)(OH)2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Cuprite Formula: Cu2O |
| ⓘ Daubréelite Formula: Fe2+Cr3+2S4 |
| ⓘ Diopside Formula: CaMgSi2O6 Locality: Raudalsvatnet, Skjåk, Innlandet, Norway |
| ⓘ Dolomite Formula: CaMg(CO3)2 Localities: Reported from at least 19 localities in this region. |
| ⓘ Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Dumortierite Formula: Al(Al2O)(Al2O)2(SiO4)3(BO3) Locality: Store Memurutind, Lom, Innlandet, Norway |
| ⓘ Enargite Formula: Cu3AsS4 |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) Localities: Reported from at least 17 localities in this region. |
| ⓘ Epsomite Formula: MgSO4 · 7H2O Habit: fibrous coating Colour: white Description: XRD-film nr 28653, MGM, Oslo References: |
| ⓘ Euxenite-(Y) Formula: (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| ⓘ 'Fayalite-Forsterite Series' Localities: Description: Olivine composition (Fa23.7) usually diagnositc for L (low bulk iron) ordinary chondrites. |
| ⓘ 'Feldspar Group' Localities: Reported from at least 17 localities in this region. |
| ⓘ 'Feldspar Group var. Cryptoperthite' Locality: Byrtnes, Lom, Innlandet, Norway |
| ⓘ 'Feldspar Group var. Perthite' |
| ⓘ 'Fergusonite' Locality: Store Memurutind, Lom, Innlandet, Norway |
| ⓘ Ferro-hornblende Formula: ◻Ca2(Fe2+4Al)(Si7Al)O22(OH)2 |
| ⓘ Fibroferrite Formula: Fe3+(SO4)(OH) · 5H2O |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F Habit: masses and elongated crystals |
| ⓘ Fluorapatite var. Carbonate-rich Fluorapatite Formula: Ca5(PO4,CO3)3(F,O) Habit: Masses and elongated crystals Colour: Greyish-blue with a brownish alteration Description: 1-5 mm roundes masses in feldspar |
| ⓘ Fluorite Formula: CaF2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Forsterite Formula: Mg2(SiO4) Locality: Framruste, Skjåk, Innlandet, Norway |
| ⓘ Forsterite var. Peridot Formula: Mg2SiO4 Locality: Framruste, Skjåk, Innlandet, Norway |
| ⓘ Gahnite ? Formula: ZnAl2O4 Description: Not confirmed by XRD |
| ⓘ Galena Formula: PbS Localities: Reported from at least 12 localities in this region. |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 Localities: Reported from at least 23 localities in this region. |
| ⓘ Gersdorffite Formula: NiAsS |
| ⓘ 'Glass' |
| ⓘ Goethite Formula: Fe3+O(OH) Localities: Reported from at least 10 localities in this region. Description: Nice velvet-coatings and spherules of goethite crystals on quartz crystals. |
| ⓘ Goosecreekite Formula: Ca[Al2Si6O16] · 5H2O Locality: Juvvatn, Lom, Innlandet, Norway References: |
| ⓘ Graphite Formula: C |
| ⓘ Grossular Formula: Ca3Al2(SiO4)3 |
| ⓘ Gypsum Formula: CaSO4 · 2H2O Localities: Reported from at least 6 localities in this region. |
| ⓘ Halotrichite Formula: Fe2+Al2(SO4)4 · 22H2O |
| ⓘ Harmotome Formula: Ba2(Si12Al4)O32 · 12H2O |
| ⓘ Helvine Formula: Be3Mn2+4(SiO4)3S Locality: Skreihaugen, Gran, Innlandet, Norway |
| ⓘ Hematite Formula: Fe2O3 Localities: Reported from at least 17 localities in this region. |
| ⓘ Hercynite Formula: Fe2+Al2O4 |
| ⓘ Hessite Formula: Ag2Te |
| ⓘ Heulandite-Ba Formula: (Ba,Ca,K)5(Si27Al9)O72 · 22H2O |
| ⓘ Heulandite-Ca Formula: (Ca,Na)5(Si27Al9)O72 · 26H2O |
| ⓘ Heulandite-Sr Formula: (Sr,Na,Ca)5(Si27Al9)O72 · 24H2O Locality: Sjoa, Sel, Innlandet, Norway |
| ⓘ 'Heulandite Subgroup' Formula: (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| ⓘ Hexahydrite Formula: Mg(H2O)6(SO4) |
| ⓘ Hisingerite Formula: Fe3+2(Si2O5)(OH)4 · 2H2O |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ Hydroxylapatite Formula: Ca5(PO4)3(OH) |
| ⓘ 'Hypersthene' Formula: (Mg,Fe)SiO3 |
| ⓘ Ilmenite Formula: Fe2+TiO3 Localities: Reported from at least 33 localities in this region. |
| ⓘ Jarosite Formula: KFe3+3(SO4)2(OH)6 |
| ⓘ Kaersutite Formula: NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| ⓘ 'K Feldspar' Localities: Reported from at least 10 localities in this region. |
| ⓘ 'K Feldspar var. Adularia' Formula: KAlSi3O8 Localities: Reported from at least 8 localities in this region. |
| ⓘ Kyanite Formula: Al2(SiO4)O Localities: Reported from at least 6 localities in this region. |
| ⓘ Langite Formula: Cu4(SO4)(OH)6 · 2H2O Locality: Gruen Prospect, Åsnes, Innlandet, Norway |
| ⓘ Laumontite Formula: CaAl2Si4O12 · 4H2O |
| ⓘ Lazulite Formula: MgAl2(PO4)2(OH)2 |
| ⓘ Leightonite Formula: K2Ca2Cu(SO4)4 · 2H2O |
| ⓘ Lepidocrocite Formula: Fe3+O(OH) Description: As alteration products of pyrite |
| ⓘ 'Limonite' |
| ⓘ Mackinawite Formula: FeS |
| ⓘ Magnesite Formula: MgCO3 Localities: Reported from at least 13 localities in this region. |
| ⓘ Magnesite var. Breunnerite Formula: (Mg,Fe)CO3 |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 Localities: Reported from at least 36 localities in this region. |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 Localities: Reported from at least 9 localities in this region. |
| ⓘ Marcasite Formula: FeS2 |
| ⓘ Melanterite Formula: Fe2+(H2O)6(SO4) · H2O |
| ⓘ Mendozite Formula: NaAl(SO4)2 · 11H2O |
| ⓘ 'Meteoritic Iron' Description: Meteoritic iron present only in scanty amounts. |
| ⓘ 'Mica Group' |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ Microcline var. Amazonite Formula: K(AlSi3O8) |
| ⓘ Molybdenite Formula: MoS2 Localities: Reported from at least 14 localities in this region. |
| ⓘ 'Monazite Group' Formula: REE(PO4) Localities: Reported from at least 8 localities in this region. |
| ⓘ Montmorillonite ? Formula: (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 25 localities in this region. |
| ⓘ Muscovite var. Fuchsite Formula: K(Al,Cr)3Si3O10(OH)2 |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Native Bismuth Formula: Bi |
| ⓘ Native Copper Formula: Cu |
| ⓘ Native Gold Formula: Au |
| ⓘ Native Gold var. Electrum Formula: (Au,Ag) |
| ⓘ Native Iron Formula: Fe |
| ⓘ Native Iron var. Kamacite Formula: (Fe,Ni) |
| ⓘ Orthoclase Formula: K(AlSi3O8) |
| ⓘ 'Orthopyroxene Subgroup' |
| ⓘ Paragonite Formula: NaAl2(AlSi3O10)(OH)2 |
| ⓘ Pargasite Formula: NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| ⓘ Pentlandite (TL) Formula: (NixFey)Σ9S8 Localities: Reported from at least 12 localities in this region. Type Locality: Espedalen mines, Gausdal, Innlandet, Norway Description: Scheerer (1843) describe a new mineral from Lillehammer, Norway, from samples he received from A. Johansen. [The label of the original piecs says Gausdal, presumably the Espedalen mines in Gausdal). He named the mineral Eisennickelkies/Jern-Nikkelkiis. |
| ⓘ Phlogopite Formula: KMg3(AlSi3O10)(OH)2 |
| ⓘ Pickeringite Formula: MgAl2(SO4)4 · 22H2O |
| ⓘ Piemontite Formula: (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 Localities: Reported from at least 20 localities in this region. |
| ⓘ Prehnite Formula: Ca2Al2Si3O10(OH)2 |
| ⓘ 'Psilomelane' References: |
| ⓘ 'Pumpellyite Subgroup' Formula: Ca2XAl2[Si2O6(OH)][SiO4](OH)2A Locality: Veti Glacier, Lom, Innlandet, Norway |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 60 localities in this region. |
| ⓘ Pyrite var. Bravoite Formula: (Fe,Ni)S2 |
| ⓘ 'Pyrochlore Group' Formula: A2Nb2(O,OH)6Z |
| ⓘ Pyrolusite Formula: Mn4+O2 |
| ⓘ Pyrophanite ? Formula: Mn2+TiO3 Locality: Vassbråa, Gran, Innlandet, Norway |
| ⓘ 'Pyroxene Group' Formula: ADSi2O6 |
| ⓘ Pyrrhotite Formula: Fe1-xS Localities: Reported from at least 43 localities in this region. |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 99 localities in this region. Description: Several doubly terminated Quartz crystals have been found at this locality through the years, only for 2-3 weeks when the tide allows it. A pegmatite runs through the beach and is mostly buried under rocks, but some Quartz crystals are seen every now and then, from 0.5cm to 5cm. (To be confirmed). |
| ⓘ Quartz var. Amethyst Formula: SiO2 |
| ⓘ Quartz var. Milky Quartz Formula: SiO2 |
| ⓘ Quartz var. Rock Crystal Formula: SiO2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 |
| ⓘ Rozenite Formula: FeSO4 · 4H2O |
| ⓘ Rutile Formula: TiO2 Localities: Reported from at least 23 localities in this region. |
| ⓘ Rutile var. Sagenite (of Saussure) Formula: TiO2 |
| ⓘ Samarskite-(Y) Formula: YFe3+Nb2O8 |
| ⓘ Saponite Formula: Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| ⓘ 'Scapolite' |
| ⓘ Scheelite Formula: Ca(WO4) |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Schreibersite Formula: (Fe,Ni)3P |
| ⓘ Scolecite Formula: CaAl2Si3O10 · 3H2O |
| ⓘ Sepiolite Formula: Mg4(Si6O15)(OH)2 · 6H2O Locality: Mugnetind, Vang, Innlandet, Norway |
| ⓘ 'Serpentine Subgroup' Formula: D3[Si2O5](OH)4 |
| ⓘ Sillimanite Formula: Al2(SiO4)O |
| ⓘ Slavíkite Formula: (H3O+)3Mg6Fe15(SO4)21(OH)18 · 98H2O |
| ⓘ 'Soapstone' |
| ⓘ Spessartine Formula: Mn2+3Al2(SiO4)3 |
| ⓘ Sphalerite Formula: ZnS Localities: Reported from at least 21 localities in this region. |
| ⓘ Stannite Formula: Cu2FeSnS4 |
| ⓘ Staurolite Formula: Fe2+2Al9Si4O23(OH) Description: Found near the adit as accessory mineral in rock |
| ⓘ Stellerite ? Formula: Ca4(Si28Al8)O72 · 28H2O Locality: Juvvatn, Lom, Innlandet, Norway References: |
| ⓘ 'Stilbite Subgroup' Formula: M6-7[Al8-9Si27-28O72] · nH2O Localities: Reported from at least 14 localities in this region. |
| ⓘ Stilpnomelane Formula: K4Fe2+48[Si64Al8]O164(OH)52 · nH2O |
| ⓘ Svanbergite Formula: SrAl3(PO4)(SO4)(OH)6 Locality: Storsjøen, Nord-Odal, Innlandet, Norway Habit: grain Colour: red Description: Found as a red grain |
| ⓘ Synchysite-(Ce) Formula: CaCe(CO3)2F Locality: Vassbråa, Gran, Innlandet, Norway |
| ⓘ Taenite Formula: (Ni,Fe) Localities: Description: Mostly as small 10-20 µm grains. |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 Localities: Reported from at least 11 localities in this region. |
| ⓘ Tellurobismuthite Formula: Bi2Te3 |
| ⓘ Tenorite Formula: CuO Description: Occure as thin crust on copper. |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S |
| ⓘ Thaumasite Formula: Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| ⓘ Thorite Formula: Th(SiO4) Locality: Byrtnes, Lom, Innlandet, Norway |
| ⓘ Thorite var. Orangite Formula: Th(SiO4) Locality: Byrtnes, Lom, Innlandet, Norway |
| ⓘ Titanite Formula: CaTiO(SiO4) Localities: Reported from at least 17 localities in this region. |
| ⓘ Todorokite Formula: (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O Locality: Fåberg, Lillehammer, Innlandet, Norway References: |
| ⓘ Topaz Formula: Al2(SiO4)(F,OH)2 |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z Localities: Reported from at least 8 localities in this region. |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ Troilite Formula: FeS |
| ⓘ Valleriite Formula: (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| ⓘ Vesuvianite Formula: Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ Violarite Formula: Fe2+Ni3+2S4 Description: Replacing pentlandite. |
| ⓘ Wavellite Formula: Al3(PO4)2(OH)3 · 5H2O Locality: Sormbrua, Elverum, Innlandet, Norway |
| ⓘ Zircon Formula: Zr(SiO4) Localities: Reported from at least 10 localities in this region. |
| ⓘ Zircon var. Alvite Formula: Zr(SiO4) Locality: Store Memurutind, Lom, Innlandet, Norway |
| ⓘ Zoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) Localities: Reported from at least 10 localities in this region. |
| ⓘ Zoisite var. Thulite Formula: (Ca2)(Al,Mn3+)3(Si2O7)(SiO4)O(OH) Localities: Reported from at least 7 localities in this region. |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Native Gold var. Electrum | 1.AA.05 | (Au,Ag) |
| ⓘ | 1.AA.05 | Au | |
| ⓘ | Native Iron | 1.AE.05 | Fe |
| ⓘ | var. Kamacite | 1.AE.05 | (Fe,Ni) |
| ⓘ | Taenite | 1.AE.10 | (Ni,Fe) |
| ⓘ | Schreibersite | 1.BD.05 | (Fe,Ni)3P |
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| ⓘ | Graphite | 1.CB.05a | C |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Hessite | 2.BA.60 | Ag2Te |
| ⓘ | Cobaltpentlandite | 2.BB.15 | Co9S8 |
| ⓘ | Pentlandite (TL) | 2.BB.15 | (NixFey)Σ9S8 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Stannite | 2.CB.15a | Cu2FeSnS4 |
| ⓘ | Cubanite | 2.CB.55a | CuFe2S3 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Troilite | 2.CC.10 | FeS |
| ⓘ | Mackinawite | 2.CC.25 | FeS |
| ⓘ | Altaite | 2.CD.10 | PbTe |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Daubréelite | 2.DA.05 | Fe2+Cr3+2S4 |
| ⓘ | Violarite | 2.DA.05 | Fe2+Ni3+2S4 |
| ⓘ | Tellurobismuthite | 2.DC.05 | Bi2Te3 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite var. Bravoite | 2.EB.05a | (Fe,Ni)S2 |
| ⓘ | 2.EB.05a | FeS2 | |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Gersdorffite | 2.EB.25 | NiAsS |
| ⓘ | Valleriite | 2.FD.30 | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | Enargite | 2.KA.05 | Cu3AsS4 |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| ⓘ | Atacamite | 3.DA.10a | Cu2(OH)3Cl |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | 'Pyrochlore Group' | 4.00. | A2Nb2(O,OH)6Z |
| ⓘ | Cuprite | 4.AA.10 | Cu2O |
| ⓘ | Tenorite | 4.AB.10 | CuO |
| ⓘ | Chromite | 4.BB.05 | Fe2+Cr3+2O4 |
| ⓘ | Gahnite ? | 4.BB.05 | ZnAl2O4 |
| ⓘ | Hercynite | 4.BB.05 | Fe2+Al2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Pyrophanite ? | 4.CB.05 | Mn2+TiO3 |
| ⓘ | Quartz var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Rock Crystal | 4.DA.05 | SiO2 |
| ⓘ | var. Milky Quartz | 4.DA.05 | SiO2 |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | var. Sagenite (of Saussure) | 4.DB.05 | TiO2 |
| ⓘ | Samarskite-(Y) | 4.DB.25 | YFe3+Nb2O8 |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Brookite | 4.DD.10 | TiO2 |
| ⓘ | Euxenite-(Y) | 4.DG.05 | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| ⓘ | Todorokite | 4.DK.10 | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| ⓘ | Goethite | 4.FD.10 | Fe3+O(OH) |
| ⓘ | Lepidocrocite | 4.FE.15 | Fe3+O(OH) |
| ⓘ | Birnessite | 4.FL.45 | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Magnesite | 5.AB.05 | MgCO3 |
| ⓘ | var. Breunnerite | 5.AB.05 | (Mg,Fe)CO3 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Synchysite-(Ce) | 5.BD.20c | CaCe(CO3)2F |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anhydrite | 7.AD.30 | CaSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Rozenite | 7.CB.15 | FeSO4 · 4H2O |
| ⓘ | Chalcanthite | 7.CB.20 | CuSO4 · 5H2O |
| ⓘ | Hexahydrite | 7.CB.25 | Mg(H2O)6(SO4) |
| ⓘ | Melanterite | 7.CB.35 | Fe2+(H2O)6(SO4) · H2O |
| ⓘ | Epsomite | 7.CB.40 | MgSO4 · 7H2O |
| ⓘ | Halotrichite | 7.CB.85 | Fe2+Al2(SO4)4 · 22H2O |
| ⓘ | Pickeringite | 7.CB.85 | MgAl2(SO4)4 · 22H2O |
| ⓘ | Mendozite | 7.CC.15 | NaAl(SO4)2 · 11H2O |
| ⓘ | Leightonite | 7.CC.70 | K2Ca2Cu(SO4)4 · 2H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Amarantite | 7.DB.30 | Fe3+2(SO4)2O · 7H2O |
| ⓘ | Copiapite | 7.DB.35 | Fe2+Fe3+4(SO4)6(OH)2 · 20H2O |
| ⓘ | Fibroferrite | 7.DC.15 | Fe3+(SO4)(OH) · 5H2O |
| ⓘ | Langite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Slavíkite | 7.DF.30 | (H3O+)3Mg6Fe15(SO4)21(OH)18 · 98H2O |
| ⓘ | Thaumasite | 7.DG.15 | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Lazulite | 8.BB.40 | MgAl2(PO4)2(OH)2 |
| ⓘ | Svanbergite | 8.BL.05 | SrAl3(PO4)(SO4)(OH)6 |
| ⓘ | Crandallite | 8.BL.10 | CaAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Fluorapatite var. Carbonate-rich Fluorapatite | 8.BN.05 | Ca5(PO4,CO3)3(F,O) |
| ⓘ | 8.BN.05 | Ca5(PO4)3F | |
| ⓘ | Hydroxylapatite | 8.BN.05 | Ca5(PO4)3(OH) |
| ⓘ | Wavellite | 8.DC.50 | Al3(PO4)2(OH)3 · 5H2O |
| Group 9 - Silicates | |||
| ⓘ | Chrysotile | 9.00. | Mg3(Si2O5)(OH)4 |
| ⓘ | Forsterite | 9.AC.05 | Mg2(SiO4) |
| ⓘ | var. Peridot | 9.AC.05 | Mg2SiO4 |
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Grossular | 9.AD.25 | Ca3Al2(SiO4)3 |
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Zircon var. Alvite | 9.AD.30 | Zr(SiO4) |
| ⓘ | Thorite var. Orangite | 9.AD.30 | Th(SiO4) |
| ⓘ | 9.AD.30 | Th(SiO4) | |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Sillimanite | 9.AF.05 | Al2(SiO4)O |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Kyanite | 9.AF.15 | Al2(SiO4)O |
| ⓘ | Staurolite | 9.AF.30 | Fe2+2Al9Si4O23(OH) |
| ⓘ | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | Dumortierite | 9.AJ.10 | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| ⓘ | Axinite-(Fe) | 9.BD.20 | Ca2Fe2+Al2BSi4O15OH |
| ⓘ | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Piemontite | 9.BG.05a | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| ⓘ | Zoisite var. Thulite | 9.BG.10 | (Ca2)(Al,Mn3+)3(Si2O7)(SiO4)O(OH) |
| ⓘ | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) | |
| ⓘ | Vesuvianite | 9.BG.35 | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Cordierite | 9.CJ.10 | Mg2Al4Si5O18 |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Augite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Aegirine-augite ? | 9.DA.20 | (NaaCabFe2+cMgd)(Fe3+eAlfFe2+gMgh)Si2O6 |
| ⓘ | Anthophyllite | 9.DD.05 | ◻Mg2Mg5(Si8O22)(OH)2 |
| ⓘ | Cummingtonite | 9.DE.05 | ◻Mg2Mg5(Si8O22)(OH)2 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Ferro-hornblende | 9.DE.10 | ◻Ca2(Fe2+4Al)(Si7Al)O22(OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Kaersutite | 9.DE.15 | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| ⓘ | Pargasite | 9.DE.15 | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| ⓘ | Babingtonite | 9.DK.05 | Ca2Fe2+Fe3+Si5O14(OH) |
| ⓘ | Prehnite | 9.DP.20 | Ca2Al2Si3O10(OH)2 |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Muscovite var. Fuchsite | 9.EC.15 | K(Al,Cr)3Si3O10(OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | Paragonite | 9.EC.15 | NaAl2(AlSi3O10)(OH)2 |
| ⓘ | Muscovite var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Montmorillonite ? | 9.EC.40 | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ | Saponite | 9.EC.45 | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | var. Chromium-bearing Clinochlore | 9.EC.55 | Mg5(Al,Cr)2Si3O10(OH)8 |
| ⓘ | Hisingerite | 9.ED.10 | Fe3+2(Si2O5)(OH)4 · 2H2O |
| ⓘ | Antigorite | 9.ED.15 | Mg3(Si2O5)(OH)4 |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Bementite | 9.EE.05 | Mn7Si6O15(OH)8 |
| ⓘ | Sepiolite | 9.EE.25 | Mg4(Si6O15)(OH)2 · 6H2O |
| ⓘ | Stilpnomelane | 9.EG.40 | K4Fe2+48[Si64Al8]O164(OH)52 · nH2O |
| ⓘ | Microcline var. Amazonite | 9.FA.30 | K(AlSi3O8) |
| ⓘ | 9.FA.30 | K(AlSi3O8) | |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Anorthite ? | 9.FA.35 | Ca(Al2Si2O8) |
| ⓘ | var. Labradorite ? | 9.FA.35 | (Ca,Na)[Al(Al,Si)Si2O8] |
| ⓘ | Helvine | 9.FB.10 | Be3Mn2+4(SiO4)3S |
| ⓘ | Scolecite | 9.GA.05 | CaAl2Si3O10 · 3H2O |
| ⓘ | Analcime | 9.GB.05 | Na(AlSi2O6) · H2O |
| ⓘ | Laumontite | 9.GB.10 | CaAl2Si4O12 · 4H2O |
| ⓘ | Goosecreekite | 9.GB.25 | Ca[Al2Si6O16] · 5H2O |
| ⓘ | Harmotome | 9.GC.10 | Ba2(Si12Al4)O32 · 12H2O |
| ⓘ | Heulandite-Ca | 9.GE.05 | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| ⓘ | Heulandite-Sr | 9.GE.05 | (Sr,Na,Ca)5(Si27Al9)O72 · 24H2O |
| ⓘ | Heulandite-Ba | 9.GE.05 | (Ba,Ca,K)5(Si27Al9)O72 · 22H2O |
| ⓘ | Stellerite ? | 9.GE.15 | Ca4(Si28Al8)O72 · 28H2O |
| ⓘ | Brewsterite-Ba | 9.GE.20 | Ba(Al2Si6)O16 · 5H2O |
| ⓘ | Brewsterite-Sr | 9.GE.20 | Sr(Al2Si6)O16 · 5H2O |
| Unclassified | |||
| ⓘ | 'K Feldspar var. Adularia' | - | KAlSi3O8 |
| ⓘ | 'Amphibole Supergroup' | - | AB2C5(T8O22)W2 |
| ⓘ | 'Apophyllite Group' | - | AB4[Si8O20]X · 8H2O |
| ⓘ | 'Bastnäsite' | - | (Ce/Nd/Y/REE)(CO3)F |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Brewsterite Subgroup' | - | |
| ⓘ | 'Chabazite' | - | |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Heulandite Subgroup' | - | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| ⓘ | 'Hypersthene' | - | (Mg,Fe)SiO3 |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Monazite Group' | - | REE(PO4) |
| ⓘ | 'Psilomelane' | - | |
| ⓘ | 'Pumpellyite Subgroup' | - | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| ⓘ | 'Stilbite Subgroup' | - | M6-7[Al8-9Si27-28O72] · nH2O |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Amphibole Supergroup var. Uralite' | - | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ | 'Feldspar Group var. Perthite' | - | |
| ⓘ | 'Mica Group' | - | |
| ⓘ | 'Clinopyroxene Subgroup' | - | |
| ⓘ | 'Fayalite-Forsterite Series' | - | |
| ⓘ | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
| ⓘ | 'Scapolite' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ | 'Feldspar Group var. Cryptoperthite' | - | |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'Soapstone' | - | |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Meteoritic Iron' | - | |
| ⓘ | 'Fergusonite' | - | |
| ⓘ | 'Orthopyroxene Subgroup' | - | |
| ⓘ | 'Serpentine Subgroup' | - | D3[Si2O5](OH)4 |
| ⓘ | 'Glass' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
| ⓘ | 'Coal blend' | - | |
| ⓘ | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Amarantite | Fe23+(SO4)2O · 7H2O |
| H | ⓘ Analcime | Na(AlSi2O6) · H2O |
| H | ⓘ Anthophyllite | ◻Mg2Mg5(Si8O22)(OH)2 |
| H | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| H | ⓘ Apophyllite Group | AB4[Si8O20]X · 8H2O |
| H | ⓘ Atacamite | Cu2(OH)3Cl |
| H | ⓘ Babingtonite | Ca2Fe2+Fe3+Si5O14(OH) |
| H | ⓘ Bementite | Mn7Si6O15(OH)8 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Birnessite | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Chalcanthite | CuSO4 · 5H2O |
| H | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| H | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Cummingtonite | ◻Mg2Mg5(Si8O22)(OH)2 |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Epsomite | MgSO4 · 7H2O |
| H | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| H | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| H | ⓘ Fibroferrite | Fe3+(SO4)(OH) · 5H2O |
| H | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Goosecreekite | Ca[Al2Si6O16] · 5H2O |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Halotrichite | Fe2+Al2(SO4)4 · 22H2O |
| H | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| H | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| H | ⓘ Hexahydrite | Mg(H2O)6(SO4) |
| H | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| H | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| H | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| H | ⓘ Lazulite | MgAl2(PO4)2(OH)2 |
| H | ⓘ Leightonite | K2Ca2Cu(SO4)4 · 2H2O |
| H | ⓘ Lepidocrocite | Fe3+O(OH) |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| H | ⓘ Mendozite | NaAl(SO4)2 · 11H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| H | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| H | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Pickeringite | MgAl2(SO4)4 · 22H2O |
| H | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| H | ⓘ Pumpellyite Subgroup | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| H | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
| H | ⓘ Rozenite | FeSO4 · 4H2O |
| H | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| H | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| H | ⓘ Slavíkite | (H3O+)3Mg6Fe15(SO4)21(OH)18 · 98H2O |
| H | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| H | ⓘ Stellerite | Ca4(Si28Al8)O72 · 28H2O |
| H | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| H | ⓘ Stilpnomelane | K4Fe482+[Si64Al8]O164(OH)52 · nH2O |
| H | ⓘ Svanbergite | SrAl3(PO4)(SO4)(OH)6 |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| H | ⓘ Zoisite var. Thulite | (Ca2)(Al,Mn3+)3(Si2O7)(SiO4)O(OH) |
| H | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| H | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| H | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| H | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| H | ⓘ Wavellite | Al3(PO4)2(OH)3 · 5H2O |
| H | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Brewsterite-Ba | Ba(Al2Si6)O16 · 5H2O |
| H | ⓘ Brewsterite-Sr | Sr(Al2Si6)O16 · 5H2O |
| H | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| H | ⓘ Heulandite-Sr | (Sr,Na,Ca)5(Si27Al9)O72 · 24H2O |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| H | ⓘ Heulandite-Ba | (Ba,Ca,K)5(Si27Al9)O72 · 22H2O |
| H | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| B | Boron | |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| B | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Fluorapatite var. Carbonate-rich Fluorapatite | Ca5(PO4,CO3)3(F,O) |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Graphite | C |
| C | ⓘ Magnesite | MgCO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| C | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| C | ⓘ Magnesite var. Breunnerite | (Mg,Fe)CO3 |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| O | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Zircon var. Alvite | Zr(SiO4) |
| O | ⓘ Amarantite | Fe23+(SO4)2O · 7H2O |
| O | ⓘ Microcline var. Amazonite | K(AlSi3O8) |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Amphibole Supergroup | AB2C5(T8O22)W2 |
| O | ⓘ Analcime | Na(AlSi2O6) · H2O |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Anhydrite | CaSO4 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Anorthite | Ca(Al2Si2O8) |
| O | ⓘ Anthophyllite | ◻Mg2Mg5(Si8O22)(OH)2 |
| O | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| O | ⓘ Apophyllite Group | AB4[Si8O20]X · 8H2O |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Atacamite | Cu2(OH)3Cl |
| O | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Babingtonite | Ca2Fe2+Fe3+Si5O14(OH) |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| O | ⓘ Bementite | Mn7Si6O15(OH)8 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Birnessite | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Brookite | TiO2 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Fluorapatite var. Carbonate-rich Fluorapatite | Ca5(PO4,CO3)3(F,O) |
| O | ⓘ Chalcanthite | CuSO4 · 5H2O |
| O | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| O | ⓘ Chromite | Fe2+Cr23+O4 |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| O | ⓘ Cordierite | Mg2Al4Si5O18 |
| O | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Cummingtonite | ◻Mg2Mg5(Si8O22)(OH)2 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Epsomite | MgSO4 · 7H2O |
| O | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| O | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| O | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| O | ⓘ Fibroferrite | Fe3+(SO4)(OH) · 5H2O |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Forsterite | Mg2(SiO4) |
| O | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| O | ⓘ Gahnite | ZnAl2O4 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Goosecreekite | Ca[Al2Si6O16] · 5H2O |
| O | ⓘ Grossular | Ca3Al2(SiO4)3 |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Halotrichite | Fe2+Al2(SO4)4 · 22H2O |
| O | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| O | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hercynite | Fe2+Al2O4 |
| O | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| O | ⓘ Hexahydrite | Mg(H2O)6(SO4) |
| O | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| O | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| O | ⓘ Hypersthene | (Mg,Fe)SiO3 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| O | ⓘ Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| O | ⓘ Kyanite | Al2(SiO4)O |
| O | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| O | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| O | ⓘ Lazulite | MgAl2(PO4)2(OH)2 |
| O | ⓘ Leightonite | K2Ca2Cu(SO4)4 · 2H2O |
| O | ⓘ Lepidocrocite | Fe3+O(OH) |
| O | ⓘ Magnesite | MgCO3 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| O | ⓘ Mendozite | NaAl(SO4)2 · 11H2O |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Monazite Group | REE(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| O | ⓘ Thorite var. Orangite | Th(SiO4) |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| O | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Pickeringite | MgAl2(SO4)4 · 22H2O |
| O | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| O | ⓘ Pumpellyite Subgroup | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| O | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Pyrophanite | Mn2+TiO3 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rozenite | FeSO4 · 4H2O |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
| O | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| O | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| O | ⓘ Sillimanite | Al2(SiO4)O |
| O | ⓘ Slavíkite | (H3O+)3Mg6Fe15(SO4)21(OH)18 · 98H2O |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| O | ⓘ Stellerite | Ca4(Si28Al8)O72 · 28H2O |
| O | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| O | ⓘ Stilpnomelane | K4Fe482+[Si64Al8]O164(OH)52 · nH2O |
| O | ⓘ Svanbergite | SrAl3(PO4)(SO4)(OH)6 |
| O | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Tenorite | CuO |
| O | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| O | ⓘ Thorite | Th(SiO4) |
| O | ⓘ Zoisite var. Thulite | (Ca2)(Al,Mn3+)3(Si2O7)(SiO4)O(OH) |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| O | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| O | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| O | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| O | ⓘ Wavellite | Al3(PO4)2(OH)3 · 5H2O |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Quartz var. Rock Crystal | SiO2 |
| O | ⓘ Quartz var. Milky Quartz | SiO2 |
| O | ⓘ Brewsterite-Ba | Ba(Al2Si6)O16 · 5H2O |
| O | ⓘ Brewsterite-Sr | Sr(Al2Si6)O16 · 5H2O |
| O | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| O | ⓘ Heulandite-Sr | (Sr,Na,Ca)5(Si27Al9)O72 · 24H2O |
| O | ⓘ Forsterite var. Peridot | Mg2SiO4 |
| O | ⓘ Magnesite var. Breunnerite | (Mg,Fe)CO3 |
| O | ⓘ Fayalite-Forsterite Series | |
| O | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Pyroxene Group | ADSi2O6 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| O | ⓘ Heulandite-Ba | (Ba,Ca,K)5(Si27Al9)O72 · 22H2O |
| O | ⓘ Apatite | Ca5(PO4)3A |
| O | ⓘ Rutile var. Sagenite (of Saussure) | TiO2 |
| O | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| F | Fluorine | |
| F | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite var. Carbonate-rich Fluorapatite | Ca5(PO4,CO3)3(F,O) |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| F | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| F | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Na | Sodium | |
| Na | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Na | ⓘ Birnessite | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Na | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Na | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Na | ⓘ Mendozite | NaAl(SO4)2 · 11H2O |
| Na | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Na | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| Na | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Na | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Na | ⓘ Heulandite-Sr | (Sr,Na,Ca)5(Si27Al9)O72 · 24H2O |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Anthophyllite | ◻Mg2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Cordierite | Mg2Al4Si5O18 |
| Mg | ⓘ Cummingtonite | ◻Mg2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Epsomite | MgSO4 · 7H2O |
| Mg | ⓘ Forsterite | Mg2(SiO4) |
| Mg | ⓘ Hexahydrite | Mg(H2O)6(SO4) |
| Mg | ⓘ Hypersthene | (Mg,Fe)SiO3 |
| Mg | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Mg | ⓘ Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| Mg | ⓘ Lazulite | MgAl2(PO4)2(OH)2 |
| Mg | ⓘ Magnesite | MgCO3 |
| Mg | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Mg | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Pickeringite | MgAl2(SO4)4 · 22H2O |
| Mg | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| Mg | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| Mg | ⓘ Slavíkite | (H3O+)3Mg6Fe15(SO4)21(OH)18 · 98H2O |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| Mg | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Mg | ⓘ Forsterite var. Peridot | Mg2SiO4 |
| Mg | ⓘ Magnesite var. Breunnerite | (Mg,Fe)CO3 |
| Mg | ⓘ Fayalite-Forsterite Series | |
| Al | Aluminium | |
| Al | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Al | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Microcline var. Amazonite | K(AlSi3O8) |
| Al | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Anorthite | Ca(Al2Si2O8) |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Cordierite | Mg2Al4Si5O18 |
| Al | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Al | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Al | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Al | ⓘ Gahnite | ZnAl2O4 |
| Al | ⓘ Goosecreekite | Ca[Al2Si6O16] · 5H2O |
| Al | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Al | ⓘ Halotrichite | Fe2+Al2(SO4)4 · 22H2O |
| Al | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| Al | ⓘ Hercynite | Fe2+Al2O4 |
| Al | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Al | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Al | ⓘ Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| Al | ⓘ Kyanite | Al2(SiO4)O |
| Al | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Al | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Al | ⓘ Lazulite | MgAl2(PO4)2(OH)2 |
| Al | ⓘ Mendozite | NaAl(SO4)2 · 11H2O |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Pickeringite | MgAl2(SO4)4 · 22H2O |
| Al | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Al | ⓘ Pumpellyite Subgroup | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| Al | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| Al | ⓘ Sillimanite | Al2(SiO4)O |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Al | ⓘ Stellerite | Ca4(Si28Al8)O72 · 28H2O |
| Al | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Al | ⓘ Stilpnomelane | K4Fe482+[Si64Al8]O164(OH)52 · nH2O |
| Al | ⓘ Svanbergite | SrAl3(PO4)(SO4)(OH)6 |
| Al | ⓘ Zoisite var. Thulite | (Ca2)(Al,Mn3+)3(Si2O7)(SiO4)O(OH) |
| Al | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Al | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Al | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Al | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| Al | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | ⓘ Wavellite | Al3(PO4)2(OH)3 · 5H2O |
| Al | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Brewsterite-Ba | Ba(Al2Si6)O16 · 5H2O |
| Al | ⓘ Brewsterite-Sr | Sr(Al2Si6)O16 · 5H2O |
| Al | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Al | ⓘ Heulandite-Sr | (Sr,Na,Ca)5(Si27Al9)O72 · 24H2O |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Al | ⓘ Heulandite-Ba | (Ba,Ca,K)5(Si27Al9)O72 · 22H2O |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Si | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Zircon var. Alvite | Zr(SiO4) |
| Si | ⓘ Microcline var. Amazonite | K(AlSi3O8) |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Anorthite | Ca(Al2Si2O8) |
| Si | ⓘ Anthophyllite | ◻Mg2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Apophyllite Group | AB4[Si8O20]X · 8H2O |
| Si | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Babingtonite | Ca2Fe2+Fe3+Si5O14(OH) |
| Si | ⓘ Bementite | Mn7Si6O15(OH)8 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Cordierite | Mg2Al4Si5O18 |
| Si | ⓘ Cummingtonite | ◻Mg2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Si | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Si | ⓘ Forsterite | Mg2(SiO4) |
| Si | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Si | ⓘ Goosecreekite | Ca[Al2Si6O16] · 5H2O |
| Si | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Si | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| Si | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| Si | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Si | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| Si | ⓘ Hypersthene | (Mg,Fe)SiO3 |
| Si | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Si | ⓘ Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| Si | ⓘ Kyanite | Al2(SiO4)O |
| Si | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Si | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Si | ⓘ Thorite var. Orangite | Th(SiO4) |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Si | ⓘ Pumpellyite Subgroup | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| Si | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| Si | ⓘ Sillimanite | Al2(SiO4)O |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Si | ⓘ Stellerite | Ca4(Si28Al8)O72 · 28H2O |
| Si | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Si | ⓘ Stilpnomelane | K4Fe482+[Si64Al8]O164(OH)52 · nH2O |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| Si | ⓘ Thorite | Th(SiO4) |
| Si | ⓘ Zoisite var. Thulite | (Ca2)(Al,Mn3+)3(Si2O7)(SiO4)O(OH) |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| Si | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Quartz var. Rock Crystal | SiO2 |
| Si | ⓘ Quartz var. Milky Quartz | SiO2 |
| Si | ⓘ Brewsterite-Ba | Ba(Al2Si6)O16 · 5H2O |
| Si | ⓘ Brewsterite-Sr | Sr(Al2Si6)O16 · 5H2O |
| Si | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Si | ⓘ Heulandite-Sr | (Sr,Na,Ca)5(Si27Al9)O72 · 24H2O |
| Si | ⓘ Forsterite var. Peridot | Mg2SiO4 |
| Si | ⓘ Fayalite-Forsterite Series | |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Pyroxene Group | ADSi2O6 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| Si | ⓘ Heulandite-Ba | (Ba,Ca,K)5(Si27Al9)O72 · 22H2O |
| Si | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| P | Phosphorus | |
| P | ⓘ Fluorapatite var. Carbonate-rich Fluorapatite | Ca5(PO4,CO3)3(F,O) |
| P | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| P | ⓘ Lazulite | MgAl2(PO4)2(OH)2 |
| P | ⓘ Monazite Group | REE(PO4) |
| P | ⓘ Schreibersite | (Fe,Ni)3P |
| P | ⓘ Svanbergite | SrAl3(PO4)(SO4)(OH)6 |
| P | ⓘ Wavellite | Al3(PO4)2(OH)3 · 5H2O |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Amarantite | Fe23+(SO4)2O · 7H2O |
| S | ⓘ Anhydrite | CaSO4 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Pyrite var. Bravoite | (Fe,Ni)S2 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcanthite | CuSO4 · 5H2O |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Cobaltpentlandite | Co9S8 |
| S | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| S | ⓘ Covellite | CuS |
| S | ⓘ Cubanite | CuFe2S3 |
| S | ⓘ Daubréelite | Fe2+Cr23+S4 |
| S | ⓘ Enargite | Cu3AsS4 |
| S | ⓘ Epsomite | MgSO4 · 7H2O |
| S | ⓘ Fibroferrite | Fe3+(SO4)(OH) · 5H2O |
| S | ⓘ Galena | PbS |
| S | ⓘ Gersdorffite | NiAsS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Halotrichite | Fe2+Al2(SO4)4 · 22H2O |
| S | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| S | ⓘ Hexahydrite | Mg(H2O)6(SO4) |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Leightonite | K2Ca2Cu(SO4)4 · 2H2O |
| S | ⓘ Mackinawite | FeS |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| S | ⓘ Mendozite | NaAl(SO4)2 · 11H2O |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pentlandite | (NixFey)Σ9S8 |
| S | ⓘ Pickeringite | MgAl2(SO4)4 · 22H2O |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Rozenite | FeSO4 · 4H2O |
| S | ⓘ Slavíkite | (H3O+)3Mg6Fe15(SO4)21(OH)18 · 98H2O |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stannite | Cu2FeSnS4 |
| S | ⓘ Svanbergite | SrAl3(PO4)(SO4)(OH)6 |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| S | ⓘ Troilite | FeS |
| S | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| S | ⓘ Violarite | Fe2+Ni23+S4 |
| Cl | Chlorine | |
| Cl | ⓘ Atacamite | Cu2(OH)3Cl |
| Cl | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| K | Potassium | |
| K | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| K | ⓘ Microcline var. Amazonite | K(AlSi3O8) |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| K | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| K | ⓘ Leightonite | K2Ca2Cu(SO4)4 · 2H2O |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| K | ⓘ Stilpnomelane | K4Fe482+[Si64Al8]O164(OH)52 · nH2O |
| K | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Heulandite-Ba | (Ba,Ca,K)5(Si27Al9)O72 · 22H2O |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Ca | ⓘ Anhydrite | CaSO4 |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Anorthite | Ca(Al2Si2O8) |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Babingtonite | Ca2Fe2+Fe3+Si5O14(OH) |
| Ca | ⓘ Birnessite | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Fluorapatite var. Carbonate-rich Fluorapatite | Ca5(PO4,CO3)3(F,O) |
| Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ca | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Ca | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Goosecreekite | Ca[Al2Si6O16] · 5H2O |
| Ca | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Ca | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| Ca | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Ca | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Ca | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Ca | ⓘ Leightonite | K2Ca2Cu(SO4)4 · 2H2O |
| Ca | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Ca | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Ca | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Ca | ⓘ Pumpellyite Subgroup | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| Ca | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| Ca | ⓘ Stellerite | Ca4(Si28Al8)O72 · 28H2O |
| Ca | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| Ca | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| Ca | ⓘ Zoisite var. Thulite | (Ca2)(Al,Mn3+)3(Si2O7)(SiO4)O(OH) |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ca | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Ca | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Ca | ⓘ Heulandite-Sr | (Sr,Na,Ca)5(Si27Al9)O72 · 24H2O |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Heulandite-Ba | (Ba,Ca,K)5(Si27Al9)O72 · 22H2O |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ti | Titanium | |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Brookite | TiO2 |
| Ti | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Ti | ⓘ Pyrophanite | Mn2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| Ti | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Ti | ⓘ Rutile var. Sagenite (of Saussure) | TiO2 |
| Cr | Chromium | |
| Cr | ⓘ Chromite | Fe2+Cr23+O4 |
| Cr | ⓘ Daubréelite | Fe2+Cr23+S4 |
| Cr | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Cr | ⓘ Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| Mn | Manganese | |
| Mn | ⓘ Bementite | Mn7Si6O15(OH)8 |
| Mn | ⓘ Birnessite | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| Mn | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| Mn | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Pyrophanite | Mn2+TiO3 |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Mn | ⓘ Zoisite var. Thulite | (Ca2)(Al,Mn3+)3(Si2O7)(SiO4)O(OH) |
| Mn | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Mn | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Fe | ⓘ Amarantite | Fe23+(SO4)2O · 7H2O |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Babingtonite | Ca2Fe2+Fe3+Si5O14(OH) |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Pyrite var. Bravoite | (Fe,Ni)S2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chromite | Fe2+Cr23+O4 |
| Fe | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| Fe | ⓘ Cubanite | CuFe2S3 |
| Fe | ⓘ Daubréelite | Fe2+Cr23+S4 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Fe | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Fe | ⓘ Fibroferrite | Fe3+(SO4)(OH) · 5H2O |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Halotrichite | Fe2+Al2(SO4)4 · 22H2O |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Hercynite | Fe2+Al2O4 |
| Fe | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| Fe | ⓘ Hypersthene | (Mg,Fe)SiO3 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Native Iron | Fe |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Native Iron var. Kamacite | (Fe,Ni) |
| Fe | ⓘ Lepidocrocite | Fe3+O(OH) |
| Fe | ⓘ Mackinawite | FeS |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| Fe | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Rozenite | FeSO4 · 4H2O |
| Fe | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
| Fe | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Schreibersite | (Fe,Ni)3P |
| Fe | ⓘ Slavíkite | (H3O+)3Mg6Fe15(SO4)21(OH)18 · 98H2O |
| Fe | ⓘ Stannite | Cu2FeSnS4 |
| Fe | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Fe | ⓘ Stilpnomelane | K4Fe482+[Si64Al8]O164(OH)52 · nH2O |
| Fe | ⓘ Taenite | (Ni,Fe) |
| Fe | ⓘ Troilite | FeS |
| Fe | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| Fe | ⓘ Violarite | Fe2+Ni23+S4 |
| Fe | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Fe | ⓘ Magnesite var. Breunnerite | (Mg,Fe)CO3 |
| Fe | ⓘ Fayalite-Forsterite Series | |
| Fe | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Co | Cobalt | |
| Co | ⓘ Cobaltpentlandite | Co9S8 |
| Ni | Nickel | |
| Ni | ⓘ Pyrite var. Bravoite | (Fe,Ni)S2 |
| Ni | ⓘ Gersdorffite | NiAsS |
| Ni | ⓘ Native Iron var. Kamacite | (Fe,Ni) |
| Ni | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Ni | ⓘ Schreibersite | (Fe,Ni)3P |
| Ni | ⓘ Taenite | (Ni,Fe) |
| Ni | ⓘ Violarite | Fe2+Ni23+S4 |
| Cu | Copper | |
| Cu | ⓘ Atacamite | Cu2(OH)3Cl |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcanthite | CuSO4 · 5H2O |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cubanite | CuFe2S3 |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Enargite | Cu3AsS4 |
| Cu | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Leightonite | K2Ca2Cu(SO4)4 · 2H2O |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Stannite | Cu2FeSnS4 |
| Cu | ⓘ Tenorite | CuO |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| Zn | Zinc | |
| Zn | ⓘ Gahnite | ZnAl2O4 |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Enargite | Cu3AsS4 |
| As | ⓘ Gersdorffite | NiAsS |
| Sr | Strontium | |
| Sr | ⓘ Svanbergite | SrAl3(PO4)(SO4)(OH)6 |
| Sr | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Sr | ⓘ Brewsterite-Sr | Sr(Al2Si6)O16 · 5H2O |
| Sr | ⓘ Heulandite-Sr | (Sr,Na,Ca)5(Si27Al9)O72 · 24H2O |
| Y | Yttrium | |
| Y | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| Y | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Y | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
| Zr | Zirconium | |
| Zr | ⓘ Zircon var. Alvite | Zr(SiO4) |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Nb | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
| Nb | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
| Nb | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Ag | Silver | |
| Ag | ⓘ Native Gold var. Electrum | (Au,Ag) |
| Ag | ⓘ Hessite | Ag2Te |
| Sn | Tin | |
| Sn | ⓘ Stannite | Cu2FeSnS4 |
| Sb | Antimony | |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Te | Tellurium | |
| Te | ⓘ Altaite | PbTe |
| Te | ⓘ Hessite | Ag2Te |
| Te | ⓘ Tellurobismuthite | Bi2Te3 |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| Ba | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Ba | ⓘ Brewsterite-Ba | Ba(Al2Si6)O16 · 5H2O |
| Ba | ⓘ Heulandite-Ba | (Ba,Ca,K)5(Si27Al9)O72 · 22H2O |
| Ce | Cerium | |
| Ce | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| Ce | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ce | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| Nd | Neodymium | |
| Nd | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| Ta | Tantalum | |
| Ta | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
| Au | Gold | |
| Au | ⓘ Native Gold var. Electrum | (Au,Ag) |
| Au | ⓘ Native Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Altaite | PbTe |
| Pb | ⓘ Galena | PbS |
| Bi | Bismuth | |
| Bi | ⓘ Native Bismuth | Bi |
| Bi | ⓘ Tellurobismuthite | Bi2Te3 |
| Th | Thorium | |
| Th | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Th | ⓘ Thorite var. Orangite | Th(SiO4) |
| Th | ⓘ Thorite | Th(SiO4) |
| U | Uranium | |
| U | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
Geochronology
Mineralization age: Paleoproterozoic : 1673 ± 8 MaImportant note: This table is based only on rock and mineral ages recorded on mindat.org for this locality and is not necessarily a complete representation of the geochronology, but does give an indication of possible mineralization events relevant to this locality. As more age information is added this table may expand in the future. A break in the table simply indicates a lack of data entered here, not necessarily a break in the geologic sequence. Grey background entries are from different, related, localities.
| Geologic Time | Rocks, Minerals and Events | ||||||
|---|---|---|---|---|---|---|---|
| Precambrian | |||||||
| Proterozoic | |||||||
| Paleoproterozoic | |||||||
| Statherian |
| ||||||
Fossils
There are 538 fossil localities from the PaleoBioDB database within this region.These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 538 |
|---|---|
| Youngest Fossil Listed | 443 Ma (Silurian) |
| Oldest Fossil Listed | 1,000 Ma (Neoproterozoic) |
| Stratigraphic Units | Click here to view 45 stratigraphic units. |
| Fossils from Region | Click here to show the list. |
| Fossil Localities | Click to show 115 fossil localities |
- Innlandet
- Alvdal
- Dovre
- Eidskog
- Elverum
- Engerdal
- Gausdal
- Gjøvik
- Gran
- Late/Upper Ordovician🐚 213. Above Øyskogtern Lake
- Late/Upper Ordovician🐚 221. Above Øyskogtern Lake
- Late/Upper Ordovician🐚 223. Above Øyskogtern Lake
- Late/Upper Ordovician🐚 265. southwest of Skirstadtjernet
- Late/Upper Ordovician🐚 268. southwest of Skirstadtjernet
- Late/Upper Ordovician🐚 270S southwest of Skirstadtjernet
- Late/Upper Ordovician🐚 282. southwest of Skirstadtjernet
- Late/Upper Ordovician🐚 283S. southwest of Skirstadtjernet
- Late/Upper Ordovician🐚 285. southwest of Skirstadtjernet
- Late/Upper Ordovician🐚 286. southwest of Skirstadtjernet
- Paleozoic🐚 300 m south of Gran railway station
- Late/Upper Ordovician🐚 315. East of Øyskogtern Lake
- Late/Upper Ordovician🐚 317. East of Øyskogtern Lake
- Late/Upper Ordovician🐚 635. West of Øyskogtern Lake
- Late/Upper Ordovician🐚 between Gamme and Gammeøvre
- Late/Upper Ordovician🐚 Espen
- Late/Upper Ordovician🐚 Gagnum
- Late/Upper Ordovician🐚 Gagnum Farm
- Late/Upper Ordovician🐚 Granset
- Late/Upper Ordovician🐚 Grymyr
- Late/Upper Ordovician🐚 Grånasen
- Middle Ordovician🐚 Gullerud
- Middle Ordovician🐚 Hovstangen
- Paleozoic🐚 Kalvsjo Formation
- Ordovician🐚 Kløvstad in Gran
- Ordovician🐚 Mjør
- Middle Ordovician🐚 Road section at Hvattum
- Late/Upper Ordovician🐚 Rokotjernet
- Ordovician🐚 Røykenvik
- Middle Ordovician🐚 South of Skiaker
- Paleozoic🐚 Stadum
- Ordovician🐚 Sølvsberget
- Ordovician🐚 Tønnerud
- Late/Upper Ordovician🐚 Vien
- Late/Upper Ordovician🐚 Vien Søndre
- Late/Upper Ordovician🐚 W28
- Late/Upper Ordovician🐚 W35
- Late/Upper Ordovician🐚 W517
- Late/Upper Ordovician🐚 W548
- Late/Upper Ordovician🐚 W551
- Late/Upper Ordovician🐚 W554
- Late/Upper Ordovician🐚 W87
- Late/Upper Ordovician🐚 W92N
- Late/Upper Ordovician🐚 W94
- Late/Upper Ordovician🐚 W95
- Innlandet
- Hamar
- Kongsvinger
- Løten
- Nordre Land
- Østre Toten
- Ringsaker
- Ordovician🐚 Bergevika
- Ordovician🐚 between Tørud and Bratberg
- Ordovician🐚 Brummundal
- Ordovician🐚 Creek below Holmen and Vollenga
- Cambrian🐚 Evjevika
- Ordovician🐚 Fangberget
- Middle Ordovician🐚 Furnes Church
- Ordovician🐚 Heramb
- Cambrian🐚 Holmia fauna
- Middle Ordovician🐚 Håve in Håvesveen
- Cambrian🐚 Krogsrud
- Cambrian🐚 Mælum
- Ordovician🐚 near Bratberg
- Middle Ordovician🐚 Nydal- Furnes Church
- Cambrian🐚 Ringstrand
- Ordovician🐚 river bank at eastem side of Brumundelva
- Cambrian🐚 Skyberg Farm
- Paleozoic🐚 Steinsodden
- Middle Ordovician🐚 Sterudstranda
- Cambrian🐚 Tømten
- Helgøya
- Sel
- Søndre Land
- Stange
- Vang
- Vestre Toten
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Innlandet |
|---|---|
| Wikidata ID: | Q56404886 |
| GeoNames ID: | 12110598 |
Localities in this Region
- Innlandet
- ⭔Alvdal
- ⭔Åmot
- ⭔Åsnes
- ⭔Dovre
- ⭔Eidskog
- ⭔Elverum
- ⭔Engerdal
- ⭔Etnedal
- ⭔Folldal
- ⭔Gausdal
- ⭔Gjøvik
- ⭔Gran
- ⭔Grue
- ⭔Hamar
- ⭔Kongsvinger
- ⭔Lesja
- ⭔Lillehammer
- ⭔Lom
- Austre Memuru Glacier
- Bøverdalen
- Byrberge
- Byrbergje
- Byrtnes
- East of Mt. Galdhøpiggen
- Glitra Olivine Deposit
- Glittertind massif
- Grotågjelet
- Heimre Håbreen
- Heimre Ilå Glacier
- Hellstugu Glacier
- Hurr Glacier
- Hurra River Valley
- Jutingsholet
- Juvasshytta
- Juvvatn
- Krokåfaret
- Kvitingsfaret
- Leirdalen
- Leirdalen - Visdalen
- Loftet
- Otta River
- Raudvatn
- Roadcut Lom
- Solhell
- Søre Illåbreen
- Steinbudalen
- Store Memurutind
- ⭔Tesse
- Trono-odden
- Veo-Smådalen Pressure Tunnel
- Veti Glacier
- Viki
- Visdalen
- ⭔Løten
- ⭔Nord-Aurdal
- ⭔Nord-Fron
- ⭔Nord-Odal
- Innlandet
- ⭔Nordre Land
- ⭔Os
- ⭔Østre Toten
- ⭔Øyer
- ⭔Øystre Slidre
- ⭔Rendalen
- ⭔Ringebu
- ⭔Ringsaker
- ⭔Sel
- ⭔Skjåk
- ⭔Søndre Land
- ⭔Sør-Aurdal
- ⭔Sør-Fron
- ⭔Sør-Odal
- ⭔Stange
- ⭔Stor-Elvdal
- ⭔Tolga
- ⭔Trysil
- ⭔Tynset
- Børsjøhø Mines
- Dølvad
- Dølvadseter
- Fådals Mines
- Fåsten
- Fåstenen prospect
- Hamndals Mines
- Kvikne
- Kvikne Mines
- Banken Mine
- Dals Mine
- Estenvangen 1 Mine
- Estenvangen 2 Mine
- Gabe Gottes Mine
- Gjøkåsen Prospect
- Grubeåsen Mine
- Kojan Prospects
- Midtre Berstjern Prospect
- Mine 1707
- Nedre Vang Mine
- Nordre Berstjern Prospect
- Odden 1 Mine
- Odden 2 Mine
- Odden Prospect
- Øvre Vang Mine
- Segen Gottes Mine
- Søndre Berstjern Prospect
- Storbekken Prospect
- Vangsberget Mine
- RKV Project
- Røstvangen Mines
- Sandbekkdalen Soapstone Quarry
- Vakkerlien Nickel Prospect
- ⭔Vågå
- ⭔Våler
- ⭔Vang
- ⭔Vestre Slidre
- ⭔Vestre Toten
Other Regions, Features and Areas that Intersect
Eurasian PlateTectonic Plate
- Baltic Shield
- Sveconorwegian BeltShield
- CaledonidesOrogenic Belt
- Transscandinavian Igneous BeltMagmatic Province
EuropeContinent
Norway
- DovrefjellMountain Range
- JotunheimenNational Park
- Oslo Volcanic ProvinceVolcanic Province
- Western Gneiss RegionGeologic Region
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Quick NavTopCommoditiesMineral ListRock TypesGeochronologyFossilsOther DatabasesLocalities in RegionOther Regions
Nygard Quarry, Hunndalen, Gjøvik, Innlandet, Norway