Log In
Mansfeld-Südharz, Saxony-Anhalt, Germanyi
| Regional Level Types | |
|---|---|
| Mansfeld-Südharz | District |
| Saxony-Anhalt | State |
| Germany | Country |
This page kindly sponsored by Dr. Günter Grundmann
Get Involved with mindat.org
Mindat.org has grown through countless contributions from mineral enthusiasts, collectors, researchers and experts around the world — people just like you.
Want to take part?
1
2
3
4
Contribute
Add photos, locality information and knowledge
Every contribution helps make mindat.org better for everyone.
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Eisleben Lutherstadt | 24,346 (2016) |
| Sangerhausen | 23,347 (2015) |
| Hettstedt | 15,949 (2015) |
| Helbra | 4,723 (2011) |
| Mansfeld | 3,501 (2014) |
| Allstedt | 3,153 (2015) |
Other Languages:
German:
Landkreis Mansfeld-Südharz, Sachsen-Anhalt, Deutschland
The district was established by merging the former districts of Sangerhausen and Mansfelder Land as part of the reform of 2007.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities246 valid minerals. 11 (TL) - type locality of valid minerals. 1 erroneous literature entry.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Acanthite Formula: Ag2S |
| ⓘ Aegirine-augite Formula: (NaaCabFe2+cMgd)(Fe3+eAlfFe2+gMgh)Si2O6 |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 |
| ⓘ 'α-Brass' Formula: Cu3Zn References: Alfonso Frías Forcada Collection; specimen acquired from Sönke Stolze.Identified by Alfonso Frías Forcada: Dealer/Collection Label |
| ⓘ 'Andorite' Formula: AgPbSb3S6 |
| ⓘ Andradite Formula: Ca3Fe3+2(SiO4)3 References: Gerhard Möhn Collection Analyzed by Joy Desor, Gerhard Möhn.Identification: SEM-EDS |
| ⓘ Anglesite Formula: PbSO4 Localities: Reported from at least 13 localities in this region. |
| ⓘ Anhydrite Formula: CaSO4 Localities: Reported from at least 7 localities in this region. |
| ⓘ Anilite Formula: Cu7S4 |
| ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 |
| ⓘ Annabergite Formula: Ni3(AsO4)2 · 8H2O |
| ⓘ 'Antimony Ochre' |
| ⓘ Antlerite Formula: Cu3(SO4)(OH)4 |
| ⓘ Aragonite Formula: CaCO3 Localities: Reported from at least 10 localities in this region. |
| ⓘ Åkermanite Formula: Ca2Mg[Si2O7] References: Gerhard Möhn Collection Analyzed by Joy Desor, Gerhard Möhn.Identification: SEM-EDS |
| ⓘ Arsenolite Formula: As2O3 Localities: Description: small octahedra |
| ⓘ Arsenopyrite Formula: FeAsS Localities: Reported from at least 6 localities in this region. |
| ⓘ Asagiite Formula: NiCu4(SO4)2(OH)6 · 6H2O |
| ⓘ Atacamite Formula: Cu2(OH)3Cl |
| ⓘ Athabascaite Formula: Cu5Se4 |
| ⓘ Augite Formula: (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ Aurichalcite Formula: (Zn,Cu)5(CO3)2(OH)6 References: Gerhard Möhn Collection Analyzed by Gerhard Möhn.Identified by Gerhard Möhn: Wet Chemical, SEM-EDS |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 |
| ⓘ Baryte Formula: BaSO4 Localities: Reported from at least 12 localities in this region. |
| ⓘ Beaverite-(Cu) Formula: Pb(Fe3+2Cu)(SO4)2(OH)6 References: Gerhard Möhn collectionIdentified by Gerhard Möhn: SEM-EDS |
| ⓘ Bechererite Formula: Zn7Cu(OH)13[(SiO(OH)3(SO4)] References: Gerhard Möhn Collection Analyzed by Joy Desor, Gerhard Möhn.Identification: XRD |
| ⓘ 'Belosharite' Formula: Mg4(OH)6(SO4) · 7H2O References: Gerhard Möhn collectionIdentified by Gerhard Möhn: XRD, SEM-EDS |
| ⓘ Berzelianite Formula: Cu2-xSe (x ≈ 0.12) |
| ⓘ Betekhtinite (TL) Formula: Pb2(Cu,Fe)22-24S15 Localities: |
| ⓘ Beudantite Formula: PbFe3+3(AsO4)(SO4)(OH)6 Localities: |
| ⓘ Bindheimite Formula: Pb2Sb2O6O |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Bobierrite Formula: Mg3(PO4)2 · 8H2O Description: As white pseudomorphs after cattiite. References: Gerhard Möhn Collection Analyzed by Joy Desor, Gerhard Möhn.Identification: XRD, SEM-EDS |
| ⓘ Boleite Formula: KPb26Ag9Cu24(OH)48Cl62 Description: added with Knoll (2004) as reference, but this reference does not mention boleite. |
| ⓘ Bornhardtite Formula: Co2+Co3+2Se4 |
| ⓘ Bornite Formula: Cu5FeS4 Localities: Reported from at least 9 localities in this region. |
| ⓘ Botallackite Formula: Cu2(OH)3Cl |
| ⓘ Boulangerite Formula: Pb5Sb4S11 Localities: Reported from at least 6 localities in this region. |
| ⓘ Bournonite Formula: PbCuSbS3 Localities: Reported from at least 6 localities in this region. |
| ⓘ Branchite Formula: C20H34 |
| ⓘ Braunite Formula: Mn2+Mn3+6(SiO4)O8 |
| ⓘ Brianyoungite Formula: Zn3(CO3,SO4)(OH)4 |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 Localities: Reported from at least 7 localities in this region. |
| ⓘ Bunsenite Formula: NiO |
| ⓘ Calcite Formula: CaCO3 Localities: Reported from at least 20 localities in this region. |
| ⓘ Calcite var. Barleycorn Formula: CaCO3 |
| ⓘ Calcite var. Glendonite Formula: CaCO3 |
| ⓘ Caledonite Formula: Pb5Cu2(SO4)3(CO3)(OH)6 |
| ⓘ Callaghanite Formula: Cu2Mg2(CO3)(OH)6 · 2H2O |
| ⓘ Carpholite Formula: Mn2+Al2(Si2O6)(OH)4 |
| ⓘ Cassiterite Formula: SnO2 References: Gerhard Möhn Collection Analyzed by Joy Desor, Gerhard Möhn.Identification: SEM-EDS |
| ⓘ 'Castaingite' Formula: CuMo2S5 |
| ⓘ Cattiite Formula: Mg3(PO4)2 · 22H2O References: Gerhard Möhn Collection Analyzed by Joy Desor, Gerhard Möhn.Identification: XRD, SEM-EDS |
| ⓘ Celestine Formula: SrSO4 |
| ⓘ Cerussite Formula: PbCO3 Localities: Reported from at least 10 localities in this region. |
| ⓘ Cervantite Formula: Sb3+Sb5+O4 |
| ⓘ Chalcocite Formula: Cu2S Localities: Reported from at least 8 localities in this region. |
| ⓘ Chalconatronite Formula: Na2Cu(CO3)2 · 3H2O |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 18 localities in this region. |
| ⓘ Chalcostibite (TL) Formula: CuSbS2 Type Locality: |
| ⓘ Chlorapatite Formula: Ca5(PO4)3Cl References: Gerhard Möhn Collection Analyzed by Joy Desor, Gerhard Möhn.Identification: SEM-EDS |
| ⓘ Chlorargyrite Formula: AgCl References: Gerhard Möhn Collection Analyzed by Joy Desor, Gerhard MöhnIdentification: SEM-EDS |
| ⓘ 'Chlorite Group' |
| ⓘ Chloroxiphite Formula: Pb3CuO2Cl2(OH)2 |
| ⓘ Chrisstanleyite Formula: Ag2Pd3Se4 Locality: Eskaborn adit, Tilkerode Mining District, Mansfeld, Mansfeld-Südharz, Saxony-Anhalt, Germany References: |
| ⓘ Chromite Formula: Fe2+Cr3+2O4 References: Gerhard Möhn Collection Analyzed by Joy Desor, Gerhard Möhn.Identification: SEM-EDS |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ Chukanovite Formula: Fe2+2(CO3)(OH)2 References: |
| ⓘ Clausthalite Formula: PbSe |
| ⓘ Clinoatacamite Formula: Cu2(OH)3Cl References: Gerhard Möhn Collection Analyzed by Joy Desor, Gerhard MöhnIdentification: SEM-EDS, Raman Spectroscopy |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ Clinochlore var. Pennine Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ Connellite Formula: Cu19(SO4)(OH)32Cl4 · 3H2O Localities: Reported from at least 6 localities in this region. |
| ⓘ Cotunnite Formula: PbCl2 References: |
| ⓘ Covellite Formula: CuS Localities: Reported from at least 8 localities in this region. |
| ⓘ Cubanite Formula: CuFe2S3 |
| ⓘ Cuprite Formula: Cu2O Localities: Reported from at least 8 localities in this region. |
| ⓘ Cuprospinel Formula: Cu2+Fe3+2O4 References: Gerhard Möhn Collection Analyzed by Joy Desor, Gerhard Möhn.Identification: SEM-EDS |
| ⓘ Cyanotrichite Formula: Cu4Al2(SO4)(OH)12 · 2H2O |
| ⓘ Dadsonite (TL) Formula: Pb23Sb25S60Cl Type Locality: |
| ⓘ Davreuxite Formula: MnAl6Si4O17(OH)2 |
| ⓘ Delafossite Formula: Cu+Fe3+O2 |
| ⓘ Devilline Formula: CaCu4(SO4)2(OH)6 · 3H2O Localities: Gottesbelohnung smelter, Mansfeld, Mansfeld-Südharz, Saxony-Anhalt, Germany August Bebel smelter slag locality (Kochhütte smelter slag locality), Helbra, Mansfeld-Südharz, Saxony-Anhalt, Germany Lichtloch 26, Mansfeld, Mansfeld-Südharz, Saxony-Anhalt, Germany Eckardt smelter slag locality, Leimbach, Mansfeld, Mansfeld-Südharz, Saxony-Anhalt, Germany Karl-Liebknecht smelter (Krughütte) slag locality, Eisleben, Mansfeld-Südharz, Saxony-Anhalt, Germany |
| ⓘ Diaphorite Formula: Ag3Pb2Sb3S8 |
| ⓘ Digenite (TL) Formula: Cu9S5 Localities: |
| ⓘ Djurleite Formula: Cu31S16 |
| ⓘ Dolomite Formula: CaMg(CO3)2 Localities: Eskaborn adit, Tilkerode Mining District, Mansfeld, Mansfeld-Südharz, Saxony-Anhalt, Germany Tilkerode mining district, Mansfeld, Mansfeld-Südharz, Saxony-Anhalt, Germany Graf Jost-Christian Mine, Wolfsberg, Sangerhausen, Mansfeld-Südharz, Saxony-Anhalt, Germany Eisleben, Mansfeld-Südharz, Saxony-Anhalt, Germany Thomas-Münzer shaft (Sangerhausen shaft), Sangerhausen, Mansfeld-Südharz, Saxony-Anhalt, Germany |
| ⓘ Dypingite Formula: Mg5(CO3)4(OH)2 · 5H2O |
| ⓘ Elyite Formula: Pb4Cu(SO4)O2(OH)4 · H2O Localities: August Bebel smelter slag locality (Kochhütte smelter slag locality), Helbra, Mansfeld-Südharz, Saxony-Anhalt, Germany Gottesbelohnung smelter, Mansfeld, Mansfeld-Südharz, Saxony-Anhalt, Germany Lichtloch 25, Mansfeld, Mansfeld-Südharz, Saxony-Anhalt, Germany Eckardt smelter slag locality, Leimbach, Mansfeld, Mansfeld-Südharz, Saxony-Anhalt, Germany Kupferkammer smelter slag locality, Hettstedt, Mansfeld-Südharz, Saxony-Anhalt, Germany |
| ⓘ Eskebornite (TL) Formula: CuFeSe2 Localities: |
| ⓘ Eskolaite Formula: Cr2O3 References: Gerhard Möhn Collection Analyzed by Joy Desor, Gerhard Möhn.Identification: SEM-EDS |
| ⓘ Eucairite Formula: AgCuSe |
| ⓘ Fayalite Formula: Fe2+2(SiO4) |
| ⓘ Fehrite Formula: MgCu4(SO4)2(OH)6 · 6H2O References: Gerhard Möhn collectionIdentified by Gerhard Möhn: XRD, SEM-EDS |
| ⓘ Ferrihydrite Formula: Fe3+10O14(OH)2 Localities: Description: added with Knoll (2004) as reference, but this reference does not mention ferrihydrite. |
| ⓘ Ferrobustamite Formula: CaFe2+(Si2O6) |
| ⓘ Ferroselite Formula: FeSe2 |
| ⓘ Fluorite Formula: CaF2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Fornacite Formula: Pb2Cu(CrO4)(AsO4)(OH) References: Gerhard Möhn Collection Analyzed by Joy Desor, Gerhard Möhn.Identification: SEM-EDS, Raman Spectroscopy |
| ⓘ Forsterite Formula: Mg2(SiO4) |
| ⓘ Franklinite Formula: Zn2+Fe3+2O4 References: Gerhard Möhn Collection Analyzed by Joy Desor, Gerhard Möhn.Identification: SEM-EDS |
| ⓘ Freboldite Formula: CoSe References: |
| ⓘ Freieslebenite Formula: AgPbSbS3 |
| ⓘ Fülöppite Formula: Pb3Sb8S15 |
| ⓘ Galena Formula: PbS Localities: Reported from at least 15 localities in this region. |
| ⓘ Gearksutite Formula: Ca[Al(F,OH)5(H2O)] |
| ⓘ Geffroyite Formula: (Cu,Fe,Ag)9(Se,S)8 |
| ⓘ Gersdorffite Formula: NiAsS |
| ⓘ Giorgiosite Formula: Mg5(CO3)4(OH)2 · 5-6H2O References: Gerhard Möhn collectionIdentified by Gerhard Möhn: XRD, SEM-EDS |
| ⓘ Goethite Formula: Fe3+O(OH) Localities: Reported from at least 10 localities in this region. |
| ⓘ Gorceixite Formula: BaAl3(PO4)(PO3OH)(OH)6 |
| ⓘ Gordaite Formula: NaZn4(SO4)(OH)6Cl · 6H2O |
| ⓘ Greenockite Formula: CdS |
| ⓘ Guanajuatite ? Formula: Bi2Se3 |
| ⓘ Gunningite Formula: ZnSO4 · H2O References: Gerhard Möhn Collection Analyzed by Joy Desor, Gerhard Möhn.Identification: Wet Chemical, SEM-EDS |
| ⓘ Gypsum Formula: CaSO4 · 2H2O Localities: Reported from at least 22 localities in this region. |
| ⓘ Gypsum var. Selenite Formula: CaSO4 · 2H2O |
| ⓘ Hardystonite Formula: Ca2Zn[Si2O7] Localities: Colour: Dark red, green, near black; some exhibits blue-red pleochroism Description: Occurs in slag. |
| ⓘ Haydeeite Formula: Cu3Mg(OH)6Cl2 References: Gerhard Möhn Collection Analyzed by Joy Desor, Gerhard MöhnIdentification: SEM-EDS, Raman Spectroscopy |
| ⓘ Hedenbergite Formula: CaFe2+Si2O6 References: |
| ⓘ Hematite Formula: Fe2O3 Localities: Reported from at least 11 localities in this region. |
| ⓘ Heteromorphite Formula: Pb7Sb8S19 |
| ⓘ Heyrovskýite ? Formula: Pb6Bi2S9 |
| ⓘ Honessite Formula: (Ni1-xFe3+x)(OH)2[SO4]x/2 · nH2O References: Gerhard Möhn collectionIdentified by Gerhard Möhn: XRD, SEM-EDS |
| ⓘ Hydrocerussite Formula: Pb3(CO3)2(OH)2 |
| ⓘ Hydrohonessite Formula: (Ni1-xFe3+x)(OH)2(SO4)x/2 · nH2O References: Gerhard Möhn collectionIdentified by Gerhard Möhn: XRD, SEM-EDS |
| ⓘ Hydromagnesite Formula: Mg5(CO3)4(OH)2 · 4H2O Description: Analyzed by Joy Desor and Gerhard Möhn.
References: Gerhard Möhn collectionIdentified by Gerhard Möhn: XRD, SEM-EDS |
| ⓘ Hydroxylpyromorphite Formula: Pb5(PO4)3(OH) References: Gerhard Möhn Collection Analyzed by Joy Desor, Gerhard Möhn.Identification: XRD, SEM-EDS |
| ⓘ Hydrozincite Formula: Zn5(CO3)2(OH)6 Localities: Weiße mine, Hayn, Südharz, Mansfeld-Südharz, Saxony-Anhalt, Germany Silberner Nagel Mine, Stolberg, Südharz, Mansfeld-Südharz, Saxony-Anhalt, Germany Kupferkammer smelter slag locality, Hettstedt, Mansfeld-Südharz, Saxony-Anhalt, Germany Lichtloch 26, Mansfeld, Mansfeld-Südharz, Saxony-Anhalt, Germany August Bebel smelter slag locality (Kochhütte smelter slag locality), Helbra, Mansfeld-Südharz, Saxony-Anhalt, Germany |
| ⓘ Jacutingaite Formula: Pt2HgSe3 |
| ⓘ Jamesonite Formula: Pb4FeSb6S14 |
| ⓘ Jarosite Formula: KFe3+3(SO4)2(OH)6 |
| ⓘ Kaňkite Formula: FeAsO4 · 3.5H2O |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 |
| ⓘ 'Kaolinite Subgroup' Formula: Al2Si2O5(OH)4 |
| ⓘ Kermesite ? Formula: Sb2S2O |
| ⓘ Klockmannite Formula: CuSe |
| ⓘ Ktenasite Formula: ZnCu4(SO4)2(OH)6 · 6H2O |
| ⓘ Lahnsteinite Formula: Zn4(SO4)(OH)6 · 3H2O References: Gerhard Möhn collectionIdentified by Gerhard Möhn: XRD, SEM-EDS |
| ⓘ Lanarkite Formula: Pb2(SO4)O Localities: |
| ⓘ Langite Formula: Cu4(SO4)(OH)6 · 2H2O Localities: Reported from at least 7 localities in this region. |
| ⓘ Lansfordite Formula: MgCO3 · 5H2O |
| ⓘ Leadhillite Formula: Pb4(CO3)2(SO4)(OH)2 Locality: Eckardt smelter slag locality, Leimbach, Mansfeld, Mansfeld-Südharz, Saxony-Anhalt, Germany References: |
| ⓘ Lepidocrocite Formula: Fe3+O(OH) |
| ⓘ Liebenbergite Formula: Ni2(SiO4) |
| ⓘ Liebigite Formula: Ca2(UO2)(CO3)3 · 11H2O |
| ⓘ 'Limonite' Localities: Reported from at least 6 localities in this region. |
| ⓘ Linarite Formula: PbCu(SO4)(OH)2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Litharge Formula: PbO Localities: Lichtloch 25, Mansfeld, Mansfeld-Südharz, Saxony-Anhalt, Germany August Bebel smelter slag locality (Kochhütte smelter slag locality), Helbra, Mansfeld-Südharz, Saxony-Anhalt, Germany Gottesbelohnung smelter, Mansfeld, Mansfeld-Südharz, Saxony-Anhalt, Germany Lichtloch 26, Mansfeld, Mansfeld-Südharz, Saxony-Anhalt, Germany |
| ⓘ Magnesiochromite Formula: MgCr2O4 References: Gerhard Möhn Collection Analyzed by Joy Desor, Gerhard Möhn.Identification: SEM-EDS |
| ⓘ Magnesite Formula: MgCO3 |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 Localities: Description: strongly ferromagnetic |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 Localities: Reported from at least 11 localities in this region. |
| ⓘ 'Manganese Oxides' |
| ⓘ Manganite Formula: Mn3+O(OH) |
| ⓘ Marcasite Formula: FeS2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Massicot Formula: PbO |
| ⓘ Maucherite (TL) Formula: Ni11As8 Localities: Eisleben, Mansfeld-Südharz, Saxony-Anhalt, Germany Bernard-Koenen shafts I-II, Niederröblingen (Helme), Allstedt, Mansfeld-Südharz, Saxony-Anhalt, Germany Max-Lademann shaft (Clotilde shaft), Eisleben, Mansfeld-Südharz, Saxony-Anhalt, Germany Hans-Seidel shafts I-II (Graf-von-Hohenthal-Schächte I und II), Helbra, Mansfeld-Südharz, Saxony-Anhalt, Germany Type Locality: Eisleben, Mansfeld-Südharz, Saxony-Anhalt, Germany |
| ⓘ Mcconnellite Formula: CuCrO2 References: Gerhard Möhn Collection Analyzed by Joy Desor, Gerhard MöhnIdentification: XRD, SEM-EDS |
| ⓘ Mcguinnessite Formula: (Mg,Cu)2(CO3)(OH)2 References: Gerhard Möhn Collection Analyzed by Joy Desor, Gerhard Möhn.Identification: Wet Chemical, SEM-EDS |
| ⓘ Melanterite Formula: Fe2+(H2O)6(SO4) · H2O |
| ⓘ 'Melnikovite' |
| ⓘ Miargyrite Formula: AgSbS2 |
| ⓘ Millerite Formula: NiS |
| ⓘ Mimetite Formula: Pb5(AsO4)3Cl |
| ⓘ Molybdenite Formula: MoS2 |
| ⓘ Monohydrocalcite Formula: CaCO3 · H2O Localities: Oberhütte slag locality, Volkstedt, Eisleben, Mansfeld-Südharz, Saxony-Anhalt, Germany Gottesbelohnung smelter, Mansfeld, Mansfeld-Südharz, Saxony-Anhalt, Germany August Bebel smelter slag locality (Kochhütte smelter slag locality), Helbra, Mansfeld-Südharz, Saxony-Anhalt, Germany Lichtloch 26, Mansfeld, Mansfeld-Südharz, Saxony-Anhalt, Germany Lichtloch 25, Mansfeld, Mansfeld-Südharz, Saxony-Anhalt, Germany |
| ⓘ Mullite Formula: Al4+2xSi2-2xO10-x |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Muscovite var. Illite Formula: K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ Nahcolite Formula: NaHCO3 |
| ⓘ Nakauriite Formula: Cu8(SO4)4(CO3)(OH)6 · 48H2O References: |
| ⓘ Namuwite Formula: Zn4(SO4)(OH)6 · 4H2O Localities: Lichtloch 25, Mansfeld, Mansfeld-Südharz, Saxony-Anhalt, Germany Oberhütte slag locality, Volkstedt, Eisleben, Mansfeld-Südharz, Saxony-Anhalt, Germany Gottesbelohnung smelter, Mansfeld, Mansfeld-Südharz, Saxony-Anhalt, Germany Lichtloch 26, Mansfeld, Mansfeld-Südharz, Saxony-Anhalt, Germany Karl-Liebknecht smelter (Krughütte) slag locality, Eisleben, Mansfeld-Südharz, Saxony-Anhalt, Germany ? (more information) |
| ⓘ Nantokite ? Formula: CuCl Localities: Description: Added with Knoll (2004) as reference, but this reference does not mention nantokite. |
| ⓘ Native Arsenic Formula: As |
| ⓘ Native Bismuth Formula: Bi |
| ⓘ Native Copper Formula: Cu Localities: Reported from at least 14 localities in this region. |
| ⓘ Native Gold Formula: Au |
| ⓘ Native Lead Formula: Pb Localities: Description: Tenacity: malleable
Hardness: 1.5 |
| ⓘ Native Selenium Formula: Se |
| ⓘ Native Silver Formula: Ag Localities: Reported from at least 9 localities in this region. |
| ⓘ Native Sulphur Formula: S8 Localities: Reported from at least 11 localities in this region. |
| ⓘ Native Zinc Formula: Zn References: |
| ⓘ Natrozippeite Formula: Na5(UO2)8(SO4)4O5(OH)3 · 12H2O References: |
| ⓘ Naumannite (TL) Formula: Ag2Se Type Locality: |
| ⓘ Nesquehonite Formula: MgCO3 · 3H2O References: Gerhard Möhn collectionIdentified by Gerhard Möhn: Wet Chemical, XRD, SEM-EDS |
| ⓘ Nickelhexahydrite Formula: Ni2+(H2O)6(SO4) References: Gerhard Möhn Collection Analyzed by Joy Desor, Gerhard Möhn.Identification: Wet Chemical, XRD, SEM-EDS |
| ⓘ Nickeline Formula: NiAs Localities: Reported from at least 6 localities in this region. |
| ⓘ Nickelskutterudite Formula: NiAs3 |
| ⓘ Orpiment Formula: As2S3 |
| ⓘ Orthoclase Formula: K(AlSi3O8) |
| ⓘ Osakaite Formula: Zn4(SO4)(OH)6 · 5H2O References: Gerhard Möhn Collection Analyzed by Joy Desor, Gerhard Möhn.Identification: XRD, SEM-EDS |
| ⓘ Owyheeite ? Formula: Ag3Pb10Sb11S28 |
| ⓘ Paralaurionite Formula: PbCl(OH) References: Gerhard Möhn Collection Analyzed by Joy Desor, Gerhard MöhnIdentification: XRD, SEM-EDS |
| ⓘ Paramelaconite ? Formula: Cu+2Cu2+2O3 Description: No analytical details known. |
| ⓘ Parasymplesite Formula: Fe2+3(AsO4)2 · 8H2O |
| ⓘ Paratacamite Formula: Cu3(Cu,Zn)(OH)6Cl2 |
| ⓘ Penroseite Formula: (Ni,Co,Cu)Se2 |
| ⓘ Periclase Formula: MgO References: Gerhard Möhn Collection Analyzed by Joy Desor, Gerhard MöhnIdentification: XRD, SEM-EDS |
| ⓘ 'Petroleum' Locality: Fortschritt shaft I (Wolfschacht), Volkstedt, Eisleben, Mansfeld-Südharz, Saxony-Anhalt, Germany References: Dr. Günter Grundmann collectionIdentified by Dr. Günter Grundmann: Polarised-light microscopy |
| ⓘ 'Petroleum var. Bitumen' Locality: Fortschritt shaft I (Wolfschacht), Volkstedt, Eisleben, Mansfeld-Südharz, Saxony-Anhalt, Germany References: Dr. Günter Grundmann collectionIdentified by Dr. Günter Grundmann: Polarised-light microscopy |
| ⓘ Phoenicochroite Formula: Pb2(CrO4)O References: Gerhard Möhn collectionIdentified by Gerhard Möhn: SEM-EDS |
| ⓘ Pitticite Formula: (Fe, AsO4, H2O) (?) |
| ⓘ Plagionite (TL) Formula: Pb5Sb8S17 Localities: |
| ⓘ Plumbonacrite Formula: Pb5O(OH)2(CO3)3 |
| ⓘ Posnjakite Formula: Cu4(SO4)(OH)6 · H2O |
| ⓘ 'Psilomelane' |
| ⓘ 'Pumpellyite-(Fe)' |
| ⓘ Pyrargyrite Formula: Ag3SbS3 |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 16 localities in this region. |
| ⓘ Pyrolusite Formula: Mn4+O2 |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl |
| ⓘ Pyrrhotite Formula: Fe1-xS |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 19 localities in this region. |
| ⓘ Quartz var. Agate Formula: SiO2 |
| ⓘ Quartz var. Amethyst Formula: SiO2 |
| ⓘ Quartz var. Chalcedony Formula: SiO2 |
| ⓘ Quartz var. Rock Crystal Formula: SiO2 |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 |
| ⓘ Ramazzoite Formula: [Mg8Cu12(PO4)(CO3)4(OH)24(H2O)20][(H0.33SO4)3(H2O)36] |
| ⓘ Rammelsbergite Formula: NiAs2 |
| ⓘ Ranciéite Formula: (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| ⓘ Realgar Formula: As4S4 |
| ⓘ Reevesite Formula: Ni6Fe3+2(OH)16(CO3) · 4H2O References: Gerhard Möhn Collection Analyzed by Joy Desor, Gerhard Möhn.Identification: SEM-EDS |
| ⓘ Retgersite Formula: NiSO4 · 6H2O References: Gerhard Möhn Collection Analyzed by Joy Desor, Gerhard Möhn.Identification: Wet Chemical, XRD, SEM-EDS |
| ⓘ 'Retinite' |
| ⓘ Robinsonite Formula: Pb4Sb6S13 Locality: Graf Jost-Christian Mine, Wolfsberg, Sangerhausen, Mansfeld-Südharz, Saxony-Anhalt, Germany Colour: grey Fluorescence: none Description: Identified by Gunter Blass by EDS? References: |
| ⓘ Sauconite Formula: Na0.3Zn3((Si,Al)4O10)(OH)2 · 4H2O References: Gerhard Möhn Collection Analyzed by Joy Desor, Gerhard Möhn.Identification: Wet Chemical, XRD, SEM-EDS |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Schulenbergite Formula: (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| ⓘ Schulténite Formula: Pb(HAsO4) |
| ⓘ Scorodite Formula: Fe3+AsO4 · 2H2O |
| ⓘ Semseyite Formula: Pb9Sb8S21 |
| ⓘ Senarmontite Formula: Sb2O3 |
| ⓘ Serpierite Formula: Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O Localities: Reported from at least 8 localities in this region. |
| ⓘ Siderite Formula: FeCO3 Localities: Reported from at least 13 localities in this region. |
| ⓘ Skutterudite Formula: CoAs3 |
| ⓘ Spangolite Formula: Cu6Al(SO4)(OH)12Cl · 3H2O |
| ⓘ Spertiniite Formula: Cu(OH)2 |
| ⓘ Spessartine Formula: Mn2+3Al2(SiO4)3 |
| ⓘ Sphalerite Formula: ZnS Localities: Reported from at least 13 localities in this region. |
| ⓘ Sphalerite var. Schalenblende Locality: Thomas-Münzer shaft (Sangerhausen shaft), Sangerhausen, Mansfeld-Südharz, Saxony-Anhalt, Germany References: |
| ⓘ Stibiconite Formula: Sb3+Sb5+2O6(OH) |
| ⓘ Stibiopalladinite Formula: Pd5Sb2 Locality: Eskaborn adit, Tilkerode Mining District, Mansfeld, Mansfeld-Südharz, Saxony-Anhalt, Germany References: |
| ⓘ Stibnite Formula: Sb2S3 |
| ⓘ Stilleite Formula: ZnSe |
| ⓘ Stolzite Formula: Pb(WO4) |
| ⓘ Strengite Formula: FePO4 · 2H2O |
| ⓘ Strontianite Formula: SrCO3 |
| ⓘ Temagamite Formula: Pd3HgTe3 |
| ⓘ 'Tennantite Subgroup' Formula: Cu6(Cu4C2+2)As4S12S |
| ⓘ Tenorite Formula: CuO Localities: August Bebel smelter slag locality (Kochhütte smelter slag locality), Helbra, Mansfeld-Südharz, Saxony-Anhalt, Germany Lichtloch 26, Mansfeld, Mansfeld-Südharz, Saxony-Anhalt, Germany Gottesbelohnung smelter, Mansfeld, Mansfeld-Südharz, Saxony-Anhalt, Germany Kupferkammer smelter slag locality, Hettstedt, Mansfeld-Südharz, Saxony-Anhalt, Germany |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S Localities: Reported from at least 7 localities in this region. |
| ⓘ Thaumasite Formula: Ca3(SO4)[Si(OH)6](CO3) · 12H2O References: Gerhard Möhn Collection Analyzed by Joy Desor, Gerhard Möhn.Identification: Wet Chemical, XRD, SEM-EDS |
| ⓘ Tiemannite Formula: HgSe Locality: Eskaborn adit, Tilkerode Mining District, Mansfeld, Mansfeld-Südharz, Saxony-Anhalt, Germany References: |
| ⓘ Tilkerodeite (TL) Formula: Pd2HgSe3 Type Locality: |
| ⓘ Tischendorfite (TL) Formula: Pd8Hg3Se9 Type Locality: |
| ⓘ Trevorite Formula: Ni2+Fe3+2O4 |
| ⓘ Tripuhyite ? Formula: Fe3+Sb5+O4 |
| ⓘ Trogtalite Formula: CoSe2 |
| ⓘ Trüstedtite Formula: Ni3Se4 |
| ⓘ Tzeferisite Formula: CaZn8(SO4)2(OH)12Cl2(H2O)9 References: Gerhard Möhn Collection Analyzed by Joy Desor, Gerhard Möhn.Identification: XRD, SEM-EDS |
| ⓘ 'UM1973-06-CO:MgH' Formula: Mg5(CO3)4(OH)2 · 8H2O Description: Analyzed by Joy Desor and Gerhard Möhn.
Intergrown with Dypingite and Hydromagnesite. References: Gerhard Möhn collectionIdentified by Gerhard Möhn: XRD, SEM-EDS |
| ⓘ Umangite Formula: Cu3Se2 |
| ⓘ 'Unnamed (Gordaite-related Ca-Zn Sulphate Chloride Hydrate)' Formula: Ca[Zn8(SO4)2(OH)12Cl2](H2O)9 References: |
| ⓘ Uraninite Formula: UO2 |
| ⓘ Urvantsevite Formula: Pd(Bi,Pb)2 |
| ⓘ Vaesite Formula: NiS2 |
| ⓘ Valentinite Formula: Sb2O3 |
| ⓘ Variscite Formula: AlPO4 · 2H2O |
| ⓘ Villamanínite Formula: (Cu,Ni,Co,Fe)S2 |
| ⓘ Vivianite Formula: Fe2+Fe2+2(PO4)2 · 8H2O |
| ⓘ Wavellite Formula: Al3(PO4)2(OH)3 · 5H2O |
| ⓘ Willemite Formula: Zn2SiO4 |
| ⓘ 'Wolframite Group' |
| ⓘ Woodwardite Formula: Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| ⓘ Formula: Pb(MoO4) Locality: August Bebel smelter slag locality (Kochhütte smelter slag locality), Helbra, Mansfeld-Südharz, Saxony-Anhalt, Germany - erroneously reported Description: Wrong label on micromount with sulphur crystals. References: |
| ⓘ Zincite Formula: ZnO References: |
| ⓘ Zinkenite (TL) Formula: Pb9Sb22S42 Localities: |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Native Gold | 1.AA.05 | Au |
| ⓘ | Native Lead | 1.AA.05 | Pb |
| ⓘ | Native Silver | 1.AA.05 | Ag |
| ⓘ | Native Zinc | 1.AB.05 | Zn |
| ⓘ | 'α-Brass' | 1.AB.10a | Cu3Zn |
| ⓘ | Native Arsenic | 1.CA.05 | As |
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| ⓘ | Native Sulphur | 1.CC.05 | S8 |
| ⓘ | Native Selenium | 1.CC.10 | Se |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Maucherite (TL) | 2.AB.15 | Ni11As8 |
| ⓘ | Stibiopalladinite | 2.AC.20a | Pd5Sb2 |
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Djurleite | 2.BA.05 | Cu31S16 |
| ⓘ | Anilite | 2.BA.10 | Cu7S4 |
| ⓘ | Digenite (TL) | 2.BA.10 | Cu9S5 |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Berzelianite | 2.BA.20 | Cu2-xSe (x ≈ 0.12) |
| ⓘ | Athabascaite | 2.BA.25 | Cu5Se4 |
| ⓘ | Umangite | 2.BA.25 | Cu3Se2 |
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Eucairite | 2.BA.50 | AgCuSe |
| ⓘ | Naumannite (TL) | 2.BA.55 | Ag2Se |
| ⓘ | Geffroyite | 2.BB.15 | (Cu,Fe,Ag)9(Se,S)8 |
| ⓘ | Chrisstanleyite | 2.BC.15 | Ag2Pd3Se4 |
| ⓘ | Temagamite | 2.BC.50 | Pd3HgTe3 |
| ⓘ | Tischendorfite (TL) | 2.BC.65 | Pd8Hg3Se9 |
| ⓘ | Betekhtinite (TL) | 2.BE.05 | Pb2(Cu,Fe)22-24S15 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Klockmannite | 2.CA.05b | CuSe |
| ⓘ | Sphalerite var. Schalenblende | 2.CB.05a | ZnS |
| ⓘ | 2.CB.05a | ZnS | |
| ⓘ | Stilleite | 2.CB.05a | ZnSe |
| ⓘ | Tiemannite | 2.CB.05a | HgSe |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Eskebornite (TL) | 2.CB.10a | CuFeSe2 |
| ⓘ | Greenockite | 2.CB.45 | CdS |
| ⓘ | Cubanite | 2.CB.55a | CuFe2S3 |
| ⓘ | Tilkerodeite (TL) | 2.CC. | Pd2HgSe3 |
| ⓘ | Freboldite | 2.CC.05 | CoSe |
| ⓘ | Nickeline | 2.CC.05 | NiAs |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Millerite | 2.CC.20 | NiS |
| ⓘ | Jacutingaite | 2.CC.45 | Pt2HgSe3 |
| ⓘ | Clausthalite | 2.CD.10 | PbSe |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Bornhardtite | 2.DA.05 | Co2+Co3+2Se4 |
| ⓘ | Trüstedtite | 2.DA.05 | Ni3Se4 |
| ⓘ | Guanajuatite ? | 2.DB.05 | Bi2Se3 |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | 'Castaingite' | 2.DC.15 | CuMo2S5 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Penroseite | 2.EB.05a | (Ni,Co,Cu)Se2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Trogtalite | 2.EB.05a | CoSe2 |
| ⓘ | Vaesite | 2.EB.05a | NiS2 |
| ⓘ | Villamanínite | 2.EB.05a | (Cu,Ni,Co,Fe)S2 |
| ⓘ | Ferroselite | 2.EB.10a | FeSe2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Rammelsbergite | 2.EB.15a | NiAs2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Gersdorffite | 2.EB.25 | NiAsS |
| ⓘ | Urvantsevite | 2.EB.30 | Pd(Bi,Pb)2 |
| ⓘ | Nickelskutterudite | 2.EC.05 | NiAs3 |
| ⓘ | Skutterudite | 2.EC.05 | CoAs3 |
| ⓘ | Realgar | 2.FA.15a | As4S4 |
| ⓘ | Orpiment | 2.FA.30 | As2S3 |
| ⓘ | Kermesite ? | 2.FD.05 | Sb2S2O |
| ⓘ | Pyrargyrite | 2.GA.05 | Ag3SbS3 |
| ⓘ | Bournonite | 2.GA.50 | PbCuSbS3 |
| ⓘ | 'Tennantite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)As4S12S |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | Chalcostibite (TL) | 2.HA.05 | CuSbS2 |
| ⓘ | Miargyrite | 2.HA.10 | AgSbS2 |
| ⓘ | Jamesonite | 2.HB.15 | Pb4FeSb6S14 |
| ⓘ | Fülöppite | 2.HC.10a | Pb3Sb8S15 |
| ⓘ | Plagionite (TL) | 2.HC.10b | Pb5Sb8S17 |
| ⓘ | Heteromorphite | 2.HC.10c | Pb7Sb8S19 |
| ⓘ | Semseyite | 2.HC.10d | Pb9Sb8S21 |
| ⓘ | Boulangerite | 2.HC.15 | Pb5Sb4S11 |
| ⓘ | Robinsonite | 2.HC.20 | Pb4Sb6S13 |
| ⓘ | Dadsonite (TL) | 2.HC.30 | Pb23Sb25S60Cl |
| ⓘ | Owyheeite ? | 2.HC.35 | Ag3Pb10Sb11S28 |
| ⓘ | Diaphorite | 2.JB.05 | Ag3Pb2Sb3S8 |
| ⓘ | Freieslebenite | 2.JB.15 | AgPbSbS3 |
| ⓘ | Zinkenite (TL) | 2.JB.35a | Pb9Sb22S42 |
| ⓘ | Heyrovskýite ? | 2.JB.40b | Pb6Bi2S9 |
| Group 3 - Halides | |||
| ⓘ | Nantokite ? | 3.AA.05 | CuCl |
| ⓘ | Chlorargyrite | 3.AA.15 | AgCl |
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| ⓘ | Cotunnite | 3.AB.85 | PbCl2 |
| ⓘ | Gearksutite | 3.CC.05 | Ca[Al(F,OH)5(H2O)] |
| ⓘ | Atacamite | 3.DA.10a | Cu2(OH)3Cl |
| ⓘ | Botallackite | 3.DA.10b | Cu2(OH)3Cl |
| ⓘ | Clinoatacamite | 3.DA.10b | Cu2(OH)3Cl |
| ⓘ | Paratacamite | 3.DA.10c | Cu3(Cu,Zn)(OH)6Cl2 |
| ⓘ | Haydeeite | 3.DA.10c | Cu3Mg(OH)6Cl2 |
| ⓘ | Connellite | 3.DA.25 | Cu19(SO4)(OH)32Cl4 · 3H2O |
| ⓘ | Boleite | 3.DB.15 | KPb26Ag9Cu24(OH)48Cl62 |
| ⓘ | Chloroxiphite | 3.DB.30 | Pb3CuO2Cl2(OH)2 |
| ⓘ | Paralaurionite | 3.DC.05 | PbCl(OH) |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Cuprite | 4.AA.10 | Cu2O |
| ⓘ | Paramelaconite ? | 4.AA.15 | Cu+2Cu2+2O3 |
| ⓘ | Tenorite | 4.AB.10 | CuO |
| ⓘ | Delafossite | 4.AB.15 | Cu+Fe3+O2 |
| ⓘ | Mcconnellite | 4.AB.15 | CuCrO2 |
| ⓘ | Zincite | 4.AB.20 | ZnO |
| ⓘ | Bunsenite | 4.AB.25 | NiO |
| ⓘ | Periclase | 4.AB.25 | MgO |
| ⓘ | Litharge | 4.AC.20 | PbO |
| ⓘ | Massicot | 4.AC.25 | PbO |
| ⓘ | Chromite | 4.BB.05 | Fe2+Cr3+2O4 |
| ⓘ | Cuprospinel | 4.BB.05 | Cu2+Fe3+2O4 |
| ⓘ | Franklinite | 4.BB.05 | Zn2+Fe3+2O4 |
| ⓘ | Magnesiochromite | 4.BB.05 | MgCr2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Trevorite | 4.BB.05 | Ni2+Fe3+2O4 |
| ⓘ | Eskolaite | 4.CB.05 | Cr2O3 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Arsenolite | 4.CB.50 | As2O3 |
| ⓘ | Senarmontite | 4.CB.50 | Sb2O3 |
| ⓘ | Valentinite | 4.CB.55 | Sb2O3 |
| ⓘ | Quartz var. Agate | 4.DA.05 | SiO2 |
| ⓘ | var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Rock Crystal | 4.DA.05 | SiO2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Tripuhyite ? | 4.DB.05 | Fe3+Sb5+O4 |
| ⓘ | 'Wolframite Group' | 4.DB.30 va | |
| ⓘ | Cervantite | 4.DE.30 | Sb3+Sb5+O4 |
| ⓘ | Bindheimite | 4.DH.20 | Pb2Sb2O6O |
| ⓘ | Stibiconite | 4.DH.20 | Sb3+Sb5+2O6(OH) |
| ⓘ | Uraninite | 4.DL.05 | UO2 |
| ⓘ | Spertiniite | 4.FD.05 | Cu(OH)2 |
| ⓘ | Goethite | 4.FD.10 | Fe3+O(OH) |
| ⓘ | Manganite | 4.FD.15 | Mn3+O(OH) |
| ⓘ | Lepidocrocite | 4.FE.15 | Fe3+O(OH) |
| ⓘ | Ferrihydrite | 4.FE.35 | Fe3+10O14(OH)2 |
| ⓘ | Ranciéite | 4.FL.40 | (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Nahcolite | 5.AA.15 | NaHCO3 |
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Magnesite | 5.AB.05 | MgCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Calcite var. Glendonite | 5.AB.05 | CaCO3 |
| ⓘ | var. Barleycorn | 5.AB.05 | CaCO3 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Strontianite | 5.AB.15 | SrCO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Mcguinnessite | 5.BA.10 | (Mg,Cu)2(CO3)(OH)2 |
| ⓘ | Chukanovite | 5.BA.10 | Fe2+2(CO3)(OH)2 |
| ⓘ | Aurichalcite | 5.BA.15 | (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ | Hydrozincite | 5.BA.15 | Zn5(CO3)2(OH)6 |
| ⓘ | Hydrocerussite | 5.BE.10 | Pb3(CO3)2(OH)2 |
| ⓘ | Plumbonacrite | 5.BE.15 | Pb5O(OH)2(CO3)3 |
| ⓘ | Brianyoungite | 5.BF.30 | Zn3(CO3,SO4)(OH)4 |
| ⓘ | Leadhillite | 5.BF.40 | Pb4(CO3)2(SO4)(OH)2 |
| ⓘ | Nesquehonite | 5.CA.05 | MgCO3 · 3H2O |
| ⓘ | Lansfordite | 5.CA.10 | MgCO3 · 5H2O |
| ⓘ | Monohydrocalcite | 5.CB.20 | CaCO3 · H2O |
| ⓘ | Chalconatronite | 5.CB.40 | Na2Cu(CO3)2 · 3H2O |
| ⓘ | Dypingite | 5.DA.05 | Mg5(CO3)4(OH)2 · 5H2O |
| ⓘ | Giorgiosite | 5.DA.05 | Mg5(CO3)4(OH)2 · 5-6H2O |
| ⓘ | Hydromagnesite | 5.DA.05 | Mg5(CO3)4(OH)2 · 4H2O |
| ⓘ | Callaghanite | 5.DA.25 | Cu2Mg2(CO3)(OH)6 · 2H2O |
| ⓘ | Reevesite | 5.DA.50 | Ni6Fe3+2(OH)16(CO3) · 4H2O |
| ⓘ | Liebigite | 5.ED.20 | Ca2(UO2)(CO3)3 · 11H2O |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anhydrite | 7.AD.30 | CaSO4 |
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Celestine | 7.AD.35 | SrSO4 |
| ⓘ | Antlerite | 7.BB.15 | Cu3(SO4)(OH)4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Beaverite-(Cu) | 7.BC.10 | Pb(Fe3+2Cu)(SO4)2(OH)6 |
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Caledonite | 7.BC.50 | Pb5Cu2(SO4)3(CO3)(OH)6 |
| ⓘ | Linarite | 7.BC.65 | PbCu(SO4)(OH)2 |
| ⓘ | Lanarkite | 7.BD.40 | Pb2(SO4)O |
| ⓘ | Gunningite | 7.CB.05 | ZnSO4 · H2O |
| ⓘ | Nickelhexahydrite | 7.CB.25 | Ni2+(H2O)6(SO4) |
| ⓘ | Retgersite | 7.CB.30 | NiSO4 · 6H2O |
| ⓘ | Melanterite | 7.CB.35 | Fe2+(H2O)6(SO4) · H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | var. Selenite | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Asagiite | 7.DD. | NiCu4(SO4)2(OH)6 · 6H2O |
| ⓘ | Langite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Posnjakite | 7.DD.10 | Cu4(SO4)(OH)6 · H2O |
| ⓘ | Fehrite | 7.DD.10 | MgCu4(SO4)2(OH)6 · 6H2O |
| ⓘ | Spangolite | 7.DD.15 | Cu6Al(SO4)(OH)12Cl · 3H2O |
| ⓘ | Ktenasite | 7.DD.20 | ZnCu4(SO4)2(OH)6 · 6H2O |
| ⓘ | Devilline | 7.DD.30 | CaCu4(SO4)2(OH)6 · 3H2O |
| ⓘ | Serpierite | 7.DD.30 | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| ⓘ | Honessite | 7.DD.35 | (Ni1-xFe3+x)(OH)2[SO4]x/2 · nH2O |
| ⓘ | Hydrohonessite | 7.DD.35 | (Ni1-xFe3+x)(OH)2(SO4)x/2 · nH2O |
| ⓘ | Woodwardite | 7.DD.35 | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| ⓘ | Lahnsteinite | 7.DD.47 | Zn4(SO4)(OH)6 · 3H2O |
| ⓘ | Namuwite | 7.DD.50 | Zn4(SO4)(OH)6 · 4H2O |
| ⓘ | Bechererite | 7.DD.55 | Zn7Cu(OH)13[(SiO(OH)3(SO4)] |
| ⓘ | Schulenbergite | 7.DD.80 | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| ⓘ | Cyanotrichite | 7.DE.10 | Cu4Al2(SO4)(OH)12 · 2H2O |
| ⓘ | Osakaite | 7.DE.40 | Zn4(SO4)(OH)6 · 5H2O |
| ⓘ | Tzeferisite | 7.DF. | CaZn8(SO4)2(OH)12Cl2(H2O)9 |
| ⓘ | Gordaite | 7.DF.50 | NaZn4(SO4)(OH)6Cl · 6H2O |
| ⓘ | Elyite | 7.DF.65 | Pb4Cu(SO4)O2(OH)4 · H2O |
| ⓘ | Thaumasite | 7.DG.15 | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| ⓘ | Nakauriite | 7.DG.30 | Cu8(SO4)4(CO3)(OH)6 · 48H2O |
| ⓘ | Ramazzoite | 7.DG.55 | [Mg8Cu12(PO4)(CO3)4(OH)24(H2O)20][(H0.33SO4)3(H2O)36] |
| ⓘ | Natrozippeite | 7.EC.05 | Na5(UO2)8(SO4)4O5(OH)3 · 12H2O |
| ⓘ | Phoenicochroite | 7.FB.05 | Pb2(CrO4)O |
| ⓘ | Fornacite | 7.FC.10 | Pb2Cu(CrO4)(AsO4)(OH) |
| ⓘ | Stolzite | 7.GA.05 | Pb(WO4) |
| ⓘ | Wulfenite ? | 7.GA.05 | Pb(MoO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Schulténite | 8.AD.30 | Pb(HAsO4) |
| ⓘ | Beudantite | 8.BL.05 | PbFe3+3(AsO4)(SO4)(OH)6 |
| ⓘ | Gorceixite | 8.BL.10 | BaAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Chlorapatite | 8.BN.05 | Ca5(PO4)3Cl |
| ⓘ | Mimetite | 8.BN.05 | Pb5(AsO4)3Cl |
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Hydroxylpyromorphite | 8.BN.05 | Pb5(PO4)3(OH) |
| ⓘ | Scorodite | 8.CD.10 | Fe3+AsO4 · 2H2O |
| ⓘ | Strengite | 8.CD.10 | FePO4 · 2H2O |
| ⓘ | Variscite | 8.CD.10 | AlPO4 · 2H2O |
| ⓘ | Bobierrite | 8.CE.35 | Mg3(PO4)2 · 8H2O |
| ⓘ | Annabergite | 8.CE.40 | Ni3(AsO4)2 · 8H2O |
| ⓘ | Parasymplesite | 8.CE.40 | Fe2+3(AsO4)2 · 8H2O |
| ⓘ | Vivianite | 8.CE.40 | Fe2+Fe2+2(PO4)2 · 8H2O |
| ⓘ | Cattiite | 8.CE.50 | Mg3(PO4)2 · 22H2O |
| ⓘ | Kaňkite | 8.CE.60 | FeAsO4 · 3.5H2O |
| ⓘ | Pitticite | 8.DB.05 | (Fe, AsO4, H2O) (?) |
| ⓘ | Wavellite | 8.DC.50 | Al3(PO4)2(OH)3 · 5H2O |
| Group 9 - Silicates | |||
| ⓘ | Willemite | 9.AA.05 | Zn2SiO4 |
| ⓘ | Fayalite | 9.AC.05 | Fe2+2(SiO4) |
| ⓘ | Forsterite | 9.AC.05 | Mg2(SiO4) |
| ⓘ | Liebenbergite | 9.AC.05 | Ni2(SiO4) |
| ⓘ | Andradite | 9.AD.25 | Ca3Fe3+2(SiO4)3 |
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Mullite | 9.AF.20 | Al4+2xSi2-2xO10-x |
| ⓘ | Braunite | 9.AG.05 | Mn2+Mn3+6(SiO4)O8 |
| ⓘ | Åkermanite | 9.BB.10 | Ca2Mg[Si2O7] |
| ⓘ | Hardystonite | 9.BB.10 | Ca2Zn[Si2O7] |
| ⓘ | Davreuxite | 9.BF.15 | MnAl6Si4O17(OH)2 |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Augite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Hedenbergite | 9.DA.15 | CaFe2+Si2O6 |
| ⓘ | Aegirine-augite | 9.DA.20 | (NaaCabFe2+cMgd)(Fe3+eAlfFe2+gMgh)Si2O6 |
| ⓘ | Carpholite | 9.DB.05 | Mn2+Al2(Si2O6)(OH)4 |
| ⓘ | Ferrobustamite | 9.DG.05 | CaFe2+(Si2O6) |
| ⓘ | Muscovite var. Illite | 9.EC.15 | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | Sauconite | 9.EC.45 | Na0.3Zn3((Si,Al)4O10)(OH)2 · 4H2O |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | var. Pennine | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| Group 10 - Organic Compounds | |||
| ⓘ | Branchite | 10.BA.10 | C20H34 |
| Unclassified | |||
| ⓘ | 'Antimony Ochre' | - | |
| ⓘ | 'Andorite' | - | AgPbSb3S6 |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Psilomelane' | - | |
| ⓘ | 'Melnikovite' | - | |
| ⓘ | 'Retinite' | - | |
| ⓘ | 'Petroleum var. Bitumen' | - | |
| ⓘ | '' | - | |
| ⓘ | 'Pumpellyite-(Fe)' | - | |
| ⓘ | 'Manganese Oxides' | - | |
| ⓘ | 'Unnamed (Gordaite-related Ca-Zn Sulphate Chloride Hydrate)' | - | Ca[Zn8(SO4)2(OH)12Cl2](H2O)9 |
| ⓘ | 'Belosharite' | - | Mg4(OH)6(SO4) · 7H2O |
| ⓘ | 'Kaolinite Subgroup' | - | Al2Si2O5(OH)4 |
| ⓘ | 'UM1973-06-CO:MgH' | - | Mg5(CO3)4(OH)2 · 8H2O |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| H | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| H | ⓘ Atacamite | Cu2(OH)3Cl |
| H | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| H | ⓘ Bechererite | Zn7Cu(OH)13[(SiO(OH)3(SO4)] |
| H | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Bobierrite | Mg3(PO4)2 · 8H2O |
| H | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| H | ⓘ Botallackite | Cu2(OH)3Cl |
| H | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| H | ⓘ Callaghanite | Cu2Mg2(CO3)(OH)6 · 2H2O |
| H | ⓘ Carpholite | Mn2+Al2(Si2O6)(OH)4 |
| H | ⓘ Chloroxiphite | Pb3CuO2Cl2(OH)2 |
| H | ⓘ Chalconatronite | Na2Cu(CO3)2 · 3H2O |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Clinoatacamite | Cu2(OH)3Cl |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| H | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| H | ⓘ Davreuxite | MnAl6Si4O17(OH)2 |
| H | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| H | ⓘ Dypingite | Mg5(CO3)4(OH)2 · 5H2O |
| H | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| H | ⓘ Ferrihydrite | Fe103+O14(OH)2 |
| H | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| H | ⓘ Gearksutite | Ca[Al(F,OH)5(H2O)] |
| H | ⓘ Giorgiosite | Mg5(CO3)4(OH)2 · 5-6H2O |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Gunningite | ZnSO4 · H2O |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Honessite | (Ni1-xFex3+)(OH)2[SO4]x/2 · nH2O |
| H | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| H | ⓘ Hydrohonessite | (Ni1-xFex3+)(OH)2(SO4)x/2 · nH2O |
| H | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| H | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| H | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Kaňkite | FeAsO4 · 3.5H2O |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Ktenasite | ZnCu4(SO4)2(OH)6 · 6H2O |
| H | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Lansfordite | MgCO3 · 5H2O |
| H | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| H | ⓘ Lepidocrocite | Fe3+O(OH) |
| H | ⓘ Liebigite | Ca2(UO2)(CO3)3 · 11H2O |
| H | ⓘ Linarite | PbCu(SO4)(OH)2 |
| H | ⓘ Manganite | Mn3+O(OH) |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Mcguinnessite | (Mg,Cu)2(CO3)(OH)2 |
| H | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| H | ⓘ Monohydrocalcite | CaCO3 · H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Nahcolite | NaHCO3 |
| H | ⓘ Namuwite | Zn4(SO4)(OH)6 · 4H2O |
| H | ⓘ Nesquehonite | MgCO3 · 3H2O |
| H | ⓘ Nickelhexahydrite | Ni2+(H2O)6(SO4) |
| H | ⓘ Nakauriite | Cu8(SO4)4(CO3)(OH)6 · 48H2O |
| H | ⓘ Paralaurionite | PbCl(OH) |
| H | ⓘ Parasymplesite | Fe32+(AsO4)2 · 8H2O |
| H | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| H | ⓘ Pitticite | (Fe, AsO4, H2O) (?) |
| H | ⓘ Plumbonacrite | Pb5O(OH)2(CO3)3 |
| H | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| H | ⓘ Ranciéite | (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| H | ⓘ Reevesite | Ni6Fe23+(OH)16(CO3) · 4H2O |
| H | ⓘ Retgersite | NiSO4 · 6H2O |
| H | ⓘ Sauconite | Na0.3Zn3((Si,Al)4O10)(OH)2 · 4H2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| H | ⓘ Schulténite | Pb(HAsO4) |
| H | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| H | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| H | ⓘ Natrozippeite | Na5(UO2)8(SO4)4O5(OH)3 · 12H2O |
| H | ⓘ Spangolite | Cu6Al(SO4)(OH)12Cl · 3H2O |
| H | ⓘ Spertiniite | Cu(OH)2 |
| H | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| H | ⓘ Strengite | FePO4 · 2H2O |
| H | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| H | ⓘ Variscite | AlPO4 · 2H2O |
| H | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| H | ⓘ Wavellite | Al3(PO4)2(OH)3 · 5H2O |
| H | ⓘ Woodwardite | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| H | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| H | ⓘ Gordaite | NaZn4(SO4)(OH)6Cl · 6H2O |
| H | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Cattiite | Mg3(PO4)2 · 22H2O |
| H | ⓘ Branchite | C20H34 |
| H | ⓘ Chukanovite | Fe22+(CO3)(OH)2 |
| H | ⓘ Unnamed (Gordaite-related Ca-Zn Sulphate Chloride Hydrate) | Ca[Zn8(SO4)2(OH)12Cl2](H2O)9 |
| H | ⓘ Osakaite | Zn4(SO4)(OH)6 · 5H2O |
| H | ⓘ Haydeeite | Cu3Mg(OH)6Cl2 |
| H | ⓘ Hydroxylpyromorphite | Pb5(PO4)3(OH) |
| H | ⓘ Belosharite | Mg4(OH)6(SO4) · 7H2O |
| H | ⓘ Lahnsteinite | Zn4(SO4)(OH)6 · 3H2O |
| H | ⓘ Kaolinite Subgroup | Al2Si2O5(OH)4 |
| H | ⓘ UM1973-06-CO:MgH | Mg5(CO3)4(OH)2 · 8H2O |
| H | ⓘ Ramazzoite | [Mg8Cu12(PO4)(CO3)4(OH)24(H2O)20][(H0.33SO4)3(H2O)36] |
| H | ⓘ Fehrite | MgCu4(SO4)2(OH)6 · 6H2O |
| H | ⓘ Asagiite | NiCu4(SO4)2(OH)6 · 6H2O |
| H | ⓘ Tzeferisite | CaZn8(SO4)2(OH)12Cl2(H2O)9 |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| C | ⓘ Callaghanite | Cu2Mg2(CO3)(OH)6 · 2H2O |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Chalconatronite | Na2Cu(CO3)2 · 3H2O |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Dypingite | Mg5(CO3)4(OH)2 · 5H2O |
| C | ⓘ Giorgiosite | Mg5(CO3)4(OH)2 · 5-6H2O |
| C | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| C | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| C | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| C | ⓘ Lansfordite | MgCO3 · 5H2O |
| C | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| C | ⓘ Liebigite | Ca2(UO2)(CO3)3 · 11H2O |
| C | ⓘ Magnesite | MgCO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Mcguinnessite | (Mg,Cu)2(CO3)(OH)2 |
| C | ⓘ Monohydrocalcite | CaCO3 · H2O |
| C | ⓘ Nahcolite | NaHCO3 |
| C | ⓘ Nesquehonite | MgCO3 · 3H2O |
| C | ⓘ Nakauriite | Cu8(SO4)4(CO3)(OH)6 · 48H2O |
| C | ⓘ Plumbonacrite | Pb5O(OH)2(CO3)3 |
| C | ⓘ Reevesite | Ni6Fe23+(OH)16(CO3) · 4H2O |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Strontianite | SrCO3 |
| C | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| C | ⓘ Branchite | C20H34 |
| C | ⓘ Calcite var. Glendonite | CaCO3 |
| C | ⓘ Chukanovite | Fe22+(CO3)(OH)2 |
| C | ⓘ Calcite var. Barleycorn | CaCO3 |
| C | ⓘ UM1973-06-CO:MgH | Mg5(CO3)4(OH)2 · 8H2O |
| C | ⓘ Ramazzoite | [Mg8Cu12(PO4)(CO3)4(OH)24(H2O)20][(H0.33SO4)3(H2O)36] |
| O | Oxygen | |
| O | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| O | ⓘ Quartz var. Agate | SiO2 |
| O | ⓘ Åkermanite | Ca2Mg[Si2O7] |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Anhydrite | CaSO4 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| O | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| O | ⓘ Arsenolite | As2O3 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Atacamite | Cu2(OH)3Cl |
| O | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| O | ⓘ Bechererite | Zn7Cu(OH)13[(SiO(OH)3(SO4)] |
| O | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| O | ⓘ Bindheimite | Pb2Sb2O6O |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Bobierrite | Mg3(PO4)2 · 8H2O |
| O | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| O | ⓘ Botallackite | Cu2(OH)3Cl |
| O | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| O | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Bunsenite | NiO |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| O | ⓘ Callaghanite | Cu2Mg2(CO3)(OH)6 · 2H2O |
| O | ⓘ Carpholite | Mn2+Al2(Si2O6)(OH)4 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Celestine | SrSO4 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Cervantite | Sb3+Sb5+O4 |
| O | ⓘ Chloroxiphite | Pb3CuO2Cl2(OH)2 |
| O | ⓘ Chalconatronite | Na2Cu(CO3)2 · 3H2O |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| O | ⓘ Chromite | Fe2+Cr23+O4 |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Clinoatacamite | Cu2(OH)3Cl |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Cuprospinel | Cu2+Fe23+O4 |
| O | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| O | ⓘ Davreuxite | MnAl6Si4O17(OH)2 |
| O | ⓘ Delafossite | Cu+Fe3+O2 |
| O | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Dypingite | Mg5(CO3)4(OH)2 · 5H2O |
| O | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| O | ⓘ Eskolaite | Cr2O3 |
| O | ⓘ Fayalite | Fe22+(SiO4) |
| O | ⓘ Ferrihydrite | Fe103+O14(OH)2 |
| O | ⓘ Ferrobustamite | CaFe2+(Si2O6) |
| O | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| O | ⓘ Forsterite | Mg2(SiO4) |
| O | ⓘ Franklinite | Zn2+Fe23+O4 |
| O | ⓘ Gearksutite | Ca[Al(F,OH)5(H2O)] |
| O | ⓘ Giorgiosite | Mg5(CO3)4(OH)2 · 5-6H2O |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Gunningite | ZnSO4 · H2O |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hardystonite | Ca2Zn[Si2O7] |
| O | ⓘ Hedenbergite | CaFe2+Si2O6 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Honessite | (Ni1-xFex3+)(OH)2[SO4]x/2 · nH2O |
| O | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| O | ⓘ Hydrohonessite | (Ni1-xFex3+)(OH)2(SO4)x/2 · nH2O |
| O | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| O | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| O | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Kaňkite | FeAsO4 · 3.5H2O |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Kermesite | Sb2S2O |
| O | ⓘ Ktenasite | ZnCu4(SO4)2(OH)6 · 6H2O |
| O | ⓘ Lanarkite | Pb2(SO4)O |
| O | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Lansfordite | MgCO3 · 5H2O |
| O | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| O | ⓘ Lepidocrocite | Fe3+O(OH) |
| O | ⓘ Liebenbergite | Ni2(SiO4) |
| O | ⓘ Liebigite | Ca2(UO2)(CO3)3 · 11H2O |
| O | ⓘ Linarite | PbCu(SO4)(OH)2 |
| O | ⓘ Litharge | PbO |
| O | ⓘ Magnesite | MgCO3 |
| O | ⓘ Magnesiochromite | MgCr2O4 |
| O | ⓘ Manganite | Mn3+O(OH) |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Massicot | PbO |
| O | ⓘ Mcconnellite | CuCrO2 |
| O | ⓘ Mcguinnessite | (Mg,Cu)2(CO3)(OH)2 |
| O | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| O | ⓘ Mimetite | Pb5(AsO4)3Cl |
| O | ⓘ Monohydrocalcite | CaCO3 · H2O |
| O | ⓘ Mullite | Al4+2xSi2-2xO10-x |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Nahcolite | NaHCO3 |
| O | ⓘ Namuwite | Zn4(SO4)(OH)6 · 4H2O |
| O | ⓘ Nesquehonite | MgCO3 · 3H2O |
| O | ⓘ Nickelhexahydrite | Ni2+(H2O)6(SO4) |
| O | ⓘ Nakauriite | Cu8(SO4)4(CO3)(OH)6 · 48H2O |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Paralaurionite | PbCl(OH) |
| O | ⓘ Paramelaconite | Cu2+Cu22+O3 |
| O | ⓘ Parasymplesite | Fe32+(AsO4)2 · 8H2O |
| O | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| O | ⓘ Periclase | MgO |
| O | ⓘ Phoenicochroite | Pb2(CrO4)O |
| O | ⓘ Pitticite | (Fe, AsO4, H2O) (?) |
| O | ⓘ Plumbonacrite | Pb5O(OH)2(CO3)3 |
| O | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Ranciéite | (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| O | ⓘ Reevesite | Ni6Fe23+(OH)16(CO3) · 4H2O |
| O | ⓘ Retgersite | NiSO4 · 6H2O |
| O | ⓘ Sauconite | Na0.3Zn3((Si,Al)4O10)(OH)2 · 4H2O |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| O | ⓘ Schulténite | Pb(HAsO4) |
| O | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| O | ⓘ Senarmontite | Sb2O3 |
| O | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Natrozippeite | Na5(UO2)8(SO4)4O5(OH)3 · 12H2O |
| O | ⓘ Spangolite | Cu6Al(SO4)(OH)12Cl · 3H2O |
| O | ⓘ Spertiniite | Cu(OH)2 |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| O | ⓘ Stolzite | Pb(WO4) |
| O | ⓘ Strengite | FePO4 · 2H2O |
| O | ⓘ Strontianite | SrCO3 |
| O | ⓘ Tenorite | CuO |
| O | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| O | ⓘ Trevorite | Ni2+Fe23+O4 |
| O | ⓘ Tripuhyite | Fe3+Sb5+O4 |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Valentinite | Sb2O3 |
| O | ⓘ Variscite | AlPO4 · 2H2O |
| O | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| O | ⓘ Wavellite | Al3(PO4)2(OH)3 · 5H2O |
| O | ⓘ Willemite | Zn2SiO4 |
| O | ⓘ Woodwardite | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Zincite | ZnO |
| O | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| O | ⓘ Quartz var. Rock Crystal | SiO2 |
| O | ⓘ Gordaite | NaZn4(SO4)(OH)6Cl · 6H2O |
| O | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Cattiite | Mg3(PO4)2 · 22H2O |
| O | ⓘ Calcite var. Glendonite | CaCO3 |
| O | ⓘ Chukanovite | Fe22+(CO3)(OH)2 |
| O | ⓘ Unnamed (Gordaite-related Ca-Zn Sulphate Chloride Hydrate) | Ca[Zn8(SO4)2(OH)12Cl2](H2O)9 |
| O | ⓘ Calcite var. Barleycorn | CaCO3 |
| O | ⓘ Osakaite | Zn4(SO4)(OH)6 · 5H2O |
| O | ⓘ Haydeeite | Cu3Mg(OH)6Cl2 |
| O | ⓘ Hydroxylpyromorphite | Pb5(PO4)3(OH) |
| O | ⓘ Belosharite | Mg4(OH)6(SO4) · 7H2O |
| O | ⓘ Lahnsteinite | Zn4(SO4)(OH)6 · 3H2O |
| O | ⓘ Kaolinite Subgroup | Al2Si2O5(OH)4 |
| O | ⓘ UM1973-06-CO:MgH | Mg5(CO3)4(OH)2 · 8H2O |
| O | ⓘ Ramazzoite | [Mg8Cu12(PO4)(CO3)4(OH)24(H2O)20][(H0.33SO4)3(H2O)36] |
| O | ⓘ Fehrite | MgCu4(SO4)2(OH)6 · 6H2O |
| O | ⓘ Asagiite | NiCu4(SO4)2(OH)6 · 6H2O |
| O | ⓘ Tzeferisite | CaZn8(SO4)2(OH)12Cl2(H2O)9 |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Gearksutite | Ca[Al(F,OH)5(H2O)] |
| Na | Sodium | |
| Na | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Na | ⓘ Chalconatronite | Na2Cu(CO3)2 · 3H2O |
| Na | ⓘ Nahcolite | NaHCO3 |
| Na | ⓘ Sauconite | Na0.3Zn3((Si,Al)4O10)(OH)2 · 4H2O |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Natrozippeite | Na5(UO2)8(SO4)4O5(OH)3 · 12H2O |
| Na | ⓘ Gordaite | NaZn4(SO4)(OH)6Cl · 6H2O |
| Mg | Magnesium | |
| Mg | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Mg | ⓘ Åkermanite | Ca2Mg[Si2O7] |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Bobierrite | Mg3(PO4)2 · 8H2O |
| Mg | ⓘ Callaghanite | Cu2Mg2(CO3)(OH)6 · 2H2O |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Dypingite | Mg5(CO3)4(OH)2 · 5H2O |
| Mg | ⓘ Forsterite | Mg2(SiO4) |
| Mg | ⓘ Giorgiosite | Mg5(CO3)4(OH)2 · 5-6H2O |
| Mg | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| Mg | ⓘ Lansfordite | MgCO3 · 5H2O |
| Mg | ⓘ Magnesite | MgCO3 |
| Mg | ⓘ Magnesiochromite | MgCr2O4 |
| Mg | ⓘ Mcguinnessite | (Mg,Cu)2(CO3)(OH)2 |
| Mg | ⓘ Nesquehonite | MgCO3 · 3H2O |
| Mg | ⓘ Periclase | MgO |
| Mg | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Cattiite | Mg3(PO4)2 · 22H2O |
| Mg | ⓘ Haydeeite | Cu3Mg(OH)6Cl2 |
| Mg | ⓘ Belosharite | Mg4(OH)6(SO4) · 7H2O |
| Mg | ⓘ UM1973-06-CO:MgH | Mg5(CO3)4(OH)2 · 8H2O |
| Mg | ⓘ Ramazzoite | [Mg8Cu12(PO4)(CO3)4(OH)24(H2O)20][(H0.33SO4)3(H2O)36] |
| Mg | ⓘ Fehrite | MgCu4(SO4)2(OH)6 · 6H2O |
| Al | Aluminium | |
| Al | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Carpholite | Mn2+Al2(Si2O6)(OH)4 |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| Al | ⓘ Davreuxite | MnAl6Si4O17(OH)2 |
| Al | ⓘ Gearksutite | Ca[Al(F,OH)5(H2O)] |
| Al | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Mullite | Al4+2xSi2-2xO10-x |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Sauconite | Na0.3Zn3((Si,Al)4O10)(OH)2 · 4H2O |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Spangolite | Cu6Al(SO4)(OH)12Cl · 3H2O |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Variscite | AlPO4 · 2H2O |
| Al | ⓘ Wavellite | Al3(PO4)2(OH)3 · 5H2O |
| Al | ⓘ Woodwardite | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| Al | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Kaolinite Subgroup | Al2Si2O5(OH)4 |
| Si | Silicon | |
| Si | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Si | ⓘ Quartz var. Agate | SiO2 |
| Si | ⓘ Åkermanite | Ca2Mg[Si2O7] |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Si | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Bechererite | Zn7Cu(OH)13[(SiO(OH)3(SO4)] |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| Si | ⓘ Carpholite | Mn2+Al2(Si2O6)(OH)4 |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Davreuxite | MnAl6Si4O17(OH)2 |
| Si | ⓘ Fayalite | Fe22+(SiO4) |
| Si | ⓘ Ferrobustamite | CaFe2+(Si2O6) |
| Si | ⓘ Forsterite | Mg2(SiO4) |
| Si | ⓘ Hardystonite | Ca2Zn[Si2O7] |
| Si | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Si | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Liebenbergite | Ni2(SiO4) |
| Si | ⓘ Mullite | Al4+2xSi2-2xO10-x |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Sauconite | Na0.3Zn3((Si,Al)4O10)(OH)2 · 4H2O |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| Si | ⓘ Willemite | Zn2SiO4 |
| Si | ⓘ Quartz var. Rock Crystal | SiO2 |
| Si | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Kaolinite Subgroup | Al2Si2O5(OH)4 |
| P | Phosphorus | |
| P | ⓘ Bobierrite | Mg3(PO4)2 · 8H2O |
| P | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| P | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Strengite | FePO4 · 2H2O |
| P | ⓘ Variscite | AlPO4 · 2H2O |
| P | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| P | ⓘ Wavellite | Al3(PO4)2(OH)3 · 5H2O |
| P | ⓘ Cattiite | Mg3(PO4)2 · 22H2O |
| P | ⓘ Hydroxylpyromorphite | Pb5(PO4)3(OH) |
| P | ⓘ Ramazzoite | [Mg8Cu12(PO4)(CO3)4(OH)24(H2O)20][(H0.33SO4)3(H2O)36] |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Andorite | AgPbSb3S6 |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Anhydrite | CaSO4 |
| S | ⓘ Anilite | Cu7S4 |
| S | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| S | ⓘ Bechererite | Zn7Cu(OH)13[(SiO(OH)3(SO4)] |
| S | ⓘ Betekhtinite | Pb2(Cu,Fe)22-24S15 |
| S | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Boulangerite | Pb5Sb4S11 |
| S | ⓘ Bournonite | PbCuSbS3 |
| S | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| S | ⓘ Celestine | SrSO4 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Chalcostibite | CuSbS2 |
| S | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| S | ⓘ Covellite | CuS |
| S | ⓘ Cubanite | CuFe2S3 |
| S | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| S | ⓘ Dadsonite | Pb23Sb25S60Cl |
| S | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| S | ⓘ Diaphorite | Ag3Pb2Sb3S8 |
| S | ⓘ Digenite | Cu9S5 |
| S | ⓘ Djurleite | Cu31S16 |
| S | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| S | ⓘ Fülöppite | Pb3Sb8S15 |
| S | ⓘ Freieslebenite | AgPbSbS3 |
| S | ⓘ Galena | PbS |
| S | ⓘ Geffroyite | (Cu,Fe,Ag)9(Se,S)8 |
| S | ⓘ Gersdorffite | NiAsS |
| S | ⓘ Greenockite | CdS |
| S | ⓘ Gunningite | ZnSO4 · H2O |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Heteromorphite | Pb7Sb8S19 |
| S | ⓘ Honessite | (Ni1-xFex3+)(OH)2[SO4]x/2 · nH2O |
| S | ⓘ Hydrohonessite | (Ni1-xFex3+)(OH)2(SO4)x/2 · nH2O |
| S | ⓘ Jamesonite | Pb4FeSb6S14 |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Kermesite | Sb2S2O |
| S | ⓘ Ktenasite | ZnCu4(SO4)2(OH)6 · 6H2O |
| S | ⓘ Lanarkite | Pb2(SO4)O |
| S | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| S | ⓘ Linarite | PbCu(SO4)(OH)2 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| S | ⓘ Miargyrite | AgSbS2 |
| S | ⓘ Millerite | NiS |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Namuwite | Zn4(SO4)(OH)6 · 4H2O |
| S | ⓘ Nickelhexahydrite | Ni2+(H2O)6(SO4) |
| S | ⓘ Nakauriite | Cu8(SO4)4(CO3)(OH)6 · 48H2O |
| S | ⓘ Orpiment | As2S3 |
| S | ⓘ Owyheeite | Ag3Pb10Sb11S28 |
| S | ⓘ Plagionite | Pb5Sb8S17 |
| S | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| S | ⓘ Pyrargyrite | Ag3SbS3 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Realgar | As4S4 |
| S | ⓘ Robinsonite | Pb4Sb6S13 |
| S | ⓘ Retgersite | NiSO4 · 6H2O |
| S | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| S | ⓘ Semseyite | Pb9Sb8S21 |
| S | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| S | ⓘ Natrozippeite | Na5(UO2)8(SO4)4O5(OH)3 · 12H2O |
| S | ⓘ Spangolite | Cu6Al(SO4)(OH)12Cl · 3H2O |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Native Sulphur | S8 |
| S | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| S | ⓘ Vaesite | NiS2 |
| S | ⓘ Villamanínite | (Cu,Ni,Co,Fe)S2 |
| S | ⓘ Woodwardite | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| S | ⓘ Zinkenite | Pb9Sb22S42 |
| S | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| S | ⓘ Castaingite | CuMo2S5 |
| S | ⓘ Gordaite | NaZn4(SO4)(OH)6Cl · 6H2O |
| S | ⓘ Heyrovskýite | Pb6Bi2S9 |
| S | ⓘ Unnamed (Gordaite-related Ca-Zn Sulphate Chloride Hydrate) | Ca[Zn8(SO4)2(OH)12Cl2](H2O)9 |
| S | ⓘ Osakaite | Zn4(SO4)(OH)6 · 5H2O |
| S | ⓘ Belosharite | Mg4(OH)6(SO4) · 7H2O |
| S | ⓘ Lahnsteinite | Zn4(SO4)(OH)6 · 3H2O |
| S | ⓘ Ramazzoite | [Mg8Cu12(PO4)(CO3)4(OH)24(H2O)20][(H0.33SO4)3(H2O)36] |
| S | ⓘ Fehrite | MgCu4(SO4)2(OH)6 · 6H2O |
| S | ⓘ Asagiite | NiCu4(SO4)2(OH)6 · 6H2O |
| S | ⓘ Tzeferisite | CaZn8(SO4)2(OH)12Cl2(H2O)9 |
| Cl | Chlorine | |
| Cl | ⓘ Atacamite | Cu2(OH)3Cl |
| Cl | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| Cl | ⓘ Botallackite | Cu2(OH)3Cl |
| Cl | ⓘ Chloroxiphite | Pb3CuO2Cl2(OH)2 |
| Cl | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| Cl | ⓘ Chlorargyrite | AgCl |
| Cl | ⓘ Clinoatacamite | Cu2(OH)3Cl |
| Cl | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Cl | ⓘ Cotunnite | PbCl2 |
| Cl | ⓘ Dadsonite | Pb23Sb25S60Cl |
| Cl | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Cl | ⓘ Nantokite | CuCl |
| Cl | ⓘ Paralaurionite | PbCl(OH) |
| Cl | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Cl | ⓘ Spangolite | Cu6Al(SO4)(OH)12Cl · 3H2O |
| Cl | ⓘ Gordaite | NaZn4(SO4)(OH)6Cl · 6H2O |
| Cl | ⓘ Unnamed (Gordaite-related Ca-Zn Sulphate Chloride Hydrate) | Ca[Zn8(SO4)2(OH)12Cl2](H2O)9 |
| Cl | ⓘ Haydeeite | Cu3Mg(OH)6Cl2 |
| Cl | ⓘ Tzeferisite | CaZn8(SO4)2(OH)12Cl2(H2O)9 |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| K | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| Ca | Calcium | |
| Ca | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Ca | ⓘ Åkermanite | Ca2Mg[Si2O7] |
| Ca | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Ca | ⓘ Anhydrite | CaSO4 |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| Ca | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Ferrobustamite | CaFe2+(Si2O6) |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Gearksutite | Ca[Al(F,OH)5(H2O)] |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Hardystonite | Ca2Zn[Si2O7] |
| Ca | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Ca | ⓘ Liebigite | Ca2(UO2)(CO3)3 · 11H2O |
| Ca | ⓘ Monohydrocalcite | CaCO3 · H2O |
| Ca | ⓘ Ranciéite | (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| Ca | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| Ca | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| Ca | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| Ca | ⓘ Calcite var. Glendonite | CaCO3 |
| Ca | ⓘ Unnamed (Gordaite-related Ca-Zn Sulphate Chloride Hydrate) | Ca[Zn8(SO4)2(OH)12Cl2](H2O)9 |
| Ca | ⓘ Calcite var. Barleycorn | CaCO3 |
| Ca | ⓘ Tzeferisite | CaZn8(SO4)2(OH)12Cl2(H2O)9 |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Cr | Chromium | |
| Cr | ⓘ Chromite | Fe2+Cr23+O4 |
| Cr | ⓘ Eskolaite | Cr2O3 |
| Cr | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| Cr | ⓘ Magnesiochromite | MgCr2O4 |
| Cr | ⓘ Mcconnellite | CuCrO2 |
| Cr | ⓘ Phoenicochroite | Pb2(CrO4)O |
| Mn | Manganese | |
| Mn | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| Mn | ⓘ Carpholite | Mn2+Al2(Si2O6)(OH)4 |
| Mn | ⓘ Davreuxite | MnAl6Si4O17(OH)2 |
| Mn | ⓘ Manganite | Mn3+O(OH) |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Ranciéite | (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Fe | Iron | |
| Fe | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Fe | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| Fe | ⓘ Betekhtinite | Pb2(Cu,Fe)22-24S15 |
| Fe | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chromite | Fe2+Cr23+O4 |
| Fe | ⓘ Cubanite | CuFe2S3 |
| Fe | ⓘ Cuprospinel | Cu2+Fe23+O4 |
| Fe | ⓘ Delafossite | Cu+Fe3+O2 |
| Fe | ⓘ Eskebornite | CuFeSe2 |
| Fe | ⓘ Fayalite | Fe22+(SiO4) |
| Fe | ⓘ Ferrihydrite | Fe103+O14(OH)2 |
| Fe | ⓘ Ferrobustamite | CaFe2+(Si2O6) |
| Fe | ⓘ Ferroselite | FeSe2 |
| Fe | ⓘ Franklinite | Zn2+Fe23+O4 |
| Fe | ⓘ Geffroyite | (Cu,Fe,Ag)9(Se,S)8 |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Honessite | (Ni1-xFex3+)(OH)2[SO4]x/2 · nH2O |
| Fe | ⓘ Hydrohonessite | (Ni1-xFex3+)(OH)2(SO4)x/2 · nH2O |
| Fe | ⓘ Jamesonite | Pb4FeSb6S14 |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Kaňkite | FeAsO4 · 3.5H2O |
| Fe | ⓘ Lepidocrocite | Fe3+O(OH) |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| Fe | ⓘ Parasymplesite | Fe32+(AsO4)2 · 8H2O |
| Fe | ⓘ Pitticite | (Fe, AsO4, H2O) (?) |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Reevesite | Ni6Fe23+(OH)16(CO3) · 4H2O |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Strengite | FePO4 · 2H2O |
| Fe | ⓘ Trevorite | Ni2+Fe23+O4 |
| Fe | ⓘ Tripuhyite | Fe3+Sb5+O4 |
| Fe | ⓘ Villamanínite | (Cu,Ni,Co,Fe)S2 |
| Fe | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| Fe | ⓘ Chukanovite | Fe22+(CO3)(OH)2 |
| Co | Cobalt | |
| Co | ⓘ Bornhardtite | Co2+Co23+Se4 |
| Co | ⓘ Freboldite | CoSe |
| Co | ⓘ Penroseite | (Ni,Co,Cu)Se2 |
| Co | ⓘ Skutterudite | CoAs3 |
| Co | ⓘ Trogtalite | CoSe2 |
| Co | ⓘ Villamanínite | (Cu,Ni,Co,Fe)S2 |
| Ni | Nickel | |
| Ni | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| Ni | ⓘ Bunsenite | NiO |
| Ni | ⓘ Gersdorffite | NiAsS |
| Ni | ⓘ Honessite | (Ni1-xFex3+)(OH)2[SO4]x/2 · nH2O |
| Ni | ⓘ Hydrohonessite | (Ni1-xFex3+)(OH)2(SO4)x/2 · nH2O |
| Ni | ⓘ Liebenbergite | Ni2(SiO4) |
| Ni | ⓘ Maucherite | Ni11As8 |
| Ni | ⓘ Millerite | NiS |
| Ni | ⓘ Nickelhexahydrite | Ni2+(H2O)6(SO4) |
| Ni | ⓘ Nickelskutterudite | NiAs3 |
| Ni | ⓘ Nickeline | NiAs |
| Ni | ⓘ Penroseite | (Ni,Co,Cu)Se2 |
| Ni | ⓘ Rammelsbergite | NiAs2 |
| Ni | ⓘ Reevesite | Ni6Fe23+(OH)16(CO3) · 4H2O |
| Ni | ⓘ Retgersite | NiSO4 · 6H2O |
| Ni | ⓘ Trevorite | Ni2+Fe23+O4 |
| Ni | ⓘ Trüstedtite | Ni3Se4 |
| Ni | ⓘ Vaesite | NiS2 |
| Ni | ⓘ Villamanínite | (Cu,Ni,Co,Fe)S2 |
| Ni | ⓘ Asagiite | NiCu4(SO4)2(OH)6 · 6H2O |
| Cu | Copper | |
| Cu | ⓘ Anilite | Cu7S4 |
| Cu | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| Cu | ⓘ Atacamite | Cu2(OH)3Cl |
| Cu | ⓘ Athabascaite | Cu5Se4 |
| Cu | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| Cu | ⓘ Bechererite | Zn7Cu(OH)13[(SiO(OH)3(SO4)] |
| Cu | ⓘ Berzelianite | Cu2-xSe (x ≈ 0.12) |
| Cu | ⓘ Betekhtinite | Pb2(Cu,Fe)22-24S15 |
| Cu | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Botallackite | Cu2(OH)3Cl |
| Cu | ⓘ Bournonite | PbCuSbS3 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| Cu | ⓘ Callaghanite | Cu2Mg2(CO3)(OH)6 · 2H2O |
| Cu | ⓘ Chloroxiphite | Pb3CuO2Cl2(OH)2 |
| Cu | ⓘ Chalconatronite | Na2Cu(CO3)2 · 3H2O |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Chalcostibite | CuSbS2 |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Clinoatacamite | Cu2(OH)3Cl |
| Cu | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cubanite | CuFe2S3 |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Cuprospinel | Cu2+Fe23+O4 |
| Cu | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Delafossite | Cu+Fe3+O2 |
| Cu | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Cu | ⓘ Digenite | Cu9S5 |
| Cu | ⓘ Djurleite | Cu31S16 |
| Cu | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| Cu | ⓘ Eskebornite | CuFeSe2 |
| Cu | ⓘ Eucairite | AgCuSe |
| Cu | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| Cu | ⓘ Geffroyite | (Cu,Fe,Ag)9(Se,S)8 |
| Cu | ⓘ Klockmannite | CuSe |
| Cu | ⓘ Ktenasite | ZnCu4(SO4)2(OH)6 · 6H2O |
| Cu | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Mcconnellite | CuCrO2 |
| Cu | ⓘ Mcguinnessite | (Mg,Cu)2(CO3)(OH)2 |
| Cu | ⓘ Nantokite | CuCl |
| Cu | ⓘ Nakauriite | Cu8(SO4)4(CO3)(OH)6 · 48H2O |
| Cu | ⓘ Paramelaconite | Cu2+Cu22+O3 |
| Cu | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| Cu | ⓘ Penroseite | (Ni,Co,Cu)Se2 |
| Cu | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| Cu | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| Cu | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| Cu | ⓘ Spangolite | Cu6Al(SO4)(OH)12Cl · 3H2O |
| Cu | ⓘ Spertiniite | Cu(OH)2 |
| Cu | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Cu | ⓘ Tenorite | CuO |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Umangite | Cu3Se2 |
| Cu | ⓘ Villamanínite | (Cu,Ni,Co,Fe)S2 |
| Cu | ⓘ Woodwardite | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| Cu | ⓘ α-Brass | Cu3Zn |
| Cu | ⓘ Castaingite | CuMo2S5 |
| Cu | ⓘ Haydeeite | Cu3Mg(OH)6Cl2 |
| Cu | ⓘ Ramazzoite | [Mg8Cu12(PO4)(CO3)4(OH)24(H2O)20][(H0.33SO4)3(H2O)36] |
| Cu | ⓘ Fehrite | MgCu4(SO4)2(OH)6 · 6H2O |
| Cu | ⓘ Asagiite | NiCu4(SO4)2(OH)6 · 6H2O |
| Zn | Zinc | |
| Zn | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Zn | ⓘ Bechererite | Zn7Cu(OH)13[(SiO(OH)3(SO4)] |
| Zn | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| Zn | ⓘ Franklinite | Zn2+Fe23+O4 |
| Zn | ⓘ Gunningite | ZnSO4 · H2O |
| Zn | ⓘ Hardystonite | Ca2Zn[Si2O7] |
| Zn | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| Zn | ⓘ Ktenasite | ZnCu4(SO4)2(OH)6 · 6H2O |
| Zn | ⓘ Namuwite | Zn4(SO4)(OH)6 · 4H2O |
| Zn | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| Zn | ⓘ Sauconite | Na0.3Zn3((Si,Al)4O10)(OH)2 · 4H2O |
| Zn | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| Zn | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Stilleite | ZnSe |
| Zn | ⓘ Willemite | Zn2SiO4 |
| Zn | ⓘ Native Zinc | Zn |
| Zn | ⓘ Zincite | ZnO |
| Zn | ⓘ α-Brass | Cu3Zn |
| Zn | ⓘ Gordaite | NaZn4(SO4)(OH)6Cl · 6H2O |
| Zn | ⓘ Unnamed (Gordaite-related Ca-Zn Sulphate Chloride Hydrate) | Ca[Zn8(SO4)2(OH)12Cl2](H2O)9 |
| Zn | ⓘ Osakaite | Zn4(SO4)(OH)6 · 5H2O |
| Zn | ⓘ Lahnsteinite | Zn4(SO4)(OH)6 · 3H2O |
| Zn | ⓘ Tzeferisite | CaZn8(SO4)2(OH)12Cl2(H2O)9 |
| As | Arsenic | |
| As | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| As | ⓘ Arsenolite | As2O3 |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Native Arsenic | As |
| As | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| As | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| As | ⓘ Gersdorffite | NiAsS |
| As | ⓘ Kaňkite | FeAsO4 · 3.5H2O |
| As | ⓘ Maucherite | Ni11As8 |
| As | ⓘ Mimetite | Pb5(AsO4)3Cl |
| As | ⓘ Nickelskutterudite | NiAs3 |
| As | ⓘ Nickeline | NiAs |
| As | ⓘ Orpiment | As2S3 |
| As | ⓘ Parasymplesite | Fe32+(AsO4)2 · 8H2O |
| As | ⓘ Pitticite | (Fe, AsO4, H2O) (?) |
| As | ⓘ Rammelsbergite | NiAs2 |
| As | ⓘ Realgar | As4S4 |
| As | ⓘ Schulténite | Pb(HAsO4) |
| As | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| As | ⓘ Skutterudite | CoAs3 |
| As | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Se | Selenium | |
| Se | ⓘ Athabascaite | Cu5Se4 |
| Se | ⓘ Berzelianite | Cu2-xSe (x ≈ 0.12) |
| Se | ⓘ Bornhardtite | Co2+Co23+Se4 |
| Se | ⓘ Chrisstanleyite | Ag2Pd3Se4 |
| Se | ⓘ Clausthalite | PbSe |
| Se | ⓘ Eskebornite | CuFeSe2 |
| Se | ⓘ Eucairite | AgCuSe |
| Se | ⓘ Ferroselite | FeSe2 |
| Se | ⓘ Freboldite | CoSe |
| Se | ⓘ Geffroyite | (Cu,Fe,Ag)9(Se,S)8 |
| Se | ⓘ Guanajuatite | Bi2Se3 |
| Se | ⓘ Klockmannite | CuSe |
| Se | ⓘ Naumannite | Ag2Se |
| Se | ⓘ Penroseite | (Ni,Co,Cu)Se2 |
| Se | ⓘ Native Selenium | Se |
| Se | ⓘ Stilleite | ZnSe |
| Se | ⓘ Tiemannite | HgSe |
| Se | ⓘ Trogtalite | CoSe2 |
| Se | ⓘ Trüstedtite | Ni3Se4 |
| Se | ⓘ Umangite | Cu3Se2 |
| Se | ⓘ Tischendorfite | Pd8Hg3Se9 |
| Se | ⓘ Jacutingaite | Pt2HgSe3 |
| Se | ⓘ Tilkerodeite | Pd2HgSe3 |
| Sr | Strontium | |
| Sr | ⓘ Celestine | SrSO4 |
| Sr | ⓘ Strontianite | SrCO3 |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Mo | ⓘ Castaingite | CuMo2S5 |
| Pd | Palladium | |
| Pd | ⓘ Chrisstanleyite | Ag2Pd3Se4 |
| Pd | ⓘ Stibiopalladinite | Pd5Sb2 |
| Pd | ⓘ Temagamite | Pd3HgTe3 |
| Pd | ⓘ Urvantsevite | Pd(Bi,Pb)2 |
| Pd | ⓘ Tischendorfite | Pd8Hg3Se9 |
| Pd | ⓘ Tilkerodeite | Pd2HgSe3 |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Andorite | AgPbSb3S6 |
| Ag | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| Ag | ⓘ Chlorargyrite | AgCl |
| Ag | ⓘ Chrisstanleyite | Ag2Pd3Se4 |
| Ag | ⓘ Diaphorite | Ag3Pb2Sb3S8 |
| Ag | ⓘ Eucairite | AgCuSe |
| Ag | ⓘ Freieslebenite | AgPbSbS3 |
| Ag | ⓘ Geffroyite | (Cu,Fe,Ag)9(Se,S)8 |
| Ag | ⓘ Miargyrite | AgSbS2 |
| Ag | ⓘ Naumannite | Ag2Se |
| Ag | ⓘ Owyheeite | Ag3Pb10Sb11S28 |
| Ag | ⓘ Pyrargyrite | Ag3SbS3 |
| Ag | ⓘ Native Silver | Ag |
| Cd | Cadmium | |
| Cd | ⓘ Greenockite | CdS |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sb | Antimony | |
| Sb | ⓘ Andorite | AgPbSb3S6 |
| Sb | ⓘ Bindheimite | Pb2Sb2O6O |
| Sb | ⓘ Boulangerite | Pb5Sb4S11 |
| Sb | ⓘ Bournonite | PbCuSbS3 |
| Sb | ⓘ Cervantite | Sb3+Sb5+O4 |
| Sb | ⓘ Chalcostibite | CuSbS2 |
| Sb | ⓘ Dadsonite | Pb23Sb25S60Cl |
| Sb | ⓘ Diaphorite | Ag3Pb2Sb3S8 |
| Sb | ⓘ Fülöppite | Pb3Sb8S15 |
| Sb | ⓘ Freieslebenite | AgPbSbS3 |
| Sb | ⓘ Heteromorphite | Pb7Sb8S19 |
| Sb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Sb | ⓘ Kermesite | Sb2S2O |
| Sb | ⓘ Miargyrite | AgSbS2 |
| Sb | ⓘ Owyheeite | Ag3Pb10Sb11S28 |
| Sb | ⓘ Plagionite | Pb5Sb8S17 |
| Sb | ⓘ Pyrargyrite | Ag3SbS3 |
| Sb | ⓘ Robinsonite | Pb4Sb6S13 |
| Sb | ⓘ Semseyite | Pb9Sb8S21 |
| Sb | ⓘ Senarmontite | Sb2O3 |
| Sb | ⓘ Stibiopalladinite | Pd5Sb2 |
| Sb | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Sb | ⓘ Tripuhyite | Fe3+Sb5+O4 |
| Sb | ⓘ Valentinite | Sb2O3 |
| Sb | ⓘ Zinkenite | Pb9Sb22S42 |
| Te | Tellurium | |
| Te | ⓘ Temagamite | Pd3HgTe3 |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| W | Tungsten | |
| W | ⓘ Stolzite | Pb(WO4) |
| Pt | Platinum | |
| Pt | ⓘ Jacutingaite | Pt2HgSe3 |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| Hg | Mercury | |
| Hg | ⓘ Temagamite | Pd3HgTe3 |
| Hg | ⓘ Tiemannite | HgSe |
| Hg | ⓘ Tischendorfite | Pd8Hg3Se9 |
| Hg | ⓘ Jacutingaite | Pt2HgSe3 |
| Hg | ⓘ Tilkerodeite | Pd2HgSe3 |
| Pb | Lead | |
| Pb | ⓘ Andorite | AgPbSb3S6 |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| Pb | ⓘ Betekhtinite | Pb2(Cu,Fe)22-24S15 |
| Pb | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| Pb | ⓘ Bindheimite | Pb2Sb2O6O |
| Pb | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| Pb | ⓘ Boulangerite | Pb5Sb4S11 |
| Pb | ⓘ Bournonite | PbCuSbS3 |
| Pb | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Chloroxiphite | Pb3CuO2Cl2(OH)2 |
| Pb | ⓘ Clausthalite | PbSe |
| Pb | ⓘ Cotunnite | PbCl2 |
| Pb | ⓘ Dadsonite | Pb23Sb25S60Cl |
| Pb | ⓘ Diaphorite | Ag3Pb2Sb3S8 |
| Pb | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| Pb | ⓘ Fülöppite | Pb3Sb8S15 |
| Pb | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| Pb | ⓘ Freieslebenite | AgPbSbS3 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Heteromorphite | Pb7Sb8S19 |
| Pb | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| Pb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Pb | ⓘ Lanarkite | Pb2(SO4)O |
| Pb | ⓘ Native Lead | Pb |
| Pb | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| Pb | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Pb | ⓘ Litharge | PbO |
| Pb | ⓘ Massicot | PbO |
| Pb | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Pb | ⓘ Owyheeite | Ag3Pb10Sb11S28 |
| Pb | ⓘ Paralaurionite | PbCl(OH) |
| Pb | ⓘ Phoenicochroite | Pb2(CrO4)O |
| Pb | ⓘ Plumbonacrite | Pb5O(OH)2(CO3)3 |
| Pb | ⓘ Plagionite | Pb5Sb8S17 |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Pb | ⓘ Robinsonite | Pb4Sb6S13 |
| Pb | ⓘ Schulténite | Pb(HAsO4) |
| Pb | ⓘ Semseyite | Pb9Sb8S21 |
| Pb | ⓘ Stolzite | Pb(WO4) |
| Pb | ⓘ Urvantsevite | Pd(Bi,Pb)2 |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| Pb | ⓘ Zinkenite | Pb9Sb22S42 |
| Pb | ⓘ Heyrovskýite | Pb6Bi2S9 |
| Pb | ⓘ Hydroxylpyromorphite | Pb5(PO4)3(OH) |
| Bi | Bismuth | |
| Bi | ⓘ Native Bismuth | Bi |
| Bi | ⓘ Guanajuatite | Bi2Se3 |
| Bi | ⓘ Urvantsevite | Pd(Bi,Pb)2 |
| Bi | ⓘ Heyrovskýite | Pb6Bi2S9 |
| U | Uranium | |
| U | ⓘ Liebigite | Ca2(UO2)(CO3)3 · 11H2O |
| U | ⓘ Natrozippeite | Na5(UO2)8(SO4)4O5(OH)3 · 12H2O |
| U | ⓘ Uraninite | UO2 |
Fossils
There are 225 fossil localities from the PaleoBioDB database within this region.These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 225 | |||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Youngest Fossil Listed | 2.59 Ma (Pleistocene) | |||||||||||||||
| Oldest Fossil Listed | 260 Ma (Permian) | |||||||||||||||
| Stratigraphic Units |
| |||||||||||||||
| Fossils from Region | Click here to show the list. | |||||||||||||||
| Fossil Localities | Click to show 10 fossil localities |
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Mansfeld-S%C3%BCdharz |
|---|---|
| Wikidata ID: | Q6092 |
| GeoNames ID: | 3302155 |
Localities in this Region
- Saxony-Anhalt
- Mansfeld-Südharz
- ⭔Ahlsdorf
- ⭔Allstedt
- ⭔Arnstein
- ⭔Benndorf
- ⭔Berga
- ⭔Blankenheim
- ⭔Bornstedt
- ⭔Eisleben
- ⭔Gerbstedt
- ⭔Helbra
- ⭔Hergisdorf
- ⭔Hettstedt
- ⭔Kelbra
- ⭔Klostermansfeld
- ⭔Mansfeld
- Mansfeld-Südharz
- Saxony-Anhalt
- Mansfeld-Südharz
Other Regions, Features and Areas that Intersect
Eurasian PlateTectonic Plate
- KupferschieferMining Field
- Rheno-Hercynian BeltOrogenic Belt
EuropeContinent
Germany
- Harz MountainsMountain Range
- Saxony-Anhalt
- Mansfeld-Südharz
- Sangerhausen
- Copper slate depositsGroup of Deposits
- Schlüssel aditAdit
- Sangerhausen
- Mansfeld BasinBasin
- Wippra Metamorphic ZoneMetamorphic belt
- Mansfeld-Südharz
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther RegionsReferences
Mansfeld-Südharz, Saxony-Anhalt, Germany