Mule Mountains, Cochise County, Arizona, USAi
| Regional Level Types | |
|---|---|
| Mule Mountains | Mountain Range |
| Cochise County | County |
| Arizona | State |
| USA | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
31° North , 109° West (est.)
Estimate based on other nearby localities or region boundaries.
Margin of Error:
~91km
Type:
Köppen climate type:
The Mule Mountains are approximately 20 miles long by 6 to 12 miles wide and attain a maximum altitude of 7,400 feet. They have been described as a large faulted and intruded northwest-trending anticline (Ransome, 1904). Parallel or coincident with the anticlinal axis is the Dividend fault, along which major movement took place after deposition of the Paleozoic rocks and before intrusion of the Juniper Flat Granite of Jurassic age. Vertical displacement on the fault was probably as great as 5,000 feet. On the upthrown block northeast of the Dividend fault, the Paleozoic rocks were removed by pre-Cretaceous erosion, and Cretaceous rocks there rest on Precambrian rocks and on the Juniper Flat Granite.
On the downthrown block southwest of the Dividend fault, the surface rocks are mainly Precambrian and Paleozoic rocks that have been intricately faulted and intruded by satellite dikes of the Juniper Flat Granite and later intrusive bodies. Most of the faults involving the Paleozoic rocks in the SW part of the Mule Mts trend either NW or NE, and are older than the Juniper Flat Granite. The faulting is of such magnitude and complexity that stratigraphic horizons can not be traced far laterally.
Both Bisbee and Warren lie along the Dividend fault in the middle of these mountains.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities291 valid minerals. 6 (TL) - type locality of valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Acanthite Formula: Ag2S |
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 Locality: Bisbee, Cochise County, Arizona, USA References: |
| ⓘ Aikinite Formula: PbCuBiS3 |
| ⓘ Alabandite Formula: MnS |
| ⓘ 'Allanite Group' Formula: (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Allophane Formula: (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| ⓘ Altaite Formula: PbTe |
| ⓘ Alunite Formula: KAl3(SO4)2(OH)6 |
| ⓘ Anatase Formula: TiO2 Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Andradite Formula: Ca3Fe3+2(SiO4)3 Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Anglesite Formula: PbSO4 Localities: Reported from at least 19 localities in this region. |
| ⓘ Anhydrite Formula: CaSO4 Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Anorthite Formula: Ca(Al2Si2O8) Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Anorthite var. Labradorite Formula: (Ca,Na)[Al(Al,Si)Si2O8] Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Anthonyite Formula: Cu(OH,Cl)2 · 3H2O Habit: Corroded crystals to 5mm or more Colour: Vivid violet Description: Occurs on the 1300 level. |
| ⓘ Antigorite Formula: Mg3(Si2O5)(OH)4 |
| ⓘ Antlerite Formula: Cu3(SO4)(OH)4 Localities: Reported from at least 6 localities in this region. |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Aragonite Formula: CaCO3 |
| ⓘ Aragonite var. Flos Ferri Formula: CaCO3 Locality: Bisbee, Cochise County, Arizona, USA Description: Magnificent coralloidal groups of flos ferri in limestone caverns. |
| ⓘ Atacamite Formula: Cu2(OH)3Cl References: |
| ⓘ Aurichalcite Formula: (Zn,Cu)5(CO3)2(OH)6 Localities: Bisbee, Cochise County, Arizona, USA Cole Mine, Bisbee, Cochise County, Arizona, USA Czar Mine, Copper Queen Mine, Queen Hill, Bisbee, Cochise County, Arizona, USA Copper Queen Mine, Queen Hill, Bisbee, Cochise County, Arizona, USA Holbrook Mine, Copper Queen Mine, Queen Hill, Bisbee, Cochise County, Arizona, USA |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 Localities: Reported from at least 13 localities in this region. |
| ⓘ Baryte Formula: BaSO4 Localities: Reported from at least 10 localities in this region. |
| ⓘ Bayldonite Formula: PbCu3(AsO4)2(OH)2 Locality: Bisbee, Cochise County, Arizona, USA References: |
| ⓘ Bayleyite Formula: Mg2(UO2)(CO3)3 · 18H2O |
| ⓘ Beaverite-(Cu) Formula: Pb(Fe3+2Cu)(SO4)2(OH)6 Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Beudantite Formula: PbFe3+3(AsO4)(SO4)(OH)6 Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Bílinite Formula: Fe2+Fe3+2(SO4)4 · 22H2O |
| ⓘ Bianchite Formula: Zn(SO4) · 6H2O Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ 'Bindheimite' Formula: Pb2Sb2O6O |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ 'Bisbeeite' Formula: (Cu,Mg)SiO3 · nH2O Colour: Blue Description: Occurs as pseudomorphs after shattuckite, which, in turn, is pseudomorphous after malachite. |
| ⓘ Bismite Formula: Bi2O3 |
| ⓘ Bismuthinite Formula: Bi2S3 |
| ⓘ Bismutite Formula: (BiO)2CO3 |
| ⓘ Bixbyite-(Mn) Formula: Mn3+2O3 |
| ⓘ Bogdanovite Formula: (Au,Te,Pb)3(Cu,Fe) |
| ⓘ Bornite Formula: Cu5FeS4 Localities: Reported from at least 31 localities in this region. |
| ⓘ Botryogen Formula: MgFe3+(SO4)2(OH) · 7H2O |
| ⓘ Böhmite Formula: AlO(OH) Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Braunite Formula: Mn2+Mn3+6(SiO4)O8 |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 Localities: Reported from at least 9 localities in this region. |
| ⓘ Bromargyrite Formula: AgBr |
| ⓘ Brookite Formula: TiO2 Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Brucite Formula: Mg(OH)2 |
| ⓘ Buttgenbachite Formula: Cu19(NO3)2(OH)32Cl4 · 2H2O |
| ⓘ Calaverite Formula: AuTe2 |
| ⓘ Calcite Formula: CaCO3 Localities: Reported from at least 22 localities in this region. |
| ⓘ Calcite var. Manganese-bearing Calcite Formula: (Ca,Mn)CO3 |
| ⓘ 'Campbellite' References: |
| ⓘ Canfieldite Formula: Ag8SnS6 |
| ⓘ Carbonatecyanotrichite Formula: Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| ⓘ Cassiterite Formula: SnO2 |
| ⓘ Celadonite Formula: K(MgFe3+◻)(Si4O10)(OH)2 Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Cerussite Formula: PbCO3 Localities: Reported from at least 6 localities in this region. |
| ⓘ Cesàrolite Formula: PbMn4+3O6(OH)2 Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Chalcanthite Formula: CuSO4 · 5H2O Localities: Description: Stalactites & fibrous crusts in old mine workings. |
| ⓘ Chalcoalumite (TL) Formula: CuAl4(SO4)(OH)12 · 3H2O Localities: Reported from at least 6 localities in this region. |
| ⓘ Chalcocite Formula: Cu2S Localities: Reported from at least 33 localities in this region. |
| ⓘ Chalcophanite Formula: ZnMn4+3O7 · 3H2O |
| ⓘ Chalcophyllite Formula: Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 28 localities in this region. |
| ⓘ Chalcosiderite Formula: CuFe3+6(PO4)4(OH)8 · 4H2O Localities: Description: In small quantities. |
| ⓘ Chalcostibite Formula: CuSbS2 |
| ⓘ Chamosite Formula: (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Chlorargyrite Formula: AgCl |
| ⓘ Chlorargyrite var. Bromian Chlorargyrite Formula: Ag(Cl,Br) Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ 'Chlorite Group' Localities: Habit: Isolated radial sprays; prisms to 1 cm long Description: Occurs cutting an equigranular tonalite. |
| ⓘ Chromite Formula: Fe2+Cr3+2O4 Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 Localities: Reported from at least 9 localities in this region. |
| ⓘ Chrysotile Formula: Mg3(Si2O5)(OH)4 Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Cinnabar Formula: HgS Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Claringbullite Formula: Cu4ClF(OH)6 |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ 'Clinochrysotile' Formula: Mg3(Si2O5)(OH)4 Localities: Description: Scaly, micaceous intergrowths with stevensite. |
| ⓘ Clinozoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Colusite Formula: Cu13VAs3S16 |
| ⓘ Conichalcite Formula: CaCu(AsO4)(OH) |
| ⓘ Connellite Formula: Cu19(SO4)(OH)32Cl4 · 3H2O Localities: Reported from at least 7 localities in this region. |
| ⓘ Copiapite Formula: Fe2+Fe3+4(SO4)6(OH)2 · 20H2O Localities: Habit: Crystals Colour: Bright yellow. Description: On the 2,100 foot level. |
| ⓘ Coquimbite Formula: AlFe3(SO4)6(H2O)12 · 6H2O |
| ⓘ Coronadite Formula: Pb(Mn4+6Mn3+2)O16 |
| ⓘ Cosalite Formula: Pb2Bi2S5 |
| ⓘ Covellite Formula: CuS Localities: Reported from at least 7 localities in this region. |
| ⓘ Crednerite Formula: Cu+Mn3+O2 |
| ⓘ Cryptomelane Formula: K(Mn4+7Mn3+)O16 |
| ⓘ Cuprite Formula: Cu2O Localities: Reported from at least 16 localities in this region. |
| ⓘ Cuprite var. Chalcotrichite Formula: Cu2O |
| ⓘ Cuprocopiapite Formula: Cu2+Fe3+4(SO4)6(OH)2 · 20H2O Description: Occurs on the 1800 level as a post-mining mineral. |
| ⓘ Cupropavonite Formula: Cu0.9Ag0.5Pb0.6Bi2.5S5 |
| ⓘ Cyanotrichite Formula: Cu4Al2(SO4)(OH)12 · 2H2O |
| ⓘ Delafossite Formula: Cu+Fe3+O2 Localities: Bisbee, Cochise County, Arizona, USA Cole Mine, Bisbee, Cochise County, Arizona, USA Copper Queen Mine, Queen Hill, Bisbee, Cochise County, Arizona, USA Junction Mine, Calumet and Arizona group of claims, Bisbee, Cochise County, Arizona, USA Hendricks Mine, Hendricks Gulch, Bisbee, Cochise County, Arizona, USA |
| ⓘ 'Delessite' Formula: (Mg,Fe,Fe,Al)(Si,Al)4O10(O,OH)8 Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Descloizite Formula: PbZn(VO4)(OH) |
| ⓘ Descloizite var. Copper-bearing Descloizite Formula: Pb(Zn,Cu)VO4OH Localities: Description: Small stalactites several cm long to about 8 mm across at the bases. |
| ⓘ Devilline Formula: CaCu4(SO4)2(OH)6 · 3H2O Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Diaspore Formula: AlO(OH) |
| ⓘ Dickite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Digenite Formula: Cu9S5 |
| ⓘ Diopside Formula: CaMgSi2O6 Locality: Bisbee, Cochise County, Arizona, USA Description: Grains in unoxidized pyritic ores. References: |
| ⓘ Dioptase Formula: CuSiO3 · H2O |
| ⓘ Djurleite Formula: Cu31S16 |
| ⓘ Dolomite Formula: CaMg(CO3)2 |
| ⓘ Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Dyscrasite Formula: Ag3Sb Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Eddavidite Formula: Cu12Pb2O15Br2 Locality: Bisbee, Cochise County, Arizona, USA References: |
| ⓘ Edenite Formula: NaCa2Mg5(Si7Al)O22(OH)2 |
| ⓘ Emplectite Formula: CuBiS2 |
| ⓘ Enargite Formula: Cu3AsS4 |
| ⓘ Enstatite Formula: Mg2Si2O6 Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ Epsomite Formula: MgSO4 · 7H2O Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Eugenite Formula: Ag11Hg2 Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Famatinite Formula: Cu3SbS4 |
| ⓘ 'Fayalite-Forsterite Series' Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Felsőbányaite Formula: Al4(SO4)(OH)10 · 4H2O Localities: Colour: White Description: Earthy masses with other aluminum sulphates encrusting silicified limestones and as micro-crystals. |
| ⓘ Ferricopiapite Formula: Fe3+0.67Fe3+4(SO4)6(OH)2 · 20H2O |
| ⓘ Ferrimolybdite Formula: Fe2(MoO4)3 · nH2O |
| ⓘ Fibroferrite Formula: Fe3+(SO4)(OH) · 5H2O |
| ⓘ Fluorite Formula: CaF2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Fornacite Formula: Pb2Cu(CrO4)(AsO4)(OH) |
| ⓘ 'Freibergite Subgroup' Formula: (Ag6,[Ag6]4+)(Cu4 C2+2)Sb4S12S0-1 |
| ⓘ Furutobeite Formula: (Cu,Ag)6PbS4 |
| ⓘ Galena Formula: PbS Localities: Reported from at least 12 localities in this region. |
| ⓘ Galena var. Silver-bearing Galena Formula: PbS with Ag References: |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 |
| ⓘ Gibbsite Formula: Al(OH)3 Localities: Description: Impure material with chalcoalumite & malachite. |
| ⓘ Goethite Formula: Fe3+O(OH) Localities: Reported from at least 10 localities in this region. |
| ⓘ Goldfieldite Formula: (Cu4◻2)(Cu4Cu+2)Te4S12S |
| ⓘ Gormanite Formula: (Fe2+,Mg)3(Al,Fe3+)4(PO4)4(OH)6 · 2H2O Locality: Bisbee, Cochise County, Arizona, USA Habit: Rosette aggregates Colour: Dark green Description: In drill core as rosettes in open fractures. References: |
| ⓘ Graemite (TL) Formula: Cu[TeO3] · H2O Localities: Type Locality: Cole Mine, Bisbee, Cochise County, Arizona, USA Description: Occurs on the 1200 level on and replacing teineite embedded in malachite. |
| ⓘ Graphite Formula: C Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Greenockite Formula: CdS Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Grossular Formula: Ca3Al2(SiO4)3 Locality: Bisbee, Cochise County, Arizona, USA Habit: Rounded Description: Rounded crystals in unoxidized pyritic ores. References: |
| ⓘ Groutite Formula: Mn3+O(OH) Habit: Tiny Colour: Dark brownish-black Description: Coats sooty manganese oxides. |
| ⓘ Gunningite Formula: ZnSO4 · H2O Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Gypsum Formula: CaSO4 · 2H2O Localities: Bisbee, Cochise County, Arizona, USA Cole Mine, Bisbee, Cochise County, Arizona, USA Copper Queen Mine, Queen Hill, Bisbee, Cochise County, Arizona, USA Holbrook Mine, Copper Queen Mine, Queen Hill, Bisbee, Cochise County, Arizona, USA Unnamed prospects, Juniper Flats, Bisbee, Cochise County, Arizona, USA |
| ⓘ Gypsum var. Selenite Formula: CaSO4 · 2H2O |
| ⓘ Halloysite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Halotrichite Formula: FeAl2(SO4)4 · 22H2O |
| ⓘ Hausmannite Formula: Mn2+Mn3+2O4 |
| ⓘ Hematite Formula: Fe2O3 Localities: Reported from at least 12 localities in this region. |
| ⓘ Hematite var. Specularite Formula: Fe2O3 |
| ⓘ Hemimorphite Formula: Zn4Si2O7(OH)2 · H2O |
| ⓘ Henryite (TL) Formula: (Cu,Ag)3+xTe2 , with x ~ 0.40 Type Locality: Campbell Mine, Bisbee, Cochise County, Arizona, USA Description: Very sparingly in sulfide ores. |
| ⓘ Hessite Formula: Ag2Te |
| ⓘ Hetaerolite Formula: ZnMn2O4 |
| ⓘ Hetaerolite var. Hydrohetaerolite Formula: Zn(Mn,◻)2(O,OH)4 |
| ⓘ Hexahydrite Formula: MgSO4 · 6H2O |
| ⓘ Hisingerite Formula: Fe3+2(Si2O5)(OH)4 · 2H2O Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Hocartite Formula: Ag2(Fe2+,Zn)SnS4 |
| ⓘ Hodrušite Formula: Cu8Bi12S22 |
| ⓘ Hoganite Formula: Cu(CH3COO)2 · H2O |
| ⓘ Hübnerite Formula: MnWO4 |
| ⓘ Hydrobasaluminite Formula: Al4(SO4)(OH)10 · 12-36H2O |
| ⓘ Hydrocerussite Formula: Pb3(CO3)2(OH)2 |
| ⓘ Hydrokenoralstonite Formula: Na0.5(Al,Mg)2(F,OH)6 · H2O |
| ⓘ 'Hydromuscovite' |
| ⓘ Hydrozincite Formula: Zn5(CO3)2(OH)6 Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Ilsemannite Formula: Mo3O8 · nH2O |
| ⓘ Iodargyrite Formula: AgI |
| ⓘ 'Iridescent coating' Locality: Bisbee, Cochise County, Arizona, USA References: |
| ⓘ Jacobsite Formula: Mn2+Fe3+2O4 Description: Occurs as 5 mm blebs in cryptomelane. |
| ⓘ Jalpaite Formula: Ag3CuS2 |
| ⓘ Jarosite Formula: KFe3+3(SO4)2(OH)6 |
| ⓘ Johannite Formula: Cu(UO2)2(SO4)2(OH)2 · 8H2O Description: Occurs as a post-mining efflorescence. |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 Localities: Reported from at least 6 localities in this region. |
| ⓘ Kettnerite Formula: CaBiCO3OF |
| ⓘ Kësterite Formula: Cu2ZnSnS4 |
| ⓘ Kiddcreekite (TL) Formula: Cu6SnWS8 Localities: Type Locality: Campbell Mine, Bisbee, Cochise County, Arizona, USA Description: Occurs as minute grains in sulfide orebodies. |
| ⓘ Kornelite Formula: Fe2(SO4)3 · 7H2O |
| ⓘ Kostovite Formula: CuAuTe4 |
| ⓘ Krennerite Formula: Au3AgTe8 |
| ⓘ Krupkaite Formula: PbCuBi3S6 |
| ⓘ Ktenasite Formula: ZnCu4(SO4)2(OH)6 · 6H2O |
| ⓘ Kuramite Formula: Cu3SnS4 |
| ⓘ Langite Formula: Cu4(SO4)(OH)6 · 2H2O Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Laumontite Formula: CaAl2Si4O12 · 4H2O Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Leadhillite Formula: Pb4(CO3)2(SO4)(OH)2 |
| ⓘ Lepidocrocite Formula: Fe3+O(OH) |
| ⓘ Lime Formula: CaO Description: [NOT A NATURAL MINERAL; Created when limestone in a shaft wall was calcined in an underground fire.] |
| ⓘ 'Limonite' Localities: Reported from at least 24 localities in this region. |
| ⓘ Linarite Formula: PbCu(SO4)(OH)2 |
| ⓘ Liroconite Formula: Cu2Al(AsO4)(OH)4 · 4H2O |
| ⓘ Luzonite Formula: Cu3AsS4 |
| ⓘ Magnesite Formula: MgCO3 |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 Localities: Reported from at least 20 localities in this region. Habit: Botryoidal/mammillary masses. |
| ⓘ 'Manganese Oxides' References: |
| ⓘ Manganite Formula: Mn3+O(OH) Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Marcasite Formula: FeS2 Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Matildite Formula: AgBiS2 |
| ⓘ Mawsonite Formula: Cu6Fe2SnS8 |
| ⓘ Meionite Formula: Ca4Al6Si6O24CO3 Description: Occurs on the 500 level in Abrigo Limestone. |
| ⓘ Melanterite Formula: Fe2+(H2O)6SO4 · H2O |
| ⓘ Melonite Formula: NiTe2 |
| ⓘ Metatorbernite Formula: Cu(UO2)2(PO4)2 · 8H2O References: |
| ⓘ Metavoltine Formula: K2Na6Fe2+Fe3+6O2(SO4)12 · 18H2O |
| ⓘ Microcline Formula: K(AlSi3O8) Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Miersite Formula: (Ag,Cu)I Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Mimetite Formula: Pb5(AsO4)3Cl |
| ⓘ Minium Formula: Pb3O4 Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Molybdenite Formula: MoS2 |
| ⓘ Mottramite Formula: PbCu(VO4)(OH) |
| ⓘ Murdochite Formula: Cu12Pb2O15Cl2 |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Muscovite var. Illite Formula: K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Nantokite Formula: CuCl Description: Clear, paraffin-like masses impregnating the cores of vuggy cuprite nodules. References: |
| ⓘ Native Arsenic Formula: As Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Native Bismuth Formula: Bi |
| ⓘ Native Copper Formula: Cu Localities: Reported from at least 18 localities in this region. |
| ⓘ Native Gold Formula: Au Localities: Reported from at least 10 localities in this region. |
| ⓘ Native Gold var. Electrum Formula: (Au,Ag) |
| ⓘ Native Silver Formula: Ag Localities: Reported from at least 7 localities in this region. |
| ⓘ Native Sulphur Formula: S8 |
| ⓘ Native Tellurium Formula: Te |
| ⓘ Natrolite Formula: Na2Al2Si3O10 · 2H2O Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Nekrasovite Formula: Cu26V2(Sn,As,Sb)6S32 |
| ⓘ Neltnerite Formula: CaMn3+6(SiO4)O8 |
| ⓘ Nolanite Formula: V3+8Fe3+2O14(OH)2 References: |
| ⓘ Opal Formula: SiO2 · nH2O Locality: Bisbee, Cochise County, Arizona, USA References: |
| ⓘ Opal var. Opal-AN Formula: SiO2 · nH2O Locality: Bisbee, Cochise County, Arizona, USA References: |
| ⓘ Orthoclase Formula: K(AlSi3O8) Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Osarizawaite Formula: Pb(Al2Cu2+)(SO4)2(OH)6 |
| ⓘ Paracoquimbite Formula: Fe4(SO4)6(H2O)12 · 6H2O Localities: Colour: Bright pale violet |
| ⓘ Paramelaconite (TL) Formula: Cu1+2Cu2+2O3 Localities: Habit: Unusually large crystals with forms: {001}, {101}, & {100}. Description: Occurs in a matrix of goethite. |
| ⓘ Paratacamite Formula: Cu3(Cu,Zn)(OH)6Cl2 |
| ⓘ Paratellurite Formula: TeO2 |
| ⓘ Pearceite Formula: [Ag6As2S7][Ag9CuS4] |
| ⓘ Petzite Formula: Ag3AuTe2 |
| ⓘ Pharmacosiderite Formula: KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| ⓘ Pickeringite Formula: MgAl2(SO4)4 · 22H2O |
| ⓘ Plancheite Formula: Cu8(Si8O22)(OH)4 · H2O Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Plattnerite Formula: PbO2 |
| ⓘ Plumbojarosite Formula: Pb0.5Fe3+3(SO4)2(OH)6 Description: Abundant in lead ores adjacent to quartz breccia. References: |
| ⓘ Polybasite Formula: [Ag6Sb2S7][Ag9CuS4] Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Powellite Formula: Ca(MoO4) |
| ⓘ Prehnite Formula: Ca2Al2Si3O10(OH)2 |
| ⓘ Pseudomalachite Formula: Cu5(PO4)2(OH)4 Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ 'Psilomelane' Localities: Reported from at least 23 localities in this region. |
| ⓘ Pyrargyrite Formula: Ag3SbS3 Locality: Bisbee, Cochise County, Arizona, USA References: |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 40 localities in this region. |
| ⓘ Pyrite var. Gold-bearing Pyrite Formula: FeS2 References: |
| ⓘ Pyrolusite Formula: Mn4+O2 |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl |
| ⓘ Pyrope Formula: Mg3Al2(SiO4)3 Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Pyrophyllite Formula: Al2Si4O10(OH)2 |
| ⓘ Pyrrhotite Formula: Fe1-xS |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 12 localities in this region. |
| ⓘ Quartz var. Amethyst Formula: SiO2 |
| ⓘ Quartz var. Chalcedony Formula: SiO2 References: |
| ⓘ Rammelsbergite Formula: NiAs2 Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Ransomite Formula: CuFe2(SO4)4 · 6H2O |
| ⓘ Rhodochrosite Formula: MnCO3 |
| ⓘ Rhodostannite Formula: Cu1+(Fe2+0.5Sn4+1.5)S4 |
| ⓘ Rhomboclase Formula: (H5O2)Fe3+(SO4)2 · 2H2O Localities: Bisbee, Cochise County, Arizona, USA Campbell Mine, Bisbee, Cochise County, Arizona, USA Czar Mine, Copper Queen Mine, Queen Hill, Bisbee, Cochise County, Arizona, USA Copper Queen Mine, Queen Hill, Bisbee, Cochise County, Arizona, USA Junction Mine, Calumet and Arizona group of claims, Bisbee, Cochise County, Arizona, USA |
| ⓘ Rickardite Formula: Cu7Te5 |
| ⓘ Roquesite Formula: CuInS2 |
| ⓘ Rosasite Formula: (Cu,Zn)2(CO3)(OH)2 |
| ⓘ Roscoelite Formula: KV3+2(AlSi3O10)(OH)2 |
| ⓘ Römerite Formula: Fe2+Fe3+2(SO4)4 · 14H2O |
| ⓘ Rozenite Formula: FeSO4 · 4H2O |
| ⓘ Rucklidgeite Formula: PbBi2Te4 |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Sanidine Formula: K(AlSi3O8) Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ 'Scapolite' Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ 'Scapolite var. Wernerite' Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Scheelite Formula: Ca(WO4) Localities: Description: Indefinite location SE of town (wolframite) |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Habit: Nests of small, prismatic crystals. Description: Occurs in muscovite. |
| ⓘ Scorzalite Formula: Fe2+Al2(PO4)2(OH)2 |
| ⓘ Sengierite Formula: Cu2(UO2)2(VO4)2 · 6H2O Description: Initially occurred in one isolated pocket, later more widespread; associated with malachite & disseminated in chalcocite. References: |
| ⓘ Sepiolite Formula: Mg4(Si6O15)(OH)2 · 6H2O Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ 'Serpentine Subgroup' Formula: D3[Si2O5](OH)4 |
| ⓘ Shattuckite (TL) Formula: Cu5(Si2O6)2(OH)2 Localities: Type Locality: Shattuck Mine, Bisbee, Cochise County, Arizona, USA Colour: Blue Description: Occurs as pseudomorphs after malachite & as small spherules. |
| ⓘ Siderite Formula: FeCO3 Localities: Reported from at least 6 localities in this region. |
| ⓘ Siderotil Formula: FeSO4 · 5H2O |
| ⓘ 'Silica' |
| ⓘ Smithsonite Formula: ZnCO3 |
| ⓘ Spangolite Formula: Cu6Al(SO4)(OH)12Cl · 3H2O |
| ⓘ Spertiniite Formula: Cu(OH)2 Locality: Bisbee, Cochise County, Arizona, USA Habit: Scaly structure Colour: Pale blue-green Description: Sparse incrustations with internal scaly structure on matrix of crystalline atacamite. References: |
| ⓘ Spessartine Formula: Mn2+3Al2(SiO4)3 |
| ⓘ Sphalerite Formula: ZnS Localities: Reported from at least 10 localities in this region. |
| ⓘ Spionkopite Formula: Cu39S28 |
| ⓘ Stannite Formula: Cu2FeSnS4 |
| ⓘ Stannoidite Formula: Cu+6Cu2+2(Fe2+,Zn)3Sn2S12 |
| ⓘ Stevensite Formula: (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| ⓘ Stibiconite Formula: Sb3+Sb5+2O6(OH) |
| ⓘ Stolzite Formula: Pb(WO4) |
| ⓘ Stromeyerite Formula: AgCuS |
| ⓘ Stützite Formula: Ag5-xTe3, x = 0.24-0.36 |
| ⓘ Susannite Formula: Pb4(CO3)2(SO4)(OH)2 Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Sylvanite Formula: AgAuTe4 |
| ⓘ Szomolnokite Formula: FeSO4 · H2O |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Teineite Formula: Cu2+(Te4+O3) · 2H2O |
| ⓘ Tellurite Formula: TeO2 |
| ⓘ Tellurobismuthite Formula: Bi2Te3 |
| ⓘ 'Tennantite Subgroup' Formula: Cu6(Cu4C2+2)As4S12S |
| ⓘ Tenorite Formula: CuO Localities: Reported from at least 8 localities in this region. |
| ⓘ Tenorite var. Geltenorite Formula: CuO Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Tetradymite Formula: Bi2Te2S |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S |
| ⓘ Thomsonite-Ca Formula: NaCa2[Al5Si5O20] · 6H2O Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Tilasite Formula: CaMg(AsO4)F |
| ⓘ Titanite Formula: CaTi(SiO4)O Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Tolbachite Formula: CuCl2 Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Torbernite Formula: Cu(UO2)2(PO4)2 · 12H2O |
| ⓘ 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z Locality: Bisbee, Cochise County, Arizona, USA Description: Occurs with zircon in Pinal Schist. |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 Localities: Description: Most abundant metamorphic gangue of unoxidized pyritic ores. |
| ⓘ Tungstenite Formula: WS2 Locality: Bisbee, Cochise County, Arizona, USA References: |
| ⓘ Turquoise Formula: CuAl6(PO4)4(OH)8 · 4H2O |
| ⓘ Tyuyamunite Formula: Ca(UO2)2(VO4)2 · 5-8H2O |
| ⓘ Uraninite Formula: UO2 |
| ⓘ Uranopilite Formula: (UO2)6(SO4)O2(OH)6 · 14H2O Description: Occurs as a post-mining efflorescence. |
| ⓘ Vanadinite Formula: Pb5(VO4)3Cl Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Variscite Formula: AlPO4 · 2H2O |
| ⓘ Variscite var. Ferrian Variscite Formula: (Al,Fe)PO4 · 2H2O Colour: Pale green Description: As unusual pale green, massive ferrian material. |
| ⓘ Velikite Formula: Cu2HgSnS4 |
| ⓘ Vesuvianite Formula: Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 Locality: Bisbee, Cochise County, Arizona, USA References: |
| ⓘ Volkonskoite Formula: Ca0.3(Cr,Mg,Fe)2((Si,Al)4O10)(OH)2 · 4H2O |
| ⓘ Voltaite Formula: K2Fe2+5Fe3+3Al(SO4)12 · 18H2O |
| ⓘ Volynskite Formula: AgBiTe2 |
| ⓘ 'Wad' Description: With tenorite in a botryoidal growth lining a large natural cavern wall. |
| ⓘ Willemite Formula: Zn2SiO4 |
| ⓘ Wittichenite Formula: Cu3BiS3 |
| ⓘ Wittichenite var. Silver-bearing Wittichenite Formula: (Cu,Ag)3BiS3 References: |
| ⓘ 'Wolframite Group' |
| ⓘ Wollastonite Formula: Ca3(Si3O9) |
| ⓘ Wulfenite Formula: Pb(MoO4) |
| ⓘ Yarrowite Formula: Cu9S8 |
| ⓘ Zincobotryogen Formula: (Zn,Mg,Mn2+)Fe3+(SO4)2(OH) · 7H2O Locality: Bisbee, Cochise County, Arizona, USA |
| ⓘ Zincocopiapite Formula: ZnFe3+4(SO4)6(OH)2 · 18H2O Description: Occurs as a post-mining product. |
| ⓘ Zippeite Formula: K3(UO2)4(SO4)2O3(OH) · 3H2O Description: Occurs as a post-mining efflorescence. |
| ⓘ Zircon Formula: Zr(SiO4) Localities: Description: Occurs with tourmaline in Pinal Schist. |
| ⓘ Zoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) Locality: Bisbee, Cochise County, Arizona, USA References: |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Native Gold var. Electrum | 1.AA.05 | (Au,Ag) |
| ⓘ | 1.AA.05 | Au | |
| ⓘ | Native Silver | 1.AA.05 | Ag |
| ⓘ | Eugenite | 1.AD.15c | Ag11Hg2 |
| ⓘ | Native Arsenic | 1.CA.05 | As |
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| ⓘ | Graphite | 1.CB.05a | C |
| ⓘ | Native Sulphur | 1.CC.05 | S8 |
| ⓘ | Native Tellurium | 1.CC.10 | Te |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Dyscrasite | 2.AA.35 | Ag3Sb |
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Djurleite | 2.BA.05 | Cu31S16 |
| ⓘ | Digenite | 2.BA.10 | Cu9S5 |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Rickardite | 2.BA.30 | Cu7Te5 |
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Stromeyerite | 2.BA.40 | AgCuS |
| ⓘ | Jalpaite | 2.BA.45 | Ag3CuS2 |
| ⓘ | Hessite | 2.BA.60 | Ag2Te |
| ⓘ | Henryite (TL) | 2.BA.65 | (Cu,Ag)3+xTe2 , with x ~ 0.40 |
| ⓘ | Stützite | 2.BA.65 | Ag5-xTe3, x = 0.24-0.36 |
| ⓘ | Canfieldite | 2.BA.70 | Ag8SnS6 |
| ⓘ | Petzite | 2.BA.75 | Ag3AuTe2 |
| ⓘ | Bogdanovite | 2.BA.80 | (Au,Te,Pb)3(Cu,Fe) |
| ⓘ | Furutobeite | 2.BE.10 | (Cu,Ag)6PbS4 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Spionkopite | 2.CA.05c | Cu39S28 |
| ⓘ | Yarrowite | 2.CA.05d | Cu9S8 |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Roquesite | 2.CB.10a | CuInS2 |
| ⓘ | Hocartite | 2.CB.15a | Ag2(Fe2+,Zn)SnS4 |
| ⓘ | Kësterite | 2.CB.15a | Cu2ZnSnS4 |
| ⓘ | Kuramite | 2.CB.15a | Cu3SnS4 |
| ⓘ | Stannite | 2.CB.15a | Cu2FeSnS4 |
| ⓘ | Velikite | 2.CB.15a | Cu2HgSnS4 |
| ⓘ | Stannoidite | 2.CB.15c | Cu+6Cu2+2(Fe2+,Zn)3Sn2S12 |
| ⓘ | Mawsonite | 2.CB.20 | Cu6Fe2SnS8 |
| ⓘ | Colusite | 2.CB.30 | Cu13VAs3S16 |
| ⓘ | Nekrasovite | 2.CB.30 | Cu26V2(Sn,As,Sb)6S32 |
| ⓘ | Kiddcreekite (TL) | 2.CB.35a | Cu6SnWS8 |
| ⓘ | Greenockite | 2.CB.45 | CdS |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Alabandite | 2.CD.10 | MnS |
| ⓘ | Altaite | 2.CD.10 | PbTe |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | var. Silver-bearing Galena | 2.CD.10 | PbS with Ag |
| ⓘ | Cinnabar | 2.CD.15a | HgS |
| ⓘ | Rhodostannite | 2.DA.10 | Cu1+(Fe2+0.5Sn4+1.5)S4 |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Tellurobismuthite | 2.DC.05 | Bi2Te3 |
| ⓘ | Tetradymite | 2.DC.05 | Bi2Te2S |
| ⓘ | Sylvanite | 2.EA.05 | AgAuTe4 |
| ⓘ | Calaverite | 2.EA.10 | AuTe2 |
| ⓘ | Kostovite | 2.EA.15 | CuAuTe4 |
| ⓘ | Krennerite | 2.EA.15 | Au3AgTe8 |
| ⓘ | Melonite | 2.EA.20 | NiTe2 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Tungstenite | 2.EA.30 | WS2 |
| ⓘ | Pyrite var. Gold-bearing Pyrite | 2.EB.05a | FeS2 |
| ⓘ | 2.EB.05a | FeS2 | |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Rammelsbergite | 2.EB.15a | NiAs2 |
| ⓘ | Pyrargyrite | 2.GA.05 | Ag3SbS3 |
| ⓘ | Wittichenite | 2.GA.20 | Cu3BiS3 |
| ⓘ | var. Silver-bearing Wittichenite | 2.GA.20 | (Cu,Ag)3BiS3 |
| ⓘ | 'Freibergite Subgroup' | 2.GB.05 | (Ag6,[Ag6]4+)(Cu4 C2+2)Sb4S12S0-1 |
| ⓘ | Goldfieldite | 2.GB.05 | (Cu4◻2)(Cu4Cu+2)Te4S12S |
| ⓘ | 'Tennantite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)As4S12S |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | Pearceite | 2.GB.15 | [Ag6As2S7][Ag9CuS4] |
| ⓘ | Polybasite | 2.GB.15 | [Ag6Sb2S7][Ag9CuS4] |
| ⓘ | Rucklidgeite | 2.GC.40c | PbBi2Te4 |
| ⓘ | Chalcostibite | 2.HA.05 | CuSbS2 |
| ⓘ | Emplectite | 2.HA.05 | CuBiS2 |
| ⓘ | Aikinite | 2.HB.05a | PbCuBiS3 |
| ⓘ | Krupkaite | 2.HB.05a | PbCuBi3S6 |
| ⓘ | Cupropavonite | 2.JA.05a | Cu0.9Ag0.5Pb0.6Bi2.5S5 |
| ⓘ | Hodrušite | 2.JA.10c | Cu8Bi12S22 |
| ⓘ | Matildite | 2.JA.20 | AgBiS2 |
| ⓘ | Volynskite | 2.JA.20 | AgBiTe2 |
| ⓘ | Cosalite | 2.JB.10 | Pb2Bi2S5 |
| ⓘ | Enargite | 2.KA.05 | Cu3AsS4 |
| ⓘ | Famatinite | 2.KA.10 | Cu3SbS4 |
| ⓘ | Luzonite | 2.KA.10 | Cu3AsS4 |
| Group 3 - Halides | |||
| ⓘ | Miersite | 3.AA.05 | (Ag,Cu)I |
| ⓘ | Nantokite | 3.AA.05 | CuCl |
| ⓘ | Iodargyrite | 3.AA.10 | AgI |
| ⓘ | Bromargyrite | 3.AA.15 | AgBr |
| ⓘ | Chlorargyrite | 3.AA.15 | AgCl |
| ⓘ | var. Bromian Chlorargyrite | 3.AA.15 | Ag(Cl,Br) |
| ⓘ | Tolbachite | 3.AB.05 | CuCl2 |
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| ⓘ | Hydrokenoralstonite | 3.CF.05 | Na0.5(Al,Mg)2(F,OH)6 · H2O |
| ⓘ | Atacamite | 3.DA.10a | Cu2(OH)3Cl |
| ⓘ | Paratacamite | 3.DA.10c | Cu3(Cu,Zn)(OH)6Cl2 |
| ⓘ | Claringbullite | 3.DA.15 | Cu4ClF(OH)6 |
| ⓘ | Buttgenbachite | 3.DA.25 | Cu19(NO3)2(OH)32Cl4 · 2H2O |
| ⓘ | Connellite | 3.DA.25 | Cu19(SO4)(OH)32Cl4 · 3H2O |
| ⓘ | Anthonyite | 3.DA.40 | Cu(OH,Cl)2 · 3H2O |
| ⓘ | Murdochite | 3.DB.45 | Cu12Pb2O15Cl2 |
| ⓘ | Eddavidite | 3.DB.45 | Cu12Pb2O15Br2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | Cuprite var. Chalcotrichite | 4.AA.10 | Cu2O |
| ⓘ | 4.AA.10 | Cu2O | |
| ⓘ | Paramelaconite (TL) | 4.AA.15 | Cu1+2Cu2+2O3 |
| ⓘ | Crednerite | 4.AB.05 | Cu+Mn3+O2 |
| ⓘ | Tenorite | 4.AB.10 | CuO |
| ⓘ | var. Geltenorite | 4.AB.10 | CuO |
| ⓘ | Delafossite | 4.AB.15 | Cu+Fe3+O2 |
| ⓘ | Lime | 4.AB.25 | CaO |
| ⓘ | Chromite | 4.BB.05 | Fe2+Cr3+2O4 |
| ⓘ | Jacobsite | 4.BB.05 | Mn2+Fe3+2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hausmannite | 4.BB.10 | Mn2+Mn3+2O4 |
| ⓘ | Hetaerolite | 4.BB.10 | ZnMn2O4 |
| ⓘ | var. Hydrohetaerolite | 4.BB.10 | Zn(Mn,◻)2(O,OH)4 |
| ⓘ | Minium | 4.BD.05 | Pb3O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | var. Specularite | 4.CB.05 | Fe2O3 |
| ⓘ | Bixbyite-(Mn) | 4.CB.10 | Mn3+2O3 |
| ⓘ | Nolanite | 4.CB.40 | V3+8Fe3+2O14(OH)2 |
| ⓘ | Bismite | 4.CB.60 | Bi2O3 |
| ⓘ | Quartz var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | Opal var. Opal-AN | 4.DA.10 | SiO2 · nH2O |
| ⓘ | 4.DA.10 | SiO2 · nH2O | |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Plattnerite | 4.DB.05 | PbO2 |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Hübnerite | 4.DB.30 | MnWO4 |
| ⓘ | 'Wolframite Group' | 4.DB.30 va | |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Brookite | 4.DD.10 | TiO2 |
| ⓘ | Tellurite | 4.DE.20 | TeO2 |
| ⓘ | Paratellurite | 4.DE.25 | TeO2 |
| ⓘ | 'Bindheimite' | 4.DH.20 | Pb2Sb2O6O |
| ⓘ | Stibiconite | 4.DH.20 | Sb3+Sb5+2O6(OH) |
| ⓘ | Coronadite | 4.DK.05a | Pb(Mn4+6Mn3+2)O16 |
| ⓘ | Cryptomelane | 4.DK.05a | K(Mn4+7Mn3+)O16 |
| ⓘ | Uraninite | 4.DL.05 | UO2 |
| ⓘ | Spertiniite | 4.FD.05 | Cu(OH)2 |
| ⓘ | Diaspore | 4.FD.10 | AlO(OH) |
| ⓘ | Groutite | 4.FD.10 | Mn3+O(OH) |
| ⓘ | Manganite | 4.FD.15 | Mn3+O(OH) |
| ⓘ | Brucite | 4.FE.05 | Mg(OH)2 |
| ⓘ | Gibbsite | 4.FE.10 | Al(OH)3 |
| ⓘ | Böhmite | 4.FE.15 | AlO(OH) |
| ⓘ | Lepidocrocite | 4.FE.15 | Fe3+O(OH) |
| ⓘ | Cesàrolite | 4.FG.10 | PbMn4+3O6(OH)2 |
| ⓘ | Ilsemannite | 4.FJ.15 | Mo3O8 · nH2O |
| ⓘ | Chalcophanite | 4.FL.20 | ZnMn4+3O7 · 3H2O |
| ⓘ | Sengierite | 4.HB.10 | Cu2(UO2)2(VO4)2 · 6H2O |
| ⓘ | Tyuyamunite | 4.HB.25 | Ca(UO2)2(VO4)2 · 5-8H2O |
| ⓘ | Graemite (TL) | 4.JM.15 | Cu[TeO3] · H2O |
| ⓘ | Teineite | 4.JM.20 | Cu2+(Te4+O3) · 2H2O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Magnesite | 5.AB.05 | MgCO3 |
| ⓘ | Calcite var. Manganese-bearing Calcite | 5.AB.05 | (Ca,Mn)CO3 |
| ⓘ | Rhodochrosite | 5.AB.05 | MnCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Smithsonite | 5.AB.05 | ZnCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Aragonite var. Flos Ferri | 5.AB.15 | CaCO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Rosasite | 5.BA.10 | (Cu,Zn)2(CO3)(OH)2 |
| ⓘ | Aurichalcite | 5.BA.15 | (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ | Hydrozincite | 5.BA.15 | Zn5(CO3)2(OH)6 |
| ⓘ | Hydrocerussite | 5.BE.10 | Pb3(CO3)2(OH)2 |
| ⓘ | Bismutite | 5.BE.25 | (BiO)2CO3 |
| ⓘ | Kettnerite | 5.BE.30 | CaBiCO3OF |
| ⓘ | Leadhillite | 5.BF.40 | Pb4(CO3)2(SO4)(OH)2 |
| ⓘ | Susannite | 5.BF.40 | Pb4(CO3)2(SO4)(OH)2 |
| ⓘ | Bayleyite | 5.ED.05 | Mg2(UO2)(CO3)3 · 18H2O |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anhydrite | 7.AD.30 | CaSO4 |
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Antlerite | 7.BB.15 | Cu3(SO4)(OH)4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Alunite | 7.BC.10 | KAl3(SO4)2(OH)6 |
| ⓘ | Beaverite-(Cu) | 7.BC.10 | Pb(Fe3+2Cu)(SO4)2(OH)6 |
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Osarizawaite | 7.BC.10 | Pb(Al2Cu2+)(SO4)2(OH)6 |
| ⓘ | Plumbojarosite | 7.BC.10 | Pb0.5Fe3+3(SO4)2(OH)6 |
| ⓘ | Linarite | 7.BC.65 | PbCu(SO4)(OH)2 |
| ⓘ | Gunningite | 7.CB.05 | ZnSO4 · H2O |
| ⓘ | Szomolnokite | 7.CB.05 | FeSO4 · H2O |
| ⓘ | Rozenite | 7.CB.15 | FeSO4 · 4H2O |
| ⓘ | Chalcanthite | 7.CB.20 | CuSO4 · 5H2O |
| ⓘ | Siderotil | 7.CB.20 | FeSO4 · 5H2O |
| ⓘ | Bianchite | 7.CB.25 | Zn(SO4) · 6H2O |
| ⓘ | Hexahydrite | 7.CB.25 | MgSO4 · 6H2O |
| ⓘ | Melanterite | 7.CB.35 | Fe2+(H2O)6SO4 · H2O |
| ⓘ | Epsomite | 7.CB.40 | MgSO4 · 7H2O |
| ⓘ | Coquimbite | 7.CB.55 | AlFe3(SO4)6(H2O)12 · 6H2O |
| ⓘ | Paracoquimbite | 7.CB.55 | Fe4(SO4)6(H2O)12 · 6H2O |
| ⓘ | Rhomboclase | 7.CB.55 | (H5O2)Fe3+(SO4)2 · 2H2O |
| ⓘ | Kornelite | 7.CB.60 | Fe2(SO4)3 · 7H2O |
| ⓘ | Römerite | 7.CB.75 | Fe2+Fe3+2(SO4)4 · 14H2O |
| ⓘ | Ransomite | 7.CB.80 | CuFe2(SO4)4 · 6H2O |
| ⓘ | Bílinite | 7.CB.85 | Fe2+Fe3+2(SO4)4 · 22H2O |
| ⓘ | Halotrichite | 7.CB.85 | FeAl2(SO4)4 · 22H2O |
| ⓘ | Pickeringite | 7.CB.85 | MgAl2(SO4)4 · 22H2O |
| ⓘ | Voltaite | 7.CC.25 | K2Fe2+5Fe3+3Al(SO4)12 · 18H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | var. Selenite | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Copiapite | 7.DB.35 | Fe2+Fe3+4(SO4)6(OH)2 · 20H2O |
| ⓘ | Cuprocopiapite | 7.DB.35 | Cu2+Fe3+4(SO4)6(OH)2 · 20H2O |
| ⓘ | Ferricopiapite | 7.DB.35 | Fe3+0.67Fe3+4(SO4)6(OH)2 · 20H2O |
| ⓘ | Zincocopiapite | 7.DB.35 | ZnFe3+4(SO4)6(OH)2 · 18H2O |
| ⓘ | Fibroferrite | 7.DC.15 | Fe3+(SO4)(OH) · 5H2O |
| ⓘ | Botryogen | 7.DC.25 | MgFe3+(SO4)2(OH) · 7H2O |
| ⓘ | Zincobotryogen | 7.DC.25 | (Zn,Mg,Mn2+)Fe3+(SO4)2(OH) · 7H2O |
| ⓘ | Felsőbányaite | 7.DD.05 | Al4(SO4)(OH)10 · 4H2O |
| ⓘ | Langite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Spangolite | 7.DD.15 | Cu6Al(SO4)(OH)12Cl · 3H2O |
| ⓘ | Ktenasite | 7.DD.20 | ZnCu4(SO4)2(OH)6 · 6H2O |
| ⓘ | Devilline | 7.DD.30 | CaCu4(SO4)2(OH)6 · 3H2O |
| ⓘ | Chalcoalumite (TL) | 7.DD.75 | CuAl4(SO4)(OH)12 · 3H2O |
| ⓘ | Carbonatecyanotrichite | 7.DE.10 | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| ⓘ | Cyanotrichite | 7.DE.10 | Cu4Al2(SO4)(OH)12 · 2H2O |
| ⓘ | Hydrobasaluminite | 7.DE.60 | Al4(SO4)(OH)10 · 12-36H2O |
| ⓘ | Metavoltine | 7.DF.35 | K2Na6Fe2+Fe3+6O2(SO4)12 · 18H2O |
| ⓘ | Uranopilite | 7.EA.05 | (UO2)6(SO4)O2(OH)6 · 14H2O |
| ⓘ | Johannite | 7.EB.05 | Cu(UO2)2(SO4)2(OH)2 · 8H2O |
| ⓘ | Zippeite | 7.EC.05 | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| ⓘ | Fornacite | 7.FC.10 | Pb2Cu(CrO4)(AsO4)(OH) |
| ⓘ | Powellite | 7.GA.05 | Ca(MoO4) |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| ⓘ | Stolzite | 7.GA.05 | Pb(WO4) |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| ⓘ | Ferrimolybdite | 7.GB.30 | Fe2(MoO4)3 · nH2O |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Tilasite | 8.BB. | CaMg(AsO4)F |
| ⓘ | Scorzalite | 8.BB.40 | Fe2+Al2(PO4)2(OH)2 |
| ⓘ | Pseudomalachite | 8.BD.05 | Cu5(PO4)2(OH)4 |
| ⓘ | Conichalcite | 8.BH.35 | CaCu(AsO4)(OH) |
| ⓘ | Descloizite var. Copper-bearing Descloizite | 8.BH.40 | Pb(Zn,Cu)VO4OH |
| ⓘ | 8.BH.40 | PbZn(VO4)(OH) | |
| ⓘ | Mottramite | 8.BH.40 | PbCu(VO4)(OH) |
| ⓘ | Bayldonite | 8.BH.45 | PbCu3(AsO4)2(OH)2 |
| ⓘ | Beudantite | 8.BL.05 | PbFe3+3(AsO4)(SO4)(OH)6 |
| ⓘ | Mimetite | 8.BN.05 | Pb5(AsO4)3Cl |
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Vanadinite | 8.BN.05 | Pb5(VO4)3Cl |
| ⓘ | Variscite | 8.CD.10 | AlPO4 · 2H2O |
| ⓘ | var. Ferrian Variscite | 8.CD.10 | (Al,Fe)PO4 · 2H2O |
| ⓘ | Gormanite | 8.DC.45 | (Fe2+,Mg)3(Al,Fe3+)4(PO4)4(OH)6 · 2H2O |
| ⓘ | Chalcosiderite | 8.DD.15 | CuFe3+6(PO4)4(OH)8 · 4H2O |
| ⓘ | Turquoise | 8.DD.15 | CuAl6(PO4)4(OH)8 · 4H2O |
| ⓘ | Liroconite | 8.DF.20 | Cu2Al(AsO4)(OH)4 · 4H2O |
| ⓘ | Chalcophyllite | 8.DF.30 | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| ⓘ | Pharmacosiderite | 8.DK.10 | KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| ⓘ | Torbernite | 8.EB.05 | Cu(UO2)2(PO4)2 · 12H2O |
| ⓘ | Metatorbernite | 8.EB.10 | Cu(UO2)2(PO4)2 · 8H2O |
| Group 9 - Silicates | |||
| ⓘ | Chrysotile | 9.00. | Mg3(Si2O5)(OH)4 |
| ⓘ | Willemite | 9.AA.05 | Zn2SiO4 |
| ⓘ | Andradite | 9.AD.25 | Ca3Fe3+2(SiO4)3 |
| ⓘ | Grossular | 9.AD.25 | Ca3Al2(SiO4)3 |
| ⓘ | Pyrope | 9.AD.25 | Mg3Al2(SiO4)3 |
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Braunite | 9.AG.05 | Mn2+Mn3+6(SiO4)O8 |
| ⓘ | Neltnerite | 9.AG.05 | CaMn3+6(SiO4)O8 |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Hemimorphite | 9.BD.10 | Zn4Si2O7(OH)2 · H2O |
| ⓘ | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Zoisite | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Vesuvianite | 9.BG.35 | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ | Dioptase | 9.CJ.30 | CuSiO3 · H2O |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Enstatite | 9.DA.05 | Mg2Si2O6 |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Plancheite | 9.DB.35 | Cu8(Si8O22)(OH)4 · H2O |
| ⓘ | Shattuckite (TL) | 9.DB.40 | Cu5(Si2O6)2(OH)2 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Edenite | 9.DE.15 | NaCa2Mg5(Si7Al)O22(OH)2 |
| ⓘ | Wollastonite | 9.DG.05 | Ca3(Si3O9) |
| ⓘ | Prehnite | 9.DP.20 | Ca2Al2Si3O10(OH)2 |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Pyrophyllite | 9.EC.10 | Al2Si4O10(OH)2 |
| ⓘ | Celadonite | 9.EC.15 | K(MgFe3+◻)(Si4O10)(OH)2 |
| ⓘ | Muscovite var. Illite | 9.EC.15 | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | Roscoelite | 9.EC.15 | KV3+2(AlSi3O10)(OH)2 |
| ⓘ | Muscovite var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Volkonskoite | 9.EC.40 | Ca0.3(Cr,Mg,Fe)2((Si,Al)4O10)(OH)2 · 4H2O |
| ⓘ | Stevensite | 9.EC.45 | (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| ⓘ | Chamosite | 9.EC.55 | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | 'Clinochrysotile' | 9.ED. | Mg3(Si2O5)(OH)4 |
| ⓘ | Dickite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Halloysite | 9.ED.10 | Al2(Si2O5)(OH)4 |
| ⓘ | Hisingerite | 9.ED.10 | Fe3+2(Si2O5)(OH)4 · 2H2O |
| ⓘ | Antigorite | 9.ED.15 | Mg3(Si2O5)(OH)4 |
| ⓘ | Allophane | 9.ED.20 | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Sepiolite | 9.EE.25 | Mg4(Si6O15)(OH)2 · 6H2O |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Sanidine | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Anorthite | 9.FA.35 | Ca(Al2Si2O8) |
| ⓘ | var. Labradorite | 9.FA.35 | (Ca,Na)[Al(Al,Si)Si2O8] |
| ⓘ | Meionite | 9.FB.15 | Ca4Al6Si6O24CO3 |
| ⓘ | Natrolite | 9.GA.05 | Na2Al2Si3O10 · 2H2O |
| ⓘ | Thomsonite-Ca | 9.GA.10 | NaCa2[Al5Si5O20] · 6H2O |
| ⓘ | Laumontite | 9.GB.10 | CaAl2Si4O12 · 4H2O |
| Group 10 - Organic Compounds | |||
| ⓘ | Hoganite | 10.AA.35 | Cu(CH3COO)2 · H2O |
| Unclassified | |||
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Delessite' | - | (Mg,Fe,Fe,Al)(Si,Al)4O10(O,OH)8 |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Psilomelane' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| ⓘ | 'Wad' | - | |
| ⓘ | 'Scapolite var. Wernerite' | - | |
| ⓘ | 'Fayalite-Forsterite Series' | - | |
| ⓘ | 'Scapolite' | - | |
| ⓘ | 'Hydromuscovite' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Silica' | - | |
| ⓘ | 'Serpentine Subgroup' | - | D3[Si2O5](OH)4 |
| ⓘ | 'Bisbeeite' | - | (Cu,Mg)SiO3 · nH2O |
| ⓘ | 'Manganese Oxides' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'Campbellite' | - | |
| ⓘ | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| ⓘ | 'Iridescent coating' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| H | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| H | ⓘ Anthonyite | Cu(OH,Cl)2 · 3H2O |
| H | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| H | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| H | ⓘ Atacamite | Cu2(OH)3Cl |
| H | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| H | ⓘ Bayleyite | Mg2(UO2)(CO3)3 · 18H2O |
| H | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| H | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| H | ⓘ Bianchite | Zn(SO4) · 6H2O |
| H | ⓘ Bílinite | Fe2+Fe23+(SO4)4 · 22H2O |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Böhmite | AlO(OH) |
| H | ⓘ Botryogen | MgFe3+(SO4)2(OH) · 7H2O |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Buttgenbachite | Cu19(NO3)2(OH)32Cl4 · 2H2O |
| H | ⓘ Brucite | Mg(OH)2 |
| H | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| H | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| H | ⓘ Cesàrolite | PbMn34+O6(OH)2 |
| H | ⓘ Chalcosiderite | CuFe63+(PO4)4(OH)8 · 4H2O |
| H | ⓘ Chalcophanite | ZnMn34+O7 · 3H2O |
| H | ⓘ Chalcanthite | CuSO4 · 5H2O |
| H | ⓘ Chalcoalumite | CuAl4(SO4)(OH)12 · 3H2O |
| H | ⓘ Chamosite | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| H | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| H | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Claringbullite | Cu4ClF(OH)6 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Clinochrysotile | Mg3(Si2O5)(OH)4 |
| H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| H | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| H | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| H | ⓘ Coquimbite | AlFe3(SO4)6(H2O)12 · 6H2O |
| H | ⓘ Cuprocopiapite | Cu2+Fe43+(SO4)6(OH)2 · 20H2O |
| H | ⓘ Descloizite var. Copper-bearing Descloizite | Pb(Zn,Cu)VO4OH |
| H | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| H | ⓘ Delessite | (Mg,Fe,Fe,Al)(Si,Al)4O10(O,OH)8 |
| H | ⓘ Descloizite | PbZn(VO4)(OH) |
| H | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| H | ⓘ Diaspore | AlO(OH) |
| H | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| H | ⓘ Dioptase | CuSiO3 · H2O |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Epsomite | MgSO4 · 7H2O |
| H | ⓘ Felsőbányaite | Al4(SO4)(OH)10 · 4H2O |
| H | ⓘ Ferricopiapite | Fe3+0.67Fe43+(SO4)6(OH)2 · 20H2O |
| H | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| H | ⓘ Fibroferrite | Fe3+(SO4)(OH) · 5H2O |
| H | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| H | ⓘ Gibbsite | Al(OH)3 |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gormanite | (Fe2+,Mg)3(Al,Fe3+)4(PO4)4(OH)6 · 2H2O |
| H | ⓘ Graemite | Cu[TeO3] · H2O |
| H | ⓘ Groutite | Mn3+O(OH) |
| H | ⓘ Gunningite | ZnSO4 · H2O |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Halloysite | Al2(Si2O5)(OH)4 |
| H | ⓘ Halotrichite | FeAl2(SO4)4 · 22H2O |
| H | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| H | ⓘ Hexahydrite | MgSO4 · 6H2O |
| H | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| H | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
| H | ⓘ Hydrobasaluminite | Al4(SO4)(OH)10 · 12-36H2O |
| H | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| H | ⓘ Hetaerolite var. Hydrohetaerolite | Zn(Mn,◻)2(O,OH)4 |
| H | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| H | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| H | ⓘ Ilsemannite | Mo3O8 · nH2O |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Johannite | Cu(UO2)2(SO4)2(OH)2 · 8H2O |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Kornelite | Fe2(SO4)3 · 7H2O |
| H | ⓘ Ktenasite | ZnCu4(SO4)2(OH)6 · 6H2O |
| H | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| H | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| H | ⓘ Lepidocrocite | Fe3+O(OH) |
| H | ⓘ Linarite | PbCu(SO4)(OH)2 |
| H | ⓘ Liroconite | Cu2Al(AsO4)(OH)4 · 4H2O |
| H | ⓘ Manganite | Mn3+O(OH) |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| H | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| H | ⓘ Metavoltine | K2Na6Fe2+Fe63+O2(SO4)12 · 18H2O |
| H | ⓘ Mottramite | PbCu(VO4)(OH) |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Nolanite | V83+Fe23+O14(OH)2 |
| H | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Osarizawaite | Pb(Al2Cu2+)(SO4)2(OH)6 |
| H | ⓘ Paracoquimbite | Fe4(SO4)6(H2O)12 · 6H2O |
| H | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| H | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| H | ⓘ Pickeringite | MgAl2(SO4)4 · 22H2O |
| H | ⓘ Plancheite | Cu8(Si8O22)(OH)4 · H2O |
| H | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| H | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| H | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| H | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| H | ⓘ Hydrokenoralstonite | Na0.5(Al,Mg)2(F,OH)6 · H2O |
| H | ⓘ Ransomite | CuFe2(SO4)4 · 6H2O |
| H | ⓘ Rhomboclase | (H5O2)Fe3+(SO4)2 · 2H2O |
| H | ⓘ Römerite | Fe2+Fe23+(SO4)4 · 14H2O |
| H | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| H | ⓘ Roscoelite | KV23+(AlSi3O10)(OH)2 |
| H | ⓘ Rozenite | FeSO4 · 4H2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Scorzalite | Fe2+Al2(PO4)2(OH)2 |
| H | ⓘ Sengierite | Cu2(UO2)2(VO4)2 · 6H2O |
| H | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| H | ⓘ Shattuckite | Cu5(Si2O6)2(OH)2 |
| H | ⓘ Siderotil | FeSO4 · 5H2O |
| H | ⓘ Spangolite | Cu6Al(SO4)(OH)12Cl · 3H2O |
| H | ⓘ Spertiniite | Cu(OH)2 |
| H | ⓘ Stevensite | (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| H | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| H | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| H | ⓘ Szomolnokite | FeSO4 · H2O |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Teineite | Cu2+(Te4+O3) · 2H2O |
| H | ⓘ Thomsonite-Ca | NaCa2[Al5Si5O20] · 6H2O |
| H | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| H | ⓘ Tyuyamunite | Ca(UO2)2(VO4)2 · 5-8H2O |
| H | ⓘ Uranopilite | (UO2)6(SO4)O2(OH)6 · 14H2O |
| H | ⓘ Variscite | AlPO4 · 2H2O |
| H | ⓘ Volkonskoite | Ca0.3(Cr,Mg,Fe)2((Si,Al)4O10)(OH)2 · 4H2O |
| H | ⓘ Voltaite | K2Fe52+Fe33+Al(SO4)12 · 18H2O |
| H | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| H | ⓘ Zincobotryogen | (Zn,Mg,Mn2+)Fe3+(SO4)2(OH) · 7H2O |
| H | ⓘ Zincocopiapite | ZnFe43+(SO4)6(OH)2 · 18H2O |
| H | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| H | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Hoganite | Cu(CH3COO)2 · H2O |
| H | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| H | ⓘ Variscite var. Ferrian Variscite | (Al,Fe)PO4 · 2H2O |
| H | ⓘ Bisbeeite | (Cu,Mg)SiO3 · nH2O |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| H | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| B | Boron | |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Bayleyite | Mg2(UO2)(CO3)3 · 18H2O |
| C | ⓘ Bismutite | (BiO)2CO3 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Graphite | C |
| C | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| C | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| C | ⓘ Kettnerite | CaBiCO3OF |
| C | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| C | ⓘ Magnesite | MgCO3 |
| C | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| C | ⓘ Rhodochrosite | MnCO3 |
| C | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Smithsonite | ZnCO3 |
| C | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| C | ⓘ Scapolite var. Wernerite | |
| C | ⓘ Aragonite var. Flos Ferri | CaCO3 |
| C | ⓘ Hoganite | Cu(CH3COO)2 · H2O |
| N | Nitrogen | |
| N | ⓘ Buttgenbachite | Cu19(NO3)2(OH)32Cl4 · 2H2O |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| O | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Anhydrite | CaSO4 |
| O | ⓘ Anorthite | Ca(Al2Si2O8) |
| O | ⓘ Anthonyite | Cu(OH,Cl)2 · 3H2O |
| O | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| O | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Atacamite | Cu2(OH)3Cl |
| O | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| O | ⓘ Bayleyite | Mg2(UO2)(CO3)3 · 18H2O |
| O | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| O | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| O | ⓘ Bianchite | Zn(SO4) · 6H2O |
| O | ⓘ Bílinite | Fe2+Fe23+(SO4)4 · 22H2O |
| O | ⓘ Bindheimite | Pb2Sb2O6O |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Bismite | Bi2O3 |
| O | ⓘ Bismutite | (BiO)2CO3 |
| O | ⓘ Bixbyite-(Mn) | Mn23+O3 |
| O | ⓘ Böhmite | AlO(OH) |
| O | ⓘ Botryogen | MgFe3+(SO4)2(OH) · 7H2O |
| O | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Brookite | TiO2 |
| O | ⓘ Buttgenbachite | Cu19(NO3)2(OH)32Cl4 · 2H2O |
| O | ⓘ Brucite | Mg(OH)2 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Cesàrolite | PbMn34+O6(OH)2 |
| O | ⓘ Chalcosiderite | CuFe63+(PO4)4(OH)8 · 4H2O |
| O | ⓘ Chalcophanite | ZnMn34+O7 · 3H2O |
| O | ⓘ Chalcanthite | CuSO4 · 5H2O |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Chalcoalumite | CuAl4(SO4)(OH)12 · 3H2O |
| O | ⓘ Chamosite | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| O | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| O | ⓘ Cuprite var. Chalcotrichite | Cu2O |
| O | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| O | ⓘ Chromite | Fe2+Cr23+O4 |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Claringbullite | Cu4ClF(OH)6 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Clinochrysotile | Mg3(Si2O5)(OH)4 |
| O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| O | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| O | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| O | ⓘ Coquimbite | AlFe3(SO4)6(H2O)12 · 6H2O |
| O | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| O | ⓘ Crednerite | Cu+Mn3+O2 |
| O | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Cuprocopiapite | Cu2+Fe43+(SO4)6(OH)2 · 20H2O |
| O | ⓘ Descloizite var. Copper-bearing Descloizite | Pb(Zn,Cu)VO4OH |
| O | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| O | ⓘ Delafossite | Cu+Fe3+O2 |
| O | ⓘ Delessite | (Mg,Fe,Fe,Al)(Si,Al)4O10(O,OH)8 |
| O | ⓘ Descloizite | PbZn(VO4)(OH) |
| O | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| O | ⓘ Diaspore | AlO(OH) |
| O | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dioptase | CuSiO3 · H2O |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| O | ⓘ Enstatite | Mg2Si2O6 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Epsomite | MgSO4 · 7H2O |
| O | ⓘ Felsőbányaite | Al4(SO4)(OH)10 · 4H2O |
| O | ⓘ Ferricopiapite | Fe3+0.67Fe43+(SO4)6(OH)2 · 20H2O |
| O | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| O | ⓘ Fibroferrite | Fe3+(SO4)(OH) · 5H2O |
| O | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| O | ⓘ Gibbsite | Al(OH)3 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Gormanite | (Fe2+,Mg)3(Al,Fe3+)4(PO4)4(OH)6 · 2H2O |
| O | ⓘ Graemite | Cu[TeO3] · H2O |
| O | ⓘ Grossular | Ca3Al2(SiO4)3 |
| O | ⓘ Groutite | Mn3+O(OH) |
| O | ⓘ Gunningite | ZnSO4 · H2O |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Halloysite | Al2(Si2O5)(OH)4 |
| O | ⓘ Halotrichite | FeAl2(SO4)4 · 22H2O |
| O | ⓘ Hausmannite | Mn2+Mn23+O4 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| O | ⓘ Hetaerolite | ZnMn2O4 |
| O | ⓘ Hexahydrite | MgSO4 · 6H2O |
| O | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| O | ⓘ Hübnerite | MnWO4 |
| O | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
| O | ⓘ Hydrobasaluminite | Al4(SO4)(OH)10 · 12-36H2O |
| O | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| O | ⓘ Hetaerolite var. Hydrohetaerolite | Zn(Mn,◻)2(O,OH)4 |
| O | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| O | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| O | ⓘ Ilsemannite | Mo3O8 · nH2O |
| O | ⓘ Jacobsite | Mn2+Fe23+O4 |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Johannite | Cu(UO2)2(SO4)2(OH)2 · 8H2O |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Kettnerite | CaBiCO3OF |
| O | ⓘ Kornelite | Fe2(SO4)3 · 7H2O |
| O | ⓘ Ktenasite | ZnCu4(SO4)2(OH)6 · 6H2O |
| O | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| O | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| O | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| O | ⓘ Lepidocrocite | Fe3+O(OH) |
| O | ⓘ Lime | CaO |
| O | ⓘ Linarite | PbCu(SO4)(OH)2 |
| O | ⓘ Liroconite | Cu2Al(AsO4)(OH)4 · 4H2O |
| O | ⓘ Magnesite | MgCO3 |
| O | ⓘ Manganite | Mn3+O(OH) |
| O | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| O | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| O | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| O | ⓘ Metavoltine | K2Na6Fe2+Fe63+O2(SO4)12 · 18H2O |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Mimetite | Pb5(AsO4)3Cl |
| O | ⓘ Minium | Pb3O4 |
| O | ⓘ Mottramite | PbCu(VO4)(OH) |
| O | ⓘ Murdochite | Cu12Pb2O15Cl2 |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Neltnerite | CaMn63+(SiO4)O8 |
| O | ⓘ Nolanite | V83+Fe23+O14(OH)2 |
| O | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Osarizawaite | Pb(Al2Cu2+)(SO4)2(OH)6 |
| O | ⓘ Paracoquimbite | Fe4(SO4)6(H2O)12 · 6H2O |
| O | ⓘ Paramelaconite | Cu21+Cu22+O3 |
| O | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| O | ⓘ Paratellurite | TeO2 |
| O | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| O | ⓘ Pickeringite | MgAl2(SO4)4 · 22H2O |
| O | ⓘ Plancheite | Cu8(Si8O22)(OH)4 · H2O |
| O | ⓘ Plattnerite | PbO2 |
| O | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| O | ⓘ Powellite | Ca(MoO4) |
| O | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| O | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| O | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Hydrokenoralstonite | Na0.5(Al,Mg)2(F,OH)6 · H2O |
| O | ⓘ Ransomite | CuFe2(SO4)4 · 6H2O |
| O | ⓘ Rhodochrosite | MnCO3 |
| O | ⓘ Rhomboclase | (H5O2)Fe3+(SO4)2 · 2H2O |
| O | ⓘ Römerite | Fe2+Fe23+(SO4)4 · 14H2O |
| O | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| O | ⓘ Roscoelite | KV23+(AlSi3O10)(OH)2 |
| O | ⓘ Rozenite | FeSO4 · 4H2O |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Sanidine | K(AlSi3O8) |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Scorzalite | Fe2+Al2(PO4)2(OH)2 |
| O | ⓘ Sengierite | Cu2(UO2)2(VO4)2 · 6H2O |
| O | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| O | ⓘ Shattuckite | Cu5(Si2O6)2(OH)2 |
| O | ⓘ Siderotil | FeSO4 · 5H2O |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Smithsonite | ZnCO3 |
| O | ⓘ Spangolite | Cu6Al(SO4)(OH)12Cl · 3H2O |
| O | ⓘ Spertiniite | Cu(OH)2 |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Stevensite | (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| O | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| O | ⓘ Stolzite | Pb(WO4) |
| O | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| O | ⓘ Szomolnokite | FeSO4 · H2O |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Teineite | Cu2+(Te4+O3) · 2H2O |
| O | ⓘ Tellurite | TeO2 |
| O | ⓘ Tenorite | CuO |
| O | ⓘ Thomsonite-Ca | NaCa2[Al5Si5O20] · 6H2O |
| O | ⓘ Tilasite | CaMg(AsO4)F |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| O | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| O | ⓘ Tyuyamunite | Ca(UO2)2(VO4)2 · 5-8H2O |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Uranopilite | (UO2)6(SO4)O2(OH)6 · 14H2O |
| O | ⓘ Vanadinite | Pb5(VO4)3Cl |
| O | ⓘ Variscite | AlPO4 · 2H2O |
| O | ⓘ Volkonskoite | Ca0.3(Cr,Mg,Fe)2((Si,Al)4O10)(OH)2 · 4H2O |
| O | ⓘ Voltaite | K2Fe52+Fe33+Al(SO4)12 · 18H2O |
| O | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| O | ⓘ Scapolite var. Wernerite | |
| O | ⓘ Willemite | Zn2SiO4 |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Wollastonite | Ca3(Si3O9) |
| O | ⓘ Zincobotryogen | (Zn,Mg,Mn2+)Fe3+(SO4)2(OH) · 7H2O |
| O | ⓘ Zincocopiapite | ZnFe43+(SO4)6(OH)2 · 18H2O |
| O | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| O | ⓘ Hematite var. Specularite | Fe2O3 |
| O | ⓘ Aragonite var. Flos Ferri | CaCO3 |
| O | ⓘ Fayalite-Forsterite Series | |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Tenorite var. Geltenorite | CuO |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Hoganite | Cu(CH3COO)2 · H2O |
| O | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| O | ⓘ Variscite var. Ferrian Variscite | (Al,Fe)PO4 · 2H2O |
| O | ⓘ Bisbeeite | (Cu,Mg)SiO3 · nH2O |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| O | ⓘ Eddavidite | Cu12Pb2O15Br2 |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Claringbullite | Cu4ClF(OH)6 |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Kettnerite | CaBiCO3OF |
| F | ⓘ Hydrokenoralstonite | Na0.5(Al,Mg)2(F,OH)6 · H2O |
| F | ⓘ Tilasite | CaMg(AsO4)F |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Na | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Na | ⓘ Metavoltine | K2Na6Fe2+Fe63+O2(SO4)12 · 18H2O |
| Na | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Na | ⓘ Hydrokenoralstonite | Na0.5(Al,Mg)2(F,OH)6 · H2O |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Stevensite | (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| Na | ⓘ Thomsonite-Ca | NaCa2[Al5Si5O20] · 6H2O |
| Na | ⓘ Scapolite var. Wernerite | |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Bayleyite | Mg2(UO2)(CO3)3 · 18H2O |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Botryogen | MgFe3+(SO4)2(OH) · 7H2O |
| Mg | ⓘ Brucite | Mg(OH)2 |
| Mg | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| Mg | ⓘ Chamosite | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| Mg | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Clinochrysotile | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Delessite | (Mg,Fe,Fe,Al)(Si,Al)4O10(O,OH)8 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Mg | ⓘ Enstatite | Mg2Si2O6 |
| Mg | ⓘ Epsomite | MgSO4 · 7H2O |
| Mg | ⓘ Gormanite | (Fe2+,Mg)3(Al,Fe3+)4(PO4)4(OH)6 · 2H2O |
| Mg | ⓘ Hexahydrite | MgSO4 · 6H2O |
| Mg | ⓘ Magnesite | MgCO3 |
| Mg | ⓘ Pickeringite | MgAl2(SO4)4 · 22H2O |
| Mg | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| Mg | ⓘ Hydrokenoralstonite | Na0.5(Al,Mg)2(F,OH)6 · H2O |
| Mg | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| Mg | ⓘ Stevensite | (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Tilasite | CaMg(AsO4)F |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Volkonskoite | Ca0.3(Cr,Mg,Fe)2((Si,Al)4O10)(OH)2 · 4H2O |
| Mg | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Mg | ⓘ Fayalite-Forsterite Series | |
| Mg | ⓘ Bisbeeite | (Cu,Mg)SiO3 · nH2O |
| Al | Aluminium | |
| Al | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Al | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| Al | ⓘ Anorthite | Ca(Al2Si2O8) |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Böhmite | AlO(OH) |
| Al | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| Al | ⓘ Chalcoalumite | CuAl4(SO4)(OH)12 · 3H2O |
| Al | ⓘ Chamosite | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| Al | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Coquimbite | AlFe3(SO4)6(H2O)12 · 6H2O |
| Al | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| Al | ⓘ Delessite | (Mg,Fe,Fe,Al)(Si,Al)4O10(O,OH)8 |
| Al | ⓘ Diaspore | AlO(OH) |
| Al | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Felsőbányaite | Al4(SO4)(OH)10 · 4H2O |
| Al | ⓘ Gibbsite | Al(OH)3 |
| Al | ⓘ Gormanite | (Fe2+,Mg)3(Al,Fe3+)4(PO4)4(OH)6 · 2H2O |
| Al | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Al | ⓘ Halloysite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Halotrichite | FeAl2(SO4)4 · 22H2O |
| Al | ⓘ Hydrobasaluminite | Al4(SO4)(OH)10 · 12-36H2O |
| Al | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Al | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Al | ⓘ Liroconite | Cu2Al(AsO4)(OH)4 · 4H2O |
| Al | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Osarizawaite | Pb(Al2Cu2+)(SO4)2(OH)6 |
| Al | ⓘ Pickeringite | MgAl2(SO4)4 · 22H2O |
| Al | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Al | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| Al | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| Al | ⓘ Hydrokenoralstonite | Na0.5(Al,Mg)2(F,OH)6 · H2O |
| Al | ⓘ Roscoelite | KV23+(AlSi3O10)(OH)2 |
| Al | ⓘ Sanidine | K(AlSi3O8) |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Scorzalite | Fe2+Al2(PO4)2(OH)2 |
| Al | ⓘ Spangolite | Cu6Al(SO4)(OH)12Cl · 3H2O |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Thomsonite-Ca | NaCa2[Al5Si5O20] · 6H2O |
| Al | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| Al | ⓘ Variscite | AlPO4 · 2H2O |
| Al | ⓘ Volkonskoite | Ca0.3(Cr,Mg,Fe)2((Si,Al)4O10)(OH)2 · 4H2O |
| Al | ⓘ Voltaite | K2Fe52+Fe33+Al(SO4)12 · 18H2O |
| Al | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | ⓘ Scapolite var. Wernerite | |
| Al | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Variscite var. Ferrian Variscite | (Al,Fe)PO4 · 2H2O |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Si | ⓘ Anorthite | Ca(Al2Si2O8) |
| Si | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| Si | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Chamosite | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| Si | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Clinochrysotile | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Delessite | (Mg,Fe,Fe,Al)(Si,Al)4O10(O,OH)8 |
| Si | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Dioptase | CuSiO3 · H2O |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Si | ⓘ Enstatite | Mg2Si2O6 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Si | ⓘ Halloysite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Si | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| Si | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
| Si | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Si | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Si | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Neltnerite | CaMn63+(SiO4)O8 |
| Si | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Plancheite | Cu8(Si8O22)(OH)4 · H2O |
| Si | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Si | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| Si | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Roscoelite | KV23+(AlSi3O10)(OH)2 |
| Si | ⓘ Sanidine | K(AlSi3O8) |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| Si | ⓘ Shattuckite | Cu5(Si2O6)2(OH)2 |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Stevensite | (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Thomsonite-Ca | NaCa2[Al5Si5O20] · 6H2O |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Volkonskoite | Ca0.3(Cr,Mg,Fe)2((Si,Al)4O10)(OH)2 · 4H2O |
| Si | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Si | ⓘ Scapolite var. Wernerite | |
| Si | ⓘ Willemite | Zn2SiO4 |
| Si | ⓘ Wollastonite | Ca3(Si3O9) |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Fayalite-Forsterite Series | |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| Si | ⓘ Bisbeeite | (Cu,Mg)SiO3 · nH2O |
| Si | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| P | Phosphorus | |
| P | ⓘ Chalcosiderite | CuFe63+(PO4)4(OH)8 · 4H2O |
| P | ⓘ Gormanite | (Fe2+,Mg)3(Al,Fe3+)4(PO4)4(OH)6 · 2H2O |
| P | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| P | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Scorzalite | Fe2+Al2(PO4)2(OH)2 |
| P | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| P | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| P | ⓘ Variscite | AlPO4 · 2H2O |
| P | ⓘ Variscite var. Ferrian Variscite | (Al,Fe)PO4 · 2H2O |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Aikinite | PbCuBiS3 |
| S | ⓘ Alabandite | MnS |
| S | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Anhydrite | CaSO4 |
| S | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| S | ⓘ Pyrite var. Gold-bearing Pyrite | FeS2 |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| S | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| S | ⓘ Bianchite | Zn(SO4) · 6H2O |
| S | ⓘ Bílinite | Fe2+Fe23+(SO4)4 · 22H2O |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Botryogen | MgFe3+(SO4)2(OH) · 7H2O |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Canfieldite | Ag8SnS6 |
| S | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcanthite | CuSO4 · 5H2O |
| S | ⓘ Chalcoalumite | CuAl4(SO4)(OH)12 · 3H2O |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| S | ⓘ Chalcostibite | CuSbS2 |
| S | ⓘ Cinnabar | HgS |
| S | ⓘ Colusite | Cu13VAs3S16 |
| S | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| S | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| S | ⓘ Coquimbite | AlFe3(SO4)6(H2O)12 · 6H2O |
| S | ⓘ Cosalite | Pb2Bi2S5 |
| S | ⓘ Covellite | CuS |
| S | ⓘ Cuprocopiapite | Cu2+Fe43+(SO4)6(OH)2 · 20H2O |
| S | ⓘ Cupropavonite | Cu0.9Ag0.5Pb0.6Bi2.5S5 |
| S | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| S | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| S | ⓘ Digenite | Cu9S5 |
| S | ⓘ Djurleite | Cu31S16 |
| S | ⓘ Emplectite | CuBiS2 |
| S | ⓘ Enargite | Cu3AsS4 |
| S | ⓘ Epsomite | MgSO4 · 7H2O |
| S | ⓘ Famatinite | Cu3SbS4 |
| S | ⓘ Felsőbányaite | Al4(SO4)(OH)10 · 4H2O |
| S | ⓘ Ferricopiapite | Fe3+0.67Fe43+(SO4)6(OH)2 · 20H2O |
| S | ⓘ Fibroferrite | Fe3+(SO4)(OH) · 5H2O |
| S | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| S | ⓘ Furutobeite | (Cu,Ag)6PbS4 |
| S | ⓘ Galena | PbS |
| S | ⓘ Goldfieldite | (Cu4◻2)(Cu4Cu2+)Te4S12S |
| S | ⓘ Greenockite | CdS |
| S | ⓘ Gunningite | ZnSO4 · H2O |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Halotrichite | FeAl2(SO4)4 · 22H2O |
| S | ⓘ Hexahydrite | MgSO4 · 6H2O |
| S | ⓘ Hocartite | Ag2(Fe2+,Zn)SnS4 |
| S | ⓘ Hodrušite | Cu8Bi12S22 |
| S | ⓘ Hydrobasaluminite | Al4(SO4)(OH)10 · 12-36H2O |
| S | ⓘ Jalpaite | Ag3CuS2 |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Johannite | Cu(UO2)2(SO4)2(OH)2 · 8H2O |
| S | ⓘ Kësterite | Cu2ZnSnS4 |
| S | ⓘ Kiddcreekite | Cu6SnWS8 |
| S | ⓘ Kornelite | Fe2(SO4)3 · 7H2O |
| S | ⓘ Krupkaite | PbCuBi3S6 |
| S | ⓘ Ktenasite | ZnCu4(SO4)2(OH)6 · 6H2O |
| S | ⓘ Kuramite | Cu3SnS4 |
| S | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| S | ⓘ Linarite | PbCu(SO4)(OH)2 |
| S | ⓘ Luzonite | Cu3AsS4 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Matildite | AgBiS2 |
| S | ⓘ Mawsonite | Cu6Fe2SnS8 |
| S | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| S | ⓘ Metavoltine | K2Na6Fe2+Fe63+O2(SO4)12 · 18H2O |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Nekrasovite | Cu26V2(Sn,As,Sb)6S32 |
| S | ⓘ Osarizawaite | Pb(Al2Cu2+)(SO4)2(OH)6 |
| S | ⓘ Paracoquimbite | Fe4(SO4)6(H2O)12 · 6H2O |
| S | ⓘ Pearceite | [Ag6As2S7][Ag9CuS4] |
| S | ⓘ Pickeringite | MgAl2(SO4)4 · 22H2O |
| S | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| S | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| S | ⓘ Pyrargyrite | Ag3SbS3 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Ransomite | CuFe2(SO4)4 · 6H2O |
| S | ⓘ Rhodostannite | Cu1+(Fe2+0.5Sn4+1.5)S4 |
| S | ⓘ Rhomboclase | (H5O2)Fe3+(SO4)2 · 2H2O |
| S | ⓘ Römerite | Fe2+Fe23+(SO4)4 · 14H2O |
| S | ⓘ Roquesite | CuInS2 |
| S | ⓘ Rozenite | FeSO4 · 4H2O |
| S | ⓘ Siderotil | FeSO4 · 5H2O |
| S | ⓘ Spangolite | Cu6Al(SO4)(OH)12Cl · 3H2O |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Spionkopite | Cu39S28 |
| S | ⓘ Stannite | Cu2FeSnS4 |
| S | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| S | ⓘ Stromeyerite | AgCuS |
| S | ⓘ Native Sulphur | S8 |
| S | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| S | ⓘ Szomolnokite | FeSO4 · H2O |
| S | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| S | ⓘ Tetradymite | Bi2Te2S |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Tungstenite | WS2 |
| S | ⓘ Uranopilite | (UO2)6(SO4)O2(OH)6 · 14H2O |
| S | ⓘ Velikite | Cu2HgSnS4 |
| S | ⓘ Voltaite | K2Fe52+Fe33+Al(SO4)12 · 18H2O |
| S | ⓘ Wittichenite | Cu3BiS3 |
| S | ⓘ Yarrowite | Cu9S8 |
| S | ⓘ Zincobotryogen | (Zn,Mg,Mn2+)Fe3+(SO4)2(OH) · 7H2O |
| S | ⓘ Zincocopiapite | ZnFe43+(SO4)6(OH)2 · 18H2O |
| S | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| S | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| S | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| S | ⓘ Wittichenite var. Silver-bearing Wittichenite | (Cu,Ag)3BiS3 |
| Cl | Chlorine | |
| Cl | ⓘ Anthonyite | Cu(OH,Cl)2 · 3H2O |
| Cl | ⓘ Atacamite | Cu2(OH)3Cl |
| Cl | ⓘ Buttgenbachite | Cu19(NO3)2(OH)32Cl4 · 2H2O |
| Cl | ⓘ Chlorargyrite | AgCl |
| Cl | ⓘ Claringbullite | Cu4ClF(OH)6 |
| Cl | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Cl | ⓘ Chlorargyrite var. Bromian Chlorargyrite | Ag(Cl,Br) |
| Cl | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Cl | ⓘ Murdochite | Cu12Pb2O15Cl2 |
| Cl | ⓘ Nantokite | CuCl |
| Cl | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Cl | ⓘ Spangolite | Cu6Al(SO4)(OH)12Cl · 3H2O |
| Cl | ⓘ Tolbachite | CuCl2 |
| Cl | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Cl | ⓘ Scapolite var. Wernerite | |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| K | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| K | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| K | ⓘ Metavoltine | K2Na6Fe2+Fe63+O2(SO4)12 · 18H2O |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| K | ⓘ Roscoelite | KV23+(AlSi3O10)(OH)2 |
| K | ⓘ Sanidine | K(AlSi3O8) |
| K | ⓘ Voltaite | K2Fe52+Fe33+Al(SO4)12 · 18H2O |
| K | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Ca | ⓘ Anhydrite | CaSO4 |
| Ca | ⓘ Anorthite | Ca(Al2Si2O8) |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| Ca | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Kettnerite | CaBiCO3OF |
| Ca | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Ca | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Ca | ⓘ Lime | CaO |
| Ca | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| Ca | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Ca | ⓘ Neltnerite | CaMn63+(SiO4)O8 |
| Ca | ⓘ Powellite | Ca(MoO4) |
| Ca | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Stevensite | (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| Ca | ⓘ Thomsonite-Ca | NaCa2[Al5Si5O20] · 6H2O |
| Ca | ⓘ Tilasite | CaMg(AsO4)F |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Tyuyamunite | Ca(UO2)2(VO4)2 · 5-8H2O |
| Ca | ⓘ Volkonskoite | Ca0.3(Cr,Mg,Fe)2((Si,Al)4O10)(OH)2 · 4H2O |
| Ca | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Ca | ⓘ Scapolite var. Wernerite | |
| Ca | ⓘ Wollastonite | Ca3(Si3O9) |
| Ca | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| Ca | ⓘ Aragonite var. Flos Ferri | CaCO3 |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ti | Titanium | |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Brookite | TiO2 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| V | Vanadium | |
| V | ⓘ Colusite | Cu13VAs3S16 |
| V | ⓘ Descloizite var. Copper-bearing Descloizite | Pb(Zn,Cu)VO4OH |
| V | ⓘ Descloizite | PbZn(VO4)(OH) |
| V | ⓘ Mottramite | PbCu(VO4)(OH) |
| V | ⓘ Nekrasovite | Cu26V2(Sn,As,Sb)6S32 |
| V | ⓘ Nolanite | V83+Fe23+O14(OH)2 |
| V | ⓘ Roscoelite | KV23+(AlSi3O10)(OH)2 |
| V | ⓘ Sengierite | Cu2(UO2)2(VO4)2 · 6H2O |
| V | ⓘ Tyuyamunite | Ca(UO2)2(VO4)2 · 5-8H2O |
| V | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Cr | Chromium | |
| Cr | ⓘ Chromite | Fe2+Cr23+O4 |
| Cr | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| Cr | ⓘ Volkonskoite | Ca0.3(Cr,Mg,Fe)2((Si,Al)4O10)(OH)2 · 4H2O |
| Mn | Manganese | |
| Mn | ⓘ Alabandite | MnS |
| Mn | ⓘ Bixbyite-(Mn) | Mn23+O3 |
| Mn | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| Mn | ⓘ Cesàrolite | PbMn34+O6(OH)2 |
| Mn | ⓘ Chalcophanite | ZnMn34+O7 · 3H2O |
| Mn | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| Mn | ⓘ Crednerite | Cu+Mn3+O2 |
| Mn | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| Mn | ⓘ Groutite | Mn3+O(OH) |
| Mn | ⓘ Hausmannite | Mn2+Mn23+O4 |
| Mn | ⓘ Hetaerolite | ZnMn2O4 |
| Mn | ⓘ Hübnerite | MnWO4 |
| Mn | ⓘ Hetaerolite var. Hydrohetaerolite | Zn(Mn,◻)2(O,OH)4 |
| Mn | ⓘ Jacobsite | Mn2+Fe23+O4 |
| Mn | ⓘ Manganite | Mn3+O(OH) |
| Mn | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| Mn | ⓘ Neltnerite | CaMn63+(SiO4)O8 |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Rhodochrosite | MnCO3 |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Fe | ⓘ Pyrite var. Gold-bearing Pyrite | FeS2 |
| Fe | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| Fe | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| Fe | ⓘ Bílinite | Fe2+Fe23+(SO4)4 · 22H2O |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bogdanovite | (Au,Te,Pb)3(Cu,Fe) |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Botryogen | MgFe3+(SO4)2(OH) · 7H2O |
| Fe | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| Fe | ⓘ Chalcosiderite | CuFe63+(PO4)4(OH)8 · 4H2O |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chamosite | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| Fe | ⓘ Chromite | Fe2+Cr23+O4 |
| Fe | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| Fe | ⓘ Coquimbite | AlFe3(SO4)6(H2O)12 · 6H2O |
| Fe | ⓘ Cuprocopiapite | Cu2+Fe43+(SO4)6(OH)2 · 20H2O |
| Fe | ⓘ Delafossite | Cu+Fe3+O2 |
| Fe | ⓘ Delessite | (Mg,Fe,Fe,Al)(Si,Al)4O10(O,OH)8 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Ferricopiapite | Fe3+0.67Fe43+(SO4)6(OH)2 · 20H2O |
| Fe | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| Fe | ⓘ Fibroferrite | Fe3+(SO4)(OH) · 5H2O |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Gormanite | (Fe2+,Mg)3(Al,Fe3+)4(PO4)4(OH)6 · 2H2O |
| Fe | ⓘ Halotrichite | FeAl2(SO4)4 · 22H2O |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| Fe | ⓘ Hocartite | Ag2(Fe2+,Zn)SnS4 |
| Fe | ⓘ Jacobsite | Mn2+Fe23+O4 |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Kornelite | Fe2(SO4)3 · 7H2O |
| Fe | ⓘ Lepidocrocite | Fe3+O(OH) |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Mawsonite | Cu6Fe2SnS8 |
| Fe | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| Fe | ⓘ Metavoltine | K2Na6Fe2+Fe63+O2(SO4)12 · 18H2O |
| Fe | ⓘ Nolanite | V83+Fe23+O14(OH)2 |
| Fe | ⓘ Paracoquimbite | Fe4(SO4)6(H2O)12 · 6H2O |
| Fe | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| Fe | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Ransomite | CuFe2(SO4)4 · 6H2O |
| Fe | ⓘ Rhodostannite | Cu1+(Fe2+0.5Sn4+1.5)S4 |
| Fe | ⓘ Rhomboclase | (H5O2)Fe3+(SO4)2 · 2H2O |
| Fe | ⓘ Römerite | Fe2+Fe23+(SO4)4 · 14H2O |
| Fe | ⓘ Rozenite | FeSO4 · 4H2O |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Scorzalite | Fe2+Al2(PO4)2(OH)2 |
| Fe | ⓘ Siderotil | FeSO4 · 5H2O |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Stannite | Cu2FeSnS4 |
| Fe | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| Fe | ⓘ Szomolnokite | FeSO4 · H2O |
| Fe | ⓘ Volkonskoite | Ca0.3(Cr,Mg,Fe)2((Si,Al)4O10)(OH)2 · 4H2O |
| Fe | ⓘ Voltaite | K2Fe52+Fe33+Al(SO4)12 · 18H2O |
| Fe | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Fe | ⓘ Zincobotryogen | (Zn,Mg,Mn2+)Fe3+(SO4)2(OH) · 7H2O |
| Fe | ⓘ Zincocopiapite | ZnFe43+(SO4)6(OH)2 · 18H2O |
| Fe | ⓘ Hematite var. Specularite | Fe2O3 |
| Fe | ⓘ Fayalite-Forsterite Series | |
| Fe | ⓘ Variscite var. Ferrian Variscite | (Al,Fe)PO4 · 2H2O |
| Ni | Nickel | |
| Ni | ⓘ Melonite | NiTe2 |
| Ni | ⓘ Rammelsbergite | NiAs2 |
| Cu | Copper | |
| Cu | ⓘ Aikinite | PbCuBiS3 |
| Cu | ⓘ Anthonyite | Cu(OH,Cl)2 · 3H2O |
| Cu | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| Cu | ⓘ Atacamite | Cu2(OH)3Cl |
| Cu | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| Cu | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| Cu | ⓘ Bogdanovite | (Au,Te,Pb)3(Cu,Fe) |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Buttgenbachite | Cu19(NO3)2(OH)32Cl4 · 2H2O |
| Cu | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| Cu | ⓘ Chalcosiderite | CuFe63+(PO4)4(OH)8 · 4H2O |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcanthite | CuSO4 · 5H2O |
| Cu | ⓘ Chalcoalumite | CuAl4(SO4)(OH)12 · 3H2O |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Cuprite var. Chalcotrichite | Cu2O |
| Cu | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| Cu | ⓘ Chalcostibite | CuSbS2 |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Claringbullite | Cu4ClF(OH)6 |
| Cu | ⓘ Colusite | Cu13VAs3S16 |
| Cu | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| Cu | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Crednerite | Cu+Mn3+O2 |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Cuprocopiapite | Cu2+Fe43+(SO4)6(OH)2 · 20H2O |
| Cu | ⓘ Descloizite var. Copper-bearing Descloizite | Pb(Zn,Cu)VO4OH |
| Cu | ⓘ Cupropavonite | Cu0.9Ag0.5Pb0.6Bi2.5S5 |
| Cu | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Delafossite | Cu+Fe3+O2 |
| Cu | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Cu | ⓘ Digenite | Cu9S5 |
| Cu | ⓘ Dioptase | CuSiO3 · H2O |
| Cu | ⓘ Djurleite | Cu31S16 |
| Cu | ⓘ Emplectite | CuBiS2 |
| Cu | ⓘ Enargite | Cu3AsS4 |
| Cu | ⓘ Famatinite | Cu3SbS4 |
| Cu | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| Cu | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Cu | ⓘ Furutobeite | (Cu,Ag)6PbS4 |
| Cu | ⓘ Goldfieldite | (Cu4◻2)(Cu4Cu2+)Te4S12S |
| Cu | ⓘ Graemite | Cu[TeO3] · H2O |
| Cu | ⓘ Hodrušite | Cu8Bi12S22 |
| Cu | ⓘ Henryite | (Cu,Ag)3+xTe2 , with x ~ 0.40 |
| Cu | ⓘ Jalpaite | Ag3CuS2 |
| Cu | ⓘ Johannite | Cu(UO2)2(SO4)2(OH)2 · 8H2O |
| Cu | ⓘ Kësterite | Cu2ZnSnS4 |
| Cu | ⓘ Kiddcreekite | Cu6SnWS8 |
| Cu | ⓘ Kostovite | CuAuTe4 |
| Cu | ⓘ Krupkaite | PbCuBi3S6 |
| Cu | ⓘ Ktenasite | ZnCu4(SO4)2(OH)6 · 6H2O |
| Cu | ⓘ Kuramite | Cu3SnS4 |
| Cu | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Cu | ⓘ Liroconite | Cu2Al(AsO4)(OH)4 · 4H2O |
| Cu | ⓘ Luzonite | Cu3AsS4 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Mawsonite | Cu6Fe2SnS8 |
| Cu | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| Cu | ⓘ Miersite | (Ag,Cu)I |
| Cu | ⓘ Mottramite | PbCu(VO4)(OH) |
| Cu | ⓘ Murdochite | Cu12Pb2O15Cl2 |
| Cu | ⓘ Nantokite | CuCl |
| Cu | ⓘ Nekrasovite | Cu26V2(Sn,As,Sb)6S32 |
| Cu | ⓘ Osarizawaite | Pb(Al2Cu2+)(SO4)2(OH)6 |
| Cu | ⓘ Paramelaconite | Cu21+Cu22+O3 |
| Cu | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| Cu | ⓘ Pearceite | [Ag6As2S7][Ag9CuS4] |
| Cu | ⓘ Plancheite | Cu8(Si8O22)(OH)4 · H2O |
| Cu | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| Cu | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| Cu | ⓘ Ransomite | CuFe2(SO4)4 · 6H2O |
| Cu | ⓘ Rhodostannite | Cu1+(Fe2+0.5Sn4+1.5)S4 |
| Cu | ⓘ Rickardite | Cu7Te5 |
| Cu | ⓘ Roquesite | CuInS2 |
| Cu | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Cu | ⓘ Sengierite | Cu2(UO2)2(VO4)2 · 6H2O |
| Cu | ⓘ Shattuckite | Cu5(Si2O6)2(OH)2 |
| Cu | ⓘ Spangolite | Cu6Al(SO4)(OH)12Cl · 3H2O |
| Cu | ⓘ Spertiniite | Cu(OH)2 |
| Cu | ⓘ Spionkopite | Cu39S28 |
| Cu | ⓘ Stannite | Cu2FeSnS4 |
| Cu | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| Cu | ⓘ Stromeyerite | AgCuS |
| Cu | ⓘ Teineite | Cu2+(Te4+O3) · 2H2O |
| Cu | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Cu | ⓘ Tenorite | CuO |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Tolbachite | CuCl2 |
| Cu | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| Cu | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| Cu | ⓘ Velikite | Cu2HgSnS4 |
| Cu | ⓘ Wittichenite | Cu3BiS3 |
| Cu | ⓘ Yarrowite | Cu9S8 |
| Cu | ⓘ Tenorite var. Geltenorite | CuO |
| Cu | ⓘ Hoganite | Cu(CH3COO)2 · H2O |
| Cu | ⓘ Wittichenite var. Silver-bearing Wittichenite | (Cu,Ag)3BiS3 |
| Cu | ⓘ Bisbeeite | (Cu,Mg)SiO3 · nH2O |
| Cu | ⓘ Eddavidite | Cu12Pb2O15Br2 |
| Zn | Zinc | |
| Zn | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Zn | ⓘ Bianchite | Zn(SO4) · 6H2O |
| Zn | ⓘ Chalcophanite | ZnMn34+O7 · 3H2O |
| Zn | ⓘ Descloizite var. Copper-bearing Descloizite | Pb(Zn,Cu)VO4OH |
| Zn | ⓘ Descloizite | PbZn(VO4)(OH) |
| Zn | ⓘ Gunningite | ZnSO4 · H2O |
| Zn | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Zn | ⓘ Hetaerolite | ZnMn2O4 |
| Zn | ⓘ Hocartite | Ag2(Fe2+,Zn)SnS4 |
| Zn | ⓘ Hetaerolite var. Hydrohetaerolite | Zn(Mn,◻)2(O,OH)4 |
| Zn | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| Zn | ⓘ Kësterite | Cu2ZnSnS4 |
| Zn | ⓘ Ktenasite | ZnCu4(SO4)2(OH)6 · 6H2O |
| Zn | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| Zn | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Zn | ⓘ Smithsonite | ZnCO3 |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| Zn | ⓘ Willemite | Zn2SiO4 |
| Zn | ⓘ Zincobotryogen | (Zn,Mg,Mn2+)Fe3+(SO4)2(OH) · 7H2O |
| Zn | ⓘ Zincocopiapite | ZnFe43+(SO4)6(OH)2 · 18H2O |
| As | Arsenic | |
| As | ⓘ Native Arsenic | As |
| As | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| As | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| As | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| As | ⓘ Colusite | Cu13VAs3S16 |
| As | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| As | ⓘ Enargite | Cu3AsS4 |
| As | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| As | ⓘ Liroconite | Cu2Al(AsO4)(OH)4 · 4H2O |
| As | ⓘ Luzonite | Cu3AsS4 |
| As | ⓘ Mimetite | Pb5(AsO4)3Cl |
| As | ⓘ Nekrasovite | Cu26V2(Sn,As,Sb)6S32 |
| As | ⓘ Pearceite | [Ag6As2S7][Ag9CuS4] |
| As | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| As | ⓘ Rammelsbergite | NiAs2 |
| As | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| As | ⓘ Tilasite | CaMg(AsO4)F |
| Br | Bromine | |
| Br | ⓘ Bromargyrite | AgBr |
| Br | ⓘ Chlorargyrite var. Bromian Chlorargyrite | Ag(Cl,Br) |
| Br | ⓘ Eddavidite | Cu12Pb2O15Br2 |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Mo | Molybdenum | |
| Mo | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| Mo | ⓘ Ilsemannite | Mo3O8 · nH2O |
| Mo | ⓘ Molybdenite | MoS2 |
| Mo | ⓘ Powellite | Ca(MoO4) |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Bromargyrite | AgBr |
| Ag | ⓘ Canfieldite | Ag8SnS6 |
| Ag | ⓘ Chlorargyrite | AgCl |
| Ag | ⓘ Cupropavonite | Cu0.9Ag0.5Pb0.6Bi2.5S5 |
| Ag | ⓘ Dyscrasite | Ag3Sb |
| Ag | ⓘ Native Gold var. Electrum | (Au,Ag) |
| Ag | ⓘ Chlorargyrite var. Bromian Chlorargyrite | Ag(Cl,Br) |
| Ag | ⓘ Eugenite | Ag11Hg2 |
| Ag | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Ag | ⓘ Furutobeite | (Cu,Ag)6PbS4 |
| Ag | ⓘ Hessite | Ag2Te |
| Ag | ⓘ Hocartite | Ag2(Fe2+,Zn)SnS4 |
| Ag | ⓘ Henryite | (Cu,Ag)3+xTe2 , with x ~ 0.40 |
| Ag | ⓘ Iodargyrite | AgI |
| Ag | ⓘ Jalpaite | Ag3CuS2 |
| Ag | ⓘ Krennerite | Au3AgTe8 |
| Ag | ⓘ Matildite | AgBiS2 |
| Ag | ⓘ Miersite | (Ag,Cu)I |
| Ag | ⓘ Pearceite | [Ag6As2S7][Ag9CuS4] |
| Ag | ⓘ Petzite | Ag3AuTe2 |
| Ag | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| Ag | ⓘ Pyrargyrite | Ag3SbS3 |
| Ag | ⓘ Native Silver | Ag |
| Ag | ⓘ Stromeyerite | AgCuS |
| Ag | ⓘ Stützite | Ag5-xTe3, x = 0.24-0.36 |
| Ag | ⓘ Sylvanite | AgAuTe4 |
| Ag | ⓘ Volynskite | AgBiTe2 |
| Ag | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| Ag | ⓘ Wittichenite var. Silver-bearing Wittichenite | (Cu,Ag)3BiS3 |
| Cd | Cadmium | |
| Cd | ⓘ Greenockite | CdS |
| In | Indium | |
| In | ⓘ Roquesite | CuInS2 |
| Sn | Tin | |
| Sn | ⓘ Canfieldite | Ag8SnS6 |
| Sn | ⓘ Cassiterite | SnO2 |
| Sn | ⓘ Hocartite | Ag2(Fe2+,Zn)SnS4 |
| Sn | ⓘ Kësterite | Cu2ZnSnS4 |
| Sn | ⓘ Kiddcreekite | Cu6SnWS8 |
| Sn | ⓘ Kuramite | Cu3SnS4 |
| Sn | ⓘ Mawsonite | Cu6Fe2SnS8 |
| Sn | ⓘ Nekrasovite | Cu26V2(Sn,As,Sb)6S32 |
| Sn | ⓘ Rhodostannite | Cu1+(Fe2+0.5Sn4+1.5)S4 |
| Sn | ⓘ Stannite | Cu2FeSnS4 |
| Sn | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| Sn | ⓘ Velikite | Cu2HgSnS4 |
| Sb | Antimony | |
| Sb | ⓘ Bindheimite | Pb2Sb2O6O |
| Sb | ⓘ Chalcostibite | CuSbS2 |
| Sb | ⓘ Dyscrasite | Ag3Sb |
| Sb | ⓘ Famatinite | Cu3SbS4 |
| Sb | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Sb | ⓘ Nekrasovite | Cu26V2(Sn,As,Sb)6S32 |
| Sb | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| Sb | ⓘ Pyrargyrite | Ag3SbS3 |
| Sb | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Te | Tellurium | |
| Te | ⓘ Altaite | PbTe |
| Te | ⓘ Bogdanovite | (Au,Te,Pb)3(Cu,Fe) |
| Te | ⓘ Calaverite | AuTe2 |
| Te | ⓘ Goldfieldite | (Cu4◻2)(Cu4Cu2+)Te4S12S |
| Te | ⓘ Graemite | Cu[TeO3] · H2O |
| Te | ⓘ Hessite | Ag2Te |
| Te | ⓘ Henryite | (Cu,Ag)3+xTe2 , with x ~ 0.40 |
| Te | ⓘ Kostovite | CuAuTe4 |
| Te | ⓘ Krennerite | Au3AgTe8 |
| Te | ⓘ Melonite | NiTe2 |
| Te | ⓘ Paratellurite | TeO2 |
| Te | ⓘ Petzite | Ag3AuTe2 |
| Te | ⓘ Rickardite | Cu7Te5 |
| Te | ⓘ Rucklidgeite | PbBi2Te4 |
| Te | ⓘ Stützite | Ag5-xTe3, x = 0.24-0.36 |
| Te | ⓘ Sylvanite | AgAuTe4 |
| Te | ⓘ Teineite | Cu2+(Te4+O3) · 2H2O |
| Te | ⓘ Tellurite | TeO2 |
| Te | ⓘ Native Tellurium | Te |
| Te | ⓘ Tellurobismuthite | Bi2Te3 |
| Te | ⓘ Tetradymite | Bi2Te2S |
| Te | ⓘ Volynskite | AgBiTe2 |
| I | Iodine | |
| I | ⓘ Iodargyrite | AgI |
| I | ⓘ Miersite | (Ag,Cu)I |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| W | Tungsten | |
| W | ⓘ Hübnerite | MnWO4 |
| W | ⓘ Kiddcreekite | Cu6SnWS8 |
| W | ⓘ Scheelite | Ca(WO4) |
| W | ⓘ Stolzite | Pb(WO4) |
| W | ⓘ Tungstenite | WS2 |
| Au | Gold | |
| Au | ⓘ Bogdanovite | (Au,Te,Pb)3(Cu,Fe) |
| Au | ⓘ Calaverite | AuTe2 |
| Au | ⓘ Native Gold var. Electrum | (Au,Ag) |
| Au | ⓘ Native Gold | Au |
| Au | ⓘ Kostovite | CuAuTe4 |
| Au | ⓘ Krennerite | Au3AgTe8 |
| Au | ⓘ Petzite | Ag3AuTe2 |
| Au | ⓘ Sylvanite | AgAuTe4 |
| Hg | Mercury | |
| Hg | ⓘ Cinnabar | HgS |
| Hg | ⓘ Eugenite | Ag11Hg2 |
| Hg | ⓘ Velikite | Cu2HgSnS4 |
| Pb | Lead | |
| Pb | ⓘ Aikinite | PbCuBiS3 |
| Pb | ⓘ Altaite | PbTe |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| Pb | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| Pb | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| Pb | ⓘ Bindheimite | Pb2Sb2O6O |
| Pb | ⓘ Bogdanovite | (Au,Te,Pb)3(Cu,Fe) |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Cesàrolite | PbMn34+O6(OH)2 |
| Pb | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| Pb | ⓘ Cosalite | Pb2Bi2S5 |
| Pb | ⓘ Descloizite var. Copper-bearing Descloizite | Pb(Zn,Cu)VO4OH |
| Pb | ⓘ Cupropavonite | Cu0.9Ag0.5Pb0.6Bi2.5S5 |
| Pb | ⓘ Descloizite | PbZn(VO4)(OH) |
| Pb | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| Pb | ⓘ Furutobeite | (Cu,Ag)6PbS4 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| Pb | ⓘ Krupkaite | PbCuBi3S6 |
| Pb | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| Pb | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Pb | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Pb | ⓘ Minium | Pb3O4 |
| Pb | ⓘ Mottramite | PbCu(VO4)(OH) |
| Pb | ⓘ Murdochite | Cu12Pb2O15Cl2 |
| Pb | ⓘ Osarizawaite | Pb(Al2Cu2+)(SO4)2(OH)6 |
| Pb | ⓘ Plattnerite | PbO2 |
| Pb | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Pb | ⓘ Rucklidgeite | PbBi2Te4 |
| Pb | ⓘ Stolzite | Pb(WO4) |
| Pb | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| Pb | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| Pb | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| Pb | ⓘ Eddavidite | Cu12Pb2O15Br2 |
| Bi | Bismuth | |
| Bi | ⓘ Aikinite | PbCuBiS3 |
| Bi | ⓘ Bismite | Bi2O3 |
| Bi | ⓘ Native Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Bismutite | (BiO)2CO3 |
| Bi | ⓘ Cosalite | Pb2Bi2S5 |
| Bi | ⓘ Cupropavonite | Cu0.9Ag0.5Pb0.6Bi2.5S5 |
| Bi | ⓘ Emplectite | CuBiS2 |
| Bi | ⓘ Hodrušite | Cu8Bi12S22 |
| Bi | ⓘ Kettnerite | CaBiCO3OF |
| Bi | ⓘ Krupkaite | PbCuBi3S6 |
| Bi | ⓘ Matildite | AgBiS2 |
| Bi | ⓘ Rucklidgeite | PbBi2Te4 |
| Bi | ⓘ Tellurobismuthite | Bi2Te3 |
| Bi | ⓘ Tetradymite | Bi2Te2S |
| Bi | ⓘ Volynskite | AgBiTe2 |
| Bi | ⓘ Wittichenite | Cu3BiS3 |
| Bi | ⓘ Wittichenite var. Silver-bearing Wittichenite | (Cu,Ag)3BiS3 |
| U | Uranium | |
| U | ⓘ Bayleyite | Mg2(UO2)(CO3)3 · 18H2O |
| U | ⓘ Johannite | Cu(UO2)2(SO4)2(OH)2 · 8H2O |
| U | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| U | ⓘ Sengierite | Cu2(UO2)2(VO4)2 · 6H2O |
| U | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| U | ⓘ Tyuyamunite | Ca(UO2)2(VO4)2 · 5-8H2O |
| U | ⓘ Uraninite | UO2 |
| U | ⓘ Uranopilite | (UO2)6(SO4)O2(OH)6 · 14H2O |
| U | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
Localities in this Region
- Arizona
- Cochise County
- ⭔Bisbee
- Bay State Mine
- Bisbee SE No. 1 Limestone occurrence
- Black Jack Mine
- Bounty Mine
- Brewery Gulch
- Calumet and Arizona group of claims
- Campbell Mine
- Cochise Project
- Cochise property
- Cole Mine
- Copperopolis Mine
- Dallas Mine
- Danville-Hanchetta claims
- Denn Mine
- Dreadnaught Mine
- Escabrosa Ridge
- Garfield Mine
- Gold Hill
- Hendricks Gulch
- Higgins Mine
- Ivanhoe Mine
- John D. Jr. claim
- Juniper Flats
- ⭔Bisbee
- Cochise County
- Arizona
- Cochise County
- Bisbee
- Bisbee Blue Mine
- Calumet and Cochise Mine
- Captain prospect
- Caretto claim group
- Cochise Queen prospect
- Congdon Mine
- Copper King prospect (Copper King of Arizona prospect)
- Cuprite Mine
- Don Luis pit
- Glance Mine
- Granville & Unknown claims
- Illinois Mine
- Inspiration group
- Lucky Strike prospect
- Lucky Swede lode
- Modern prospect
- Tombstone Canyon
- Uncle Sam Gulch
- Unknown No. 2 claim
- Yakima Dolomite occurrence
- Cochise County
Other Regions, Features and Areas that Intersect
Mexico
- Sierra Madre OccidentalMountain Range
North AmericaContinent
- Sonoran DesertDesert
North America PlateTectonic Plate
- Basin and Range BasinsBasin
- Mazatzal DomainDomain
- Pedregosa BasinBasin
- Southern Basin and RangeWide Rift
USA
- Arizona
- Cochise County
- Warren Mining DistrictMining District
- Cochise County
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Lavender Pit, Bisbee, Cochise County, Arizona, USA