Warren Mining District, Cochise County, Arizona, USAi
| Regional Level Types | |
|---|---|
| Warren Mining District | Mining District |
| Cochise County | County |
| Arizona | State |
| USA | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
31° North , 109° West (est.)
Estimate based on other nearby localities or region boundaries.
Margin of Error:
~33km
Type:
Köppen climate type:
Other/historical names associated with this locality:
Bisbee Mining District
A Cu-Pb-Zn-Ag-Au-Mn-F (Cd-Bi-Se-Te-As-Sb-U) mining district located in T.22-24S., R.23-25E.
Mineralization is of several types: (1) Base metal oxides, carbonates, and sulfides in large, irregular replacement bodies in tilted and faulted Paleozoic limestone formations that have been invaded by Jurassic granitic porphyry stocks, dikes, and sills; (2) Disseminated copper oxides, carbonates, and sulfides in Jurassic granitic porphyry stock; (3) Manganese oxide pods and lenses along fractures and fault zones in Paleozoic limestones; and (4) Spotty base metal and gold-silver mineralization in quartz veins in Jurassic granitic porphyry stock.
This district, which is famous for its copper mines, minerals and production also produced considerable quantities of lead and zinc. Prior to 1880, lead carbonate ore was mined from the Hendricks claim, about ¼ mile south of Bisbee, and smelted in a primitive furnace at a spring near the present main street of town Some oxidized lead ore from the Hendricks claim was used for flux at Charleston during the early 1880's.
The Copper Queen company granted leases on lead areas in the Uncle Sam mine during 1908, and in the Gardner and Southwest mines during 1910. Subsequently the company carried on successful development of lead ore in the Gardner and Southwest mines.
During 1911-17 notable bodies of oxidized siliceous lead ore were discovered and worked in upper levels of the Shattuck mine.
The first zinc production of the district was in 1917-18; during those years Calumet and Arizona Mining Co. shipped lead-zinc sulfide ore t paint manufacturers in Kansas. Shipment of zinc ore to smelters began in 1922. In 1925 the Shattuck mill, which was built in 1918, was converted entirely to flotation.
In 1927 Phelps Dodge Corp. built a flotation plant of 150 tons daily capacity for treatment of low-grade lead ore, and installed at Douglas a lead smelter of 200 tons daily capacity. Owing to low metal prices and resultant curtailment by custom ore shippers, the concentrator operated for only five months, and the lead smelter closed in April, 1930.
In 1939 the district produced zinc for the first time since 1927. Subsequently zinc-lead ore bodies were mined in the eastern part of the district. Part of the ore was sent to the Shattuck-Denn custom mill a Bisbee, and some to the Eagle-Picher mill at Sahuarita, until November 1945, when Phelps Dodge Corp. completed its zinc-lead concentrator.
The district yielded record amounts of zinc each year during 1944-1947 and 1949, and of lead during 1945-47 and 1949.
Lead and zinc have been found in various places in the western portion of the district as well, but details regarding the occurrences throughout much of this ground are unavailable.
The presence of sphalerite in rather large bodies with pyrite and chalcopyrite in the area between the Southwest and Czar Mines, in the Gardner Mine, and in the Briggs area has been noted. Lead ore has been mined from the Hendricks, Southwest Uncle Sam, Gardner, and Shattuck areas.
Lead carbonate in Hendricks Gulch constituted the first body of ore to be worked n the Warren District. According to Ransome it formed very irregular bunches in the limestone in the vicinity of a fault fissure. Trischka (1938, pp.37) wrote:
The ore is mostly in the Martin (Devonian) limestone and clusters about a siliceous core which crops out as silica breccia and manganese on the surface. This siliceus core which is porous due to leaching, contained most of the lead carbonate ores that were mined from the district. The iron, and possibly some copper were leached out of this silica core, which later collapsed. The lead, altering in place, remained in the silica. In this silica also the gold was both mechanically and chemically concentrated during leaching. Where shelves of contact material occurred between the silica and the limestone, variable thicknesses of silica resting on this contact were minable for gold.
The silica core may have resulted from complete leaching of siliceous pyrite which is commonly associated with orebodies all parts of the district. The oxidation slumping above the orebody as well as around its sides suggests this possibility.
Workings include shafts, tunnels and open pit workings. More than 150 million tons of base metal ore, and approximately 35,000 tons of manganese ore were mined sine the late 1870's. This production has yielded some 3.8 million tons of copper, 154.9 thousand tons of lead, 189 thousand tons of zinc, over 2.6 million ounces of gold and 100.3 million ounces of silver.
Mineralization is of several types: (1) Base metal oxides, carbonates, and sulfides in large, irregular replacement bodies in tilted and faulted Paleozoic limestone formations that have been invaded by Jurassic granitic porphyry stocks, dikes, and sills; (2) Disseminated copper oxides, carbonates, and sulfides in Jurassic granitic porphyry stock; (3) Manganese oxide pods and lenses along fractures and fault zones in Paleozoic limestones; and (4) Spotty base metal and gold-silver mineralization in quartz veins in Jurassic granitic porphyry stock.
This district, which is famous for its copper mines, minerals and production also produced considerable quantities of lead and zinc. Prior to 1880, lead carbonate ore was mined from the Hendricks claim, about ¼ mile south of Bisbee, and smelted in a primitive furnace at a spring near the present main street of town Some oxidized lead ore from the Hendricks claim was used for flux at Charleston during the early 1880's.
The Copper Queen company granted leases on lead areas in the Uncle Sam mine during 1908, and in the Gardner and Southwest mines during 1910. Subsequently the company carried on successful development of lead ore in the Gardner and Southwest mines.
During 1911-17 notable bodies of oxidized siliceous lead ore were discovered and worked in upper levels of the Shattuck mine.
The first zinc production of the district was in 1917-18; during those years Calumet and Arizona Mining Co. shipped lead-zinc sulfide ore t paint manufacturers in Kansas. Shipment of zinc ore to smelters began in 1922. In 1925 the Shattuck mill, which was built in 1918, was converted entirely to flotation.
In 1927 Phelps Dodge Corp. built a flotation plant of 150 tons daily capacity for treatment of low-grade lead ore, and installed at Douglas a lead smelter of 200 tons daily capacity. Owing to low metal prices and resultant curtailment by custom ore shippers, the concentrator operated for only five months, and the lead smelter closed in April, 1930.
In 1939 the district produced zinc for the first time since 1927. Subsequently zinc-lead ore bodies were mined in the eastern part of the district. Part of the ore was sent to the Shattuck-Denn custom mill a Bisbee, and some to the Eagle-Picher mill at Sahuarita, until November 1945, when Phelps Dodge Corp. completed its zinc-lead concentrator.
The district yielded record amounts of zinc each year during 1944-1947 and 1949, and of lead during 1945-47 and 1949.
Lead and zinc have been found in various places in the western portion of the district as well, but details regarding the occurrences throughout much of this ground are unavailable.
The presence of sphalerite in rather large bodies with pyrite and chalcopyrite in the area between the Southwest and Czar Mines, in the Gardner Mine, and in the Briggs area has been noted. Lead ore has been mined from the Hendricks, Southwest Uncle Sam, Gardner, and Shattuck areas.
Lead carbonate in Hendricks Gulch constituted the first body of ore to be worked n the Warren District. According to Ransome it formed very irregular bunches in the limestone in the vicinity of a fault fissure. Trischka (1938, pp.37) wrote:
The ore is mostly in the Martin (Devonian) limestone and clusters about a siliceous core which crops out as silica breccia and manganese on the surface. This siliceus core which is porous due to leaching, contained most of the lead carbonate ores that were mined from the district. The iron, and possibly some copper were leached out of this silica core, which later collapsed. The lead, altering in place, remained in the silica. In this silica also the gold was both mechanically and chemically concentrated during leaching. Where shelves of contact material occurred between the silica and the limestone, variable thicknesses of silica resting on this contact were minable for gold.
The silica core may have resulted from complete leaching of siliceous pyrite which is commonly associated with orebodies all parts of the district. The oxidation slumping above the orebody as well as around its sides suggests this possibility.
Workings include shafts, tunnels and open pit workings. More than 150 million tons of base metal ore, and approximately 35,000 tons of manganese ore were mined sine the late 1870's. This production has yielded some 3.8 million tons of copper, 154.9 thousand tons of lead, 189 thousand tons of zinc, over 2.6 million ounces of gold and 100.3 million ounces of silver.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities298 valid minerals. 7 (TL) - type locality of valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Acanthite Formula: Ag2S |
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 Locality: Bisbee, Cochise County, Arizona, USA References: |
| ⓘ Aikinite Formula: PbCuBiS3 |
| ⓘ Alabandite Formula: MnS |
| ⓘ 'Allanite Group' Formula: (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Allophane Formula: (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| ⓘ Altaite Formula: PbTe |
| ⓘ Alunite Formula: KAl3(SO4)2(OH)6 |
| ⓘ Anatase Formula: TiO2 Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Andradite Formula: Ca3Fe3+2(SiO4)3 Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Anglesite Formula: PbSO4 Localities: Reported from at least 20 localities in this region. |
| ⓘ Anhydrite Formula: CaSO4 Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Anorthite Formula: Ca(Al2Si2O8) Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Anorthite var. Labradorite Formula: (Ca,Na)[Al(Al,Si)Si2O8] Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Anthonyite Formula: Cu(OH,Cl)2 · 3H2O Habit: Corroded crystals to 5mm or more Colour: Vivid violet Description: Occurs on the 1300 level. |
| ⓘ Antigorite Formula: Mg3(Si2O5)(OH)4 |
| ⓘ Antlerite Formula: Cu3(SO4)(OH)4 Localities: Reported from at least 6 localities in this region. |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Aragonite Formula: CaCO3 |
| ⓘ Aragonite var. Flos Ferri Formula: CaCO3 Localities: Description: Magnificent coralloidal groups of flos ferri in limestone caverns. |
| ⓘ Atacamite Formula: Cu2(OH)3Cl |
| ⓘ Aurichalcite Formula: (Zn,Cu)5(CO3)2(OH)6 Localities: Reported from at least 7 localities in this region. |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 Localities: Reported from at least 15 localities in this region. |
| ⓘ Barlowite Formula: Cu4BrF(OH)6 |
| ⓘ Baryte Formula: BaSO4 Localities: Reported from at least 12 localities in this region. |
| ⓘ Bayldonite Formula: PbCu3(AsO4)2(OH)2 |
| ⓘ Bayleyite Formula: Mg2(UO2)(CO3)3 · 18H2O |
| ⓘ Beaverite-(Cu) Formula: Pb(Fe3+2Cu)(SO4)2(OH)6 |
| ⓘ Beraunite Formula: Fe3+6(PO4)4O(OH)4 · 6H2O |
| ⓘ Beudantite Formula: PbFe3+3(AsO4)(SO4)(OH)6 |
| ⓘ Bílinite Formula: Fe2+Fe3+2(SO4)4 · 22H2O |
| ⓘ Bianchite Formula: Zn(SO4) · 6H2O Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ 'Bindheimite' Formula: Pb2Sb2O6O |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ 'Bisbeeite' Formula: (Cu,Mg)SiO3 · nH2O Colour: Blue Description: Occurs as pseudomorphs after shattuckite, which, in turn, is pseudomorphous after malachite. |
| ⓘ Bismite Formula: Bi2O3 |
| ⓘ Bismuthinite Formula: Bi2S3 |
| ⓘ Bismutite Formula: (BiO)2CO3 |
| ⓘ Bixbyite-(Mn) Formula: Mn3+2O3 |
| ⓘ Bogdanovite Formula: (Au,Te,Pb)3(Cu,Fe) |
| ⓘ Boothite Formula: CuSO4 · 7H2O Habit: As cm-wide clusters of radiating acicular crystals Colour: Light blue Description: Also as small granular masses composed of 1 to 2 mm crystals. |
| ⓘ Bornite Formula: Cu5FeS4 Localities: Reported from at least 35 localities in this region. |
| ⓘ Botallackite Formula: Cu2(OH)3Cl |
| ⓘ Botryogen Formula: MgFe3+(SO4)2(OH) · 7H2O |
| ⓘ Böhmite Formula: AlO(OH) Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Braunite Formula: Mn2+Mn3+6(SiO4)O8 Localities: Reported from at least 6 localities in this region. |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 Localities: Reported from at least 12 localities in this region. |
| ⓘ Bromargyrite Formula: AgBr |
| ⓘ Brookite Formula: TiO2 Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Brucite Formula: Mg(OH)2 |
| ⓘ Buttgenbachite Formula: Cu19(NO3)2(OH)32Cl4 · 2H2O |
| ⓘ Calaverite Formula: AuTe2 |
| ⓘ Calcite Formula: CaCO3 Localities: Reported from at least 25 localities in this region. |
| ⓘ Calcite var. Manganese-bearing Calcite Formula: (Ca,Mn)CO3 |
| ⓘ 'Campbellite' References: |
| ⓘ Canfieldite Formula: Ag8SnS6 |
| ⓘ Carbonatecyanotrichite Formula: Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| ⓘ Cassiterite Formula: SnO2 |
| ⓘ Celadonite Formula: K(MgFe3+◻)(Si4O10)(OH)2 Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Cerussite Formula: PbCO3 Localities: Reported from at least 8 localities in this region. |
| ⓘ Cesàrolite Formula: PbMn4+3O6(OH)2 |
| ⓘ Chalcanthite Formula: CuSO4 · 5H2O Localities: Description: Stalactites & fibrous crusts in old mine workings. |
| ⓘ Chalcoalumite (TL) Formula: CuAl4(SO4)(OH)12 · 3H2O Localities: Reported from at least 6 localities in this region. |
| ⓘ Chalcocite Formula: Cu2S Localities: Reported from at least 35 localities in this region. |
| ⓘ Chalcophanite Formula: ZnMn4+3O7 · 3H2O |
| ⓘ Chalcophyllite Formula: Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 31 localities in this region. |
| ⓘ Chalcosiderite Formula: CuFe3+6(PO4)4(OH)8 · 4H2O Localities: Description: In small quantities. |
| ⓘ Chalcostibite Formula: CuSbS2 |
| ⓘ Chamosite Formula: (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| ⓘ Chlorargyrite Formula: AgCl |
| ⓘ Chlorargyrite var. Bromian Chlorargyrite Formula: Ag(Cl,Br) Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ 'Chlorite Group' Localities: Habit: Isolated radial sprays; prisms to 1 cm long Description: Occurs cutting an equigranular tonalite. |
| ⓘ Chromite Formula: Fe2+Cr3+2O4 Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 Localities: Reported from at least 11 localities in this region. |
| ⓘ Chrysotile Formula: Mg3(Si2O5)(OH)4 Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Cinnabar Formula: HgS Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Claringbullite Formula: Cu4ClF(OH)6 |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ 'Clinochrysotile' Formula: Mg3(Si2O5)(OH)4 Localities: Description: Scaly, micaceous intergrowths with stevensite. |
| ⓘ Clinozoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ Colusite Formula: Cu13VAs3S16 |
| ⓘ Conichalcite Formula: CaCu(AsO4)(OH) Localities: Reported from at least 6 localities in this region. |
| ⓘ Connellite Formula: Cu19(SO4)(OH)32Cl4 · 3H2O Localities: Reported from at least 9 localities in this region. |
| ⓘ Copiapite Formula: Fe2+Fe3+4(SO4)6(OH)2 · 20H2O Localities: Campbell Mine, Bisbee, Cochise County, Arizona, USA Southwest Mine, Hendricks Gulch, Bisbee, Cochise County, Arizona, USA Copper Queen Mine, Queen Hill, Bisbee, Cochise County, Arizona, USA Junction Mine, Calumet and Arizona group of claims, Bisbee, Cochise County, Arizona, USA Tunnel level, Higgins Mine, Bisbee, Cochise County, Arizona, USA Habit: Crystals Colour: Bright yellow. Description: On the 2,100 foot level. |
| ⓘ Coquimbite Formula: AlFe3(SO4)6(H2O)12 · 6H2O |
| ⓘ Coronadite Formula: Pb(Mn4+6Mn3+2)O16 |
| ⓘ Cosalite Formula: Pb2Bi2S5 |
| ⓘ Covellite Formula: CuS Localities: Reported from at least 7 localities in this region. |
| ⓘ Crednerite Formula: Cu+Mn3+O2 |
| ⓘ Cryptomelane Formula: K(Mn4+7Mn3+)O16 |
| ⓘ Cuprite Formula: Cu2O Localities: Reported from at least 18 localities in this region. |
| ⓘ Cuprite var. Chalcotrichite Formula: Cu2O |
| ⓘ Cuprocopiapite Formula: Cu2+Fe3+4(SO4)6(OH)2 · 20H2O Description: Occurs on the 1800 level as a post-mining mineral. |
| ⓘ Cupropavonite Formula: Cu0.9Ag0.5Pb0.6Bi2.5S5 |
| ⓘ Cyanotrichite Formula: Cu4Al2(SO4)(OH)12 · 2H2O |
| ⓘ Delafossite Formula: Cu+Fe3+O2 Localities: Reported from at least 6 localities in this region. |
| ⓘ 'Delessite' Formula: (Mg,Fe,Fe,Al)(Si,Al)4O10(O,OH)8 Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Descloizite Formula: PbZn(VO4)(OH) |
| ⓘ Descloizite var. Copper-bearing Descloizite Formula: Pb(Zn,Cu)VO4OH Localities: Description: Small stalactites several cm long to about 8 mm across at the bases. |
| ⓘ Devilline Formula: CaCu4(SO4)2(OH)6 · 3H2O |
| ⓘ Diaspore Formula: AlO(OH) |
| ⓘ Dickite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Digenite Formula: Cu9S5 |
| ⓘ Diopside Formula: CaMgSi2O6 Localities: Description: Grains in unoxidized pyritic ores. |
| ⓘ Dioptase Formula: CuSiO3 · H2O |
| ⓘ Djurleite Formula: Cu31S16 |
| ⓘ Dolomite Formula: CaMg(CO3)2 |
| ⓘ Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Dyscrasite Formula: Ag3Sb Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Eddavidite (TL) Formula: Cu12Pb2O15Br2 Localities: |
| ⓘ Edenite Formula: NaCa2Mg5(Si7Al)O22(OH)2 |
| ⓘ Emplectite Formula: CuBiS2 |
| ⓘ Enargite Formula: Cu3AsS4 |
| ⓘ Enstatite Formula: Mg2Si2O6 Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ Epsomite Formula: MgSO4 · 7H2O |
| ⓘ Eugenite Formula: Ag11Hg2 |
| ⓘ Famatinite Formula: Cu3SbS4 |
| ⓘ 'Fayalite-Forsterite Series' |
| ⓘ Felsőbányaite Formula: Al4(SO4)(OH)10 · 4H2O Localities: Colour: White Description: Earthy masses with other aluminum sulphates encrusting silicified limestones and as micro-crystals. |
| ⓘ Ferricopiapite Formula: Fe3+0.67Fe3+4(SO4)6(OH)2 · 20H2O |
| ⓘ Ferrimolybdite Formula: Fe2(MoO4)3 · nH2O |
| ⓘ Fibroferrite Formula: Fe3+(SO4)(OH) · 5H2O |
| ⓘ Fluorite Formula: CaF2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Fornacite Formula: Pb2Cu(CrO4)(AsO4)(OH) |
| ⓘ 'Freibergite Subgroup' Formula: (Ag6,[Ag6]4+)(Cu4 C2+2)Sb4S12S0-1 |
| ⓘ Furutobeite Formula: (Cu,Ag)6PbS4 |
| ⓘ Galena Formula: PbS Localities: Reported from at least 12 localities in this region. |
| ⓘ Galena var. Silver-bearing Galena Formula: PbS with Ag References: |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 |
| ⓘ Gibbsite Formula: Al(OH)3 Localities: Description: Impure material with chalcoalumite & malachite. |
| ⓘ Goethite Formula: Fe3+O(OH) Localities: Reported from at least 12 localities in this region. |
| ⓘ Goldfieldite Formula: (Cu4◻2)(Cu4Cu+2)Te4S12S |
| ⓘ Gormanite Formula: (Fe2+,Mg)3(Al,Fe3+)4(PO4)4(OH)6 · 2H2O Locality: Bisbee, Cochise County, Arizona, USA Habit: Rosette aggregates Colour: Dark green Description: In drill core as rosettes in open fractures. References: |
| ⓘ Goslarite Formula: ZnSO4 · 7H2O Description: Post-mining mineral, locally abundant. |
| ⓘ Graemite (TL) Formula: Cu[TeO3] · H2O Localities: Type Locality: Cole Mine, Bisbee, Cochise County, Arizona, USA Description: Occurs on the 1200 level on and replacing teineite embedded in malachite. |
| ⓘ Graphite Formula: C |
| ⓘ Greenockite Formula: CdS |
| ⓘ Grossular Formula: Ca3Al2(SiO4)3 Localities: Habit: Rounded Description: Rounded crystals in unoxidized pyritic ores. |
| ⓘ Groutite Formula: Mn3+O(OH) Habit: Tiny Colour: Dark brownish-black Description: Coats sooty manganese oxides. |
| ⓘ Gunningite Formula: ZnSO4 · H2O Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Gypsum Formula: CaSO4 · 2H2O Localities: Reported from at least 8 localities in this region. |
| ⓘ Gypsum var. Selenite Formula: CaSO4 · 2H2O |
| ⓘ Halloysite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Halotrichite Formula: FeAl2(SO4)4 · 22H2O |
| ⓘ Hausmannite Formula: Mn2+Mn3+2O4 |
| ⓘ Hematite Formula: Fe2O3 Localities: Reported from at least 13 localities in this region. |
| ⓘ Hematite var. Specularite Formula: Fe2O3 |
| ⓘ Hemimorphite Formula: Zn4Si2O7(OH)2 · H2O |
| ⓘ Henryite (TL) Formula: (Cu,Ag)3+xTe2 , with x ~ 0.40 Type Locality: Campbell Mine, Bisbee, Cochise County, Arizona, USA Description: Very sparingly in sulfide ores. |
| ⓘ Hessite Formula: Ag2Te |
| ⓘ Hetaerolite Formula: ZnMn2O4 |
| ⓘ Hetaerolite var. Hydrohetaerolite Formula: Zn(Mn,◻)2(O,OH)4 |
| ⓘ Hexahydrite Formula: MgSO4 · 6H2O |
| ⓘ Hisingerite Formula: Fe3+2(Si2O5)(OH)4 · 2H2O Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Hocartite Formula: Ag2(Fe2+,Zn)SnS4 |
| ⓘ Hodrušite Formula: Cu8Bi12S22 |
| ⓘ Hoganite Formula: Cu(CH3COO)2 · H2O |
| ⓘ Hübnerite Formula: MnWO4 |
| ⓘ Hydrobasaluminite Formula: Al4(SO4)(OH)10 · 12-36H2O |
| ⓘ Hydrobiotite Formula: K(Mg,Fe2+)6((Si,Al)8O20)(OH)4 · nH2O Description: Alt. product assoc. with intrusion of quartz monzonite. |
| ⓘ Hydrocerussite Formula: Pb3(CO3)2(OH)2 |
| ⓘ Hydrohalloysite Formula: Al2Si2O5(OH)4 · 2H2O Description: A product of hydrothermal alteration. |
| ⓘ Hydrokenoralstonite Formula: Na0.5(Al,Mg)2(F,OH)6 · H2O |
| ⓘ 'Hydromuscovite' |
| ⓘ Hydrozincite Formula: Zn5(CO3)2(OH)6 Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Ilsemannite Formula: Mo3O8 · nH2O |
| ⓘ Iodargyrite Formula: AgI |
| ⓘ 'Iridescent coating' Locality: Bisbee, Cochise County, Arizona, USA References: |
| ⓘ Jacobsite Formula: Mn2+Fe3+2O4 Description: Occurs as 5 mm blebs in cryptomelane. |
| ⓘ Jalpaite Formula: Ag3CuS2 |
| ⓘ Jarosite Formula: KFe3+3(SO4)2(OH)6 |
| ⓘ Johannite Formula: Cu(UO2)2(SO4)2(OH)2 · 8H2O Description: Occurs as a post-mining efflorescence. |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 Localities: Reported from at least 6 localities in this region. |
| ⓘ Kettnerite Formula: CaBiCO3OF |
| ⓘ Kësterite Formula: Cu2ZnSnS4 |
| ⓘ Kiddcreekite (TL) Formula: Cu6SnWS8 Localities: Type Locality: Campbell Mine, Bisbee, Cochise County, Arizona, USA Description: Occurs as minute grains in sulfide orebodies. |
| ⓘ Kornelite Formula: Fe2(SO4)3 · 7H2O |
| ⓘ Kostovite Formula: CuAuTe4 |
| ⓘ Krennerite Formula: Au3AgTe8 |
| ⓘ Krupkaite Formula: PbCuBi3S6 |
| ⓘ Ktenasite Formula: ZnCu4(SO4)2(OH)6 · 6H2O |
| ⓘ Kuramite Formula: Cu3SnS4 |
| ⓘ Langite Formula: Cu4(SO4)(OH)6 · 2H2O |
| ⓘ Laumontite Formula: CaAl2Si4O12 · 4H2O |
| ⓘ Leadhillite Formula: Pb4(CO3)2(SO4)(OH)2 |
| ⓘ Lepidocrocite Formula: Fe3+O(OH) |
| ⓘ Lime Formula: CaO Description: [NOT A NATURAL MINERAL; Created when limestone in a shaft wall was calcined in an underground fire.] |
| ⓘ 'Limonite' Localities: Reported from at least 25 localities in this region. |
| ⓘ Linarite Formula: PbCu(SO4)(OH)2 |
| ⓘ Liroconite Formula: Cu2Al(AsO4)(OH)4 · 4H2O |
| ⓘ Luzonite Formula: Cu3AsS4 |
| ⓘ Magnesite Formula: MgCO3 |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 Localities: Reported from at least 22 localities in this region. Habit: Botryoidal/mammillary masses. |
| ⓘ 'Manganese Oxides' |
| ⓘ 'Manganese Oxides var. Manganese Dendrites' References: |
| ⓘ Manganite Formula: Mn3+O(OH) Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Marcasite Formula: FeS2 Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Matildite Formula: AgBiS2 |
| ⓘ Mawsonite Formula: Cu6Fe2SnS8 |
| ⓘ Meionite Formula: Ca4Al6Si6O24CO3 Description: Occurs on the 500 level in Abrigo Limestone. |
| ⓘ Melanterite Formula: Fe2+(H2O)6SO4 · H2O |
| ⓘ Melonite Formula: NiTe2 |
| ⓘ Metatorbernite Formula: Cu(UO2)2(PO4)2 · 8H2O References: |
| ⓘ Metavoltine Formula: K2Na6Fe2+Fe3+6O2(SO4)12 · 18H2O |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ Miersite Formula: (Ag,Cu)I |
| ⓘ Mimetite Formula: Pb5(AsO4)3Cl |
| ⓘ Minium Formula: Pb3O4 Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Molybdenite Formula: MoS2 |
| ⓘ Mottramite Formula: PbCu(VO4)(OH) |
| ⓘ Murdochite Formula: Cu12Pb2O15Cl2 |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 8 localities in this region. |
| ⓘ Muscovite var. Illite Formula: K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Nantokite Formula: CuCl Localities: Description: Clear, paraffin-like masses impregnating the cores of vuggy cuprite nodules. |
| ⓘ Native Arsenic Formula: As Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Native Bismuth Formula: Bi |
| ⓘ Native Copper Formula: Cu Localities: Reported from at least 20 localities in this region. |
| ⓘ Native Gold Formula: Au Localities: Reported from at least 12 localities in this region. |
| ⓘ Native Gold var. Electrum Formula: (Au,Ag) |
| ⓘ Native Silver Formula: Ag Localities: Reported from at least 7 localities in this region. |
| ⓘ Native Sulphur Formula: S8 |
| ⓘ Native Tellurium Formula: Te |
| ⓘ Natrolite Formula: Na2Al2Si3O10 · 2H2O Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Nekrasovite Formula: Cu26V2(Sn,As,Sb)6S32 |
| ⓘ Neltnerite Formula: CaMn3+6(SiO4)O8 |
| ⓘ Nolanite Formula: V3+8Fe3+2O14(OH)2 References: |
| ⓘ Opal Formula: SiO2 · nH2O Locality: Bisbee, Cochise County, Arizona, USA References: |
| ⓘ Opal var. Opal-AN Formula: SiO2 · nH2O Locality: Bisbee, Cochise County, Arizona, USA References: |
| ⓘ Orthoclase Formula: K(AlSi3O8) Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Osarizawaite Formula: Pb(Al2Cu2+)(SO4)2(OH)6 |
| ⓘ Paracoquimbite Formula: Fe4(SO4)6(H2O)12 · 6H2O Localities: Colour: Bright pale violet |
| ⓘ Paramelaconite (TL) Formula: Cu1+2Cu2+2O3 Localities: Habit: Unusually large crystals with forms: {001}, {101}, & {100}. Description: Occurs in a matrix of goethite. |
| ⓘ Paratacamite Formula: Cu3(Cu,Zn)(OH)6Cl2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Paratellurite Formula: TeO2 |
| ⓘ Pearceite Formula: [Ag6As2S7][Ag9CuS4] |
| ⓘ Petzite Formula: Ag3AuTe2 |
| ⓘ Pharmacosiderite Formula: KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| ⓘ Pickeringite Formula: MgAl2(SO4)4 · 22H2O |
| ⓘ Plancheite Formula: Cu8(Si8O22)(OH)4 · H2O Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Plattnerite Formula: PbO2 |
| ⓘ Plumbojarosite Formula: Pb0.5Fe3+3(SO4)2(OH)6 Localities: Description: Abundant in lead ores adjacent to quartz breccia. |
| ⓘ Polybasite Formula: [Ag6Sb2S7][Ag9CuS4] Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Powellite Formula: Ca(MoO4) |
| ⓘ Prehnite Formula: Ca2Al2Si3O10(OH)2 |
| ⓘ Pseudomalachite Formula: Cu5(PO4)2(OH)4 Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ 'Psilomelane' Localities: Reported from at least 25 localities in this region. |
| ⓘ 'Pumpellyite Subgroup' Formula: Ca2XAl2[Si2O6(OH)][SiO4](OH)2A Description: Reported. |
| ⓘ Pyrargyrite Formula: Ag3SbS3 Locality: Bisbee, Cochise County, Arizona, USA References: |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 42 localities in this region. |
| ⓘ Pyrite var. Gold-bearing Pyrite Formula: FeS2 References: |
| ⓘ Pyrolusite Formula: Mn4+O2 |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl |
| ⓘ Pyrope Formula: Mg3Al2(SiO4)3 Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Pyrophyllite Formula: Al2Si4O10(OH)2 |
| ⓘ Pyrrhotite Formula: Fe1-xS |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 14 localities in this region. |
| ⓘ Quartz var. Agate Formula: SiO2 References: Rolf LuetckeIdentified by Rolf Luetcke: Visual Identification |
| ⓘ Quartz var. Amethyst Formula: SiO2 |
| ⓘ Quartz var. Chalcedony Formula: SiO2 |
| ⓘ Rammelsbergite Formula: NiAs2 |
| ⓘ Ransomite Formula: CuFe2(SO4)4 · 6H2O |
| ⓘ Rhodochrosite Formula: MnCO3 |
| ⓘ Rhodostannite Formula: Cu1+(Fe2+0.5Sn4+1.5)S4 |
| ⓘ Rhomboclase Formula: (H5O2)Fe3+(SO4)2 · 2H2O Localities: Bisbee, Cochise County, Arizona, USA Campbell Mine, Bisbee, Cochise County, Arizona, USA Czar Mine, Copper Queen Mine, Queen Hill, Bisbee, Cochise County, Arizona, USA Copper Queen Mine, Queen Hill, Bisbee, Cochise County, Arizona, USA Junction Mine, Calumet and Arizona group of claims, Bisbee, Cochise County, Arizona, USA |
| ⓘ Rickardite Formula: Cu7Te5 |
| ⓘ Roquesite Formula: CuInS2 |
| ⓘ Rosasite Formula: (Cu,Zn)2(CO3)(OH)2 |
| ⓘ Roscoelite Formula: KV3+2(AlSi3O10)(OH)2 |
| ⓘ Römerite Formula: Fe2+Fe3+2(SO4)4 · 14H2O |
| ⓘ Rozenite Formula: FeSO4 · 4H2O |
| ⓘ Rucklidgeite Formula: PbBi2Te4 |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Sanidine Formula: K(AlSi3O8) Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ 'Scapolite' Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ 'Scapolite var. Wernerite' Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Scheelite Formula: Ca(WO4) Localities: Description: Indefinite location SE of town (wolframite) |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Habit: Nests of small, prismatic crystals. Description: Occurs in muscovite. |
| ⓘ Scorzalite Formula: Fe2+Al2(PO4)2(OH)2 |
| ⓘ Sengierite Formula: Cu2(UO2)2(VO4)2 · 6H2O Description: Initially occurred in one isolated pocket, later more widespread; associated with malachite & disseminated in chalcocite. References: |
| ⓘ Sepiolite Formula: Mg4(Si6O15)(OH)2 · 6H2O Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ 'Serpentine Subgroup' Formula: D3[Si2O5](OH)4 |
| ⓘ Shattuckite (TL) Formula: Cu5(Si2O6)2(OH)2 Localities: Type Locality: Shattuck Mine, Bisbee, Cochise County, Arizona, USA Colour: Blue Description: Occurs as pseudomorphs after malachite & as small spherules. |
| ⓘ Siderite Formula: FeCO3 Localities: Reported from at least 7 localities in this region. |
| ⓘ Siderotil Formula: FeSO4 · 5H2O |
| ⓘ 'Silica' |
| ⓘ Smithsonite Formula: ZnCO3 |
| ⓘ Spangolite Formula: Cu6Al(SO4)(OH)12Cl · 3H2O Localities: |
| ⓘ Spertiniite Formula: Cu(OH)2 Locality: Bisbee, Cochise County, Arizona, USA Habit: Scaly structure Colour: Pale blue-green Description: Sparse incrustations with internal scaly structure on matrix of crystalline atacamite. References: |
| ⓘ Spessartine Formula: Mn2+3Al2(SiO4)3 |
| ⓘ Sphalerite Formula: ZnS Localities: Reported from at least 11 localities in this region. |
| ⓘ Spionkopite Formula: Cu39S28 |
| ⓘ Stannite Formula: Cu2FeSnS4 |
| ⓘ Stannoidite Formula: Cu+6Cu2+2(Fe2+,Zn)3Sn2S12 |
| ⓘ Stevensite Formula: (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| ⓘ Stibiconite Formula: Sb3+Sb5+2O6(OH) |
| ⓘ Stolzite Formula: Pb(WO4) |
| ⓘ Stromeyerite Formula: AgCuS |
| ⓘ Stützite Formula: Ag5-xTe3, x = 0.24-0.36 |
| ⓘ Susannite Formula: Pb4(CO3)2(SO4)(OH)2 Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Sylvanite Formula: AgAuTe4 |
| ⓘ Szomolnokite Formula: FeSO4 · H2O |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Teineite Formula: Cu2+(Te4+O3) · 2H2O |
| ⓘ Tellurite Formula: TeO2 |
| ⓘ Tellurobismuthite Formula: Bi2Te3 |
| ⓘ 'Tennantite Subgroup' Formula: Cu6(Cu4C2+2)As4S12S |
| ⓘ Tenorite Formula: CuO Localities: Reported from at least 9 localities in this region. |
| ⓘ Tenorite var. Geltenorite Formula: CuO Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Tetradymite Formula: Bi2Te2S |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S |
| ⓘ Thomsonite-Ca Formula: NaCa2[Al5Si5O20] · 6H2O |
| ⓘ Tilasite Formula: CaMg(AsO4)F |
| ⓘ Titanite Formula: CaTi(SiO4)O |
| ⓘ Tolbachite Formula: CuCl2 |
| ⓘ Torbernite Formula: Cu(UO2)2(PO4)2 · 12H2O |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z Localities: Description: Occurs with zircon in Pinal Schist. |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 Localities: Description: Most abundant metamorphic gangue of unoxidized pyritic ores. |
| ⓘ Tungstenite Formula: WS2 Locality: Bisbee, Cochise County, Arizona, USA References: |
| ⓘ Turquoise Formula: CuAl6(PO4)4(OH)8 · 4H2O |
| ⓘ Tyuyamunite Formula: Ca(UO2)2(VO4)2 · 5-8H2O |
| ⓘ Uraninite Formula: UO2 |
| ⓘ Uranopilite Formula: (UO2)6(SO4)O2(OH)6 · 14H2O Description: Occurs as a post-mining efflorescence. |
| ⓘ Vanadinite Formula: Pb5(VO4)3Cl Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Variscite Formula: AlPO4 · 2H2O |
| ⓘ Variscite var. Ferrian Variscite Formula: (Al,Fe)PO4 · 2H2O Colour: Pale green Description: As unusual pale green, massive ferrian material. |
| ⓘ Velikite Formula: Cu2HgSnS4 |
| ⓘ Vesuvianite Formula: Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 Locality: Bisbee, Cochise County, Arizona, USA References: |
| ⓘ Volkonskoite Formula: Ca0.3(Cr,Mg,Fe)2((Si,Al)4O10)(OH)2 · 4H2O |
| ⓘ Voltaite Formula: K2Fe2+5Fe3+3Al(SO4)12 · 18H2O |
| ⓘ Volynskite Formula: AgBiTe2 |
| ⓘ 'Wad' |
| ⓘ Willemite Formula: Zn2SiO4 |
| ⓘ Wittichenite Formula: Cu3BiS3 |
| ⓘ Wittichenite var. Silver-bearing Wittichenite Formula: (Cu,Ag)3BiS3 References: |
| ⓘ 'Wolframite Group' |
| ⓘ Wollastonite Formula: Ca3(Si3O9) |
| ⓘ Wulfenite Formula: Pb(MoO4) |
| ⓘ Yarrowite Formula: Cu9S8 |
| ⓘ Zincobotryogen Formula: (Zn,Mg,Mn2+)Fe3+(SO4)2(OH) · 7H2O |
| ⓘ Zincocopiapite Formula: ZnFe3+4(SO4)6(OH)2 · 18H2O Description: Occurs as a post-mining product. |
| ⓘ Zippeite Formula: K3(UO2)4(SO4)2O3(OH) · 3H2O Description: Occurs as a post-mining efflorescence. |
| ⓘ Zircon Formula: Zr(SiO4) Localities: Description: Occurs with tourmaline in Pinal Schist. |
| ⓘ Zoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Native Gold var. Electrum | 1.AA.05 | (Au,Ag) |
| ⓘ | 1.AA.05 | Au | |
| ⓘ | Native Silver | 1.AA.05 | Ag |
| ⓘ | Eugenite | 1.AD.15c | Ag11Hg2 |
| ⓘ | Native Arsenic | 1.CA.05 | As |
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| ⓘ | Graphite | 1.CB.05a | C |
| ⓘ | Native Sulphur | 1.CC.05 | S8 |
| ⓘ | Native Tellurium | 1.CC.10 | Te |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Dyscrasite | 2.AA.35 | Ag3Sb |
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Djurleite | 2.BA.05 | Cu31S16 |
| ⓘ | Digenite | 2.BA.10 | Cu9S5 |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Rickardite | 2.BA.30 | Cu7Te5 |
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Stromeyerite | 2.BA.40 | AgCuS |
| ⓘ | Jalpaite | 2.BA.45 | Ag3CuS2 |
| ⓘ | Hessite | 2.BA.60 | Ag2Te |
| ⓘ | Henryite (TL) | 2.BA.65 | (Cu,Ag)3+xTe2 , with x ~ 0.40 |
| ⓘ | Stützite | 2.BA.65 | Ag5-xTe3, x = 0.24-0.36 |
| ⓘ | Canfieldite | 2.BA.70 | Ag8SnS6 |
| ⓘ | Petzite | 2.BA.75 | Ag3AuTe2 |
| ⓘ | Bogdanovite | 2.BA.80 | (Au,Te,Pb)3(Cu,Fe) |
| ⓘ | Furutobeite | 2.BE.10 | (Cu,Ag)6PbS4 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Spionkopite | 2.CA.05c | Cu39S28 |
| ⓘ | Yarrowite | 2.CA.05d | Cu9S8 |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Roquesite | 2.CB.10a | CuInS2 |
| ⓘ | Hocartite | 2.CB.15a | Ag2(Fe2+,Zn)SnS4 |
| ⓘ | Kësterite | 2.CB.15a | Cu2ZnSnS4 |
| ⓘ | Kuramite | 2.CB.15a | Cu3SnS4 |
| ⓘ | Stannite | 2.CB.15a | Cu2FeSnS4 |
| ⓘ | Velikite | 2.CB.15a | Cu2HgSnS4 |
| ⓘ | Stannoidite | 2.CB.15c | Cu+6Cu2+2(Fe2+,Zn)3Sn2S12 |
| ⓘ | Mawsonite | 2.CB.20 | Cu6Fe2SnS8 |
| ⓘ | Colusite | 2.CB.30 | Cu13VAs3S16 |
| ⓘ | Nekrasovite | 2.CB.30 | Cu26V2(Sn,As,Sb)6S32 |
| ⓘ | Kiddcreekite (TL) | 2.CB.35a | Cu6SnWS8 |
| ⓘ | Greenockite | 2.CB.45 | CdS |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Alabandite | 2.CD.10 | MnS |
| ⓘ | Altaite | 2.CD.10 | PbTe |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | var. Silver-bearing Galena | 2.CD.10 | PbS with Ag |
| ⓘ | Cinnabar | 2.CD.15a | HgS |
| ⓘ | Rhodostannite | 2.DA.10 | Cu1+(Fe2+0.5Sn4+1.5)S4 |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Tellurobismuthite | 2.DC.05 | Bi2Te3 |
| ⓘ | Tetradymite | 2.DC.05 | Bi2Te2S |
| ⓘ | Sylvanite | 2.EA.05 | AgAuTe4 |
| ⓘ | Calaverite | 2.EA.10 | AuTe2 |
| ⓘ | Kostovite | 2.EA.15 | CuAuTe4 |
| ⓘ | Krennerite | 2.EA.15 | Au3AgTe8 |
| ⓘ | Melonite | 2.EA.20 | NiTe2 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Tungstenite | 2.EA.30 | WS2 |
| ⓘ | Pyrite var. Gold-bearing Pyrite | 2.EB.05a | FeS2 |
| ⓘ | 2.EB.05a | FeS2 | |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Rammelsbergite | 2.EB.15a | NiAs2 |
| ⓘ | Pyrargyrite | 2.GA.05 | Ag3SbS3 |
| ⓘ | Wittichenite | 2.GA.20 | Cu3BiS3 |
| ⓘ | var. Silver-bearing Wittichenite | 2.GA.20 | (Cu,Ag)3BiS3 |
| ⓘ | 'Freibergite Subgroup' | 2.GB.05 | (Ag6,[Ag6]4+)(Cu4 C2+2)Sb4S12S0-1 |
| ⓘ | Goldfieldite | 2.GB.05 | (Cu4◻2)(Cu4Cu+2)Te4S12S |
| ⓘ | 'Tennantite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)As4S12S |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | Pearceite | 2.GB.15 | [Ag6As2S7][Ag9CuS4] |
| ⓘ | Polybasite | 2.GB.15 | [Ag6Sb2S7][Ag9CuS4] |
| ⓘ | Rucklidgeite | 2.GC.40c | PbBi2Te4 |
| ⓘ | Chalcostibite | 2.HA.05 | CuSbS2 |
| ⓘ | Emplectite | 2.HA.05 | CuBiS2 |
| ⓘ | Aikinite | 2.HB.05a | PbCuBiS3 |
| ⓘ | Krupkaite | 2.HB.05a | PbCuBi3S6 |
| ⓘ | Cupropavonite | 2.JA.05a | Cu0.9Ag0.5Pb0.6Bi2.5S5 |
| ⓘ | Hodrušite | 2.JA.10c | Cu8Bi12S22 |
| ⓘ | Matildite | 2.JA.20 | AgBiS2 |
| ⓘ | Volynskite | 2.JA.20 | AgBiTe2 |
| ⓘ | Cosalite | 2.JB.10 | Pb2Bi2S5 |
| ⓘ | Enargite | 2.KA.05 | Cu3AsS4 |
| ⓘ | Famatinite | 2.KA.10 | Cu3SbS4 |
| ⓘ | Luzonite | 2.KA.10 | Cu3AsS4 |
| Group 3 - Halides | |||
| ⓘ | Miersite | 3.AA.05 | (Ag,Cu)I |
| ⓘ | Nantokite | 3.AA.05 | CuCl |
| ⓘ | Iodargyrite | 3.AA.10 | AgI |
| ⓘ | Bromargyrite | 3.AA.15 | AgBr |
| ⓘ | Chlorargyrite | 3.AA.15 | AgCl |
| ⓘ | var. Bromian Chlorargyrite | 3.AA.15 | Ag(Cl,Br) |
| ⓘ | Tolbachite | 3.AB.05 | CuCl2 |
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| ⓘ | Hydrokenoralstonite | 3.CF.05 | Na0.5(Al,Mg)2(F,OH)6 · H2O |
| ⓘ | Atacamite | 3.DA.10a | Cu2(OH)3Cl |
| ⓘ | Botallackite | 3.DA.10b | Cu2(OH)3Cl |
| ⓘ | Paratacamite | 3.DA.10c | Cu3(Cu,Zn)(OH)6Cl2 |
| ⓘ | Claringbullite | 3.DA.15 | Cu4ClF(OH)6 |
| ⓘ | Barlowite | 3.DA.15 | Cu4BrF(OH)6 |
| ⓘ | Buttgenbachite | 3.DA.25 | Cu19(NO3)2(OH)32Cl4 · 2H2O |
| ⓘ | Connellite | 3.DA.25 | Cu19(SO4)(OH)32Cl4 · 3H2O |
| ⓘ | Anthonyite | 3.DA.40 | Cu(OH,Cl)2 · 3H2O |
| ⓘ | Murdochite | 3.DB.45 | Cu12Pb2O15Cl2 |
| ⓘ | Eddavidite (TL) | 3.DB.45 | Cu12Pb2O15Br2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | Cuprite var. Chalcotrichite | 4.AA.10 | Cu2O |
| ⓘ | 4.AA.10 | Cu2O | |
| ⓘ | Paramelaconite (TL) | 4.AA.15 | Cu1+2Cu2+2O3 |
| ⓘ | Crednerite | 4.AB.05 | Cu+Mn3+O2 |
| ⓘ | Tenorite | 4.AB.10 | CuO |
| ⓘ | var. Geltenorite | 4.AB.10 | CuO |
| ⓘ | Delafossite | 4.AB.15 | Cu+Fe3+O2 |
| ⓘ | Lime | 4.AB.25 | CaO |
| ⓘ | Chromite | 4.BB.05 | Fe2+Cr3+2O4 |
| ⓘ | Jacobsite | 4.BB.05 | Mn2+Fe3+2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hausmannite | 4.BB.10 | Mn2+Mn3+2O4 |
| ⓘ | Hetaerolite | 4.BB.10 | ZnMn2O4 |
| ⓘ | var. Hydrohetaerolite | 4.BB.10 | Zn(Mn,◻)2(O,OH)4 |
| ⓘ | Minium | 4.BD.05 | Pb3O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | var. Specularite | 4.CB.05 | Fe2O3 |
| ⓘ | Bixbyite-(Mn) | 4.CB.10 | Mn3+2O3 |
| ⓘ | Nolanite | 4.CB.40 | V3+8Fe3+2O14(OH)2 |
| ⓘ | Bismite | 4.CB.60 | Bi2O3 |
| ⓘ | Quartz var. Agate | 4.DA.05 | SiO2 |
| ⓘ | var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | Opal var. Opal-AN | 4.DA.10 | SiO2 · nH2O |
| ⓘ | 4.DA.10 | SiO2 · nH2O | |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Plattnerite | 4.DB.05 | PbO2 |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Hübnerite | 4.DB.30 | MnWO4 |
| ⓘ | 'Wolframite Group' | 4.DB.30 va | |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Brookite | 4.DD.10 | TiO2 |
| ⓘ | Tellurite | 4.DE.20 | TeO2 |
| ⓘ | Paratellurite | 4.DE.25 | TeO2 |
| ⓘ | 'Bindheimite' | 4.DH.20 | Pb2Sb2O6O |
| ⓘ | Stibiconite | 4.DH.20 | Sb3+Sb5+2O6(OH) |
| ⓘ | Coronadite | 4.DK.05a | Pb(Mn4+6Mn3+2)O16 |
| ⓘ | Cryptomelane | 4.DK.05a | K(Mn4+7Mn3+)O16 |
| ⓘ | Uraninite | 4.DL.05 | UO2 |
| ⓘ | Spertiniite | 4.FD.05 | Cu(OH)2 |
| ⓘ | Diaspore | 4.FD.10 | AlO(OH) |
| ⓘ | Groutite | 4.FD.10 | Mn3+O(OH) |
| ⓘ | Manganite | 4.FD.15 | Mn3+O(OH) |
| ⓘ | Brucite | 4.FE.05 | Mg(OH)2 |
| ⓘ | Gibbsite | 4.FE.10 | Al(OH)3 |
| ⓘ | Böhmite | 4.FE.15 | AlO(OH) |
| ⓘ | Lepidocrocite | 4.FE.15 | Fe3+O(OH) |
| ⓘ | Cesàrolite | 4.FG.10 | PbMn4+3O6(OH)2 |
| ⓘ | Ilsemannite | 4.FJ.15 | Mo3O8 · nH2O |
| ⓘ | Chalcophanite | 4.FL.20 | ZnMn4+3O7 · 3H2O |
| ⓘ | Sengierite | 4.HB.10 | Cu2(UO2)2(VO4)2 · 6H2O |
| ⓘ | Tyuyamunite | 4.HB.25 | Ca(UO2)2(VO4)2 · 5-8H2O |
| ⓘ | Graemite (TL) | 4.JM.15 | Cu[TeO3] · H2O |
| ⓘ | Teineite | 4.JM.20 | Cu2+(Te4+O3) · 2H2O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Magnesite | 5.AB.05 | MgCO3 |
| ⓘ | Calcite var. Manganese-bearing Calcite | 5.AB.05 | (Ca,Mn)CO3 |
| ⓘ | Rhodochrosite | 5.AB.05 | MnCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Smithsonite | 5.AB.05 | ZnCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Aragonite var. Flos Ferri | 5.AB.15 | CaCO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Rosasite | 5.BA.10 | (Cu,Zn)2(CO3)(OH)2 |
| ⓘ | Aurichalcite | 5.BA.15 | (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ | Hydrozincite | 5.BA.15 | Zn5(CO3)2(OH)6 |
| ⓘ | Hydrocerussite | 5.BE.10 | Pb3(CO3)2(OH)2 |
| ⓘ | Bismutite | 5.BE.25 | (BiO)2CO3 |
| ⓘ | Kettnerite | 5.BE.30 | CaBiCO3OF |
| ⓘ | Leadhillite | 5.BF.40 | Pb4(CO3)2(SO4)(OH)2 |
| ⓘ | Susannite | 5.BF.40 | Pb4(CO3)2(SO4)(OH)2 |
| ⓘ | Bayleyite | 5.ED.05 | Mg2(UO2)(CO3)3 · 18H2O |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anhydrite | 7.AD.30 | CaSO4 |
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Antlerite | 7.BB.15 | Cu3(SO4)(OH)4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Alunite | 7.BC.10 | KAl3(SO4)2(OH)6 |
| ⓘ | Beaverite-(Cu) | 7.BC.10 | Pb(Fe3+2Cu)(SO4)2(OH)6 |
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Osarizawaite | 7.BC.10 | Pb(Al2Cu2+)(SO4)2(OH)6 |
| ⓘ | Plumbojarosite | 7.BC.10 | Pb0.5Fe3+3(SO4)2(OH)6 |
| ⓘ | Linarite | 7.BC.65 | PbCu(SO4)(OH)2 |
| ⓘ | Gunningite | 7.CB.05 | ZnSO4 · H2O |
| ⓘ | Szomolnokite | 7.CB.05 | FeSO4 · H2O |
| ⓘ | Rozenite | 7.CB.15 | FeSO4 · 4H2O |
| ⓘ | Chalcanthite | 7.CB.20 | CuSO4 · 5H2O |
| ⓘ | Siderotil | 7.CB.20 | FeSO4 · 5H2O |
| ⓘ | Bianchite | 7.CB.25 | Zn(SO4) · 6H2O |
| ⓘ | Hexahydrite | 7.CB.25 | MgSO4 · 6H2O |
| ⓘ | Boothite | 7.CB.35 | CuSO4 · 7H2O |
| ⓘ | Melanterite | 7.CB.35 | Fe2+(H2O)6SO4 · H2O |
| ⓘ | Epsomite | 7.CB.40 | MgSO4 · 7H2O |
| ⓘ | Goslarite | 7.CB.40 | ZnSO4 · 7H2O |
| ⓘ | Coquimbite | 7.CB.55 | AlFe3(SO4)6(H2O)12 · 6H2O |
| ⓘ | Paracoquimbite | 7.CB.55 | Fe4(SO4)6(H2O)12 · 6H2O |
| ⓘ | Rhomboclase | 7.CB.55 | (H5O2)Fe3+(SO4)2 · 2H2O |
| ⓘ | Kornelite | 7.CB.60 | Fe2(SO4)3 · 7H2O |
| ⓘ | Römerite | 7.CB.75 | Fe2+Fe3+2(SO4)4 · 14H2O |
| ⓘ | Ransomite | 7.CB.80 | CuFe2(SO4)4 · 6H2O |
| ⓘ | Bílinite | 7.CB.85 | Fe2+Fe3+2(SO4)4 · 22H2O |
| ⓘ | Halotrichite | 7.CB.85 | FeAl2(SO4)4 · 22H2O |
| ⓘ | Pickeringite | 7.CB.85 | MgAl2(SO4)4 · 22H2O |
| ⓘ | Voltaite | 7.CC.25 | K2Fe2+5Fe3+3Al(SO4)12 · 18H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | var. Selenite | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Copiapite | 7.DB.35 | Fe2+Fe3+4(SO4)6(OH)2 · 20H2O |
| ⓘ | Cuprocopiapite | 7.DB.35 | Cu2+Fe3+4(SO4)6(OH)2 · 20H2O |
| ⓘ | Ferricopiapite | 7.DB.35 | Fe3+0.67Fe3+4(SO4)6(OH)2 · 20H2O |
| ⓘ | Zincocopiapite | 7.DB.35 | ZnFe3+4(SO4)6(OH)2 · 18H2O |
| ⓘ | Fibroferrite | 7.DC.15 | Fe3+(SO4)(OH) · 5H2O |
| ⓘ | Botryogen | 7.DC.25 | MgFe3+(SO4)2(OH) · 7H2O |
| ⓘ | Zincobotryogen | 7.DC.25 | (Zn,Mg,Mn2+)Fe3+(SO4)2(OH) · 7H2O |
| ⓘ | Felsőbányaite | 7.DD.05 | Al4(SO4)(OH)10 · 4H2O |
| ⓘ | Langite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Spangolite | 7.DD.15 | Cu6Al(SO4)(OH)12Cl · 3H2O |
| ⓘ | Ktenasite | 7.DD.20 | ZnCu4(SO4)2(OH)6 · 6H2O |
| ⓘ | Devilline | 7.DD.30 | CaCu4(SO4)2(OH)6 · 3H2O |
| ⓘ | Chalcoalumite (TL) | 7.DD.75 | CuAl4(SO4)(OH)12 · 3H2O |
| ⓘ | Carbonatecyanotrichite | 7.DE.10 | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| ⓘ | Cyanotrichite | 7.DE.10 | Cu4Al2(SO4)(OH)12 · 2H2O |
| ⓘ | Hydrobasaluminite | 7.DE.60 | Al4(SO4)(OH)10 · 12-36H2O |
| ⓘ | Metavoltine | 7.DF.35 | K2Na6Fe2+Fe3+6O2(SO4)12 · 18H2O |
| ⓘ | Uranopilite | 7.EA.05 | (UO2)6(SO4)O2(OH)6 · 14H2O |
| ⓘ | Johannite | 7.EB.05 | Cu(UO2)2(SO4)2(OH)2 · 8H2O |
| ⓘ | Zippeite | 7.EC.05 | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| ⓘ | Fornacite | 7.FC.10 | Pb2Cu(CrO4)(AsO4)(OH) |
| ⓘ | Powellite | 7.GA.05 | Ca(MoO4) |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| ⓘ | Stolzite | 7.GA.05 | Pb(WO4) |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| ⓘ | Ferrimolybdite | 7.GB.30 | Fe2(MoO4)3 · nH2O |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Tilasite | 8.BB. | CaMg(AsO4)F |
| ⓘ | Scorzalite | 8.BB.40 | Fe2+Al2(PO4)2(OH)2 |
| ⓘ | Pseudomalachite | 8.BD.05 | Cu5(PO4)2(OH)4 |
| ⓘ | Conichalcite | 8.BH.35 | CaCu(AsO4)(OH) |
| ⓘ | Descloizite var. Copper-bearing Descloizite | 8.BH.40 | Pb(Zn,Cu)VO4OH |
| ⓘ | 8.BH.40 | PbZn(VO4)(OH) | |
| ⓘ | Mottramite | 8.BH.40 | PbCu(VO4)(OH) |
| ⓘ | Bayldonite | 8.BH.45 | PbCu3(AsO4)2(OH)2 |
| ⓘ | Beudantite | 8.BL.05 | PbFe3+3(AsO4)(SO4)(OH)6 |
| ⓘ | Mimetite | 8.BN.05 | Pb5(AsO4)3Cl |
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Vanadinite | 8.BN.05 | Pb5(VO4)3Cl |
| ⓘ | Variscite | 8.CD.10 | AlPO4 · 2H2O |
| ⓘ | var. Ferrian Variscite | 8.CD.10 | (Al,Fe)PO4 · 2H2O |
| ⓘ | Beraunite | 8.DC.27 | Fe3+6(PO4)4O(OH)4 · 6H2O |
| ⓘ | Gormanite | 8.DC.45 | (Fe2+,Mg)3(Al,Fe3+)4(PO4)4(OH)6 · 2H2O |
| ⓘ | Chalcosiderite | 8.DD.15 | CuFe3+6(PO4)4(OH)8 · 4H2O |
| ⓘ | Turquoise | 8.DD.15 | CuAl6(PO4)4(OH)8 · 4H2O |
| ⓘ | Liroconite | 8.DF.20 | Cu2Al(AsO4)(OH)4 · 4H2O |
| ⓘ | Chalcophyllite | 8.DF.30 | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| ⓘ | Pharmacosiderite | 8.DK.10 | KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| ⓘ | Torbernite | 8.EB.05 | Cu(UO2)2(PO4)2 · 12H2O |
| ⓘ | Metatorbernite | 8.EB.10 | Cu(UO2)2(PO4)2 · 8H2O |
| Group 9 - Silicates | |||
| ⓘ | Chrysotile | 9.00. | Mg3(Si2O5)(OH)4 |
| ⓘ | Willemite | 9.AA.05 | Zn2SiO4 |
| ⓘ | Andradite | 9.AD.25 | Ca3Fe3+2(SiO4)3 |
| ⓘ | Grossular | 9.AD.25 | Ca3Al2(SiO4)3 |
| ⓘ | Pyrope | 9.AD.25 | Mg3Al2(SiO4)3 |
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Braunite | 9.AG.05 | Mn2+Mn3+6(SiO4)O8 |
| ⓘ | Neltnerite | 9.AG.05 | CaMn3+6(SiO4)O8 |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Hemimorphite | 9.BD.10 | Zn4Si2O7(OH)2 · H2O |
| ⓘ | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Zoisite | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Vesuvianite | 9.BG.35 | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ | Dioptase | 9.CJ.30 | CuSiO3 · H2O |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Enstatite | 9.DA.05 | Mg2Si2O6 |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Plancheite | 9.DB.35 | Cu8(Si8O22)(OH)4 · H2O |
| ⓘ | Shattuckite (TL) | 9.DB.40 | Cu5(Si2O6)2(OH)2 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Edenite | 9.DE.15 | NaCa2Mg5(Si7Al)O22(OH)2 |
| ⓘ | Wollastonite | 9.DG.05 | Ca3(Si3O9) |
| ⓘ | Prehnite | 9.DP.20 | Ca2Al2Si3O10(OH)2 |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Pyrophyllite | 9.EC.10 | Al2Si4O10(OH)2 |
| ⓘ | Celadonite | 9.EC.15 | K(MgFe3+◻)(Si4O10)(OH)2 |
| ⓘ | Muscovite var. Illite | 9.EC.15 | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | Roscoelite | 9.EC.15 | KV3+2(AlSi3O10)(OH)2 |
| ⓘ | Muscovite var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Volkonskoite | 9.EC.40 | Ca0.3(Cr,Mg,Fe)2((Si,Al)4O10)(OH)2 · 4H2O |
| ⓘ | Stevensite | 9.EC.45 | (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| ⓘ | Chamosite | 9.EC.55 | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Hydrobiotite | 9.EC.60 | K(Mg,Fe2+)6((Si,Al)8O20)(OH)4 · nH2O |
| ⓘ | 'Clinochrysotile' | 9.ED. | Mg3(Si2O5)(OH)4 |
| ⓘ | Dickite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Halloysite | 9.ED.10 | Al2(Si2O5)(OH)4 |
| ⓘ | Hisingerite | 9.ED.10 | Fe3+2(Si2O5)(OH)4 · 2H2O |
| ⓘ | Hydrohalloysite | 9.ED.10 | Al2Si2O5(OH)4 · 2H2O |
| ⓘ | Antigorite | 9.ED.15 | Mg3(Si2O5)(OH)4 |
| ⓘ | Allophane | 9.ED.20 | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Sepiolite | 9.EE.25 | Mg4(Si6O15)(OH)2 · 6H2O |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Sanidine | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Anorthite | 9.FA.35 | Ca(Al2Si2O8) |
| ⓘ | var. Labradorite | 9.FA.35 | (Ca,Na)[Al(Al,Si)Si2O8] |
| ⓘ | Meionite | 9.FB.15 | Ca4Al6Si6O24CO3 |
| ⓘ | Natrolite | 9.GA.05 | Na2Al2Si3O10 · 2H2O |
| ⓘ | Thomsonite-Ca | 9.GA.10 | NaCa2[Al5Si5O20] · 6H2O |
| ⓘ | Laumontite | 9.GB.10 | CaAl2Si4O12 · 4H2O |
| Group 10 - Organic Compounds | |||
| ⓘ | Hoganite | 10.AA.35 | Cu(CH3COO)2 · H2O |
| Unclassified | |||
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Delessite' | - | (Mg,Fe,Fe,Al)(Si,Al)4O10(O,OH)8 |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Psilomelane' | - | |
| ⓘ | 'Pumpellyite Subgroup' | - | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Wad' | - | |
| ⓘ | 'Scapolite var. Wernerite' | - | |
| ⓘ | 'Fayalite-Forsterite Series' | - | |
| ⓘ | 'Scapolite' | - | |
| ⓘ | 'Hydromuscovite' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Silica' | - | |
| ⓘ | 'Serpentine Subgroup' | - | D3[Si2O5](OH)4 |
| ⓘ | 'Bisbeeite' | - | (Cu,Mg)SiO3 · nH2O |
| ⓘ | 'Manganese Oxides var. Manganese Dendrites' | - | |
| ⓘ | '' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'Campbellite' | - | |
| ⓘ | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| ⓘ | 'Iridescent coating' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| H | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| H | ⓘ Anthonyite | Cu(OH,Cl)2 · 3H2O |
| H | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| H | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| H | ⓘ Atacamite | Cu2(OH)3Cl |
| H | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| H | ⓘ Bayleyite | Mg2(UO2)(CO3)3 · 18H2O |
| H | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| H | ⓘ Beraunite | Fe63+(PO4)4O(OH)4 · 6H2O |
| H | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| H | ⓘ Bianchite | Zn(SO4) · 6H2O |
| H | ⓘ Bílinite | Fe2+Fe23+(SO4)4 · 22H2O |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Böhmite | AlO(OH) |
| H | ⓘ Boothite | CuSO4 · 7H2O |
| H | ⓘ Botallackite | Cu2(OH)3Cl |
| H | ⓘ Botryogen | MgFe3+(SO4)2(OH) · 7H2O |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Buttgenbachite | Cu19(NO3)2(OH)32Cl4 · 2H2O |
| H | ⓘ Brucite | Mg(OH)2 |
| H | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| H | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| H | ⓘ Cesàrolite | PbMn34+O6(OH)2 |
| H | ⓘ Chalcosiderite | CuFe63+(PO4)4(OH)8 · 4H2O |
| H | ⓘ Chalcophanite | ZnMn34+O7 · 3H2O |
| H | ⓘ Chalcanthite | CuSO4 · 5H2O |
| H | ⓘ Chalcoalumite | CuAl4(SO4)(OH)12 · 3H2O |
| H | ⓘ Chamosite | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| H | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| H | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Claringbullite | Cu4ClF(OH)6 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Clinochrysotile | Mg3(Si2O5)(OH)4 |
| H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| H | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| H | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| H | ⓘ Coquimbite | AlFe3(SO4)6(H2O)12 · 6H2O |
| H | ⓘ Cuprocopiapite | Cu2+Fe43+(SO4)6(OH)2 · 20H2O |
| H | ⓘ Descloizite var. Copper-bearing Descloizite | Pb(Zn,Cu)VO4OH |
| H | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| H | ⓘ Delessite | (Mg,Fe,Fe,Al)(Si,Al)4O10(O,OH)8 |
| H | ⓘ Descloizite | PbZn(VO4)(OH) |
| H | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| H | ⓘ Diaspore | AlO(OH) |
| H | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| H | ⓘ Dioptase | CuSiO3 · H2O |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Epsomite | MgSO4 · 7H2O |
| H | ⓘ Felsőbányaite | Al4(SO4)(OH)10 · 4H2O |
| H | ⓘ Ferricopiapite | Fe3+0.67Fe43+(SO4)6(OH)2 · 20H2O |
| H | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| H | ⓘ Fibroferrite | Fe3+(SO4)(OH) · 5H2O |
| H | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| H | ⓘ Gibbsite | Al(OH)3 |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gormanite | (Fe2+,Mg)3(Al,Fe3+)4(PO4)4(OH)6 · 2H2O |
| H | ⓘ Goslarite | ZnSO4 · 7H2O |
| H | ⓘ Graemite | Cu[TeO3] · H2O |
| H | ⓘ Groutite | Mn3+O(OH) |
| H | ⓘ Gunningite | ZnSO4 · H2O |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Halloysite | Al2(Si2O5)(OH)4 |
| H | ⓘ Halotrichite | FeAl2(SO4)4 · 22H2O |
| H | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| H | ⓘ Hexahydrite | MgSO4 · 6H2O |
| H | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| H | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
| H | ⓘ Hydrobasaluminite | Al4(SO4)(OH)10 · 12-36H2O |
| H | ⓘ Hydrobiotite | K(Mg,Fe2+)6((Si,Al)8O20)(OH)4 · nH2O |
| H | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| H | ⓘ Hetaerolite var. Hydrohetaerolite | Zn(Mn,◻)2(O,OH)4 |
| H | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| H | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| H | ⓘ Ilsemannite | Mo3O8 · nH2O |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Johannite | Cu(UO2)2(SO4)2(OH)2 · 8H2O |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Kornelite | Fe2(SO4)3 · 7H2O |
| H | ⓘ Ktenasite | ZnCu4(SO4)2(OH)6 · 6H2O |
| H | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| H | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| H | ⓘ Lepidocrocite | Fe3+O(OH) |
| H | ⓘ Linarite | PbCu(SO4)(OH)2 |
| H | ⓘ Liroconite | Cu2Al(AsO4)(OH)4 · 4H2O |
| H | ⓘ Manganite | Mn3+O(OH) |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| H | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| H | ⓘ Metavoltine | K2Na6Fe2+Fe63+O2(SO4)12 · 18H2O |
| H | ⓘ Mottramite | PbCu(VO4)(OH) |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Nolanite | V83+Fe23+O14(OH)2 |
| H | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Osarizawaite | Pb(Al2Cu2+)(SO4)2(OH)6 |
| H | ⓘ Paracoquimbite | Fe4(SO4)6(H2O)12 · 6H2O |
| H | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| H | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| H | ⓘ Pickeringite | MgAl2(SO4)4 · 22H2O |
| H | ⓘ Plancheite | Cu8(Si8O22)(OH)4 · H2O |
| H | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| H | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| H | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| H | ⓘ Pumpellyite Subgroup | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| H | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| H | ⓘ Hydrokenoralstonite | Na0.5(Al,Mg)2(F,OH)6 · H2O |
| H | ⓘ Ransomite | CuFe2(SO4)4 · 6H2O |
| H | ⓘ Rhomboclase | (H5O2)Fe3+(SO4)2 · 2H2O |
| H | ⓘ Römerite | Fe2+Fe23+(SO4)4 · 14H2O |
| H | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| H | ⓘ Roscoelite | KV23+(AlSi3O10)(OH)2 |
| H | ⓘ Rozenite | FeSO4 · 4H2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Scorzalite | Fe2+Al2(PO4)2(OH)2 |
| H | ⓘ Sengierite | Cu2(UO2)2(VO4)2 · 6H2O |
| H | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| H | ⓘ Shattuckite | Cu5(Si2O6)2(OH)2 |
| H | ⓘ Siderotil | FeSO4 · 5H2O |
| H | ⓘ Spangolite | Cu6Al(SO4)(OH)12Cl · 3H2O |
| H | ⓘ Spertiniite | Cu(OH)2 |
| H | ⓘ Stevensite | (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| H | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| H | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| H | ⓘ Szomolnokite | FeSO4 · H2O |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Teineite | Cu2+(Te4+O3) · 2H2O |
| H | ⓘ Thomsonite-Ca | NaCa2[Al5Si5O20] · 6H2O |
| H | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| H | ⓘ Tyuyamunite | Ca(UO2)2(VO4)2 · 5-8H2O |
| H | ⓘ Uranopilite | (UO2)6(SO4)O2(OH)6 · 14H2O |
| H | ⓘ Variscite | AlPO4 · 2H2O |
| H | ⓘ Volkonskoite | Ca0.3(Cr,Mg,Fe)2((Si,Al)4O10)(OH)2 · 4H2O |
| H | ⓘ Voltaite | K2Fe52+Fe33+Al(SO4)12 · 18H2O |
| H | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| H | ⓘ Zincobotryogen | (Zn,Mg,Mn2+)Fe3+(SO4)2(OH) · 7H2O |
| H | ⓘ Zincocopiapite | ZnFe43+(SO4)6(OH)2 · 18H2O |
| H | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| H | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Hydrohalloysite | Al2Si2O5(OH)4 · 2H2O |
| H | ⓘ Hoganite | Cu(CH3COO)2 · H2O |
| H | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| H | ⓘ Variscite var. Ferrian Variscite | (Al,Fe)PO4 · 2H2O |
| H | ⓘ Bisbeeite | (Cu,Mg)SiO3 · nH2O |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| H | ⓘ Barlowite | Cu4BrF(OH)6 |
| H | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| B | Boron | |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Bayleyite | Mg2(UO2)(CO3)3 · 18H2O |
| C | ⓘ Bismutite | (BiO)2CO3 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Graphite | C |
| C | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| C | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| C | ⓘ Kettnerite | CaBiCO3OF |
| C | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| C | ⓘ Magnesite | MgCO3 |
| C | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| C | ⓘ Rhodochrosite | MnCO3 |
| C | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Smithsonite | ZnCO3 |
| C | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| C | ⓘ Scapolite var. Wernerite | |
| C | ⓘ Aragonite var. Flos Ferri | CaCO3 |
| C | ⓘ Hoganite | Cu(CH3COO)2 · H2O |
| N | Nitrogen | |
| N | ⓘ Buttgenbachite | Cu19(NO3)2(OH)32Cl4 · 2H2O |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Quartz var. Agate | SiO2 |
| O | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| O | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Anhydrite | CaSO4 |
| O | ⓘ Anorthite | Ca(Al2Si2O8) |
| O | ⓘ Anthonyite | Cu(OH,Cl)2 · 3H2O |
| O | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| O | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Atacamite | Cu2(OH)3Cl |
| O | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| O | ⓘ Bayleyite | Mg2(UO2)(CO3)3 · 18H2O |
| O | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| O | ⓘ Beraunite | Fe63+(PO4)4O(OH)4 · 6H2O |
| O | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| O | ⓘ Bianchite | Zn(SO4) · 6H2O |
| O | ⓘ Bílinite | Fe2+Fe23+(SO4)4 · 22H2O |
| O | ⓘ Bindheimite | Pb2Sb2O6O |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Bismite | Bi2O3 |
| O | ⓘ Bismutite | (BiO)2CO3 |
| O | ⓘ Bixbyite-(Mn) | Mn23+O3 |
| O | ⓘ Böhmite | AlO(OH) |
| O | ⓘ Boothite | CuSO4 · 7H2O |
| O | ⓘ Botallackite | Cu2(OH)3Cl |
| O | ⓘ Botryogen | MgFe3+(SO4)2(OH) · 7H2O |
| O | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Brookite | TiO2 |
| O | ⓘ Buttgenbachite | Cu19(NO3)2(OH)32Cl4 · 2H2O |
| O | ⓘ Brucite | Mg(OH)2 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Cesàrolite | PbMn34+O6(OH)2 |
| O | ⓘ Chalcosiderite | CuFe63+(PO4)4(OH)8 · 4H2O |
| O | ⓘ Chalcophanite | ZnMn34+O7 · 3H2O |
| O | ⓘ Chalcanthite | CuSO4 · 5H2O |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Chalcoalumite | CuAl4(SO4)(OH)12 · 3H2O |
| O | ⓘ Chamosite | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| O | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| O | ⓘ Cuprite var. Chalcotrichite | Cu2O |
| O | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| O | ⓘ Chromite | Fe2+Cr23+O4 |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Claringbullite | Cu4ClF(OH)6 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Clinochrysotile | Mg3(Si2O5)(OH)4 |
| O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| O | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| O | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| O | ⓘ Coquimbite | AlFe3(SO4)6(H2O)12 · 6H2O |
| O | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| O | ⓘ Crednerite | Cu+Mn3+O2 |
| O | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Cuprocopiapite | Cu2+Fe43+(SO4)6(OH)2 · 20H2O |
| O | ⓘ Descloizite var. Copper-bearing Descloizite | Pb(Zn,Cu)VO4OH |
| O | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| O | ⓘ Delafossite | Cu+Fe3+O2 |
| O | ⓘ Delessite | (Mg,Fe,Fe,Al)(Si,Al)4O10(O,OH)8 |
| O | ⓘ Descloizite | PbZn(VO4)(OH) |
| O | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| O | ⓘ Diaspore | AlO(OH) |
| O | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dioptase | CuSiO3 · H2O |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| O | ⓘ Enstatite | Mg2Si2O6 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Epsomite | MgSO4 · 7H2O |
| O | ⓘ Felsőbányaite | Al4(SO4)(OH)10 · 4H2O |
| O | ⓘ Ferricopiapite | Fe3+0.67Fe43+(SO4)6(OH)2 · 20H2O |
| O | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| O | ⓘ Fibroferrite | Fe3+(SO4)(OH) · 5H2O |
| O | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| O | ⓘ Gibbsite | Al(OH)3 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Gormanite | (Fe2+,Mg)3(Al,Fe3+)4(PO4)4(OH)6 · 2H2O |
| O | ⓘ Goslarite | ZnSO4 · 7H2O |
| O | ⓘ Graemite | Cu[TeO3] · H2O |
| O | ⓘ Grossular | Ca3Al2(SiO4)3 |
| O | ⓘ Groutite | Mn3+O(OH) |
| O | ⓘ Gunningite | ZnSO4 · H2O |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Halloysite | Al2(Si2O5)(OH)4 |
| O | ⓘ Halotrichite | FeAl2(SO4)4 · 22H2O |
| O | ⓘ Hausmannite | Mn2+Mn23+O4 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| O | ⓘ Hetaerolite | ZnMn2O4 |
| O | ⓘ Hexahydrite | MgSO4 · 6H2O |
| O | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| O | ⓘ Hübnerite | MnWO4 |
| O | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
| O | ⓘ Hydrobasaluminite | Al4(SO4)(OH)10 · 12-36H2O |
| O | ⓘ Hydrobiotite | K(Mg,Fe2+)6((Si,Al)8O20)(OH)4 · nH2O |
| O | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| O | ⓘ Hetaerolite var. Hydrohetaerolite | Zn(Mn,◻)2(O,OH)4 |
| O | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| O | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| O | ⓘ Ilsemannite | Mo3O8 · nH2O |
| O | ⓘ Jacobsite | Mn2+Fe23+O4 |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Johannite | Cu(UO2)2(SO4)2(OH)2 · 8H2O |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Kettnerite | CaBiCO3OF |
| O | ⓘ Kornelite | Fe2(SO4)3 · 7H2O |
| O | ⓘ Ktenasite | ZnCu4(SO4)2(OH)6 · 6H2O |
| O | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| O | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| O | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| O | ⓘ Lepidocrocite | Fe3+O(OH) |
| O | ⓘ Lime | CaO |
| O | ⓘ Linarite | PbCu(SO4)(OH)2 |
| O | ⓘ Liroconite | Cu2Al(AsO4)(OH)4 · 4H2O |
| O | ⓘ Magnesite | MgCO3 |
| O | ⓘ Manganite | Mn3+O(OH) |
| O | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| O | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| O | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| O | ⓘ Metavoltine | K2Na6Fe2+Fe63+O2(SO4)12 · 18H2O |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Mimetite | Pb5(AsO4)3Cl |
| O | ⓘ Minium | Pb3O4 |
| O | ⓘ Mottramite | PbCu(VO4)(OH) |
| O | ⓘ Murdochite | Cu12Pb2O15Cl2 |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Neltnerite | CaMn63+(SiO4)O8 |
| O | ⓘ Nolanite | V83+Fe23+O14(OH)2 |
| O | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Osarizawaite | Pb(Al2Cu2+)(SO4)2(OH)6 |
| O | ⓘ Paracoquimbite | Fe4(SO4)6(H2O)12 · 6H2O |
| O | ⓘ Paramelaconite | Cu21+Cu22+O3 |
| O | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| O | ⓘ Paratellurite | TeO2 |
| O | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| O | ⓘ Pickeringite | MgAl2(SO4)4 · 22H2O |
| O | ⓘ Plancheite | Cu8(Si8O22)(OH)4 · H2O |
| O | ⓘ Plattnerite | PbO2 |
| O | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| O | ⓘ Powellite | Ca(MoO4) |
| O | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| O | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| O | ⓘ Pumpellyite Subgroup | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| O | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Hydrokenoralstonite | Na0.5(Al,Mg)2(F,OH)6 · H2O |
| O | ⓘ Ransomite | CuFe2(SO4)4 · 6H2O |
| O | ⓘ Rhodochrosite | MnCO3 |
| O | ⓘ Rhomboclase | (H5O2)Fe3+(SO4)2 · 2H2O |
| O | ⓘ Römerite | Fe2+Fe23+(SO4)4 · 14H2O |
| O | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| O | ⓘ Roscoelite | KV23+(AlSi3O10)(OH)2 |
| O | ⓘ Rozenite | FeSO4 · 4H2O |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Sanidine | K(AlSi3O8) |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Scorzalite | Fe2+Al2(PO4)2(OH)2 |
| O | ⓘ Sengierite | Cu2(UO2)2(VO4)2 · 6H2O |
| O | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| O | ⓘ Shattuckite | Cu5(Si2O6)2(OH)2 |
| O | ⓘ Siderotil | FeSO4 · 5H2O |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Smithsonite | ZnCO3 |
| O | ⓘ Spangolite | Cu6Al(SO4)(OH)12Cl · 3H2O |
| O | ⓘ Spertiniite | Cu(OH)2 |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Stevensite | (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| O | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| O | ⓘ Stolzite | Pb(WO4) |
| O | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| O | ⓘ Szomolnokite | FeSO4 · H2O |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Teineite | Cu2+(Te4+O3) · 2H2O |
| O | ⓘ Tellurite | TeO2 |
| O | ⓘ Tenorite | CuO |
| O | ⓘ Thomsonite-Ca | NaCa2[Al5Si5O20] · 6H2O |
| O | ⓘ Tilasite | CaMg(AsO4)F |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| O | ⓘ Tyuyamunite | Ca(UO2)2(VO4)2 · 5-8H2O |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Uranopilite | (UO2)6(SO4)O2(OH)6 · 14H2O |
| O | ⓘ Vanadinite | Pb5(VO4)3Cl |
| O | ⓘ Variscite | AlPO4 · 2H2O |
| O | ⓘ Volkonskoite | Ca0.3(Cr,Mg,Fe)2((Si,Al)4O10)(OH)2 · 4H2O |
| O | ⓘ Voltaite | K2Fe52+Fe33+Al(SO4)12 · 18H2O |
| O | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| O | ⓘ Scapolite var. Wernerite | |
| O | ⓘ Willemite | Zn2SiO4 |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Wollastonite | Ca3(Si3O9) |
| O | ⓘ Zincobotryogen | (Zn,Mg,Mn2+)Fe3+(SO4)2(OH) · 7H2O |
| O | ⓘ Zincocopiapite | ZnFe43+(SO4)6(OH)2 · 18H2O |
| O | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| O | ⓘ Hematite var. Specularite | Fe2O3 |
| O | ⓘ Aragonite var. Flos Ferri | CaCO3 |
| O | ⓘ Fayalite-Forsterite Series | |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Tenorite var. Geltenorite | CuO |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Hydrohalloysite | Al2Si2O5(OH)4 · 2H2O |
| O | ⓘ Hoganite | Cu(CH3COO)2 · H2O |
| O | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| O | ⓘ Variscite var. Ferrian Variscite | (Al,Fe)PO4 · 2H2O |
| O | ⓘ Bisbeeite | (Cu,Mg)SiO3 · nH2O |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | ⓘ Barlowite | Cu4BrF(OH)6 |
| O | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| O | ⓘ Eddavidite | Cu12Pb2O15Br2 |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Claringbullite | Cu4ClF(OH)6 |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Kettnerite | CaBiCO3OF |
| F | ⓘ Hydrokenoralstonite | Na0.5(Al,Mg)2(F,OH)6 · H2O |
| F | ⓘ Tilasite | CaMg(AsO4)F |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | ⓘ Barlowite | Cu4BrF(OH)6 |
| Na | Sodium | |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Na | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Na | ⓘ Metavoltine | K2Na6Fe2+Fe63+O2(SO4)12 · 18H2O |
| Na | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Na | ⓘ Hydrokenoralstonite | Na0.5(Al,Mg)2(F,OH)6 · H2O |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Stevensite | (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| Na | ⓘ Thomsonite-Ca | NaCa2[Al5Si5O20] · 6H2O |
| Na | ⓘ Scapolite var. Wernerite | |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Bayleyite | Mg2(UO2)(CO3)3 · 18H2O |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Botryogen | MgFe3+(SO4)2(OH) · 7H2O |
| Mg | ⓘ Brucite | Mg(OH)2 |
| Mg | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| Mg | ⓘ Chamosite | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| Mg | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Clinochrysotile | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Delessite | (Mg,Fe,Fe,Al)(Si,Al)4O10(O,OH)8 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Mg | ⓘ Enstatite | Mg2Si2O6 |
| Mg | ⓘ Epsomite | MgSO4 · 7H2O |
| Mg | ⓘ Gormanite | (Fe2+,Mg)3(Al,Fe3+)4(PO4)4(OH)6 · 2H2O |
| Mg | ⓘ Hexahydrite | MgSO4 · 6H2O |
| Mg | ⓘ Hydrobiotite | K(Mg,Fe2+)6((Si,Al)8O20)(OH)4 · nH2O |
| Mg | ⓘ Magnesite | MgCO3 |
| Mg | ⓘ Pickeringite | MgAl2(SO4)4 · 22H2O |
| Mg | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| Mg | ⓘ Hydrokenoralstonite | Na0.5(Al,Mg)2(F,OH)6 · H2O |
| Mg | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| Mg | ⓘ Stevensite | (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Tilasite | CaMg(AsO4)F |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Volkonskoite | Ca0.3(Cr,Mg,Fe)2((Si,Al)4O10)(OH)2 · 4H2O |
| Mg | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Mg | ⓘ Fayalite-Forsterite Series | |
| Mg | ⓘ Bisbeeite | (Cu,Mg)SiO3 · nH2O |
| Al | Aluminium | |
| Al | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Al | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| Al | ⓘ Anorthite | Ca(Al2Si2O8) |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Böhmite | AlO(OH) |
| Al | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| Al | ⓘ Chalcoalumite | CuAl4(SO4)(OH)12 · 3H2O |
| Al | ⓘ Chamosite | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| Al | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Coquimbite | AlFe3(SO4)6(H2O)12 · 6H2O |
| Al | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| Al | ⓘ Delessite | (Mg,Fe,Fe,Al)(Si,Al)4O10(O,OH)8 |
| Al | ⓘ Diaspore | AlO(OH) |
| Al | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Felsőbányaite | Al4(SO4)(OH)10 · 4H2O |
| Al | ⓘ Gibbsite | Al(OH)3 |
| Al | ⓘ Gormanite | (Fe2+,Mg)3(Al,Fe3+)4(PO4)4(OH)6 · 2H2O |
| Al | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Al | ⓘ Halloysite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Halotrichite | FeAl2(SO4)4 · 22H2O |
| Al | ⓘ Hydrobasaluminite | Al4(SO4)(OH)10 · 12-36H2O |
| Al | ⓘ Hydrobiotite | K(Mg,Fe2+)6((Si,Al)8O20)(OH)4 · nH2O |
| Al | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Al | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Al | ⓘ Liroconite | Cu2Al(AsO4)(OH)4 · 4H2O |
| Al | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Osarizawaite | Pb(Al2Cu2+)(SO4)2(OH)6 |
| Al | ⓘ Pickeringite | MgAl2(SO4)4 · 22H2O |
| Al | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Al | ⓘ Pumpellyite Subgroup | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| Al | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| Al | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| Al | ⓘ Hydrokenoralstonite | Na0.5(Al,Mg)2(F,OH)6 · H2O |
| Al | ⓘ Roscoelite | KV23+(AlSi3O10)(OH)2 |
| Al | ⓘ Sanidine | K(AlSi3O8) |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Scorzalite | Fe2+Al2(PO4)2(OH)2 |
| Al | ⓘ Spangolite | Cu6Al(SO4)(OH)12Cl · 3H2O |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Thomsonite-Ca | NaCa2[Al5Si5O20] · 6H2O |
| Al | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| Al | ⓘ Variscite | AlPO4 · 2H2O |
| Al | ⓘ Volkonskoite | Ca0.3(Cr,Mg,Fe)2((Si,Al)4O10)(OH)2 · 4H2O |
| Al | ⓘ Voltaite | K2Fe52+Fe33+Al(SO4)12 · 18H2O |
| Al | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | ⓘ Scapolite var. Wernerite | |
| Al | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Hydrohalloysite | Al2Si2O5(OH)4 · 2H2O |
| Al | ⓘ Variscite var. Ferrian Variscite | (Al,Fe)PO4 · 2H2O |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ Quartz var. Agate | SiO2 |
| Si | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Si | ⓘ Anorthite | Ca(Al2Si2O8) |
| Si | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| Si | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Chamosite | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| Si | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Clinochrysotile | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Delessite | (Mg,Fe,Fe,Al)(Si,Al)4O10(O,OH)8 |
| Si | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Dioptase | CuSiO3 · H2O |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Si | ⓘ Enstatite | Mg2Si2O6 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Si | ⓘ Halloysite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Si | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| Si | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
| Si | ⓘ Hydrobiotite | K(Mg,Fe2+)6((Si,Al)8O20)(OH)4 · nH2O |
| Si | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Si | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Si | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Neltnerite | CaMn63+(SiO4)O8 |
| Si | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Plancheite | Cu8(Si8O22)(OH)4 · H2O |
| Si | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Si | ⓘ Pumpellyite Subgroup | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| Si | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| Si | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Roscoelite | KV23+(AlSi3O10)(OH)2 |
| Si | ⓘ Sanidine | K(AlSi3O8) |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| Si | ⓘ Shattuckite | Cu5(Si2O6)2(OH)2 |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Stevensite | (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Thomsonite-Ca | NaCa2[Al5Si5O20] · 6H2O |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Volkonskoite | Ca0.3(Cr,Mg,Fe)2((Si,Al)4O10)(OH)2 · 4H2O |
| Si | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Si | ⓘ Scapolite var. Wernerite | |
| Si | ⓘ Willemite | Zn2SiO4 |
| Si | ⓘ Wollastonite | Ca3(Si3O9) |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Fayalite-Forsterite Series | |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Hydrohalloysite | Al2Si2O5(OH)4 · 2H2O |
| Si | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| Si | ⓘ Bisbeeite | (Cu,Mg)SiO3 · nH2O |
| Si | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| P | Phosphorus | |
| P | ⓘ Beraunite | Fe63+(PO4)4O(OH)4 · 6H2O |
| P | ⓘ Chalcosiderite | CuFe63+(PO4)4(OH)8 · 4H2O |
| P | ⓘ Gormanite | (Fe2+,Mg)3(Al,Fe3+)4(PO4)4(OH)6 · 2H2O |
| P | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| P | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Scorzalite | Fe2+Al2(PO4)2(OH)2 |
| P | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| P | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| P | ⓘ Variscite | AlPO4 · 2H2O |
| P | ⓘ Variscite var. Ferrian Variscite | (Al,Fe)PO4 · 2H2O |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Aikinite | PbCuBiS3 |
| S | ⓘ Alabandite | MnS |
| S | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Anhydrite | CaSO4 |
| S | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| S | ⓘ Pyrite var. Gold-bearing Pyrite | FeS2 |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| S | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| S | ⓘ Bianchite | Zn(SO4) · 6H2O |
| S | ⓘ Bílinite | Fe2+Fe23+(SO4)4 · 22H2O |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Boothite | CuSO4 · 7H2O |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Botryogen | MgFe3+(SO4)2(OH) · 7H2O |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Canfieldite | Ag8SnS6 |
| S | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcanthite | CuSO4 · 5H2O |
| S | ⓘ Chalcoalumite | CuAl4(SO4)(OH)12 · 3H2O |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| S | ⓘ Chalcostibite | CuSbS2 |
| S | ⓘ Cinnabar | HgS |
| S | ⓘ Colusite | Cu13VAs3S16 |
| S | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| S | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| S | ⓘ Coquimbite | AlFe3(SO4)6(H2O)12 · 6H2O |
| S | ⓘ Cosalite | Pb2Bi2S5 |
| S | ⓘ Covellite | CuS |
| S | ⓘ Cuprocopiapite | Cu2+Fe43+(SO4)6(OH)2 · 20H2O |
| S | ⓘ Cupropavonite | Cu0.9Ag0.5Pb0.6Bi2.5S5 |
| S | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| S | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| S | ⓘ Digenite | Cu9S5 |
| S | ⓘ Djurleite | Cu31S16 |
| S | ⓘ Emplectite | CuBiS2 |
| S | ⓘ Enargite | Cu3AsS4 |
| S | ⓘ Epsomite | MgSO4 · 7H2O |
| S | ⓘ Famatinite | Cu3SbS4 |
| S | ⓘ Felsőbányaite | Al4(SO4)(OH)10 · 4H2O |
| S | ⓘ Ferricopiapite | Fe3+0.67Fe43+(SO4)6(OH)2 · 20H2O |
| S | ⓘ Fibroferrite | Fe3+(SO4)(OH) · 5H2O |
| S | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| S | ⓘ Furutobeite | (Cu,Ag)6PbS4 |
| S | ⓘ Galena | PbS |
| S | ⓘ Goldfieldite | (Cu4◻2)(Cu4Cu2+)Te4S12S |
| S | ⓘ Goslarite | ZnSO4 · 7H2O |
| S | ⓘ Greenockite | CdS |
| S | ⓘ Gunningite | ZnSO4 · H2O |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Halotrichite | FeAl2(SO4)4 · 22H2O |
| S | ⓘ Hexahydrite | MgSO4 · 6H2O |
| S | ⓘ Hocartite | Ag2(Fe2+,Zn)SnS4 |
| S | ⓘ Hodrušite | Cu8Bi12S22 |
| S | ⓘ Hydrobasaluminite | Al4(SO4)(OH)10 · 12-36H2O |
| S | ⓘ Jalpaite | Ag3CuS2 |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Johannite | Cu(UO2)2(SO4)2(OH)2 · 8H2O |
| S | ⓘ Kësterite | Cu2ZnSnS4 |
| S | ⓘ Kiddcreekite | Cu6SnWS8 |
| S | ⓘ Kornelite | Fe2(SO4)3 · 7H2O |
| S | ⓘ Krupkaite | PbCuBi3S6 |
| S | ⓘ Ktenasite | ZnCu4(SO4)2(OH)6 · 6H2O |
| S | ⓘ Kuramite | Cu3SnS4 |
| S | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| S | ⓘ Linarite | PbCu(SO4)(OH)2 |
| S | ⓘ Luzonite | Cu3AsS4 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Matildite | AgBiS2 |
| S | ⓘ Mawsonite | Cu6Fe2SnS8 |
| S | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| S | ⓘ Metavoltine | K2Na6Fe2+Fe63+O2(SO4)12 · 18H2O |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Nekrasovite | Cu26V2(Sn,As,Sb)6S32 |
| S | ⓘ Osarizawaite | Pb(Al2Cu2+)(SO4)2(OH)6 |
| S | ⓘ Paracoquimbite | Fe4(SO4)6(H2O)12 · 6H2O |
| S | ⓘ Pearceite | [Ag6As2S7][Ag9CuS4] |
| S | ⓘ Pickeringite | MgAl2(SO4)4 · 22H2O |
| S | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| S | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| S | ⓘ Pyrargyrite | Ag3SbS3 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Ransomite | CuFe2(SO4)4 · 6H2O |
| S | ⓘ Rhodostannite | Cu1+(Fe2+0.5Sn4+1.5)S4 |
| S | ⓘ Rhomboclase | (H5O2)Fe3+(SO4)2 · 2H2O |
| S | ⓘ Römerite | Fe2+Fe23+(SO4)4 · 14H2O |
| S | ⓘ Roquesite | CuInS2 |
| S | ⓘ Rozenite | FeSO4 · 4H2O |
| S | ⓘ Siderotil | FeSO4 · 5H2O |
| S | ⓘ Spangolite | Cu6Al(SO4)(OH)12Cl · 3H2O |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Spionkopite | Cu39S28 |
| S | ⓘ Stannite | Cu2FeSnS4 |
| S | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| S | ⓘ Stromeyerite | AgCuS |
| S | ⓘ Native Sulphur | S8 |
| S | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| S | ⓘ Szomolnokite | FeSO4 · H2O |
| S | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| S | ⓘ Tetradymite | Bi2Te2S |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Tungstenite | WS2 |
| S | ⓘ Uranopilite | (UO2)6(SO4)O2(OH)6 · 14H2O |
| S | ⓘ Velikite | Cu2HgSnS4 |
| S | ⓘ Voltaite | K2Fe52+Fe33+Al(SO4)12 · 18H2O |
| S | ⓘ Wittichenite | Cu3BiS3 |
| S | ⓘ Yarrowite | Cu9S8 |
| S | ⓘ Zincobotryogen | (Zn,Mg,Mn2+)Fe3+(SO4)2(OH) · 7H2O |
| S | ⓘ Zincocopiapite | ZnFe43+(SO4)6(OH)2 · 18H2O |
| S | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| S | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| S | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| S | ⓘ Wittichenite var. Silver-bearing Wittichenite | (Cu,Ag)3BiS3 |
| Cl | Chlorine | |
| Cl | ⓘ Anthonyite | Cu(OH,Cl)2 · 3H2O |
| Cl | ⓘ Atacamite | Cu2(OH)3Cl |
| Cl | ⓘ Botallackite | Cu2(OH)3Cl |
| Cl | ⓘ Buttgenbachite | Cu19(NO3)2(OH)32Cl4 · 2H2O |
| Cl | ⓘ Chlorargyrite | AgCl |
| Cl | ⓘ Claringbullite | Cu4ClF(OH)6 |
| Cl | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Cl | ⓘ Chlorargyrite var. Bromian Chlorargyrite | Ag(Cl,Br) |
| Cl | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Cl | ⓘ Murdochite | Cu12Pb2O15Cl2 |
| Cl | ⓘ Nantokite | CuCl |
| Cl | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Cl | ⓘ Spangolite | Cu6Al(SO4)(OH)12Cl · 3H2O |
| Cl | ⓘ Tolbachite | CuCl2 |
| Cl | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Cl | ⓘ Scapolite var. Wernerite | |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| K | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| K | ⓘ Hydrobiotite | K(Mg,Fe2+)6((Si,Al)8O20)(OH)4 · nH2O |
| K | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| K | ⓘ Metavoltine | K2Na6Fe2+Fe63+O2(SO4)12 · 18H2O |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| K | ⓘ Roscoelite | KV23+(AlSi3O10)(OH)2 |
| K | ⓘ Sanidine | K(AlSi3O8) |
| K | ⓘ Voltaite | K2Fe52+Fe33+Al(SO4)12 · 18H2O |
| K | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Ca | ⓘ Anhydrite | CaSO4 |
| Ca | ⓘ Anorthite | Ca(Al2Si2O8) |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| Ca | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Kettnerite | CaBiCO3OF |
| Ca | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Ca | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Ca | ⓘ Lime | CaO |
| Ca | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| Ca | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Ca | ⓘ Neltnerite | CaMn63+(SiO4)O8 |
| Ca | ⓘ Powellite | Ca(MoO4) |
| Ca | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Ca | ⓘ Pumpellyite Subgroup | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Stevensite | (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| Ca | ⓘ Thomsonite-Ca | NaCa2[Al5Si5O20] · 6H2O |
| Ca | ⓘ Tilasite | CaMg(AsO4)F |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Tyuyamunite | Ca(UO2)2(VO4)2 · 5-8H2O |
| Ca | ⓘ Volkonskoite | Ca0.3(Cr,Mg,Fe)2((Si,Al)4O10)(OH)2 · 4H2O |
| Ca | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Ca | ⓘ Scapolite var. Wernerite | |
| Ca | ⓘ Wollastonite | Ca3(Si3O9) |
| Ca | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| Ca | ⓘ Aragonite var. Flos Ferri | CaCO3 |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ti | Titanium | |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Brookite | TiO2 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| V | Vanadium | |
| V | ⓘ Colusite | Cu13VAs3S16 |
| V | ⓘ Descloizite var. Copper-bearing Descloizite | Pb(Zn,Cu)VO4OH |
| V | ⓘ Descloizite | PbZn(VO4)(OH) |
| V | ⓘ Mottramite | PbCu(VO4)(OH) |
| V | ⓘ Nekrasovite | Cu26V2(Sn,As,Sb)6S32 |
| V | ⓘ Nolanite | V83+Fe23+O14(OH)2 |
| V | ⓘ Roscoelite | KV23+(AlSi3O10)(OH)2 |
| V | ⓘ Sengierite | Cu2(UO2)2(VO4)2 · 6H2O |
| V | ⓘ Tyuyamunite | Ca(UO2)2(VO4)2 · 5-8H2O |
| V | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Cr | Chromium | |
| Cr | ⓘ Chromite | Fe2+Cr23+O4 |
| Cr | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| Cr | ⓘ Volkonskoite | Ca0.3(Cr,Mg,Fe)2((Si,Al)4O10)(OH)2 · 4H2O |
| Mn | Manganese | |
| Mn | ⓘ Alabandite | MnS |
| Mn | ⓘ Bixbyite-(Mn) | Mn23+O3 |
| Mn | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| Mn | ⓘ Cesàrolite | PbMn34+O6(OH)2 |
| Mn | ⓘ Chalcophanite | ZnMn34+O7 · 3H2O |
| Mn | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| Mn | ⓘ Crednerite | Cu+Mn3+O2 |
| Mn | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| Mn | ⓘ Groutite | Mn3+O(OH) |
| Mn | ⓘ Hausmannite | Mn2+Mn23+O4 |
| Mn | ⓘ Hetaerolite | ZnMn2O4 |
| Mn | ⓘ Hübnerite | MnWO4 |
| Mn | ⓘ Hetaerolite var. Hydrohetaerolite | Zn(Mn,◻)2(O,OH)4 |
| Mn | ⓘ Jacobsite | Mn2+Fe23+O4 |
| Mn | ⓘ Manganite | Mn3+O(OH) |
| Mn | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| Mn | ⓘ Neltnerite | CaMn63+(SiO4)O8 |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Rhodochrosite | MnCO3 |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Fe | ⓘ Pyrite var. Gold-bearing Pyrite | FeS2 |
| Fe | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| Fe | ⓘ Beraunite | Fe63+(PO4)4O(OH)4 · 6H2O |
| Fe | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| Fe | ⓘ Bílinite | Fe2+Fe23+(SO4)4 · 22H2O |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bogdanovite | (Au,Te,Pb)3(Cu,Fe) |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Botryogen | MgFe3+(SO4)2(OH) · 7H2O |
| Fe | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| Fe | ⓘ Chalcosiderite | CuFe63+(PO4)4(OH)8 · 4H2O |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chamosite | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| Fe | ⓘ Chromite | Fe2+Cr23+O4 |
| Fe | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| Fe | ⓘ Coquimbite | AlFe3(SO4)6(H2O)12 · 6H2O |
| Fe | ⓘ Cuprocopiapite | Cu2+Fe43+(SO4)6(OH)2 · 20H2O |
| Fe | ⓘ Delafossite | Cu+Fe3+O2 |
| Fe | ⓘ Delessite | (Mg,Fe,Fe,Al)(Si,Al)4O10(O,OH)8 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Ferricopiapite | Fe3+0.67Fe43+(SO4)6(OH)2 · 20H2O |
| Fe | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| Fe | ⓘ Fibroferrite | Fe3+(SO4)(OH) · 5H2O |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Gormanite | (Fe2+,Mg)3(Al,Fe3+)4(PO4)4(OH)6 · 2H2O |
| Fe | ⓘ Halotrichite | FeAl2(SO4)4 · 22H2O |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| Fe | ⓘ Hocartite | Ag2(Fe2+,Zn)SnS4 |
| Fe | ⓘ Hydrobiotite | K(Mg,Fe2+)6((Si,Al)8O20)(OH)4 · nH2O |
| Fe | ⓘ Jacobsite | Mn2+Fe23+O4 |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Kornelite | Fe2(SO4)3 · 7H2O |
| Fe | ⓘ Lepidocrocite | Fe3+O(OH) |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Mawsonite | Cu6Fe2SnS8 |
| Fe | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| Fe | ⓘ Metavoltine | K2Na6Fe2+Fe63+O2(SO4)12 · 18H2O |
| Fe | ⓘ Nolanite | V83+Fe23+O14(OH)2 |
| Fe | ⓘ Paracoquimbite | Fe4(SO4)6(H2O)12 · 6H2O |
| Fe | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| Fe | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Ransomite | CuFe2(SO4)4 · 6H2O |
| Fe | ⓘ Rhodostannite | Cu1+(Fe2+0.5Sn4+1.5)S4 |
| Fe | ⓘ Rhomboclase | (H5O2)Fe3+(SO4)2 · 2H2O |
| Fe | ⓘ Römerite | Fe2+Fe23+(SO4)4 · 14H2O |
| Fe | ⓘ Rozenite | FeSO4 · 4H2O |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Scorzalite | Fe2+Al2(PO4)2(OH)2 |
| Fe | ⓘ Siderotil | FeSO4 · 5H2O |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Stannite | Cu2FeSnS4 |
| Fe | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| Fe | ⓘ Szomolnokite | FeSO4 · H2O |
| Fe | ⓘ Volkonskoite | Ca0.3(Cr,Mg,Fe)2((Si,Al)4O10)(OH)2 · 4H2O |
| Fe | ⓘ Voltaite | K2Fe52+Fe33+Al(SO4)12 · 18H2O |
| Fe | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Fe | ⓘ Zincobotryogen | (Zn,Mg,Mn2+)Fe3+(SO4)2(OH) · 7H2O |
| Fe | ⓘ Zincocopiapite | ZnFe43+(SO4)6(OH)2 · 18H2O |
| Fe | ⓘ Hematite var. Specularite | Fe2O3 |
| Fe | ⓘ Fayalite-Forsterite Series | |
| Fe | ⓘ Variscite var. Ferrian Variscite | (Al,Fe)PO4 · 2H2O |
| Ni | Nickel | |
| Ni | ⓘ Melonite | NiTe2 |
| Ni | ⓘ Rammelsbergite | NiAs2 |
| Cu | Copper | |
| Cu | ⓘ Aikinite | PbCuBiS3 |
| Cu | ⓘ Anthonyite | Cu(OH,Cl)2 · 3H2O |
| Cu | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| Cu | ⓘ Atacamite | Cu2(OH)3Cl |
| Cu | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| Cu | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| Cu | ⓘ Bogdanovite | (Au,Te,Pb)3(Cu,Fe) |
| Cu | ⓘ Boothite | CuSO4 · 7H2O |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Botallackite | Cu2(OH)3Cl |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Buttgenbachite | Cu19(NO3)2(OH)32Cl4 · 2H2O |
| Cu | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| Cu | ⓘ Chalcosiderite | CuFe63+(PO4)4(OH)8 · 4H2O |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcanthite | CuSO4 · 5H2O |
| Cu | ⓘ Chalcoalumite | CuAl4(SO4)(OH)12 · 3H2O |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Cuprite var. Chalcotrichite | Cu2O |
| Cu | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| Cu | ⓘ Chalcostibite | CuSbS2 |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Claringbullite | Cu4ClF(OH)6 |
| Cu | ⓘ Colusite | Cu13VAs3S16 |
| Cu | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| Cu | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Crednerite | Cu+Mn3+O2 |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Cuprocopiapite | Cu2+Fe43+(SO4)6(OH)2 · 20H2O |
| Cu | ⓘ Descloizite var. Copper-bearing Descloizite | Pb(Zn,Cu)VO4OH |
| Cu | ⓘ Cupropavonite | Cu0.9Ag0.5Pb0.6Bi2.5S5 |
| Cu | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Delafossite | Cu+Fe3+O2 |
| Cu | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Cu | ⓘ Digenite | Cu9S5 |
| Cu | ⓘ Dioptase | CuSiO3 · H2O |
| Cu | ⓘ Djurleite | Cu31S16 |
| Cu | ⓘ Emplectite | CuBiS2 |
| Cu | ⓘ Enargite | Cu3AsS4 |
| Cu | ⓘ Famatinite | Cu3SbS4 |
| Cu | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| Cu | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Cu | ⓘ Furutobeite | (Cu,Ag)6PbS4 |
| Cu | ⓘ Goldfieldite | (Cu4◻2)(Cu4Cu2+)Te4S12S |
| Cu | ⓘ Graemite | Cu[TeO3] · H2O |
| Cu | ⓘ Hodrušite | Cu8Bi12S22 |
| Cu | ⓘ Henryite | (Cu,Ag)3+xTe2 , with x ~ 0.40 |
| Cu | ⓘ Jalpaite | Ag3CuS2 |
| Cu | ⓘ Johannite | Cu(UO2)2(SO4)2(OH)2 · 8H2O |
| Cu | ⓘ Kësterite | Cu2ZnSnS4 |
| Cu | ⓘ Kiddcreekite | Cu6SnWS8 |
| Cu | ⓘ Kostovite | CuAuTe4 |
| Cu | ⓘ Krupkaite | PbCuBi3S6 |
| Cu | ⓘ Ktenasite | ZnCu4(SO4)2(OH)6 · 6H2O |
| Cu | ⓘ Kuramite | Cu3SnS4 |
| Cu | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Cu | ⓘ Liroconite | Cu2Al(AsO4)(OH)4 · 4H2O |
| Cu | ⓘ Luzonite | Cu3AsS4 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Mawsonite | Cu6Fe2SnS8 |
| Cu | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| Cu | ⓘ Miersite | (Ag,Cu)I |
| Cu | ⓘ Mottramite | PbCu(VO4)(OH) |
| Cu | ⓘ Murdochite | Cu12Pb2O15Cl2 |
| Cu | ⓘ Nantokite | CuCl |
| Cu | ⓘ Nekrasovite | Cu26V2(Sn,As,Sb)6S32 |
| Cu | ⓘ Osarizawaite | Pb(Al2Cu2+)(SO4)2(OH)6 |
| Cu | ⓘ Paramelaconite | Cu21+Cu22+O3 |
| Cu | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| Cu | ⓘ Pearceite | [Ag6As2S7][Ag9CuS4] |
| Cu | ⓘ Plancheite | Cu8(Si8O22)(OH)4 · H2O |
| Cu | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| Cu | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| Cu | ⓘ Ransomite | CuFe2(SO4)4 · 6H2O |
| Cu | ⓘ Rhodostannite | Cu1+(Fe2+0.5Sn4+1.5)S4 |
| Cu | ⓘ Rickardite | Cu7Te5 |
| Cu | ⓘ Roquesite | CuInS2 |
| Cu | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Cu | ⓘ Sengierite | Cu2(UO2)2(VO4)2 · 6H2O |
| Cu | ⓘ Shattuckite | Cu5(Si2O6)2(OH)2 |
| Cu | ⓘ Spangolite | Cu6Al(SO4)(OH)12Cl · 3H2O |
| Cu | ⓘ Spertiniite | Cu(OH)2 |
| Cu | ⓘ Spionkopite | Cu39S28 |
| Cu | ⓘ Stannite | Cu2FeSnS4 |
| Cu | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| Cu | ⓘ Stromeyerite | AgCuS |
| Cu | ⓘ Teineite | Cu2+(Te4+O3) · 2H2O |
| Cu | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Cu | ⓘ Tenorite | CuO |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Tolbachite | CuCl2 |
| Cu | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| Cu | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| Cu | ⓘ Velikite | Cu2HgSnS4 |
| Cu | ⓘ Wittichenite | Cu3BiS3 |
| Cu | ⓘ Yarrowite | Cu9S8 |
| Cu | ⓘ Tenorite var. Geltenorite | CuO |
| Cu | ⓘ Hoganite | Cu(CH3COO)2 · H2O |
| Cu | ⓘ Wittichenite var. Silver-bearing Wittichenite | (Cu,Ag)3BiS3 |
| Cu | ⓘ Bisbeeite | (Cu,Mg)SiO3 · nH2O |
| Cu | ⓘ Barlowite | Cu4BrF(OH)6 |
| Cu | ⓘ Eddavidite | Cu12Pb2O15Br2 |
| Zn | Zinc | |
| Zn | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Zn | ⓘ Bianchite | Zn(SO4) · 6H2O |
| Zn | ⓘ Chalcophanite | ZnMn34+O7 · 3H2O |
| Zn | ⓘ Descloizite var. Copper-bearing Descloizite | Pb(Zn,Cu)VO4OH |
| Zn | ⓘ Descloizite | PbZn(VO4)(OH) |
| Zn | ⓘ Goslarite | ZnSO4 · 7H2O |
| Zn | ⓘ Gunningite | ZnSO4 · H2O |
| Zn | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Zn | ⓘ Hetaerolite | ZnMn2O4 |
| Zn | ⓘ Hocartite | Ag2(Fe2+,Zn)SnS4 |
| Zn | ⓘ Hetaerolite var. Hydrohetaerolite | Zn(Mn,◻)2(O,OH)4 |
| Zn | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| Zn | ⓘ Kësterite | Cu2ZnSnS4 |
| Zn | ⓘ Ktenasite | ZnCu4(SO4)2(OH)6 · 6H2O |
| Zn | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| Zn | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Zn | ⓘ Smithsonite | ZnCO3 |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| Zn | ⓘ Willemite | Zn2SiO4 |
| Zn | ⓘ Zincobotryogen | (Zn,Mg,Mn2+)Fe3+(SO4)2(OH) · 7H2O |
| Zn | ⓘ Zincocopiapite | ZnFe43+(SO4)6(OH)2 · 18H2O |
| As | Arsenic | |
| As | ⓘ Native Arsenic | As |
| As | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| As | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| As | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| As | ⓘ Colusite | Cu13VAs3S16 |
| As | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| As | ⓘ Enargite | Cu3AsS4 |
| As | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| As | ⓘ Liroconite | Cu2Al(AsO4)(OH)4 · 4H2O |
| As | ⓘ Luzonite | Cu3AsS4 |
| As | ⓘ Mimetite | Pb5(AsO4)3Cl |
| As | ⓘ Nekrasovite | Cu26V2(Sn,As,Sb)6S32 |
| As | ⓘ Pearceite | [Ag6As2S7][Ag9CuS4] |
| As | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| As | ⓘ Rammelsbergite | NiAs2 |
| As | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| As | ⓘ Tilasite | CaMg(AsO4)F |
| Br | Bromine | |
| Br | ⓘ Bromargyrite | AgBr |
| Br | ⓘ Chlorargyrite var. Bromian Chlorargyrite | Ag(Cl,Br) |
| Br | ⓘ Barlowite | Cu4BrF(OH)6 |
| Br | ⓘ Eddavidite | Cu12Pb2O15Br2 |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Mo | Molybdenum | |
| Mo | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| Mo | ⓘ Ilsemannite | Mo3O8 · nH2O |
| Mo | ⓘ Molybdenite | MoS2 |
| Mo | ⓘ Powellite | Ca(MoO4) |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Bromargyrite | AgBr |
| Ag | ⓘ Canfieldite | Ag8SnS6 |
| Ag | ⓘ Chlorargyrite | AgCl |
| Ag | ⓘ Cupropavonite | Cu0.9Ag0.5Pb0.6Bi2.5S5 |
| Ag | ⓘ Dyscrasite | Ag3Sb |
| Ag | ⓘ Native Gold var. Electrum | (Au,Ag) |
| Ag | ⓘ Chlorargyrite var. Bromian Chlorargyrite | Ag(Cl,Br) |
| Ag | ⓘ Eugenite | Ag11Hg2 |
| Ag | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Ag | ⓘ Furutobeite | (Cu,Ag)6PbS4 |
| Ag | ⓘ Hessite | Ag2Te |
| Ag | ⓘ Hocartite | Ag2(Fe2+,Zn)SnS4 |
| Ag | ⓘ Henryite | (Cu,Ag)3+xTe2 , with x ~ 0.40 |
| Ag | ⓘ Iodargyrite | AgI |
| Ag | ⓘ Jalpaite | Ag3CuS2 |
| Ag | ⓘ Krennerite | Au3AgTe8 |
| Ag | ⓘ Matildite | AgBiS2 |
| Ag | ⓘ Miersite | (Ag,Cu)I |
| Ag | ⓘ Pearceite | [Ag6As2S7][Ag9CuS4] |
| Ag | ⓘ Petzite | Ag3AuTe2 |
| Ag | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| Ag | ⓘ Pyrargyrite | Ag3SbS3 |
| Ag | ⓘ Native Silver | Ag |
| Ag | ⓘ Stromeyerite | AgCuS |
| Ag | ⓘ Stützite | Ag5-xTe3, x = 0.24-0.36 |
| Ag | ⓘ Sylvanite | AgAuTe4 |
| Ag | ⓘ Volynskite | AgBiTe2 |
| Ag | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| Ag | ⓘ Wittichenite var. Silver-bearing Wittichenite | (Cu,Ag)3BiS3 |
| Cd | Cadmium | |
| Cd | ⓘ Greenockite | CdS |
| In | Indium | |
| In | ⓘ Roquesite | CuInS2 |
| Sn | Tin | |
| Sn | ⓘ Canfieldite | Ag8SnS6 |
| Sn | ⓘ Cassiterite | SnO2 |
| Sn | ⓘ Hocartite | Ag2(Fe2+,Zn)SnS4 |
| Sn | ⓘ Kësterite | Cu2ZnSnS4 |
| Sn | ⓘ Kiddcreekite | Cu6SnWS8 |
| Sn | ⓘ Kuramite | Cu3SnS4 |
| Sn | ⓘ Mawsonite | Cu6Fe2SnS8 |
| Sn | ⓘ Nekrasovite | Cu26V2(Sn,As,Sb)6S32 |
| Sn | ⓘ Rhodostannite | Cu1+(Fe2+0.5Sn4+1.5)S4 |
| Sn | ⓘ Stannite | Cu2FeSnS4 |
| Sn | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| Sn | ⓘ Velikite | Cu2HgSnS4 |
| Sb | Antimony | |
| Sb | ⓘ Bindheimite | Pb2Sb2O6O |
| Sb | ⓘ Chalcostibite | CuSbS2 |
| Sb | ⓘ Dyscrasite | Ag3Sb |
| Sb | ⓘ Famatinite | Cu3SbS4 |
| Sb | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Sb | ⓘ Nekrasovite | Cu26V2(Sn,As,Sb)6S32 |
| Sb | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| Sb | ⓘ Pyrargyrite | Ag3SbS3 |
| Sb | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Te | Tellurium | |
| Te | ⓘ Altaite | PbTe |
| Te | ⓘ Bogdanovite | (Au,Te,Pb)3(Cu,Fe) |
| Te | ⓘ Calaverite | AuTe2 |
| Te | ⓘ Goldfieldite | (Cu4◻2)(Cu4Cu2+)Te4S12S |
| Te | ⓘ Graemite | Cu[TeO3] · H2O |
| Te | ⓘ Hessite | Ag2Te |
| Te | ⓘ Henryite | (Cu,Ag)3+xTe2 , with x ~ 0.40 |
| Te | ⓘ Kostovite | CuAuTe4 |
| Te | ⓘ Krennerite | Au3AgTe8 |
| Te | ⓘ Melonite | NiTe2 |
| Te | ⓘ Paratellurite | TeO2 |
| Te | ⓘ Petzite | Ag3AuTe2 |
| Te | ⓘ Rickardite | Cu7Te5 |
| Te | ⓘ Rucklidgeite | PbBi2Te4 |
| Te | ⓘ Stützite | Ag5-xTe3, x = 0.24-0.36 |
| Te | ⓘ Sylvanite | AgAuTe4 |
| Te | ⓘ Teineite | Cu2+(Te4+O3) · 2H2O |
| Te | ⓘ Tellurite | TeO2 |
| Te | ⓘ Native Tellurium | Te |
| Te | ⓘ Tellurobismuthite | Bi2Te3 |
| Te | ⓘ Tetradymite | Bi2Te2S |
| Te | ⓘ Volynskite | AgBiTe2 |
| I | Iodine | |
| I | ⓘ Iodargyrite | AgI |
| I | ⓘ Miersite | (Ag,Cu)I |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| W | Tungsten | |
| W | ⓘ Hübnerite | MnWO4 |
| W | ⓘ Kiddcreekite | Cu6SnWS8 |
| W | ⓘ Scheelite | Ca(WO4) |
| W | ⓘ Stolzite | Pb(WO4) |
| W | ⓘ Tungstenite | WS2 |
| Au | Gold | |
| Au | ⓘ Bogdanovite | (Au,Te,Pb)3(Cu,Fe) |
| Au | ⓘ Calaverite | AuTe2 |
| Au | ⓘ Native Gold var. Electrum | (Au,Ag) |
| Au | ⓘ Native Gold | Au |
| Au | ⓘ Kostovite | CuAuTe4 |
| Au | ⓘ Krennerite | Au3AgTe8 |
| Au | ⓘ Petzite | Ag3AuTe2 |
| Au | ⓘ Sylvanite | AgAuTe4 |
| Hg | Mercury | |
| Hg | ⓘ Cinnabar | HgS |
| Hg | ⓘ Eugenite | Ag11Hg2 |
| Hg | ⓘ Velikite | Cu2HgSnS4 |
| Pb | Lead | |
| Pb | ⓘ Aikinite | PbCuBiS3 |
| Pb | ⓘ Altaite | PbTe |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| Pb | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| Pb | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| Pb | ⓘ Bindheimite | Pb2Sb2O6O |
| Pb | ⓘ Bogdanovite | (Au,Te,Pb)3(Cu,Fe) |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Cesàrolite | PbMn34+O6(OH)2 |
| Pb | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| Pb | ⓘ Cosalite | Pb2Bi2S5 |
| Pb | ⓘ Descloizite var. Copper-bearing Descloizite | Pb(Zn,Cu)VO4OH |
| Pb | ⓘ Cupropavonite | Cu0.9Ag0.5Pb0.6Bi2.5S5 |
| Pb | ⓘ Descloizite | PbZn(VO4)(OH) |
| Pb | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| Pb | ⓘ Furutobeite | (Cu,Ag)6PbS4 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| Pb | ⓘ Krupkaite | PbCuBi3S6 |
| Pb | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| Pb | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Pb | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Pb | ⓘ Minium | Pb3O4 |
| Pb | ⓘ Mottramite | PbCu(VO4)(OH) |
| Pb | ⓘ Murdochite | Cu12Pb2O15Cl2 |
| Pb | ⓘ Osarizawaite | Pb(Al2Cu2+)(SO4)2(OH)6 |
| Pb | ⓘ Plattnerite | PbO2 |
| Pb | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Pb | ⓘ Rucklidgeite | PbBi2Te4 |
| Pb | ⓘ Stolzite | Pb(WO4) |
| Pb | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| Pb | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| Pb | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| Pb | ⓘ Eddavidite | Cu12Pb2O15Br2 |
| Bi | Bismuth | |
| Bi | ⓘ Aikinite | PbCuBiS3 |
| Bi | ⓘ Bismite | Bi2O3 |
| Bi | ⓘ Native Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Bismutite | (BiO)2CO3 |
| Bi | ⓘ Cosalite | Pb2Bi2S5 |
| Bi | ⓘ Cupropavonite | Cu0.9Ag0.5Pb0.6Bi2.5S5 |
| Bi | ⓘ Emplectite | CuBiS2 |
| Bi | ⓘ Hodrušite | Cu8Bi12S22 |
| Bi | ⓘ Kettnerite | CaBiCO3OF |
| Bi | ⓘ Krupkaite | PbCuBi3S6 |
| Bi | ⓘ Matildite | AgBiS2 |
| Bi | ⓘ Rucklidgeite | PbBi2Te4 |
| Bi | ⓘ Tellurobismuthite | Bi2Te3 |
| Bi | ⓘ Tetradymite | Bi2Te2S |
| Bi | ⓘ Volynskite | AgBiTe2 |
| Bi | ⓘ Wittichenite | Cu3BiS3 |
| Bi | ⓘ Wittichenite var. Silver-bearing Wittichenite | (Cu,Ag)3BiS3 |
| U | Uranium | |
| U | ⓘ Bayleyite | Mg2(UO2)(CO3)3 · 18H2O |
| U | ⓘ Johannite | Cu(UO2)2(SO4)2(OH)2 · 8H2O |
| U | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| U | ⓘ Sengierite | Cu2(UO2)2(VO4)2 · 6H2O |
| U | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| U | ⓘ Tyuyamunite | Ca(UO2)2(VO4)2 · 5-8H2O |
| U | ⓘ Uraninite | UO2 |
| U | ⓘ Uranopilite | (UO2)6(SO4)O2(OH)6 · 14H2O |
| U | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
Localities in this Region
- Arizona
- Cochise County
- ⭔Bisbee
- Atlanta Mine
- Atlas claim
- Bay State Mine
- Bisbee SE No. 1 Limestone occurrence
- Black Jack Mine
- Bounty Mine
- Brewery Gulch
- Calumet and Arizona group of claims
- Campbell Mine
- Cave Mine
- Cochise Project
- Cochise property
- Cole Mine
- Copper King Mine
- Copper Prince Mine
- Copperopolis Mine
- Crown King claim
- Dallas Mine
- Danville-Hanchetta claims
- Denn Mine
- Dreadnaught Mine
- Escabrosa Ridge
- Galena Mine
- Garfield Mine
- Gold Gulch
- Gold Hill
- Hendricks Gulch
- Higgins Mine
- Ivanhoe Mine
- John D. Jr. claim
- Juniper Flats
- ⭔Bisbee
- Cochise County
- Arizona
- Cochise County
- Bisbee
- Lavender Pit
- ⭔Lavender pit area
- ⭔Lowell
- Lowell Mine
- Mammoth claim
- Marquette Mine
- Neptune Mine
- New York Mine
- Northwest of Bisbee
- Ohio Mine
- Queen Hill
- Ramsey Canyon
- Sacramento Hill
- Saginaw Mine
- Shattuck Mine
- Sunrise Shaft
- Superior Mine
- W.M.A. claim
- Wade Hampton Mine
- ⭔Warren
- Waterloo Mine
- White Tail Deer Mine
- Wolverine Mine
- Bisbee Blue Mine
- Calumet and Cochise Mine
- Captain prospect
- Caretto claim group
- Cochise Queen prospect
- Congdon Mine
- Copper King prospect (Copper King of Arizona prospect)
- Cuprite Mine
- Don Luis pit
- East Side Mine
- Glance Mine
- Granville & Unknown claims
- Illinois Mine
- Inspiration group
- Lucky Strike prospect
- Lucky Swede lode
- Modern prospect
- Mountain View Mine
- North of the Dividend fault
- Portage Lake & Bisbee Mining Company shaft (Portage Lake & Calumet Development Co. property)
- San Juan Mine
- Silver Bear Mine
- Tombstone Canyon
- Uncle Sam Gulch
- Unidentified Silica Quarry
- Unknown No. 2 claim
- Unspecified mine
- Warren Basin Leasing and Development Co. property
- ⭔White Tail Deer Mine area
- Yakima Dolomite occurrence
- Bisbee
- Cochise County
Other Regions, Features and Areas that Intersect
Mexico
- Sierra Madre OccidentalMountain Range
North AmericaContinent
- Sonoran DesertDesert
North America PlateTectonic Plate
- Basin and Range BasinsBasin
- Mazatzal DomainDomain
- Pedregosa BasinBasin
- Southern Basin and RangeWide Rift
USA
- Arizona
- Cochise County
- Mule MountainsMountain Range
- Cochise County
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Palache, Charles, Shannon, Earl. V. (1920) Higginsite, a new mineral of the olivenite group. American Mineralogist, 5 (9) 155-157
Hewett, Donnel Foster, Rove, Olaf N. (1930) Occurrence and relations of alabandite. Economic Geology, 25 (1) 36-56 doi:10.2113/gsecongeo.25.1.36
Taber, Stephen, Schaller, Waldemar T. (1930) Psittacinite from the Higgins Mine, Bisbee, Arizona. American Mineralogist, 15 (12) 575-578
Trischka, C. (1931), Bisbee orebodies reviewed: Engineering & Mining Journal, Vol. 131(11): 500-505.
Schwartz, George Melvin (1934) Paragenesis of the oxidized ores of copper. Economic Geology, 29 (1) 55-75 doi:10.2113/gsecongeo.29.1.55
Frondel, Clifford (1941) Paramelaconite: a tetragonal oxide of copper. American Mineralogist, 26 (11) 657-672
Schwartz, George Melvin (1956) Argillic alteration and ore deposits. Economic Geology, 51 (5) 407-414 doi:10.2113/gsecongeo.51.5.407
Schwartz, George Melvin (1958) Alteration of biotite under mesothermal conditions. Economic Geology, 53 (2) 164-177 doi:10.2113/gsecongeo.53.2.164
Hewett, Donnel Foster, Fleischer, Michael (1960) Deposits of the manganese oxides. Economic Geology, 55 (1) 1-55 doi:10.2113/gsecongeo.55.1.1
Hewett, D. F., Fleischer, Michael, Conklin, Nancy (1963) Deposits of the manganese oxides: supplement. Economic Geology, 58 (1). 1-51 doi:10.2113/gsecongeo.58.1.1
(1973) Index of Mining Properties in Cochise County, Arizona. University of Arizona Bulletin 187. Arizona Bureau of Mines p.85 - Table 4
Warren Mining District, Cochise County, Arizona, USA