This page is currently not sponsored. Click here to sponsor this page.
Neighbouring regions:
Type:
Other/historical names associated with this locality:
Kweichow
Other Languages:
French:
Guizhou, Chine
German:
Guizhou, China
Italian:
Guizhou, Cina
Russian:
Гуйчжоу, Китай
Simplified Chinese:
贵州省, 中国
Spanish:
Guizhou, China
Achinese:
Guizhou, Cina
Afrikaans:
Guizhou, Volksrepubliek van Sjina
Arabic:
قويتشو, الصين
Armenian:
Գույչժոու, Չինաստան
Asturian:
Guizhou, China
Basque:
Guizhou, Txina
Belarusian:
Гуйчжоу, Кітай
Bengali:
কুইচৌ, গণচীন
Breton:
Guizhou, Sina
Bulgarian:
Гуейджоу, Китайска народна република
Catalan:
Guizhou, Xina
Cebuano:
Guizhou Sheng, Tsina
Chechen:
Гуйчжоу, Цийн-мохк
Classical Chinese:
貴州省, 中國
Croatian:
Guizhou, Kina
Czech:
Kuej-čou, Čína
Danish:
Guizhou, Kina
Dutch:
Guizhou, China
Esperanto:
Gŭiĝoŭo, Ĉinujo
Estonian:
Guizhou, Hiina
Farsi/Persian:
گوئیژو, جمهوری خلق چین
Finnish:
Guizhou, Kiina
Gan:
貴州, 中國
Georgian:
გუიჯოუ, ჩინეთი
Greek:
Κουεϊτσόου, Κίνα
Gujarati:
ગુઇઝોઉ, ચીન
Hakka:
Kui-chû, Chûng-fà
Hebrew:
גוויג'ואו, סין
Hindi:
गुइझोऊ, चीन
Hungarian:
Kujcsou, Kína
Indonesian:
Guizhou, Cina
Interlingua:
Guizhou, China
Irish Gaelic:
Guizhou, An tSín
Japanese:
貴州省, 中国
Kannada:
ಗುಯಿಝೌ, ಚೀನಿ
Kapampangan:
Guizhou, Tsina
Kongo:
Guizhou, Sina
Korean:
구이저우성, 중국
Latin:
Queichea, Sinae
Latvian:
Guidžou, Ķīna
Lithuanian:
Guidžou, Kinija
Macedonian:
Гуејџоу, Кина
Malagasy:
Guizhou, Sina
Malay:
Guizhou, China
Manx:
Guizhou, Sheen
Marathi:
क्वीचौ, चीन
Min Dong Chinese:
Gói-ciŭ, Dṳ̆ng-huà Ìng-mìng Gê̤ṳng-huò-guók
Mingrelian:
გუიჯოუ, ჩინეთი
Minnan / Hokkien-Taiwanese:
Kùi-chiu-séng, Tiong-hôa
Mongolian:
Гуйжоу муж, Хятад
Northern Frisian:
Guizhou, Sina
Norwegian:
Guizhou, Kina
Norwegian (Nynorsk):
Guizhou, Kina
Novial:
Guizhou, China
Occitan:
Guizhou, China
Ossetian:
Гуйчжоу, Китай
Polish:
Kuejczou, Chiny
Portuguese:
Guizhou, China
Quechua:
Guizhou pruwinsya, Chunkuk
Romanian:
Guizhou, China
Scots:
Guizhou, Cheenae
Serbian:
Гуејџоу, Кина
Serbo-Croatian:
Guizhou, Kina
Sinhalese:
ගුයිෂු, චීනය
Swahili:
Guizhou, China
Swedish:
Guizhou, Kina
Tagalog:
Guizhou, Tsina
Tamil:
குயிசூ, சீனா
Telugu:
గుయిజో, చైనా
Thai:
มณฑลกุ้ยโจว, ประเทศจีน
Tibetan (Standard):
ཀུད་ཀྲོའུ་ཞིང་ཆེན།, རྒྱ་ནག
Traditional Chinese:
貴州, 中國
Turkish:
Guizhou, Çin
Ukrainian:
Ґуйчжоу, Китай
Urdu:
گوئیژو, چین
Uyghur:
گۇيلىن ئۆلكىسى, جۇڭخۇا خەلق جۇمھۇرىيىتى
Uzbek (Latin Script):
Guychjou, Xitoy
Venetian:
Guizhou, Cina
Vietnamese:
Quý Châu, Trung Quốc
Walloon:
Gouizhou
Waray:
Guizhou, Tsina
Welsh:
Guizhou, Tsieina
Western Punjabi:
کوئیچو, چین
Wu Chinese:
贵州省, 中国
Yakut:
Гуйчжоу, Кытай
Zhuang:
Gveicouh, Cunghvaz
Guizhou /ɡweɪˈdʒoʊ/ (Chinese: 贵州; formerly Kweichow) is a landlocked province in the southwest region of the People's Republic of China. Its capital and largest city is Guiyang, in the center of the province. Guizhou borders the autonomous region of Guangxi to the south, Yunnan to the west, Sichuan to the northwest, the municipality of Chongqing to the north, and Hunan to the east.
Over 730 ultrabasic dikes intruded into Late Tonian to Late Cambrian strata in the southeastern Guizhou Province over an area of ∼2600 km².
Over 730 ultrabasic dikes intruded into Late Tonian to Late Cambrian strata in the southeastern Guizhou Province over an area of ∼2600 km².
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities244 valid minerals. 4 (TL) - type locality of valid minerals. 3 erroneous literature entries.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Acanthite Formula: Ag2S |
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ Aktashite Formula: Cu6Hg3As4S12 References: Gu, Xuexiang, Zhang, Yongmei, Fan, Guang, Li, Ting, Dong, Shuyi, Peng, Yiwei, Zhang, Yingshuai, Li, Ling, Ge, Zhanlin (2024) Zhengminghuaite, Cu6Fe3As4S12, a new sulfosalt mineral from the Zimudang Carlin-type gold deposit in southwestern Guizhou, China. American Mineralogist, 109 (7) 1220-1227 doi:10.2138/am-2023-9078 |
| ⓘ Alabandite Formula: MnS Localities: Reported from at least 7 localities in this region. |
| ⓘ Albite Formula: Na(AlSi3O8) Localities: Reported from at least 14 localities in this region. |
| ⓘ Allophane Formula: (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| ⓘ Alum-(K) Formula: KAl(SO4)2 · 12H2O |
| ⓘ 'Amphibole Supergroup' Formula: AB2C5(T8O22)W2 |
| ⓘ Anatase Formula: TiO2 Localities: Reported from at least 34 localities in this region. |
| ⓘ Anglesite Formula: PbSO4 Localities: Reported from at least 8 localities in this region. |
| ⓘ Anhydrite Formula: CaSO4 |
| ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 Localities: Reported from at least 12 localities in this region. |
| ⓘ Anorthite Formula: Ca(Al2Si2O8) Description: Labradorite plagioclase (An61-69) found associated with glass & Ca-pyroxene. {Enstatite chondrite plagioclase is usually albitic - Cf. Mason (1966) |
| ⓘ Anorthite var. Labradorite Formula: (Ca,Na)[Al(Al,Si)Si2O8] Description: Labradorite plagioclase (An61-69) found associated with glass & Ca-pyroxene. {Enstatite chondrite plagioclase is usually albitic - Cf. Mason (1966) |
| ⓘ Antimonselite (TL) Formula: Sb2Se3 Type Locality: Description: Occurs as black anhedral grains and as radiating acicular crystals, typically <20 μm and to a maximum of 21 x 23 μm. Metallic luster, black streak,…White in reflected light, distinct bireflectance, distinct pleochroism from whit to grayish white, distinct anisotropism. …The mineral occurs with pyrite, sphalerite, galena, ferroselite, clausthalite, uraninite and others in U-bearing calcite veins |
| ⓘ 'Apatite' Formula: Ca5(PO4)3A Localities: Reported from at least 36 localities in this region. |
| ⓘ 'Apatite var. Collophane' Formula: Ca5(PO4)3(Cl/F/OH) Localities: Reported from at least 6 localities in this region. |
| ⓘ Aragonite Formula: CaCO3 |
| ⓘ Aragonite var. Flos Ferri Formula: CaCO3 Locality: Liupanshui, Guizhou, China References: |
| ⓘ Argentojarosite Formula: AgFe3+3(SO4)2(OH)6 |
| ⓘ Arsenolite Formula: As2O3 |
| ⓘ Arsenopyrite Formula: FeAsS Localities: Reported from at least 43 localities in this region. |
| ⓘ Autunite Formula: Ca(UO2)2(PO4)2 · 10-12H2O |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 |
| ⓘ Baddeleyite Formula: ZrO2 |
| ⓘ Baryte Formula: BaSO4 Localities: Reported from at least 78 localities in this region. |
| ⓘ Baryte var. Strontium-bearing Baryte Formula: (Ba,Sr)SO4 |
| ⓘ 'Bastnäsite' Formula: (Ce/Nd/Y/REE)(CO3)F References: Bian, Xiao; Yang, Minfang; Lu, Jing; Yin, Lusheng; Shao, Longyi; Hilton, Jason; Bond, David P.G.; Dai, Shifeng (2025) Sedimentary environment controls on critical metals enrichment in late Permian coal measures in western Guizhou, China. Ore Geology Reviews, 186. 106824 doi:10.1016/j.oregeorev.2025.106824 |
| ⓘ Bastnäsite-(Ce) Formula: Ce(CO3)F |
| ⓘ Beaverite-(Cu) Formula: Pb(Fe3+2Cu)(SO4)2(OH)6 Description: Reported as a constituent of low-grade lead-zinc ore from an undisclosed mining area in Guizhou Province. |
| ⓘ Berthierite Formula: FeSb2S4 |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Bismite Formula: Bi2O3 |
| ⓘ Bismuthinite ? Formula: Bi2S3 |
| ⓘ Boltwoodite Formula: (K,Na)(UO2)(SiO3OH) · 1.5H2O References: |
| ⓘ Bornite Formula: Cu5FeS4 Localities: Reported from at least 7 localities in this region. Description: Microscopic |
| ⓘ Böhmite Formula: AlO(OH) Localities: Reported from at least 12 localities in this region. |
| ⓘ Brannerite Formula: UTi2O6 |
| ⓘ Brookite Formula: TiO2 |
| ⓘ 'Calamine' |
| ⓘ Calcite Formula: CaCO3 Localities: Reported from at least 129 localities in this region. |
| ⓘ Calcite var. Iceland Spar Formula: CaCO3 References: |
| ⓘ Calcite var. Iron-bearing Calcite Formula: (Ca,Fe)CO3 |
| ⓘ Calcite var. Manganese-bearing Calcite Formula: (Ca,Mn)CO3 Localities: Reported from at least 9 localities in this region. |
| ⓘ Carbonatecyanotrichite Formula: Cu4Al2(CO3,SO4)(OH)12 · 2H2O Locality: Qinglong Mine (Dachang Mine), Dachang Sb ore field, Qinglong County, Qianxinan, Guizhou, China References: |
| ⓘ Carlhintzeite Formula: Ca2[AlF6]F · H2O |
| ⓘ Carnotite Formula: K2(UO2)2(VO4)2 · 3H2O References: Jordi FabreIdentification: XRD, Raman Spectroscopy |
| ⓘ Cassiterite Formula: SnO2 |
| ⓘ Caswellsilverite Formula: NaCrS2 |
| ⓘ Celestine Formula: SrSO4 References: Shen, Hercule (n.d.) Hercule Shan Collection.photo-1161180 |
| ⓘ Cerianite-(Ce) Formula: Ce4+O2 |
| ⓘ Cerussite Formula: PbCO3 Localities: Reported from at least 18 localities in this region. |
| ⓘ Cervantite Formula: Sb3+Sb5+O4 |
| ⓘ 'Chabazite' |
| ⓘ Chalcocite Formula: Cu2S Localities: Reported from at least 8 localities in this region. |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 49 localities in this region. |
| ⓘ Chalcostibite Formula: CuSbS2 |
| ⓘ Chamosite Formula: Fe2+5Al(AlSi3O10)(OH)8 |
| ⓘ Chamosite var. Thuringite Formula: (Fe2+,Fe3+,Mg,Al)6(Si,Al)4O10(O,OH)8 |
| ⓘ 'Charcoal' Formula: C References: Bian, Xiao; Yang, Minfang; Lu, Jing; Yin, Lusheng; Shao, Longyi; Hilton, Jason; Bond, David P.G.; Dai, Shifeng (2025) Sedimentary environment controls on critical metals enrichment in late Permian coal measures in western Guizhou, China. Ore Geology Reviews, 186. 106824 doi:10.1016/j.oregeorev.2025.106824 |
| ⓘ Chlorargyrite Formula: AgCl Locality: Yinchangpo Ag-Pb-Zn deposit, Huize Zn-Pb-(Ag) ore field, Weining County, Bijie, Guizhou, China References: |
| ⓘ 'Chlorite Group' Localities: Reported from at least 53 localities in this region. |
| ⓘ Christite Formula: TlHgAsS3 |
| ⓘ Chromite Formula: Fe2+Cr3+2O4 |
| ⓘ Cinnabar Formula: HgS Localities: Reported from at least 38 localities in this region. Habit: Modified rhombs and penetration twins to several cm Colour: Blood red on Dolomite, Dark red on Quartz Fluorescence: none |
| ⓘ Clausthalite Formula: PbSe |
| ⓘ 'Clay minerals' Localities: Niujiaotang Cd-Zn deposit, Duyun County, Qiannan, Guizhou, China Kaiyang Mine, Kaiyang County, Guiyang, Guizhou, China Shuiyindong Au-Tl-Hg deposit (Yanshang Au-Tl-Hg deposit), Huijiabao gold field, Zhenfeng County, Qianxinan, Guizhou, China ZK10 borehole, Nayong County, Bijie, Guizhou, China Leji Mine, Zhenning County, Anshun, Guizhou, China |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ Clinochlore var. Ripidolite Formula: (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| ⓘ Clinoenstatite Formula: MgSiO3 |
| ⓘ 'Clinopyroxene Subgroup' |
| ⓘ Clinozoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ Coffinite Formula: U(SiO4) · nH2O |
| ⓘ Cookeite Formula: (LiAl4◻)[AlSi3O10](OH)8 |
| ⓘ Covellite Formula: CuS |
| ⓘ Creedite Formula: Ca3Al2(SO4)(OH)2F8 · 2H2O |
| ⓘ Cryptomelane Formula: K(Mn4+7Mn3+)O16 |
| ⓘ Cuprite Formula: Cu2O |
| ⓘ Cyanotrichite Formula: Cu4Al2(SO4)(OH)12 · 2H2O Locality: Qinglong Mine (Dachang Mine), Dachang Sb ore field, Qinglong County, Qianxinan, Guizhou, China References: |
| ⓘ 'Cyanotrichite Group' |
| ⓘ Daubréelite Formula: Fe2+Cr3+2S4 Description: Zincian Daubréelite |
| ⓘ Descloizite Formula: PbZn(VO4)(OH) Description: Contains up to 5.8 wt.-% of As2O3 |
| ⓘ Diamond Formula: C |
| ⓘ Diaspore Formula: AlO(OH) Localities: Reported from at least 22 localities in this region. |
| ⓘ Dickite Formula: Al2(Si2O5)(OH)4 Localities: Reported from at least 6 localities in this region. |
| ⓘ Diopside Formula: CaMgSi2O6 |
| ⓘ Djerfisherite Formula: K6(Fe,Cu,Ni)25S26Cl |
| ⓘ Dolomite Formula: CaMg(CO3)2 Localities: Reported from at least 106 localities in this region. |
| ⓘ Dolomite var. Iron-bearing Dolomite Formula: Ca(Mg,Fe)(CO3)2 Localities: Jinfeng Mine (Lannigou Mine), Zhenfeng County, Qianxinan, Guizhou, China Yata Au-As deposit, Ceheng County, Qianxinan, Guizhou, China Paiting Au deposit, Danzhai County, Qiandongnan, Guizhou, China Shuiyindong Au-Tl-Hg deposit (Yanshang Au-Tl-Hg deposit), Huijiabao gold field, Zhenfeng County, Qianxinan, Guizhou, China |
| ⓘ Dolomite var. Manganese-bearing Dolomite Formula: CaMg(CO3)2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Enstatite Formula: Mg2Si2O6 |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) Localities: Reported from at least 7 localities in this region. |
| ⓘ Evansite Formula: Al3(PO4)(OH)6 · 6H2O |
| ⓘ 'Fayalite-Forsterite Series' |
| ⓘ 'Feldspar Group' Localities: Reported from at least 8 localities in this region. |
| ⓘ Felsőbányaite Formula: Al4(SO4)(OH)10 · 4H2O |
| ⓘ Ferrihydrite Formula: Fe3+10O14(OH)2 |
| ⓘ Ferroselite Formula: FeSe2 |
| ⓘ Formula: Fe3+4V5+4O16 · 5H2O Locality: Qinglong Mine (Dachang Mine), Dachang Sb ore field, Qinglong County, Qianxinan, Guizhou, China - erroneously reported Description: Turned out to be mikehowardite after the structure was determined. References: Christian Rewitzer collectionIdentified by Christian Rewitzer: XRD, SEM-EDS |
| ⓘ Fibroferrite Formula: Fe3+(SO4)(OH) · 5H2O References: |
| ⓘ 'Florencite' |
| ⓘ Florencite-(Ce) Formula: CeAl3(PO4)2(OH)6 |
| ⓘ Florencite-(La) Formula: LaAl3(PO4)2(OH)6 |
| ⓘ Fluellite Formula: Al2(PO4)F2(OH) · 7H2O |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F Localities: Reported from at least 6 localities in this region. |
| ⓘ Fluorapatite var. Carbonate-rich Fluorapatite Formula: Ca5(PO4,CO3)3(F,O) |
| ⓘ Fluorite Formula: CaF2 Localities: Reported from at least 47 localities in this region. |
| ⓘ Formula: (Ca1-xYx)F2+x where 0.05 < x < 0.3 Locality: Qinglong Mine (Dachang Mine), Dachang Sb ore field, Qinglong County, Qianxinan, Guizhou, China - erroneously reported Description: According Guedes (2023), an analysis on the "yttrofluorite" from Qinglong showed it to be only fluorite. No traces of Yttrium were found. The XRD & EDS analysis were done by Dr. Cesar Menor-Salvàn, Alcala University, Madrid, Spain. |
| ⓘ Foitite Formula: ◻(Fe2+2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Forsterite Formula: Mg2(SiO4) Description: Forsterite is found in a small population of refractory chondrules |
| ⓘ 'Freibergite Subgroup' Formula: (Ag6,[Ag6]4+)(Cu4 C2+2)Sb4S12S0-1 |
| ⓘ Galena Formula: PbS Localities: Reported from at least 76 localities in this region. |
| ⓘ Galkhaite Formula: (Hg5Cu)CsAs4S12 |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 Localities: |
| ⓘ Gearksutite Formula: Ca[Al(F,OH)5(H2O)] |
| ⓘ Gersdorffite Formula: NiAsS |
| ⓘ Getchellite Formula: AsSbS3 |
| ⓘ Gibbsite Formula: Al(OH)3 Localities: Reported from at least 15 localities in this region. |
| ⓘ 'Glass' Localities: Description: Glass of nearly pure Sodalite composition occurs [very minor component] |
| ⓘ 'Glauconite' Formula: K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| ⓘ Goethite Formula: Fe3+O(OH) Localities: Reported from at least 20 localities in this region. |
| ⓘ Graphite Formula: C |
| ⓘ Gratonite Formula: Pb9As4S15 References: Liu, Yu; He, Liang-Lun; Yang, Kun-Guang; Ali, Polat; Zhou, Qi; Wu, Pan; Wu, Da-Wen; Wang, Jun; Cai, Jing-Chen (2022) Constraints of C-H-O-S-Pb isotopes and fluid inclusions on the origin of the giant Zhugongtang carbonate-hosted Pb–Zn deposit in South China. Ore Geology Reviews, 151. p.105192. doi:10.1016/j.oregeorev.2022.105192 |
| ⓘ Greenockite Formula: CdS References: |
| ⓘ Greenockite var. Zinc-bearing Greenockite Formula: (Cd,Zn)S |
| ⓘ Greigite Formula: Fe2+Fe3+2S4 Description: Due to a breakdown of Djerfisherite (The 'Qingzhen Reaction') |
| ⓘ Gypsum Formula: CaSO4 · 2H2O Localities: Reported from at least 18 localities in this region. |
| ⓘ Gypsum var. Selenite Formula: CaSO4 · 2H2O Locality: Liupanshui, Guizhou, China References: |
| ⓘ Halloysite Formula: Al2Si2O5(OH)4 · n(H2O) |
| ⓘ Halotrichite Formula: Fe2+Al2(SO4)4 · 22H2O References: |
| ⓘ Hausmannite Formula: Mn2+Mn3+2O4 |
| ⓘ Hawleyite Formula: CdS |
| ⓘ Heazlewoodite Formula: Ni3S2 |
| ⓘ Hematite Formula: Fe2O3 Localities: Reported from at least 32 localities in this region. |
| ⓘ Hemimorphite Formula: Zn4Si2O7(OH)2 · H2O Localities: Reported from at least 13 localities in this region. |
| ⓘ 'Heulandite Subgroup' Formula: (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| ⓘ Hewettite Formula: CaV6O16 · 9H2O |
| ⓘ Hopeite Formula: ZnZn2(PO4)2 · 4H2O |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ 'Hydrogoethite' Formula: 3Fe2O3 · 4H2O |
| ⓘ 'Hydromica' |
| ⓘ Hydroxylapatite Formula: Ca5(PO4)3(OH) |
| ⓘ Hydrozincite Formula: Zn5(CO3)2(OH)6 Localities: Reported from at least 15 localities in this region. |
| ⓘ Idaite Formula: Cu5FeS6 |
| ⓘ 'Illite-1M' Formula: K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ Ilmenite Formula: Fe2+TiO3 |
| ⓘ Imhofite Formula: Tl5.8As15.4S26 |
| ⓘ Jamesonite Formula: Pb4FeSb6S14 |
| ⓘ Jarosite Formula: KFe3+3(SO4)2(OH)6 Localities: Reported from at least 8 localities in this region. |
| ⓘ Jordisite Formula: MoS2 Localities: Baimadong Mine (Chienxinan Mine), Xingyi County, Qianxinan, Guizhou, China Songlin Mine, Zunyi Ni-Mo-PGE-Au ore field, Bozhou District, Zunyi, Guizhou, China Songtao Miao Autonomous County, Tongren, Guizhou, China Huangjiawan Mine, Zunyi Ni-Mo-PGE-Au ore field, Bozhou District, Zunyi, Guizhou, China ? (more information) |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 Localities: Reported from at least 56 localities in this region. |
| ⓘ Kermesite Formula: Sb2S2O |
| ⓘ 'K Feldspar' |
| ⓘ Kutnohorite Formula: CaMn2+(CO3)2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Lanmuchangite (TL) Formula: Tl+Al(SO4)2 · 12H2O Type Locality: |
| ⓘ Laumontite Formula: CaAl2Si4O12 · 4H2O |
| ⓘ Lepidocrocite Formula: Fe3+O(OH) |
| ⓘ 'Leucoxene' |
| ⓘ Libethenite Formula: Cu2(PO4)(OH) References: Shen, Hercule (n.d.) Hercule Shan Collection.Raman spectroscopy, photo-id -1195859 |
| ⓘ 'Limonite' Localities: Reported from at least 56 localities in this region. |
| ⓘ Lorándite Formula: TlAsS2 Localities: Description: main ore mineral in the thallium orebody and its crystals there can reach 4cm.
Dr. Philippe Roth, letter to Lapis(2007) |
| ⓘ Maghemite Formula: (Fe3+0.67◻0.33)Fe3+2O4 |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 Localities: Reported from at least 16 localities in this region. |
| ⓘ Magnetite var. Titanium-bearing Magnetite Formula: Fe2+(Fe3+,Ti)2O4 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 Localities: Reported from at least 9 localities in this region. |
| ⓘ 'Manganepidote' |
| ⓘ 'Manganese Oxides' |
| ⓘ Marcasite Formula: FeS2 Localities: Reported from at least 35 localities in this region. |
| ⓘ Melanterite Formula: Fe2+(H2O)6(SO4) · H2O References: |
| ⓘ 'Melnikovite' |
| ⓘ Metacinnabar Formula: HgS |
| ⓘ Metacinnabar var. Selenium-bearing Metacinnabar Formula: Hg(S,Se) |
| ⓘ Metatorbernite Formula: Cu(UO2)2(PO4)2 · 8H2O References: |
| ⓘ Metatyuyamunite Formula: Ca(UO2)2(VO4)2 · 3H2O References: |
| ⓘ Metazeunerite Formula: Cu(UO2)2(AsO4)2 · 8H2O |
| ⓘ 'Mica Group' |
| ⓘ 'Micrite' |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ Microcline var. Hyalophane Formula: (K,Ba)[Al(Si,Al)Si2O8] |
| ⓘ Mikehowardite Formula: Fe3+4(V5+O4)4(H2O)2 · H2O Locality: Qinglong Mine (Dachang Mine), Dachang Sb ore field, Qinglong County, Qianxinan, Guizhou, China References: Christian Rewitzer collectionIdentification: XRD, SEM-EDS |
| ⓘ Millerite Formula: NiS |
| ⓘ Moissanite Formula: SiC |
| ⓘ Moluranite Formula: H4U4+(UO2)3(MoO4)7 · 18H2O |
| ⓘ Molybdenite Formula: MoS2 |
| ⓘ Monazite-(Ce) Formula: Ce(PO4) |
| ⓘ 'Monazite Group' Formula: REE(PO4) Localities: Reported from at least 8 localities in this region. |
| ⓘ Monazite-(La) Formula: La(PO4) |
| ⓘ Monteponite Formula: CdO |
| ⓘ Montmorillonite Formula: (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O Localities: Reported from at least 7 localities in this region. |
| ⓘ Mopungite Formula: Na[Sb5+(OH)6] Locality: Qinglong Mine (Dachang Mine), Dachang Sb ore field, Qinglong County, Qianxinan, Guizhou, China Description: Finely intermixed with ottensite. |
| ⓘ Moschellandsbergite Formula: Ag2Hg3 |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 61 localities in this region. |
| ⓘ Muscovite var. Illite Formula: K0.65Al2.0[Al0.65Si3.35O10](OH)2 Localities: Reported from at least 45 localities in this region. |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 35 localities in this region. |
| ⓘ Native Aluminium Formula: Al References: |
| ⓘ Native Antimony Formula: Sb |
| ⓘ Native Arsenic Formula: As |
| ⓘ Native Copper Formula: Cu Localities: Reported from at least 6 localities in this region. |
| ⓘ Native Gold Formula: Au Localities: Reported from at least 38 localities in this region. |
| ⓘ Native Gold var. Electrum Formula: (Au,Ag) |
| ⓘ Native Iron Formula: Fe Localities: Description: Including (a minor component) some unusual Ni-Free iron droplets [Ni<1%, Cr-1-4%] |
| ⓘ Native Iron var. Kamacite Formula: (Fe,Ni) |
| ⓘ Native Lead ? Formula: Pb Description: Native lead was reported by Yin (2009). However, the author does not address the problem of a possible anthropogenic origin, which always persists with findings of reactive metals in their native form. |
| ⓘ Native Mercury Formula: Hg |
| ⓘ Native Silver Formula: Ag |
| ⓘ Native Silver var. Kongsbergite Formula: (Ag,Hg) Locality: Nayong County, Bijie, Guizhou, China |
| ⓘ Native Sulphur Formula: S8 |
| ⓘ Native Zinc Formula: Zn |
| ⓘ Navajoite Formula: Fe3+V5+9O24 · 12H2O |
| ⓘ Nickeline Formula: NiAs |
| ⓘ Nierite Formula: Si3N4 |
| ⓘ Niningerite Formula: MgS |
| ⓘ Nsutite Formula: (Mn4+,Mn2+)(O,OH)2 |
| ⓘ Oldhamite Formula: CaS |
| ⓘ 'Olivine Group' Formula: M2SiO4 |
| ⓘ Opal Formula: SiO2 · nH2O |
| ⓘ 'Organic material' References: |
| ⓘ Orpiment Formula: As2S3 Localities: Reported from at least 26 localities in this region. |
| ⓘ Orthoclase Formula: K(AlSi3O8) |
| ⓘ Otavite Formula: CdCO3 References: |
| ⓘ Ottensite (TL) Formula: (Na,K)3Sb3+6(Sb3+S3)O9 · 3H2O Localities: |
| ⓘ 'Ozocerite' |
| ⓘ Palygorskite Formula: ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| ⓘ Parkerite Formula: Ni3(Bi,Pb)2S2 |
| ⓘ Pentlandite Formula: (NixFey)Σ9S8 |
| ⓘ Perovskite Formula: CaTiO3 |
| ⓘ Perryite Formula: (Ni,Fe)5(Si,P)2 |
| ⓘ 'Petroleum' Localities: Reported from at least 13 localities in this region. |
| ⓘ 'Petroleum var. Bitumen' Localities: Reported from at least 23 localities in this region. |
| ⓘ Phlogopite Formula: KMg3(AlSi3O10)(OH)2 |
| ⓘ Pickeringite Formula: MgAl2(SO4)4 · 22H2O |
| ⓘ Picropharmacolite Formula: Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 Localities: Reported from at least 6 localities in this region. |
| ⓘ Plumbojarosite Formula: Pb0.5Fe3+3(SO4)2(OH)6 |
| ⓘ Polybasite Formula: [Ag6Sb2S7][Ag9CuS4] |
| ⓘ Polydymite Formula: Ni2+Ni3+2S4 |
| ⓘ Příbramite Formula: CuSbSe2 Description: Reported from an undisclosed U-Hg-Mo deposit in Guizhou Province. |
| ⓘ 'Psilomelane' |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 152 localities in this region. |
| ⓘ Pyrite var. Arsenic-bearing Pyrite Formula: Fe(S,As)2 Localities: Reported from at least 13 localities in this region. |
| ⓘ Pyrite var. Bravoite Formula: (Fe,Ni)S2 |
| ⓘ Pyrite var. Gold-bearing Pyrite Formula: FeS2 |
| ⓘ Pyrite var. Thallium- and Arsenic-bearing Pyrite Formula: (Fe,Tl)(S,As)2 |
| ⓘ 'Pyrobitumen' |
| ⓘ Pyrolusite Formula: Mn4+O2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl |
| ⓘ Pyrope Formula: Mg3Al2(SiO4)3 References: Zhang, Jiawei; Santosh, M.; Zhu, Yuhua; Rao, Hongjuan; Wang, Kun; Ye, Taiping; Li, Yonggang; Liu, Weipeng (2023) Constraining the timing of deep magmatic pulses from diamondiferous kimberlite and related rocks in the South China Continent and implications for diamond exploration. Ore Geology Reviews, 154. doi:10.1016/j.oregeorev.2023.105328 |
| ⓘ Pyrophyllite Formula: Al2Si4O10(OH)2 |
| ⓘ 'Pyroxene Group' Formula: ADSi2O6 Localities: Description: While Enstatite is the dominant Pyroxene, a mildly ferosilitic (Fs 10-15) is found in some (relatively) oxidized regions. |
| ⓘ Pyrrhotite Formula: Fe1-xS Localities: Reported from at least 7 localities in this region. |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 138 localities in this region. |
| ⓘ Quartz var. Chalcedony Formula: SiO2 Localities: Reported from at least 17 localities in this region. |
| ⓘ Quartz var. Microcrystalline quartz |
| ⓘ Quartz var. Milky Quartz Formula: SiO2 |
| ⓘ Quartz var. Prase Formula: SiO2 |
| ⓘ Quartz var. Rock Crystal Formula: SiO2 |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 |
| ⓘ Raguinite Formula: TlFeS2 |
| ⓘ Realgar Formula: As4S4 Localities: Reported from at least 31 localities in this region. |
| ⓘ Rectorite Formula: (Na,Ca)Al4((Si,Al)8O20)(OH)4 · 2H2O |
| ⓘ Formula: (Mn2+,Fe2+)3(PO4)2 · 3H2O Locality: Datangpo Mn deposit, Songtao Mn ore field, Songtao Miao Autonomous County, Tongren, Guizhou, China - erroneously reported Description: According to the English abstract of the paper, the main ore mineral in the deposit is reddingite. The Chinese text however lists "菱锰矿" as the main ore mineral, which translates to rhodochrosite, not reddingite. |
| ⓘ Rhodochrosite Formula: MnCO3 Localities: Reported from at least 14 localities in this region. |
| ⓘ Rhodochrosite var. Capillitite Formula: (Mn,Zn,Fe)CO3 |
| ⓘ Rhodonite Formula: CaMn3Mn[Si5O15] |
| ⓘ Richterite Formula: Na(CaNa)Mg5(Si8O22)(OH)2 References: Zhang, Jiawei; Santosh, M.; Zhu, Yuhua; Rao, Hongjuan; Wang, Kun; Ye, Taiping; Li, Yonggang; Liu, Weipeng (2023) Constraining the timing of deep magmatic pulses from diamondiferous kimberlite and related rocks in the South China Continent and implications for diamond exploration. Ore Geology Reviews, 154. doi:10.1016/j.oregeorev.2023.105328 |
| ⓘ Roedderite Formula: K(◻Na)Mg2Mg3[Si12O30] Description: In association with minor amounts of albite and silica References: |
| ⓘ 'Roméite Group' Formula: A2(Sb5+)2O6Z |
| ⓘ Rutile Formula: TiO2 Localities: Reported from at least 24 localities in this region. |
| ⓘ Sanidine Formula: K(AlSi3O8) References: |
| ⓘ Sasaite Formula: (Al,Fe3+)14(PO4)11(SO4)(OH)7 · 83H2O |
| ⓘ 'Saussurite' |
| ⓘ Scheelite Formula: Ca(WO4) |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Schreibersite Formula: (Fe,Ni)3P |
| ⓘ Schubnelite Formula: Fe3+VO4 · H2O Locality: Qinglong Mine (Dachang Mine), Dachang Sb ore field, Qinglong County, Qianxinan, Guizhou, China References: Christian Rewitzer collectionIdentified by Christian Rewitzer: XRD, SEM-EDS |
| ⓘ Scorodite Formula: Fe3+AsO4 · 2H2O |
| ⓘ Senarmontite Formula: Sb2O3 |
| ⓘ 'Serpentine Subgroup' Formula: D3[Si2O5](OH)4 |
| ⓘ Siderite Formula: FeCO3 Localities: Reported from at least 24 localities in this region. |
| ⓘ Siegenite Formula: CoNi2S4 |
| ⓘ 'Silica' References: |
| ⓘ Sklodowskite Formula: Mg(UO2)2(SiO3OH)2 · 6H2O References: Shen, Hercule (n.d.) Hercule Shan Collection.Raman spectroscopy, photo-id 1167627 |
| ⓘ 'Smectite Group' Formula: A0.3D2-3[T4O10]Z2 · nH2O |
| ⓘ Smithsonite Formula: ZnCO3 Localities: Reported from at least 21 localities in this region. |
| ⓘ Smythite Formula: (Fe,Ni)3+xS4 (x=0-0.3) Description: Due to a breakdown of Djerfisherite (The 'Qingzhen Reaction') |
| ⓘ Sphalerite Formula: ZnS Localities: Reported from at least 96 localities in this region. |
| ⓘ Sphalerite var. Cadmium-bearing Sphalerite Formula: (Zn,Cd)S |
| ⓘ Sphalerite var. Gallium-bearing Sphalerite Formula: (Zn,Ga)S References: |
| ⓘ Sphalerite var. Marmatite Formula: (Zn,Fe)S References: |
| ⓘ Spinel Formula: MgAl2O4 |
| ⓘ Stibiconite Formula: Sb3+Sb5+2O6(OH) |
| ⓘ Stibnite Formula: Sb2S3 Localities: Reported from at least 46 localities in this region. Habit: crystals to 22 cm Colour: grey black Fluorescence: none |
| ⓘ Stibnite var. Selenium-bearing Stibnite Formula: Sb2(S,Se)3 |
| ⓘ Sulvanite Formula: Cu3VS4 |
| ⓘ Svanbergite Formula: SrAl3(PO4)(SO4)(OH)6 |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 |
| ⓘ Tennantite-(Fe) Formula: Cu6(Cu4Fe2+2)As4S12S References: Jean-Francois Carpentier CollectionIdentified by Jean-Francois Carpentier: XRD, SEM-EDS |
| ⓘ Tennantite-(Hg) Formula: Cu6(Cu4Hg2)As4S12S References: |
| ⓘ 'Tennantite Subgroup' Formula: Cu6(Cu4C2+2)As4S12S |
| ⓘ Tennantite-(Zn) Formula: Cu6(Cu4Zn2)As4S12S References: |
| ⓘ Tenorite Formula: CuO |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S Localities: Reported from at least 8 localities in this region. |
| ⓘ 'Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite' Formula: (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| ⓘ Tetrahedrite-(Zn) Formula: Cu6(Cu4Zn2)Sb4S12S |
| ⓘ Thortveitite Formula: Sc2Si2O7 |
| ⓘ Tiemannite Formula: HgSe Localities: Wanshan Mercury Ore Field, Wanshan District, Tongren, Guizhou, China U deposit No. 504, Baimacun, Kaiyang County, Guiyang, Guizhou, China Wanshan mine, Wanshan Mercury Ore Field, Wanshan District, Tongren, Guizhou, China Huangjiawan Mine, Zunyi Ni-Mo-PGE-Au ore field, Bozhou District, Zunyi, Guizhou, China |
| ⓘ Titanite Formula: CaTiO(SiO4) |
| ⓘ Tobelite Formula: (NH4)Al2(AlSi3O10)(OH)2 |
| ⓘ Topaz Formula: Al2(SiO4)(F,OH)2 |
| ⓘ Torbernite Formula: Cu(UO2)2(PO4)2 · 12H2O |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z Localities: Reported from at least 19 localities in this region. |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ Tridymite Formula: SiO2 Description: Some, at least, of the silica is identified as tridymite |
| ⓘ Troilite Formula: FeS Description: Besides its normal settings, Troilite is also found in Troilite-Daubréelite clasts |
| ⓘ Tyuyamunite Formula: Ca(UO2)2(VO4)2 · 5-8H2O |
| ⓘ Ullmannite Formula: NiSbS |
| ⓘ 'UM1986-42-S:CuFe' Formula: Cu2Fe3S5 References: |
| ⓘ 'UM1995-37-Se:CuHgSb' Formula: (Cu,Hg)1-0.7Sb0-0.3(Se,S) |
| ⓘ 'UM1997-43-S:Fe' Formula: FeS3 |
| ⓘ 'UM2001-03-C:MoS' Formula: (Mo,Fe,Ni)3(S,As)6C10 |
| ⓘ 'UM2002-16-S:CrFeHO' Formula: ~FeCr2S4 (?) or Fe-Cr-S-O |
| ⓘ 'UM2002-17-S:CrHO' Formula: ~CrS2 · (O,H2O) |
| ⓘ 'UM2002-18-S:CrHO' Formula: ~CrS2 · 2(O,H2O) |
| ⓘ 'UM2002-22-S:CuFeNa' ? Formula: Na4.5(Fe,Cu)25S26 |
| ⓘ 'UM2002-25-S:FeGaMnZn' ? Formula: (Fe,Zn,Mn,Ga)S |
| ⓘ 'Unnamed (Cu-analogue of Fraipontite)' Formula: Cu, Al, Si, O, H Locality: Qinglong Mine (Dachang Mine), Dachang Sb ore field, Qinglong County, Qianxinan, Guizhou, China References: |
| ⓘ 'Unnamed (Cu Selenide)' Formula: (Cu,Hg)1-xSbx(Se,S) Description: Reported from an undisclosed U-Hg-Mo deposit in Guizhou Province. |
| ⓘ 'Unnamed (Tl Arsenide-Sulphide)' Formula: Tl2AsS3 |
| ⓘ 'Unnamed (Tl-Cu Arsenide-Sulphide)' Formula: Tl6CuAs16S40 |
| ⓘ 'Unnamed (Tl-Sn Arsenide-Sulphide)' Formula: TlSnAsS3 |
| ⓘ Uraninite Formula: UO2 Localities: Reported from at least 8 localities in this region. |
| ⓘ Uraninite var. Pitchblende Formula: UO2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Vaesite Formula: NiS2 |
| ⓘ Valentinite Formula: Sb2O3 Localities: |
| ⓘ Valleriite Formula: (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| ⓘ Vanadinite Formula: Pb5(VO4)3Cl |
| ⓘ Variscite Formula: AlPO4 · 2H2O |
| ⓘ Vernadite Formula: (Mn4+,Fe3+,Ca,Na)(O,OH)2 · nH2O |
| ⓘ Violarite Formula: Fe2+Ni3+2S4 |
| ⓘ Wakabayashilite Formula: [(As,Sb)6S9][As4S5] |
| ⓘ 'White mica' |
| ⓘ Willemite Formula: Zn2SiO4 |
| ⓘ Witherite Formula: BaCO3 |
| ⓘ 'Wolframite Group' |
| ⓘ Wulfenite Formula: Pb(MoO4) |
| ⓘ Wurtzite Formula: (Zn,Fe)S |
| ⓘ 'Xenotime' |
| ⓘ 'Zeolite Group' Localities: Xinhua P-REE deposit, Zhijin County, Bijie, Guizhou, China Tongchanghe Cu deposit, Basalt Cu occurrences, Weining County, Bijie, Guizhou, China Facaichong Cu deposit, Basalt Cu occurrences, Weining County, Bijie, Guizhou, China Zhangsigou Cu deposit, Basalt Cu occurrences, Weining County, Bijie, Guizhou, China Heishanpo Cu deposit, Basalt Cu occurrences, Weining County, Bijie, Guizhou, China |
| ⓘ Zeunerite Formula: Cu(UO2)2(AsO4)2 · 12H2O References: |
| ⓘ Zhengminghuaite (TL) Formula: Cu6Fe3As4S12 Type Locality: References: Miyawaki, Ritsuro, Hatert, Frédéric, Pasero, Marco, Mills, Stuart J. (2022) IMA Commission on New Minerals, Nomenclature and Classification (CNMNC) – Newsletter 69. European Journal of Mineralogy, 34 (5) 463-468 doi:10.5194/ejm-34-463-2022 Gu, Xuexiang, Zhang, Yongmei, Fan, Guang, Li, Ting, Dong, Shuyi, Peng, Yiwei, Zhang, Yingshuai, Li, Ling, Ge, Zhanlin (2024) Zhengminghuaite, Cu6Fe3As4S12, a new sulfosalt mineral from the Zimudang Carlin-type gold deposit in southwestern Guizhou, China. American Mineralogist, 109 (7) 1220-1227 doi:10.2138/am-2023-9078 |
| ⓘ Zincite Formula: ZnO |
| ⓘ Zircon Formula: Zr(SiO4) Localities: Reported from at least 27 localities in this region. |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Aluminium | 1.AA.05 | Al |
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Native Gold var. Electrum | 1.AA.05 | (Au,Ag) |
| ⓘ | 1.AA.05 | Au | |
| ⓘ | Native Silver var. Kongsbergite | 1.AA.05 | (Ag,Hg) |
| ⓘ | Native Lead ? | 1.AA.05 | Pb |
| ⓘ | Native Silver | 1.AA.05 | Ag |
| ⓘ | Native Zinc | 1.AB.05 | Zn |
| ⓘ | Native Mercury | 1.AD.05 | Hg |
| ⓘ | Moschellandsbergite | 1.AD.15d | Ag2Hg3 |
| ⓘ | Native Iron | 1.AE.05 | Fe |
| ⓘ | var. Kamacite | 1.AE.05 | (Fe,Ni) |
| ⓘ | Perryite | 1.BB.10 | (Ni,Fe)5(Si,P)2 |
| ⓘ | Schreibersite | 1.BD.05 | (Fe,Ni)3P |
| ⓘ | Native Antimony | 1.CA.05 | Sb |
| ⓘ | Native Arsenic | 1.CA.05 | As |
| ⓘ | Graphite | 1.CB.05a | C |
| ⓘ | Diamond | 1.CB.10a | C |
| ⓘ | Native Sulphur | 1.CC.05 | S8 |
| ⓘ | Moissanite | 1.DA. | SiC |
| ⓘ | Nierite | 1.DB.05 | Si3N4 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Heazlewoodite | 2.BB.05 | Ni3S2 |
| ⓘ | Pentlandite | 2.BB.15 | (NixFey)Σ9S8 |
| ⓘ | Parkerite | 2.BE.20 | Ni3(Bi,Pb)2S2 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Hawleyite | 2.CB.05a | CdS |
| ⓘ | Metacinnabar | 2.CB.05a | HgS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Tiemannite | 2.CB.05a | HgSe |
| ⓘ | Sphalerite var. Marmatite | 2.CB.05a | (Zn,Fe)S |
| ⓘ | Metacinnabar var. Selenium-bearing Metacinnabar | 2.CB.05a | Hg(S,Se) |
| ⓘ | Sphalerite var. Cadmium-bearing Sphalerite | 2.CB.05a | (Zn,Cd)S |
| ⓘ | var. Gallium-bearing Sphalerite | 2.CB.05a | (Zn,Ga)S |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Idaite | 2.CB.15a | Cu5FeS6 |
| ⓘ | Greenockite | 2.CB.45 | CdS |
| ⓘ | Wurtzite | 2.CB.45 | (Zn,Fe)S |
| ⓘ | Greenockite var. Zinc-bearing Greenockite | 2.CB.45 | (Cd,Zn)S |
| ⓘ | Raguinite | 2.CB.60 | TlFeS2 |
| ⓘ | Sulvanite | 2.CB.70 | Cu3VS4 |
| ⓘ | Nickeline | 2.CC.05 | NiAs |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Smythite | 2.CC.10 | (Fe,Ni)3+xS4 (x=0-0.3) |
| ⓘ | Troilite | 2.CC.10 | FeS |
| ⓘ | Millerite | 2.CC.20 | NiS |
| ⓘ | Alabandite | 2.CD.10 | MnS |
| ⓘ | Clausthalite | 2.CD.10 | PbSe |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Niningerite | 2.CD.10 | MgS |
| ⓘ | Oldhamite | 2.CD.10 | CaS |
| ⓘ | Cinnabar | 2.CD.15a | HgS |
| ⓘ | Daubréelite | 2.DA.05 | Fe2+Cr3+2S4 |
| ⓘ | Greigite | 2.DA.05 | Fe2+Fe3+2S4 |
| ⓘ | Polydymite | 2.DA.05 | Ni2+Ni3+2S4 |
| ⓘ | Siegenite | 2.DA.05 | CoNi2S4 |
| ⓘ | Violarite | 2.DA.05 | Fe2+Ni3+2S4 |
| ⓘ | Antimonselite (TL) | 2.DB.05 | Sb2Se3 |
| ⓘ | Bismuthinite ? | 2.DB.05 | Bi2S3 |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | var. Selenium-bearing Stibnite | 2.DB.05 | Sb2(S,Se)3 |
| ⓘ | Jordisite | 2.EA.30 | MoS2 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite var. Gold-bearing Pyrite | 2.EB.05a | FeS2 |
| ⓘ | var. Bravoite | 2.EB.05a | (Fe,Ni)S2 |
| ⓘ | 2.EB.05a | FeS2 | |
| ⓘ | Vaesite | 2.EB.05a | NiS2 |
| ⓘ | Pyrite var. Arsenic-bearing Pyrite | 2.EB.05a | Fe(S,As)2 |
| ⓘ | var. Thallium- and Arsenic-bearing Pyrite | 2.EB.05a | (Fe,Tl)(S,As)2 |
| ⓘ | Ferroselite | 2.EB.10a | FeSe2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Gersdorffite | 2.EB.25 | NiAsS |
| ⓘ | Ullmannite | 2.EB.25 | NiSbS |
| ⓘ | Realgar | 2.FA.15a | As4S4 |
| ⓘ | Orpiment | 2.FA.30 | As2S3 |
| ⓘ | Getchellite | 2.FA.35 | AsSbS3 |
| ⓘ | Wakabayashilite | 2.FA.40 | [(As,Sb)6S9][As4S5] |
| ⓘ | Caswellsilverite | 2.FB.05 | NaCrS2 |
| ⓘ | Djerfisherite | 2.FC.05 | K6(Fe,Cu,Ni)25S26Cl |
| ⓘ | Kermesite | 2.FD.05 | Sb2S2O |
| ⓘ | Valleriite | 2.FD.30 | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| ⓘ | Aktashite | 2.GA.30 | Cu6Hg3As4S12 |
| ⓘ | Zhengminghuaite (TL) | 2.GA.30 | Cu6Fe3As4S12 |
| ⓘ | Tennantite-(Hg) | 2.GB. | Cu6(Cu4Hg2)As4S12S |
| ⓘ | 'Freibergite Subgroup' | 2.GB.05 | (Ag6,[Ag6]4+)(Cu4 C2+2)Sb4S12S0-1 |
| ⓘ | 'Tennantite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)As4S12S |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | 'var. Silver-bearing Tetrahedrite' | 2.GB.05 | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| ⓘ | Tennantite-(Zn) | 2.GB.05 | Cu6(Cu4Zn2)As4S12S |
| ⓘ | Tetrahedrite-(Zn) | 2.GB.05 | Cu6(Cu4Zn2)Sb4S12S |
| ⓘ | Tennantite-(Fe) | 2.GB.05 | Cu6(Cu4Fe2+2)As4S12S |
| ⓘ | Polybasite | 2.GB.15 | [Ag6Sb2S7][Ag9CuS4] |
| ⓘ | Galkhaite | 2.GB.20 | (Hg5Cu)CsAs4S12 |
| ⓘ | Chalcostibite | 2.HA.05 | CuSbS2 |
| ⓘ | Příbramite | 2.HA.05 | CuSbSe2 |
| ⓘ | Berthierite | 2.HA.20 | FeSb2S4 |
| ⓘ | Jamesonite | 2.HB.15 | Pb4FeSb6S14 |
| ⓘ | Lorándite | 2.HD.05 | TlAsS2 |
| ⓘ | Christite | 2.HD.15 | TlHgAsS3 |
| ⓘ | Imhofite | 2.HD.30 | Tl5.8As15.4S26 |
| ⓘ | Gratonite | 2.JB.55 | Pb9As4S15 |
| ⓘ | Ottensite (TL) | 2.MA.05 | (Na,K)3Sb3+6(Sb3+S3)O9 · 3H2O |
| Group 3 - Halides | |||
| ⓘ | Chlorargyrite | 3.AA.15 | AgCl |
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| ⓘ | var. Yttrofluorite ? | 3.AB.25 | (Ca1-xYx)F2+x where 0.05 < x < 0.3 |
| ⓘ | Carlhintzeite | 3.CB.45 | Ca2[AlF6]F · H2O |
| ⓘ | Gearksutite | 3.CC.05 | Ca[Al(F,OH)5(H2O)] |
| ⓘ | Creedite | 3.CG.15 | Ca3Al2(SO4)(OH)2F8 · 2H2O |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Cuprite | 4.AA.10 | Cu2O |
| ⓘ | Tenorite | 4.AB.10 | CuO |
| ⓘ | Zincite | 4.AB.20 | ZnO |
| ⓘ | Monteponite | 4.AB.25 | CdO |
| ⓘ | Chromite | 4.BB.05 | Fe2+Cr3+2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
| ⓘ | Magnetite var. Titanium-bearing Magnetite | 4.BB.05 | Fe2+(Fe3+,Ti)2O4 |
| ⓘ | Hausmannite | 4.BB.10 | Mn2+Mn3+2O4 |
| ⓘ | Maghemite | 4.BB.15 | (Fe3+0.67◻0.33)Fe3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Arsenolite | 4.CB.50 | As2O3 |
| ⓘ | Senarmontite | 4.CB.50 | Sb2O3 |
| ⓘ | Valentinite | 4.CB.55 | Sb2O3 |
| ⓘ | Bismite | 4.CB.60 | Bi2O3 |
| ⓘ | Perovskite | 4.CC.30 | CaTiO3 |
| ⓘ | Quartz var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Rock Crystal | 4.DA.05 | SiO2 |
| ⓘ | var. Milky Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Prase | 4.DA.05 | SiO2 |
| ⓘ | var. Microcrystalline quartz | 4.DA.05 | SiO2 |
| ⓘ | Opal | 4.DA.10 | SiO2 · nH2O |
| ⓘ | Tridymite | 4.DA.10 | SiO2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Nsutite | 4.DB.15c | (Mn4+,Mn2+)(O,OH)2 |
| ⓘ | 'Wolframite Group' | 4.DB.30 va | |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Brookite | 4.DD.10 | TiO2 |
| ⓘ | Cervantite | 4.DE.30 | Sb3+Sb5+O4 |
| ⓘ | Baddeleyite | 4.DE.35 | ZrO2 |
| ⓘ | 'Roméite Group' | 4.DH. | A2(Sb5+)2O6Z |
| ⓘ | Brannerite | 4.DH.05 | UTi2O6 |
| ⓘ | Stibiconite | 4.DH.20 | Sb3+Sb5+2O6(OH) |
| ⓘ | Cryptomelane | 4.DK.05a | K(Mn4+7Mn3+)O16 |
| ⓘ | Cerianite-(Ce) | 4.DL.05 | Ce4+O2 |
| ⓘ | Uraninite var. Pitchblende | 4.DL.05 | UO2 |
| ⓘ | 4.DL.05 | UO2 | |
| ⓘ | Mopungite | 4.FC.15 | Na[Sb5+(OH)6] |
| ⓘ | Diaspore | 4.FD.10 | AlO(OH) |
| ⓘ | Goethite | 4.FD.10 | Fe3+O(OH) |
| ⓘ | Gibbsite | 4.FE.10 | Al(OH)3 |
| ⓘ | Böhmite | 4.FE.15 | AlO(OH) |
| ⓘ | Lepidocrocite | 4.FE.15 | Fe3+O(OH) |
| ⓘ | Ferrihydrite | 4.FE.35 | Fe3+10O14(OH)2 |
| ⓘ | Vernadite | 4.FE.40 | (Mn4+,Fe3+,Ca,Na)(O,OH)2 · nH2O |
| ⓘ | Carnotite | 4.HB.05 | K2(UO2)2(VO4)2 · 3H2O |
| ⓘ | Metatyuyamunite | 4.HB.25 | Ca(UO2)2(VO4)2 · 3H2O |
| ⓘ | Tyuyamunite | 4.HB.25 | Ca(UO2)2(VO4)2 · 5-8H2O |
| ⓘ | Hewettite | 4.HE.15 | CaV6O16 · 9H2O |
| ⓘ | Fervanite ? | 4.HG.05 | Fe3+4V5+4O16 · 5H2O |
| ⓘ | Navajoite | 4.HG.30 | Fe3+V5+9O24 · 12H2O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | var. Manganese-bearing Calcite | 5.AB.05 | (Ca,Mn)CO3 |
| ⓘ | Otavite | 5.AB.05 | CdCO3 |
| ⓘ | Rhodochrosite | 5.AB.05 | MnCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Smithsonite | 5.AB.05 | ZnCO3 |
| ⓘ | Calcite var. Iceland Spar | 5.AB.05 | CaCO3 |
| ⓘ | var. Iron-bearing Calcite | 5.AB.05 | (Ca,Fe)CO3 |
| ⓘ | Rhodochrosite var. Capillitite | 5.AB.05 | (Mn,Zn,Fe)CO3 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Kutnohorite | 5.AB.10 | CaMn2+(CO3)2 |
| ⓘ | Dolomite var. Iron-bearing Dolomite | 5.AB.10 | Ca(Mg,Fe)(CO3)2 |
| ⓘ | var. Manganese-bearing Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Witherite | 5.AB.15 | BaCO3 |
| ⓘ | Aragonite var. Flos Ferri | 5.AB.15 | CaCO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Hydrozincite | 5.BA.15 | Zn5(CO3)2(OH)6 |
| ⓘ | Bastnäsite-(Ce) | 5.BD.20a | Ce(CO3)F |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anhydrite | 7.AD.30 | CaSO4 |
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Celestine | 7.AD.35 | SrSO4 |
| ⓘ | Baryte var. Strontium-bearing Baryte | 7.AD.35 | (Ba,Sr)SO4 |
| ⓘ | Argentojarosite | 7.BC.10 | AgFe3+3(SO4)2(OH)6 |
| ⓘ | Beaverite-(Cu) | 7.BC.10 | Pb(Fe3+2Cu)(SO4)2(OH)6 |
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Plumbojarosite | 7.BC.10 | Pb0.5Fe3+3(SO4)2(OH)6 |
| ⓘ | Melanterite | 7.CB.35 | Fe2+(H2O)6(SO4) · H2O |
| ⓘ | Halotrichite | 7.CB.85 | Fe2+Al2(SO4)4 · 22H2O |
| ⓘ | Pickeringite | 7.CB.85 | MgAl2(SO4)4 · 22H2O |
| ⓘ | Alum-(K) | 7.CC.20 | KAl(SO4)2 · 12H2O |
| ⓘ | Lanmuchangite (TL) | 7.CC.20 | Tl+Al(SO4)2 · 12H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | var. Selenite | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Fibroferrite | 7.DC.15 | Fe3+(SO4)(OH) · 5H2O |
| ⓘ | Felsőbányaite | 7.DD.05 | Al4(SO4)(OH)10 · 4H2O |
| ⓘ | Carbonatecyanotrichite | 7.DE.10 | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| ⓘ | Cyanotrichite | 7.DE.10 | Cu4Al2(SO4)(OH)12 · 2H2O |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| ⓘ | Moluranite | 7.HA.15 | H4U4+(UO2)3(MoO4)7 · 18H2O |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| ⓘ | Monazite-(La) | 8.AD.50 | La(PO4) |
| ⓘ | Libethenite | 8.BB.30 | Cu2(PO4)(OH) |
| ⓘ | Descloizite | 8.BH.40 | PbZn(VO4)(OH) |
| ⓘ | Svanbergite | 8.BL.05 | SrAl3(PO4)(SO4)(OH)6 |
| ⓘ | Florencite-(Ce) | 8.BL.13 | CeAl3(PO4)2(OH)6 |
| ⓘ | Florencite-(La) | 8.BL.13 | LaAl3(PO4)2(OH)6 |
| ⓘ | Fluorapatite var. Carbonate-rich Fluorapatite | 8.BN.05 | Ca5(PO4,CO3)3(F,O) |
| ⓘ | 8.BN.05 | Ca5(PO4)3F | |
| ⓘ | Hydroxylapatite | 8.BN.05 | Ca5(PO4)3(OH) |
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Vanadinite | 8.BN.05 | Pb5(VO4)3Cl |
| ⓘ | Mikehowardite | 8.C0. | Fe3+4(V5+O4)4(H2O)2 · H2O |
| ⓘ | Hopeite | 8.CA.30 | ZnZn2(PO4)2 · 4H2O |
| ⓘ | Schubnelite | 8.CB.35 | Fe3+VO4 · H2O |
| ⓘ | Reddingite ? | 8.CC.05 | (Mn2+,Fe2+)3(PO4)2 · 3H2O |
| ⓘ | Scorodite | 8.CD.10 | Fe3+AsO4 · 2H2O |
| ⓘ | Variscite | 8.CD.10 | AlPO4 · 2H2O |
| ⓘ | Picropharmacolite | 8.CH.15 | Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| ⓘ | Sasaite | 8.DB.55 | (Al,Fe3+)14(PO4)11(SO4)(OH)7 · 83H2O |
| ⓘ | Fluellite | 8.DE.10 | Al2(PO4)F2(OH) · 7H2O |
| ⓘ | Evansite | 8.DF.10 | Al3(PO4)(OH)6 · 6H2O |
| ⓘ | Autunite | 8.EB.05 | Ca(UO2)2(PO4)2 · 10-12H2O |
| ⓘ | Torbernite | 8.EB.05 | Cu(UO2)2(PO4)2 · 12H2O |
| ⓘ | Zeunerite | 8.EB.05 | Cu(UO2)2(AsO4)2 · 12H2O |
| ⓘ | Metatorbernite | 8.EB.10 | Cu(UO2)2(PO4)2 · 8H2O |
| ⓘ | Metazeunerite | 8.EB.10 | Cu(UO2)2(AsO4)2 · 8H2O |
| Group 9 - Silicates | |||
| ⓘ | Willemite | 9.AA.05 | Zn2SiO4 |
| ⓘ | Forsterite | 9.AC.05 | Mg2(SiO4) |
| ⓘ | Pyrope | 9.AD.25 | Mg3Al2(SiO4)3 |
| ⓘ | Coffinite | 9.AD.30 | U(SiO4) · nH2O |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | Sklodowskite | 9.AK.10 | Mg(UO2)2(SiO3OH)2 · 6H2O |
| ⓘ | Boltwoodite | 9.AK.15 | (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| ⓘ | Thortveitite | 9.BC.05 | Sc2Si2O7 |
| ⓘ | Hemimorphite | 9.BD.10 | Zn4Si2O7(OH)2 · H2O |
| ⓘ | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Foitite | 9.CK.05 | ◻(Fe2+2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Roedderite | 9.CM.05 | K(◻Na)Mg2Mg3[Si12O30] |
| ⓘ | Enstatite | 9.DA.05 | Mg2Si2O6 |
| ⓘ | Clinoenstatite | 9.DA.10 | MgSiO3 |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Richterite | 9.DE.20 | Na(CaNa)Mg5(Si8O22)(OH)2 |
| ⓘ | Rhodonite | 9.DK.05 | CaMn3Mn[Si5O15] |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Pyrophyllite | 9.EC.10 | Al2Si4O10(OH)2 |
| ⓘ | Muscovite var. Illite | 9.EC.15 | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | Tobelite | 9.EC.15 | (NH4)Al2(AlSi3O10)(OH)2 |
| ⓘ | Muscovite var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Montmorillonite | 9.EC.40 | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ | Chamosite | 9.EC.55 | Fe2+5Al(AlSi3O10)(OH)8 |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Cookeite | 9.EC.55 | (LiAl4◻)[AlSi3O10](OH)8 |
| ⓘ | Clinochlore var. Ripidolite | 9.EC.55 | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| ⓘ | Chamosite var. Thuringite | 9.EC.55 | (Fe2+,Fe3+,Mg,Al)6(Si,Al)4O10(O,OH)8 |
| ⓘ | Rectorite | 9.EC.60 | (Na,Ca)Al4((Si,Al)8O20)(OH)4 · 2H2O |
| ⓘ | Dickite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Halloysite | 9.ED.10 | Al2Si2O5(OH)4 · n(H2O) |
| ⓘ | Allophane | 9.ED.20 | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| ⓘ | Palygorskite | 9.EE.20 | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| ⓘ | Microcline var. Hyalophane | 9.FA.30 | (K,Ba)[Al(Si,Al)Si2O8] |
| ⓘ | 9.FA.30 | K(AlSi3O8) | |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Sanidine | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Anorthite | 9.FA.35 | Ca(Al2Si2O8) |
| ⓘ | var. Labradorite | 9.FA.35 | (Ca,Na)[Al(Al,Si)Si2O8] |
| ⓘ | 'Zeolite Group' | 9.G0. | |
| ⓘ | Laumontite | 9.GB.10 | CaAl2Si4O12 · 4H2O |
| Unclassified | |||
| ⓘ | 'Amphibole Supergroup' | - | AB2C5(T8O22)W2 |
| ⓘ | 'Bastnäsite' | - | (Ce/Nd/Y/REE)(CO3)F |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chabazite' | - | |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Clay minerals' | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Glauconite' | - | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| ⓘ | 'Heulandite Subgroup' | - | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Monazite Group' | - | REE(PO4) |
| ⓘ | 'Psilomelane' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Melnikovite' | - | |
| ⓘ | 'Manganepidote' | - | |
| ⓘ | 'Leucoxene' | - | |
| ⓘ | 'Xenotime' | - | |
| ⓘ | 'Mica Group' | - | |
| ⓘ | 'Ozocerite' | - | |
| ⓘ | 'Clinopyroxene Subgroup' | - | |
| ⓘ | 'Calamine' | - | |
| ⓘ | 'Fayalite-Forsterite Series' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'Petroleum var. Bitumen' | - | |
| ⓘ | '' | - | |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
| ⓘ | 'Apatite var. Collophane' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'Florencite' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Silica' | - | |
| ⓘ | 'Smectite Group' | - | A0.3D2-3[T4O10]Z2 · nH2O |
| ⓘ | 'Serpentine Subgroup' | - | D3[Si2O5](OH)4 |
| ⓘ | 'Glass' | - | |
| ⓘ | 'Manganese Oxides' | - | |
| ⓘ | 'Saussurite' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
| ⓘ | 'Olivine Group' | - | M2SiO4 |
| ⓘ | 'Hydrogoethite' | - | 3Fe2O3 · 4H2O |
| ⓘ | 'Illite-1M' | - | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ | 'Pyrobitumen' | - | |
| ⓘ | 'Unnamed (Cu-analogue of Fraipontite)' | - | Cu, Al, Si, O, H |
| ⓘ | 'Cyanotrichite Group' | - | |
| ⓘ | 'Charcoal' | - | C |
| ⓘ | 'Unnamed (Cu Selenide)' | - | (Cu,Hg)1-xSbx(Se,S) |
| ⓘ | 'UM2001-03-C:MoS' | - | (Mo,Fe,Ni)3(S,As)6C10 |
| ⓘ | 'White mica' | - | |
| ⓘ | 'Organic material' | - | |
| ⓘ | 'UM1986-42-S:CuFe' | - | Cu2Fe3S5 |
| ⓘ | 'Micrite' | - | |
| ⓘ | 'UM1995-37-Se:CuHgSb' | - | (Cu,Hg)1-0.7Sb0-0.3(Se,S) |
| ⓘ | 'UM1997-43-S:Fe' | - | FeS3 |
| ⓘ | 'UM2002-16-S:CrFeHO' | - | ~FeCr2S4 (?) or Fe-Cr-S-O |
| ⓘ | 'UM2002-17-S:CrHO' | - | ~CrS2 · (O,H2O) |
| ⓘ | 'UM2002-18-S:CrHO' | - | ~CrS2 · 2(O,H2O) |
| ⓘ | 'UM2002-22-S:CuFeNa' ? | - | Na4.5(Fe,Cu)25S26 |
| ⓘ | 'UM2002-25-S:FeGaMnZn' ? | - | (Fe,Zn,Mn,Ga)S |
| ⓘ | 'Hydromica' | - | |
| ⓘ | 'Unnamed (Tl-Cu Arsenide-Sulphide)' | - | Tl6CuAs16S40 |
| ⓘ | 'Unnamed (Tl-Sn Arsenide-Sulphide)' | - | TlSnAsS3 |
| ⓘ | 'Unnamed (Tl Arsenide-Sulphide)' | - | Tl2AsS3 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| H | ⓘ Argentojarosite | AgFe33+(SO4)2(OH)6 |
| H | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Böhmite | AlO(OH) |
| H | ⓘ Boltwoodite | (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| H | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| H | ⓘ Carlhintzeite | Ca2[AlF6]F · H2O |
| H | ⓘ Carnotite | K2(UO2)2(VO4)2 · 3H2O |
| H | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Coffinite | U(SiO4) · nH2O |
| H | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| H | ⓘ Creedite | Ca3Al2(SO4)(OH)2F8 · 2H2O |
| H | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| H | ⓘ Descloizite | PbZn(VO4)(OH) |
| H | ⓘ Diaspore | AlO(OH) |
| H | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Evansite | Al3(PO4)(OH)6 · 6H2O |
| H | ⓘ Felsőbányaite | Al4(SO4)(OH)10 · 4H2O |
| H | ⓘ Ferrihydrite | Fe103+O14(OH)2 |
| H | ⓘ Fervanite | Fe43+V45+O16 · 5H2O |
| H | ⓘ Fibroferrite | Fe3+(SO4)(OH) · 5H2O |
| H | ⓘ Florencite-(Ce) | CeAl3(PO4)2(OH)6 |
| H | ⓘ Florencite-(La) | LaAl3(PO4)2(OH)6 |
| H | ⓘ Fluellite | Al2(PO4)F2(OH) · 7H2O |
| H | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Gearksutite | Ca[Al(F,OH)5(H2O)] |
| H | ⓘ Gibbsite | Al(OH)3 |
| H | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Halloysite | Al2Si2O5(OH)4 · n(H2O) |
| H | ⓘ Halotrichite | Fe2+Al2(SO4)4 · 22H2O |
| H | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| H | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| H | ⓘ Hewettite | CaV6O16 · 9H2O |
| H | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| H | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| H | ⓘ Hopeite | ZnZn2(PO4)2 · 4H2O |
| H | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| H | ⓘ Lepidocrocite | Fe3+O(OH) |
| H | ⓘ Libethenite | Cu2(PO4)(OH) |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| H | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| H | ⓘ Metatyuyamunite | Ca(UO2)2(VO4)2 · 3H2O |
| H | ⓘ Metazeunerite | Cu(UO2)2(AsO4)2 · 8H2O |
| H | ⓘ Moluranite | H4U4+(UO2)3(MoO4)7 · 18H2O |
| H | ⓘ Mopungite | Na[Sb5+(OH)6] |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| H | ⓘ Navajoite | Fe3+V95+O24 · 12H2O |
| H | ⓘ Nsutite | (Mn4+,Mn2+)(O,OH)2 |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Pickeringite | MgAl2(SO4)4 · 22H2O |
| H | ⓘ Picropharmacolite | Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| H | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| H | ⓘ Alum-(K) | KAl(SO4)2 · 12H2O |
| H | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| H | ⓘ Rectorite | (Na,Ca)Al4((Si,Al)8O20)(OH)4 · 2H2O |
| H | ⓘ Reddingite | (Mn2+,Fe2+)3(PO4)2 · 3H2O |
| H | ⓘ Richterite | Na(CaNa)Mg5(Si8O22)(OH)2 |
| H | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| H | ⓘ Sasaite | (Al,Fe3+)14(PO4)11(SO4)(OH)7 · 83H2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Schubnelite | Fe3+VO4 · H2O |
| H | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| H | ⓘ Sklodowskite | Mg(UO2)2(SiO3OH)2 · 6H2O |
| H | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| H | ⓘ Svanbergite | SrAl3(PO4)(SO4)(OH)6 |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Chamosite var. Thuringite | (Fe2+,Fe3+,Mg,Al)6(Si,Al)4O10(O,OH)8 |
| H | ⓘ Tobelite | (NH4)Al2(AlSi3O10)(OH)2 |
| H | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| H | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Tyuyamunite | Ca(UO2)2(VO4)2 · 5-8H2O |
| H | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| H | ⓘ Variscite | AlPO4 · 2H2O |
| H | ⓘ Vernadite | (Mn4+,Fe3+,Ca,Na)(O,OH)2 · nH2O |
| H | ⓘ Zeunerite | Cu(UO2)2(AsO4)2 · 12H2O |
| H | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Apatite var. Collophane | Ca5(PO4)3(Cl/F/OH) |
| H | ⓘ Lanmuchangite | Tl+Al(SO4)2 · 12H2O |
| H | ⓘ Smectite Group | A0.3D2-3[T4O10]Z2 · nH2O |
| H | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| H | ⓘ Ottensite | (Na,K)3Sb63+(Sb3+S3)O9 · 3H2O |
| H | ⓘ Hydrogoethite | 3Fe2O3 · 4H2O |
| H | ⓘ Illite-1M | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| H | ⓘ Unnamed (Cu-analogue of Fraipontite) | Cu, Al, Si, O, H |
| H | ⓘ UM2002-17-S:CrHO | ~CrS2 · (O,H2O) |
| H | ⓘ UM2002-18-S:CrHO | ~CrS2 · 2(O,H2O) |
| H | ⓘ Mikehowardite | Fe43+(V5+O4)4(H2O)2 · H2O |
| Li | Lithium | |
| Li | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| B | Boron | |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| C | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| C | ⓘ Fluorapatite var. Carbonate-rich Fluorapatite | Ca5(PO4,CO3)3(F,O) |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Diamond | C |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Graphite | C |
| C | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| C | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| C | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Moissanite | SiC |
| C | ⓘ Otavite | CdCO3 |
| C | ⓘ Rhodochrosite | MnCO3 |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Smithsonite | ZnCO3 |
| C | ⓘ Witherite | BaCO3 |
| C | ⓘ Calcite var. Iceland Spar | CaCO3 |
| C | ⓘ Aragonite var. Flos Ferri | CaCO3 |
| C | ⓘ Calcite var. Iron-bearing Calcite | (Ca,Fe)CO3 |
| C | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| C | ⓘ Rhodochrosite var. Capillitite | (Mn,Zn,Fe)CO3 |
| C | ⓘ Dolomite var. Manganese-bearing Dolomite | CaMg(CO3)2 |
| C | ⓘ Charcoal | C |
| C | ⓘ UM2001-03-C:MoS | (Mo,Fe,Ni)3(S,As)6C10 |
| N | Nitrogen | |
| N | ⓘ Tobelite | (NH4)Al2(AlSi3O10)(OH)2 |
| N | ⓘ Nierite | Si3N4 |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| O | ⓘ Amphibole Supergroup | AB2C5(T8O22)W2 |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Anhydrite | CaSO4 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Anorthite | Ca(Al2Si2O8) |
| O | ⓘ Argentojarosite | AgFe33+(SO4)2(OH)6 |
| O | ⓘ Arsenolite | As2O3 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Baddeleyite | ZrO2 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| O | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| O | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Bismite | Bi2O3 |
| O | ⓘ Böhmite | AlO(OH) |
| O | ⓘ Boltwoodite | (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| O | ⓘ Brannerite | UTi2O6 |
| O | ⓘ Brookite | TiO2 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| O | ⓘ Fluorapatite var. Carbonate-rich Fluorapatite | Ca5(PO4,CO3)3(F,O) |
| O | ⓘ Carlhintzeite | Ca2[AlF6]F · H2O |
| O | ⓘ Carnotite | K2(UO2)2(VO4)2 · 3H2O |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Celestine | SrSO4 |
| O | ⓘ Cerianite-(Ce) | Ce4+O2 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Cervantite | Sb3+Sb5+O4 |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| O | ⓘ Chromite | Fe2+Cr23+O4 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Clinoenstatite | MgSiO3 |
| O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Coffinite | U(SiO4) · nH2O |
| O | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| O | ⓘ Creedite | Ca3Al2(SO4)(OH)2F8 · 2H2O |
| O | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| O | ⓘ Descloizite | PbZn(VO4)(OH) |
| O | ⓘ Diaspore | AlO(OH) |
| O | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Enstatite | Mg2Si2O6 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Evansite | Al3(PO4)(OH)6 · 6H2O |
| O | ⓘ Felsőbányaite | Al4(SO4)(OH)10 · 4H2O |
| O | ⓘ Ferrihydrite | Fe103+O14(OH)2 |
| O | ⓘ Fervanite | Fe43+V45+O16 · 5H2O |
| O | ⓘ Fibroferrite | Fe3+(SO4)(OH) · 5H2O |
| O | ⓘ Florencite-(Ce) | CeAl3(PO4)2(OH)6 |
| O | ⓘ Florencite-(La) | LaAl3(PO4)2(OH)6 |
| O | ⓘ Fluellite | Al2(PO4)F2(OH) · 7H2O |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Forsterite | Mg2(SiO4) |
| O | ⓘ Gearksutite | Ca[Al(F,OH)5(H2O)] |
| O | ⓘ Gibbsite | Al(OH)3 |
| O | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Halloysite | Al2Si2O5(OH)4 · n(H2O) |
| O | ⓘ Halotrichite | Fe2+Al2(SO4)4 · 22H2O |
| O | ⓘ Hausmannite | Mn2+Mn23+O4 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| O | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| O | ⓘ Hewettite | CaV6O16 · 9H2O |
| O | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| O | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| O | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| O | ⓘ Hopeite | ZnZn2(PO4)2 · 4H2O |
| O | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Kermesite | Sb2S2O |
| O | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| O | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| O | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| O | ⓘ Lepidocrocite | Fe3+O(OH) |
| O | ⓘ Libethenite | Cu2(PO4)(OH) |
| O | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| O | ⓘ Maghemite | (Fe3+0.67◻0.33)Fe23+O4 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| O | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| O | ⓘ Metatyuyamunite | Ca(UO2)2(VO4)2 · 3H2O |
| O | ⓘ Metazeunerite | Cu(UO2)2(AsO4)2 · 8H2O |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Moluranite | H4U4+(UO2)3(MoO4)7 · 18H2O |
| O | ⓘ Monazite Group | REE(PO4) |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Monazite-(La) | La(PO4) |
| O | ⓘ Monteponite | CdO |
| O | ⓘ Mopungite | Na[Sb5+(OH)6] |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| O | ⓘ Navajoite | Fe3+V95+O24 · 12H2O |
| O | ⓘ Nsutite | (Mn4+,Mn2+)(O,OH)2 |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Otavite | CdCO3 |
| O | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| O | ⓘ Perovskite | CaTiO3 |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Pickeringite | MgAl2(SO4)4 · 22H2O |
| O | ⓘ Picropharmacolite | Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| O | ⓘ Uraninite var. Pitchblende | UO2 |
| O | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| O | ⓘ Alum-(K) | KAl(SO4)2 · 12H2O |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| O | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rectorite | (Na,Ca)Al4((Si,Al)8O20)(OH)4 · 2H2O |
| O | ⓘ Reddingite | (Mn2+,Fe2+)3(PO4)2 · 3H2O |
| O | ⓘ Rhodochrosite | MnCO3 |
| O | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| O | ⓘ Richterite | Na(CaNa)Mg5(Si8O22)(OH)2 |
| O | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| O | ⓘ Roedderite | K(◻Na)Mg2Mg3[Si12O30] |
| O | ⓘ Roméite Group | A2(Sb5+)2O6Z |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Sanidine | K(AlSi3O8) |
| O | ⓘ Sasaite | (Al,Fe3+)14(PO4)11(SO4)(OH)7 · 83H2O |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Schubnelite | Fe3+VO4 · H2O |
| O | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| O | ⓘ Senarmontite | Sb2O3 |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Sklodowskite | Mg(UO2)2(SiO3OH)2 · 6H2O |
| O | ⓘ Smithsonite | ZnCO3 |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Spinel | MgAl2O4 |
| O | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| O | ⓘ Svanbergite | SrAl3(PO4)(SO4)(OH)6 |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Tenorite | CuO |
| O | ⓘ Thortveitite | Sc2Si2O7 |
| O | ⓘ Chamosite var. Thuringite | (Fe2+,Fe3+,Mg,Al)6(Si,Al)4O10(O,OH)8 |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Magnetite var. Titanium-bearing Magnetite | Fe2+(Fe3+,Ti)2O4 |
| O | ⓘ Tobelite | (NH4)Al2(AlSi3O10)(OH)2 |
| O | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| O | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Tridymite | SiO2 |
| O | ⓘ Tyuyamunite | Ca(UO2)2(VO4)2 · 5-8H2O |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Valentinite | Sb2O3 |
| O | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| O | ⓘ Vanadinite | Pb5(VO4)3Cl |
| O | ⓘ Variscite | AlPO4 · 2H2O |
| O | ⓘ Vernadite | (Mn4+,Fe3+,Ca,Na)(O,OH)2 · nH2O |
| O | ⓘ Willemite | Zn2SiO4 |
| O | ⓘ Witherite | BaCO3 |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Zeunerite | Cu(UO2)2(AsO4)2 · 12H2O |
| O | ⓘ Zincite | ZnO |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Calcite var. Iceland Spar | CaCO3 |
| O | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| O | ⓘ Quartz var. Rock Crystal | SiO2 |
| O | ⓘ Quartz var. Milky Quartz | SiO2 |
| O | ⓘ Quartz var. Prase | SiO2 |
| O | ⓘ Aragonite var. Flos Ferri | CaCO3 |
| O | ⓘ Fayalite-Forsterite Series | |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Pyroxene Group | ADSi2O6 |
| O | ⓘ Apatite var. Collophane | Ca5(PO4)3(Cl/F/OH) |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Calcite var. Iron-bearing Calcite | (Ca,Fe)CO3 |
| O | ⓘ Lanmuchangite | Tl+Al(SO4)2 · 12H2O |
| O | ⓘ Smectite Group | A0.3D2-3[T4O10]Z2 · nH2O |
| O | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| O | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| O | ⓘ Rhodochrosite var. Capillitite | (Mn,Zn,Fe)CO3 |
| O | ⓘ Apatite | Ca5(PO4)3A |
| O | ⓘ Ottensite | (Na,K)3Sb63+(Sb3+S3)O9 · 3H2O |
| O | ⓘ Olivine Group | M2SiO4 |
| O | ⓘ Hydrogoethite | 3Fe2O3 · 4H2O |
| O | ⓘ Dolomite var. Manganese-bearing Dolomite | CaMg(CO3)2 |
| O | ⓘ Illite-1M | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| O | ⓘ Unnamed (Cu-analogue of Fraipontite) | Cu, Al, Si, O, H |
| O | ⓘ Baryte var. Strontium-bearing Baryte | (Ba,Sr)SO4 |
| O | ⓘ UM2002-16-S:CrFeHO | ~FeCr2S4 (?) or Fe-Cr-S-O |
| O | ⓘ UM2002-17-S:CrHO | ~CrS2 · (O,H2O) |
| O | ⓘ UM2002-18-S:CrHO | ~CrS2 · 2(O,H2O) |
| O | ⓘ Mikehowardite | Fe43+(V5+O4)4(H2O)2 · H2O |
| F | Fluorine | |
| F | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| F | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite var. Carbonate-rich Fluorapatite | Ca5(PO4,CO3)3(F,O) |
| F | ⓘ Carlhintzeite | Ca2[AlF6]F · H2O |
| F | ⓘ Creedite | Ca3Al2(SO4)(OH)2F8 · 2H2O |
| F | ⓘ Fluellite | Al2(PO4)F2(OH) · 7H2O |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Gearksutite | Ca[Al(F,OH)5(H2O)] |
| F | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| F | ⓘ Fluorite var. Yttrofluorite | (Ca1-xYx)F2+x where 0.05 < x < 0.3 |
| F | ⓘ Apatite var. Collophane | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Boltwoodite | (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| Na | ⓘ Caswellsilverite | NaCrS2 |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Na | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Na | ⓘ Mopungite | Na[Sb5+(OH)6] |
| Na | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Na | ⓘ Rectorite | (Na,Ca)Al4((Si,Al)8O20)(OH)4 · 2H2O |
| Na | ⓘ Richterite | Na(CaNa)Mg5(Si8O22)(OH)2 |
| Na | ⓘ Roedderite | K(◻Na)Mg2Mg3[Si12O30] |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Vernadite | (Mn4+,Fe3+,Ca,Na)(O,OH)2 · nH2O |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Na | ⓘ Ottensite | (Na,K)3Sb63+(Sb3+S3)O9 · 3H2O |
| Na | ⓘ UM2002-22-S:CuFeNa | Na4.5(Fe,Cu)25S26 |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Clinoenstatite | MgSiO3 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Enstatite | Mg2Si2O6 |
| Mg | ⓘ Forsterite | Mg2(SiO4) |
| Mg | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| Mg | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Mg | ⓘ Niningerite | MgS |
| Mg | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Pickeringite | MgAl2(SO4)4 · 22H2O |
| Mg | ⓘ Picropharmacolite | Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| Mg | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| Mg | ⓘ Richterite | Na(CaNa)Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| Mg | ⓘ Roedderite | K(◻Na)Mg2Mg3[Si12O30] |
| Mg | ⓘ Sklodowskite | Mg(UO2)2(SiO3OH)2 · 6H2O |
| Mg | ⓘ Spinel | MgAl2O4 |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Chamosite var. Thuringite | (Fe2+,Fe3+,Mg,Al)6(Si,Al)4O10(O,OH)8 |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| Mg | ⓘ Fayalite-Forsterite Series | |
| Mg | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Mg | ⓘ Dolomite var. Manganese-bearing Dolomite | CaMg(CO3)2 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Native Aluminium | Al |
| Al | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Al | ⓘ Anorthite | Ca(Al2Si2O8) |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Böhmite | AlO(OH) |
| Al | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| Al | ⓘ Carlhintzeite | Ca2[AlF6]F · H2O |
| Al | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| Al | ⓘ Creedite | Ca3Al2(SO4)(OH)2F8 · 2H2O |
| Al | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| Al | ⓘ Diaspore | AlO(OH) |
| Al | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Evansite | Al3(PO4)(OH)6 · 6H2O |
| Al | ⓘ Felsőbányaite | Al4(SO4)(OH)10 · 4H2O |
| Al | ⓘ Florencite-(Ce) | CeAl3(PO4)2(OH)6 |
| Al | ⓘ Florencite-(La) | LaAl3(PO4)2(OH)6 |
| Al | ⓘ Fluellite | Al2(PO4)F2(OH) · 7H2O |
| Al | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Gearksutite | Ca[Al(F,OH)5(H2O)] |
| Al | ⓘ Gibbsite | Al(OH)3 |
| Al | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| Al | ⓘ Halloysite | Al2Si2O5(OH)4 · n(H2O) |
| Al | ⓘ Halotrichite | Fe2+Al2(SO4)4 · 22H2O |
| Al | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Al | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| Al | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Al | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Pickeringite | MgAl2(SO4)4 · 22H2O |
| Al | ⓘ Alum-(K) | KAl(SO4)2 · 12H2O |
| Al | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| Al | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| Al | ⓘ Rectorite | (Na,Ca)Al4((Si,Al)8O20)(OH)4 · 2H2O |
| Al | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| Al | ⓘ Sanidine | K(AlSi3O8) |
| Al | ⓘ Sasaite | (Al,Fe3+)14(PO4)11(SO4)(OH)7 · 83H2O |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Spinel | MgAl2O4 |
| Al | ⓘ Svanbergite | SrAl3(PO4)(SO4)(OH)6 |
| Al | ⓘ Chamosite var. Thuringite | (Fe2+,Fe3+,Mg,Al)6(Si,Al)4O10(O,OH)8 |
| Al | ⓘ Tobelite | (NH4)Al2(AlSi3O10)(OH)2 |
| Al | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Al | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| Al | ⓘ Variscite | AlPO4 · 2H2O |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Al | ⓘ Lanmuchangite | Tl+Al(SO4)2 · 12H2O |
| Al | ⓘ Illite-1M | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Al | ⓘ Unnamed (Cu-analogue of Fraipontite) | Cu, Al, Si, O, H |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Si | ⓘ Anorthite | Ca(Al2Si2O8) |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Boltwoodite | (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Clinoenstatite | MgSiO3 |
| Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Coffinite | U(SiO4) · nH2O |
| Si | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| Si | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Enstatite | Mg2Si2O6 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Forsterite | Mg2(SiO4) |
| Si | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| Si | ⓘ Halloysite | Al2Si2O5(OH)4 · n(H2O) |
| Si | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Si | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Si | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| Si | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Si | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Moissanite | SiC |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| Si | ⓘ Perryite | (Ni,Fe)5(Si,P)2 |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| Si | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Rectorite | (Na,Ca)Al4((Si,Al)8O20)(OH)4 · 2H2O |
| Si | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Si | ⓘ Richterite | Na(CaNa)Mg5(Si8O22)(OH)2 |
| Si | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| Si | ⓘ Roedderite | K(◻Na)Mg2Mg3[Si12O30] |
| Si | ⓘ Sanidine | K(AlSi3O8) |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Sklodowskite | Mg(UO2)2(SiO3OH)2 · 6H2O |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Thortveitite | Sc2Si2O7 |
| Si | ⓘ Chamosite var. Thuringite | (Fe2+,Fe3+,Mg,Al)6(Si,Al)4O10(O,OH)8 |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| Si | ⓘ Tobelite | (NH4)Al2(AlSi3O10)(OH)2 |
| Si | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Tridymite | SiO2 |
| Si | ⓘ Willemite | Zn2SiO4 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Quartz var. Rock Crystal | SiO2 |
| Si | ⓘ Quartz var. Milky Quartz | SiO2 |
| Si | ⓘ Quartz var. Prase | SiO2 |
| Si | ⓘ Nierite | Si3N4 |
| Si | ⓘ Fayalite-Forsterite Series | |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Pyroxene Group | ADSi2O6 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| Si | ⓘ Olivine Group | M2SiO4 |
| Si | ⓘ Illite-1M | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Si | ⓘ Unnamed (Cu-analogue of Fraipontite) | Cu, Al, Si, O, H |
| P | Phosphorus | |
| P | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| P | ⓘ Fluorapatite var. Carbonate-rich Fluorapatite | Ca5(PO4,CO3)3(F,O) |
| P | ⓘ Evansite | Al3(PO4)(OH)6 · 6H2O |
| P | ⓘ Florencite-(Ce) | CeAl3(PO4)2(OH)6 |
| P | ⓘ Florencite-(La) | LaAl3(PO4)2(OH)6 |
| P | ⓘ Fluellite | Al2(PO4)F2(OH) · 7H2O |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| P | ⓘ Hopeite | ZnZn2(PO4)2 · 4H2O |
| P | ⓘ Libethenite | Cu2(PO4)(OH) |
| P | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| P | ⓘ Monazite Group | REE(PO4) |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| P | ⓘ Monazite-(La) | La(PO4) |
| P | ⓘ Perryite | (Ni,Fe)5(Si,P)2 |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Reddingite | (Mn2+,Fe2+)3(PO4)2 · 3H2O |
| P | ⓘ Sasaite | (Al,Fe3+)14(PO4)11(SO4)(OH)7 · 83H2O |
| P | ⓘ Schreibersite | (Fe,Ni)3P |
| P | ⓘ Svanbergite | SrAl3(PO4)(SO4)(OH)6 |
| P | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| P | ⓘ Variscite | AlPO4 · 2H2O |
| P | ⓘ Apatite var. Collophane | Ca5(PO4)3(Cl/F/OH) |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Aktashite | Cu6Hg3As4S12 |
| S | ⓘ Alabandite | MnS |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Anhydrite | CaSO4 |
| S | ⓘ Argentojarosite | AgFe33+(SO4)2(OH)6 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Pyrite var. Gold-bearing Pyrite | FeS2 |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| S | ⓘ Berthierite | FeSb2S4 |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Pyrite var. Bravoite | (Fe,Ni)S2 |
| S | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| S | ⓘ Caswellsilverite | NaCrS2 |
| S | ⓘ Celestine | SrSO4 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Chalcostibite | CuSbS2 |
| S | ⓘ Christite | TlHgAsS3 |
| S | ⓘ Cinnabar | HgS |
| S | ⓘ Covellite | CuS |
| S | ⓘ Creedite | Ca3Al2(SO4)(OH)2F8 · 2H2O |
| S | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| S | ⓘ Daubréelite | Fe2+Cr23+S4 |
| S | ⓘ Djerfisherite | K6(Fe,Cu,Ni)25S26Cl |
| S | ⓘ Felsőbányaite | Al4(SO4)(OH)10 · 4H2O |
| S | ⓘ Fibroferrite | Fe3+(SO4)(OH) · 5H2O |
| S | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| S | ⓘ Galena | PbS |
| S | ⓘ Galkhaite | (Hg5Cu)CsAs4S12 |
| S | ⓘ Gersdorffite | NiAsS |
| S | ⓘ Getchellite | AsSbS3 |
| S | ⓘ Gratonite | Pb9As4S15 |
| S | ⓘ Greenockite | CdS |
| S | ⓘ Greigite | Fe2+Fe23+S4 |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Halotrichite | Fe2+Al2(SO4)4 · 22H2O |
| S | ⓘ Hawleyite | CdS |
| S | ⓘ Heazlewoodite | Ni3S2 |
| S | ⓘ Idaite | Cu5FeS6 |
| S | ⓘ Imhofite | Tl5.8As15.4S26 |
| S | ⓘ Jamesonite | Pb4FeSb6S14 |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Jordisite | MoS2 |
| S | ⓘ Kermesite | Sb2S2O |
| S | ⓘ Lorándite | TlAsS2 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| S | ⓘ Metacinnabar | HgS |
| S | ⓘ Millerite | NiS |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Niningerite | MgS |
| S | ⓘ Oldhamite | CaS |
| S | ⓘ Orpiment | As2S3 |
| S | ⓘ Parkerite | Ni3(Bi,Pb)2S2 |
| S | ⓘ Pentlandite | (NixFey)Σ9S8 |
| S | ⓘ Pickeringite | MgAl2(SO4)4 · 22H2O |
| S | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| S | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| S | ⓘ Polydymite | Ni2+Ni23+S4 |
| S | ⓘ Alum-(K) | KAl(SO4)2 · 12H2O |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Raguinite | TlFeS2 |
| S | ⓘ Realgar | As4S4 |
| S | ⓘ Sasaite | (Al,Fe3+)14(PO4)11(SO4)(OH)7 · 83H2O |
| S | ⓘ Siegenite | CoNi2S4 |
| S | ⓘ Smythite | (Fe,Ni)3+xS4 (x=0-0.3) |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Native Sulphur | S8 |
| S | ⓘ Sulvanite | Cu3VS4 |
| S | ⓘ Svanbergite | SrAl3(PO4)(SO4)(OH)6 |
| S | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Troilite | FeS |
| S | ⓘ Ullmannite | NiSbS |
| S | ⓘ Vaesite | NiS2 |
| S | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| S | ⓘ Violarite | Fe2+Ni23+S4 |
| S | ⓘ Wakabayashilite | [(As,Sb)6S9][As4S5] |
| S | ⓘ Wurtzite | (Zn,Fe)S |
| S | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| S | ⓘ Sphalerite var. Marmatite | (Zn,Fe)S |
| S | ⓘ Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| S | ⓘ Lanmuchangite | Tl+Al(SO4)2 · 12H2O |
| S | ⓘ Greenockite var. Zinc-bearing Greenockite | (Cd,Zn)S |
| S | ⓘ Metacinnabar var. Selenium-bearing Metacinnabar | Hg(S,Se) |
| S | ⓘ Pyrite var. Arsenic-bearing Pyrite | Fe(S,As)2 |
| S | ⓘ Ottensite | (Na,K)3Sb63+(Sb3+S3)O9 · 3H2O |
| S | ⓘ Stibnite var. Selenium-bearing Stibnite | Sb2(S,Se)3 |
| S | ⓘ Pyrite var. Thallium- and Arsenic-bearing Pyrite | (Fe,Tl)(S,As)2 |
| S | ⓘ Baryte var. Strontium-bearing Baryte | (Ba,Sr)SO4 |
| S | ⓘ Unnamed (Cu Selenide) | (Cu,Hg)1-xSbx(Se,S) |
| S | ⓘ UM2001-03-C:MoS | (Mo,Fe,Ni)3(S,As)6C10 |
| S | ⓘ Sphalerite var. Cadmium-bearing Sphalerite | (Zn,Cd)S |
| S | ⓘ UM1986-42-S:CuFe | Cu2Fe3S5 |
| S | ⓘ Sphalerite var. Gallium-bearing Sphalerite | (Zn,Ga)S |
| S | ⓘ Tennantite-(Zn) | Cu6(Cu4Zn2)As4S12S |
| S | ⓘ Tetrahedrite-(Zn) | Cu6(Cu4Zn2)Sb4S12S |
| S | ⓘ Tennantite-(Fe) | Cu6(Cu4Fe22+)As4S12S |
| S | ⓘ UM1995-37-Se:CuHgSb | (Cu,Hg)1-0.7Sb0-0.3(Se,S) |
| S | ⓘ UM1997-43-S:Fe | FeS3 |
| S | ⓘ UM2002-16-S:CrFeHO | ~FeCr2S4 (?) or Fe-Cr-S-O |
| S | ⓘ UM2002-17-S:CrHO | ~CrS2 · (O,H2O) |
| S | ⓘ UM2002-18-S:CrHO | ~CrS2 · 2(O,H2O) |
| S | ⓘ UM2002-22-S:CuFeNa | Na4.5(Fe,Cu)25S26 |
| S | ⓘ UM2002-25-S:FeGaMnZn | (Fe,Zn,Mn,Ga)S |
| S | ⓘ Tennantite-(Hg) | Cu6(Cu4Hg2)As4S12S |
| S | ⓘ Unnamed (Tl-Cu Arsenide-Sulphide) | Tl6CuAs16S40 |
| S | ⓘ Unnamed (Tl-Sn Arsenide-Sulphide) | TlSnAsS3 |
| S | ⓘ Unnamed (Tl Arsenide-Sulphide) | Tl2AsS3 |
| S | ⓘ Zhengminghuaite | Cu6Fe3As4S12 |
| Cl | Chlorine | |
| Cl | ⓘ Chlorargyrite | AgCl |
| Cl | ⓘ Djerfisherite | K6(Fe,Cu,Ni)25S26Cl |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Cl | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Cl | ⓘ Apatite var. Collophane | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Boltwoodite | (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| K | ⓘ Carnotite | K2(UO2)2(VO4)2 · 3H2O |
| K | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| K | ⓘ Djerfisherite | K6(Fe,Cu,Ni)25S26Cl |
| K | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| K | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| K | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| K | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| K | ⓘ Alum-(K) | KAl(SO4)2 · 12H2O |
| K | ⓘ Roedderite | K(◻Na)Mg2Mg3[Si12O30] |
| K | ⓘ Sanidine | K(AlSi3O8) |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Ottensite | (Na,K)3Sb63+(Sb3+S3)O9 · 3H2O |
| K | ⓘ Illite-1M | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Anhydrite | CaSO4 |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Anorthite | Ca(Al2Si2O8) |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Fluorapatite var. Carbonate-rich Fluorapatite | Ca5(PO4,CO3)3(F,O) |
| Ca | ⓘ Carlhintzeite | Ca2[AlF6]F · H2O |
| Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Creedite | Ca3Al2(SO4)(OH)2F8 · 2H2O |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Gearksutite | Ca[Al(F,OH)5(H2O)] |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Ca | ⓘ Hewettite | CaV6O16 · 9H2O |
| Ca | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| Ca | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| Ca | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Ca | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Ca | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| Ca | ⓘ Metatyuyamunite | Ca(UO2)2(VO4)2 · 3H2O |
| Ca | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Ca | ⓘ Oldhamite | CaS |
| Ca | ⓘ Perovskite | CaTiO3 |
| Ca | ⓘ Picropharmacolite | Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| Ca | ⓘ Rectorite | (Na,Ca)Al4((Si,Al)8O20)(OH)4 · 2H2O |
| Ca | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Ca | ⓘ Richterite | Na(CaNa)Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Tyuyamunite | Ca(UO2)2(VO4)2 · 5-8H2O |
| Ca | ⓘ Vernadite | (Mn4+,Fe3+,Ca,Na)(O,OH)2 · nH2O |
| Ca | ⓘ Fluorite var. Yttrofluorite | (Ca1-xYx)F2+x where 0.05 < x < 0.3 |
| Ca | ⓘ Calcite var. Iceland Spar | CaCO3 |
| Ca | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| Ca | ⓘ Aragonite var. Flos Ferri | CaCO3 |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Apatite var. Collophane | Ca5(PO4)3(Cl/F/OH) |
| Ca | ⓘ Calcite var. Iron-bearing Calcite | (Ca,Fe)CO3 |
| Ca | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ca | ⓘ Dolomite var. Manganese-bearing Dolomite | CaMg(CO3)2 |
| Sc | Scandium | |
| Sc | ⓘ Thortveitite | Sc2Si2O7 |
| Ti | Titanium | |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Brannerite | UTi2O6 |
| Ti | ⓘ Brookite | TiO2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Perovskite | CaTiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| Ti | ⓘ Magnetite var. Titanium-bearing Magnetite | Fe2+(Fe3+,Ti)2O4 |
| V | Vanadium | |
| V | ⓘ Carnotite | K2(UO2)2(VO4)2 · 3H2O |
| V | ⓘ Descloizite | PbZn(VO4)(OH) |
| V | ⓘ Fervanite | Fe43+V45+O16 · 5H2O |
| V | ⓘ Hewettite | CaV6O16 · 9H2O |
| V | ⓘ Metatyuyamunite | Ca(UO2)2(VO4)2 · 3H2O |
| V | ⓘ Navajoite | Fe3+V95+O24 · 12H2O |
| V | ⓘ Schubnelite | Fe3+VO4 · H2O |
| V | ⓘ Sulvanite | Cu3VS4 |
| V | ⓘ Tyuyamunite | Ca(UO2)2(VO4)2 · 5-8H2O |
| V | ⓘ Vanadinite | Pb5(VO4)3Cl |
| V | ⓘ Mikehowardite | Fe43+(V5+O4)4(H2O)2 · H2O |
| Cr | Chromium | |
| Cr | ⓘ Caswellsilverite | NaCrS2 |
| Cr | ⓘ Chromite | Fe2+Cr23+O4 |
| Cr | ⓘ Daubréelite | Fe2+Cr23+S4 |
| Cr | ⓘ UM2002-16-S:CrFeHO | ~FeCr2S4 (?) or Fe-Cr-S-O |
| Cr | ⓘ UM2002-17-S:CrHO | ~CrS2 · (O,H2O) |
| Cr | ⓘ UM2002-18-S:CrHO | ~CrS2 · 2(O,H2O) |
| Mn | Manganese | |
| Mn | ⓘ Alabandite | MnS |
| Mn | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| Mn | ⓘ Hausmannite | Mn2+Mn23+O4 |
| Mn | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| Mn | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| Mn | ⓘ Nsutite | (Mn4+,Mn2+)(O,OH)2 |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Reddingite | (Mn2+,Fe2+)3(PO4)2 · 3H2O |
| Mn | ⓘ Rhodochrosite | MnCO3 |
| Mn | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Mn | ⓘ Vernadite | (Mn4+,Fe3+,Ca,Na)(O,OH)2 · nH2O |
| Mn | ⓘ Rhodochrosite var. Capillitite | (Mn,Zn,Fe)CO3 |
| Mn | ⓘ UM2002-25-S:FeGaMnZn | (Fe,Zn,Mn,Ga)S |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Argentojarosite | AgFe33+(SO4)2(OH)6 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Pyrite var. Gold-bearing Pyrite | FeS2 |
| Fe | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| Fe | ⓘ Berthierite | FeSb2S4 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Pyrite var. Bravoite | (Fe,Ni)S2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Fe | ⓘ Chromite | Fe2+Cr23+O4 |
| Fe | ⓘ Daubréelite | Fe2+Cr23+S4 |
| Fe | ⓘ Djerfisherite | K6(Fe,Cu,Ni)25S26Cl |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Ferrihydrite | Fe103+O14(OH)2 |
| Fe | ⓘ Ferroselite | FeSe2 |
| Fe | ⓘ Fervanite | Fe43+V45+O16 · 5H2O |
| Fe | ⓘ Fibroferrite | Fe3+(SO4)(OH) · 5H2O |
| Fe | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Greigite | Fe2+Fe23+S4 |
| Fe | ⓘ Halotrichite | Fe2+Al2(SO4)4 · 22H2O |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Idaite | Cu5FeS6 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Native Iron | Fe |
| Fe | ⓘ Jamesonite | Pb4FeSb6S14 |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Native Iron var. Kamacite | (Fe,Ni) |
| Fe | ⓘ Lepidocrocite | Fe3+O(OH) |
| Fe | ⓘ Maghemite | (Fe3+0.67◻0.33)Fe23+O4 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| Fe | ⓘ Navajoite | Fe3+V95+O24 · 12H2O |
| Fe | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Fe | ⓘ Perryite | (Ni,Fe)5(Si,P)2 |
| Fe | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Raguinite | TlFeS2 |
| Fe | ⓘ Reddingite | (Mn2+,Fe2+)3(PO4)2 · 3H2O |
| Fe | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| Fe | ⓘ Sasaite | (Al,Fe3+)14(PO4)11(SO4)(OH)7 · 83H2O |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Schreibersite | (Fe,Ni)3P |
| Fe | ⓘ Schubnelite | Fe3+VO4 · H2O |
| Fe | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Smythite | (Fe,Ni)3+xS4 (x=0-0.3) |
| Fe | ⓘ Chamosite var. Thuringite | (Fe2+,Fe3+,Mg,Al)6(Si,Al)4O10(O,OH)8 |
| Fe | ⓘ Magnetite var. Titanium-bearing Magnetite | Fe2+(Fe3+,Ti)2O4 |
| Fe | ⓘ Troilite | FeS |
| Fe | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| Fe | ⓘ Vernadite | (Mn4+,Fe3+,Ca,Na)(O,OH)2 · nH2O |
| Fe | ⓘ Violarite | Fe2+Ni23+S4 |
| Fe | ⓘ Wurtzite | (Zn,Fe)S |
| Fe | ⓘ Sphalerite var. Marmatite | (Zn,Fe)S |
| Fe | ⓘ Fayalite-Forsterite Series | |
| Fe | ⓘ Calcite var. Iron-bearing Calcite | (Ca,Fe)CO3 |
| Fe | ⓘ Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| Fe | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Fe | ⓘ Rhodochrosite var. Capillitite | (Mn,Zn,Fe)CO3 |
| Fe | ⓘ Pyrite var. Arsenic-bearing Pyrite | Fe(S,As)2 |
| Fe | ⓘ Hydrogoethite | 3Fe2O3 · 4H2O |
| Fe | ⓘ Pyrite var. Thallium- and Arsenic-bearing Pyrite | (Fe,Tl)(S,As)2 |
| Fe | ⓘ UM2001-03-C:MoS | (Mo,Fe,Ni)3(S,As)6C10 |
| Fe | ⓘ UM1986-42-S:CuFe | Cu2Fe3S5 |
| Fe | ⓘ Tennantite-(Fe) | Cu6(Cu4Fe22+)As4S12S |
| Fe | ⓘ UM1997-43-S:Fe | FeS3 |
| Fe | ⓘ UM2002-16-S:CrFeHO | ~FeCr2S4 (?) or Fe-Cr-S-O |
| Fe | ⓘ UM2002-22-S:CuFeNa | Na4.5(Fe,Cu)25S26 |
| Fe | ⓘ UM2002-25-S:FeGaMnZn | (Fe,Zn,Mn,Ga)S |
| Fe | ⓘ Mikehowardite | Fe43+(V5+O4)4(H2O)2 · H2O |
| Fe | ⓘ Zhengminghuaite | Cu6Fe3As4S12 |
| Co | Cobalt | |
| Co | ⓘ Siegenite | CoNi2S4 |
| Ni | Nickel | |
| Ni | ⓘ Pyrite var. Bravoite | (Fe,Ni)S2 |
| Ni | ⓘ Djerfisherite | K6(Fe,Cu,Ni)25S26Cl |
| Ni | ⓘ Gersdorffite | NiAsS |
| Ni | ⓘ Heazlewoodite | Ni3S2 |
| Ni | ⓘ Native Iron var. Kamacite | (Fe,Ni) |
| Ni | ⓘ Millerite | NiS |
| Ni | ⓘ Nickeline | NiAs |
| Ni | ⓘ Parkerite | Ni3(Bi,Pb)2S2 |
| Ni | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Ni | ⓘ Perryite | (Ni,Fe)5(Si,P)2 |
| Ni | ⓘ Polydymite | Ni2+Ni23+S4 |
| Ni | ⓘ Schreibersite | (Fe,Ni)3P |
| Ni | ⓘ Siegenite | CoNi2S4 |
| Ni | ⓘ Smythite | (Fe,Ni)3+xS4 (x=0-0.3) |
| Ni | ⓘ Ullmannite | NiSbS |
| Ni | ⓘ Vaesite | NiS2 |
| Ni | ⓘ Violarite | Fe2+Ni23+S4 |
| Ni | ⓘ UM2001-03-C:MoS | (Mo,Fe,Ni)3(S,As)6C10 |
| Cu | Copper | |
| Cu | ⓘ Aktashite | Cu6Hg3As4S12 |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Chalcostibite | CuSbS2 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Djerfisherite | K6(Fe,Cu,Ni)25S26Cl |
| Cu | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Cu | ⓘ Galkhaite | (Hg5Cu)CsAs4S12 |
| Cu | ⓘ Idaite | Cu5FeS6 |
| Cu | ⓘ Libethenite | Cu2(PO4)(OH) |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| Cu | ⓘ Metazeunerite | Cu(UO2)2(AsO4)2 · 8H2O |
| Cu | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| Cu | ⓘ Sulvanite | Cu3VS4 |
| Cu | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Cu | ⓘ Tenorite | CuO |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| Cu | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| Cu | ⓘ Zeunerite | Cu(UO2)2(AsO4)2 · 12H2O |
| Cu | ⓘ Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| Cu | ⓘ Unnamed (Cu-analogue of Fraipontite) | Cu, Al, Si, O, H |
| Cu | ⓘ Unnamed (Cu Selenide) | (Cu,Hg)1-xSbx(Se,S) |
| Cu | ⓘ Příbramite | CuSbSe2 |
| Cu | ⓘ UM1986-42-S:CuFe | Cu2Fe3S5 |
| Cu | ⓘ Tennantite-(Zn) | Cu6(Cu4Zn2)As4S12S |
| Cu | ⓘ Tetrahedrite-(Zn) | Cu6(Cu4Zn2)Sb4S12S |
| Cu | ⓘ Tennantite-(Fe) | Cu6(Cu4Fe22+)As4S12S |
| Cu | ⓘ UM1995-37-Se:CuHgSb | (Cu,Hg)1-0.7Sb0-0.3(Se,S) |
| Cu | ⓘ UM2002-22-S:CuFeNa | Na4.5(Fe,Cu)25S26 |
| Cu | ⓘ Tennantite-(Hg) | Cu6(Cu4Hg2)As4S12S |
| Cu | ⓘ Unnamed (Tl-Cu Arsenide-Sulphide) | Tl6CuAs16S40 |
| Cu | ⓘ Zhengminghuaite | Cu6Fe3As4S12 |
| Zn | Zinc | |
| Zn | ⓘ Descloizite | PbZn(VO4)(OH) |
| Zn | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Zn | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| Zn | ⓘ Hopeite | ZnZn2(PO4)2 · 4H2O |
| Zn | ⓘ Smithsonite | ZnCO3 |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Willemite | Zn2SiO4 |
| Zn | ⓘ Wurtzite | (Zn,Fe)S |
| Zn | ⓘ Native Zinc | Zn |
| Zn | ⓘ Zincite | ZnO |
| Zn | ⓘ Sphalerite var. Marmatite | (Zn,Fe)S |
| Zn | ⓘ Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| Zn | ⓘ Greenockite var. Zinc-bearing Greenockite | (Cd,Zn)S |
| Zn | ⓘ Rhodochrosite var. Capillitite | (Mn,Zn,Fe)CO3 |
| Zn | ⓘ Sphalerite var. Cadmium-bearing Sphalerite | (Zn,Cd)S |
| Zn | ⓘ Sphalerite var. Gallium-bearing Sphalerite | (Zn,Ga)S |
| Zn | ⓘ Tennantite-(Zn) | Cu6(Cu4Zn2)As4S12S |
| Zn | ⓘ Tetrahedrite-(Zn) | Cu6(Cu4Zn2)Sb4S12S |
| Zn | ⓘ UM2002-25-S:FeGaMnZn | (Fe,Zn,Mn,Ga)S |
| Ga | Gallium | |
| Ga | ⓘ Sphalerite var. Gallium-bearing Sphalerite | (Zn,Ga)S |
| Ga | ⓘ UM2002-25-S:FeGaMnZn | (Fe,Zn,Mn,Ga)S |
| As | Arsenic | |
| As | ⓘ Aktashite | Cu6Hg3As4S12 |
| As | ⓘ Arsenolite | As2O3 |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Native Arsenic | As |
| As | ⓘ Christite | TlHgAsS3 |
| As | ⓘ Galkhaite | (Hg5Cu)CsAs4S12 |
| As | ⓘ Gersdorffite | NiAsS |
| As | ⓘ Getchellite | AsSbS3 |
| As | ⓘ Gratonite | Pb9As4S15 |
| As | ⓘ Imhofite | Tl5.8As15.4S26 |
| As | ⓘ Lorándite | TlAsS2 |
| As | ⓘ Metazeunerite | Cu(UO2)2(AsO4)2 · 8H2O |
| As | ⓘ Nickeline | NiAs |
| As | ⓘ Orpiment | As2S3 |
| As | ⓘ Picropharmacolite | Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| As | ⓘ Realgar | As4S4 |
| As | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| As | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| As | ⓘ Wakabayashilite | [(As,Sb)6S9][As4S5] |
| As | ⓘ Zeunerite | Cu(UO2)2(AsO4)2 · 12H2O |
| As | ⓘ Pyrite var. Arsenic-bearing Pyrite | Fe(S,As)2 |
| As | ⓘ Pyrite var. Thallium- and Arsenic-bearing Pyrite | (Fe,Tl)(S,As)2 |
| As | ⓘ UM2001-03-C:MoS | (Mo,Fe,Ni)3(S,As)6C10 |
| As | ⓘ Tennantite-(Zn) | Cu6(Cu4Zn2)As4S12S |
| As | ⓘ Tennantite-(Fe) | Cu6(Cu4Fe22+)As4S12S |
| As | ⓘ Tennantite-(Hg) | Cu6(Cu4Hg2)As4S12S |
| As | ⓘ Unnamed (Tl-Cu Arsenide-Sulphide) | Tl6CuAs16S40 |
| As | ⓘ Unnamed (Tl-Sn Arsenide-Sulphide) | TlSnAsS3 |
| As | ⓘ Unnamed (Tl Arsenide-Sulphide) | Tl2AsS3 |
| As | ⓘ Zhengminghuaite | Cu6Fe3As4S12 |
| Se | Selenium | |
| Se | ⓘ Antimonselite | Sb2Se3 |
| Se | ⓘ Clausthalite | PbSe |
| Se | ⓘ Ferroselite | FeSe2 |
| Se | ⓘ Tiemannite | HgSe |
| Se | ⓘ Metacinnabar var. Selenium-bearing Metacinnabar | Hg(S,Se) |
| Se | ⓘ Stibnite var. Selenium-bearing Stibnite | Sb2(S,Se)3 |
| Se | ⓘ Unnamed (Cu Selenide) | (Cu,Hg)1-xSbx(Se,S) |
| Se | ⓘ Příbramite | CuSbSe2 |
| Se | ⓘ UM1995-37-Se:CuHgSb | (Cu,Hg)1-0.7Sb0-0.3(Se,S) |
| Sr | Strontium | |
| Sr | ⓘ Celestine | SrSO4 |
| Sr | ⓘ Svanbergite | SrAl3(PO4)(SO4)(OH)6 |
| Sr | ⓘ Baryte var. Strontium-bearing Baryte | (Ba,Sr)SO4 |
| Y | Yttrium | |
| Y | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| Y | ⓘ Fluorite var. Yttrofluorite | (Ca1-xYx)F2+x where 0.05 < x < 0.3 |
| Zr | Zirconium | |
| Zr | ⓘ Baddeleyite | ZrO2 |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Mo | Molybdenum | |
| Mo | ⓘ Jordisite | MoS2 |
| Mo | ⓘ Moluranite | H4U4+(UO2)3(MoO4)7 · 18H2O |
| Mo | ⓘ Molybdenite | MoS2 |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Mo | ⓘ UM2001-03-C:MoS | (Mo,Fe,Ni)3(S,As)6C10 |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Argentojarosite | AgFe33+(SO4)2(OH)6 |
| Ag | ⓘ Chlorargyrite | AgCl |
| Ag | ⓘ Native Gold var. Electrum | (Au,Ag) |
| Ag | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Ag | ⓘ Native Silver var. Kongsbergite | (Ag,Hg) |
| Ag | ⓘ Moschellandsbergite | Ag2Hg3 |
| Ag | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| Ag | ⓘ Native Silver | Ag |
| Ag | ⓘ Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| Cd | Cadmium | |
| Cd | ⓘ Greenockite | CdS |
| Cd | ⓘ Hawleyite | CdS |
| Cd | ⓘ Monteponite | CdO |
| Cd | ⓘ Otavite | CdCO3 |
| Cd | ⓘ Greenockite var. Zinc-bearing Greenockite | (Cd,Zn)S |
| Cd | ⓘ Sphalerite var. Cadmium-bearing Sphalerite | (Zn,Cd)S |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sn | ⓘ Unnamed (Tl-Sn Arsenide-Sulphide) | TlSnAsS3 |
| Sb | Antimony | |
| Sb | ⓘ Native Antimony | Sb |
| Sb | ⓘ Antimonselite | Sb2Se3 |
| Sb | ⓘ Berthierite | FeSb2S4 |
| Sb | ⓘ Cervantite | Sb3+Sb5+O4 |
| Sb | ⓘ Chalcostibite | CuSbS2 |
| Sb | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Sb | ⓘ Getchellite | AsSbS3 |
| Sb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Sb | ⓘ Kermesite | Sb2S2O |
| Sb | ⓘ Mopungite | Na[Sb5+(OH)6] |
| Sb | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| Sb | ⓘ Roméite Group | A2(Sb5+)2O6Z |
| Sb | ⓘ Senarmontite | Sb2O3 |
| Sb | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Sb | ⓘ Ullmannite | NiSbS |
| Sb | ⓘ Valentinite | Sb2O3 |
| Sb | ⓘ Wakabayashilite | [(As,Sb)6S9][As4S5] |
| Sb | ⓘ Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| Sb | ⓘ Ottensite | (Na,K)3Sb63+(Sb3+S3)O9 · 3H2O |
| Sb | ⓘ Stibnite var. Selenium-bearing Stibnite | Sb2(S,Se)3 |
| Sb | ⓘ Unnamed (Cu Selenide) | (Cu,Hg)1-xSbx(Se,S) |
| Sb | ⓘ Příbramite | CuSbSe2 |
| Sb | ⓘ Tetrahedrite-(Zn) | Cu6(Cu4Zn2)Sb4S12S |
| Sb | ⓘ UM1995-37-Se:CuHgSb | (Cu,Hg)1-0.7Sb0-0.3(Se,S) |
| Cs | Caesium | |
| Cs | ⓘ Galkhaite | (Hg5Cu)CsAs4S12 |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| Ba | ⓘ Witherite | BaCO3 |
| Ba | ⓘ Baryte var. Strontium-bearing Baryte | (Ba,Sr)SO4 |
| La | Lanthanum | |
| La | ⓘ Florencite-(La) | LaAl3(PO4)2(OH)6 |
| La | ⓘ Monazite-(La) | La(PO4) |
| Ce | Cerium | |
| Ce | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| Ce | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| Ce | ⓘ Cerianite-(Ce) | Ce4+O2 |
| Ce | ⓘ Florencite-(Ce) | CeAl3(PO4)2(OH)6 |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| Nd | Neodymium | |
| Nd | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
| Au | Gold | |
| Au | ⓘ Native Gold var. Electrum | (Au,Ag) |
| Au | ⓘ Native Gold | Au |
| Hg | Mercury | |
| Hg | ⓘ Aktashite | Cu6Hg3As4S12 |
| Hg | ⓘ Christite | TlHgAsS3 |
| Hg | ⓘ Cinnabar | HgS |
| Hg | ⓘ Galkhaite | (Hg5Cu)CsAs4S12 |
| Hg | ⓘ Native Silver var. Kongsbergite | (Ag,Hg) |
| Hg | ⓘ Native Mercury | Hg |
| Hg | ⓘ Metacinnabar | HgS |
| Hg | ⓘ Moschellandsbergite | Ag2Hg3 |
| Hg | ⓘ Tiemannite | HgSe |
| Hg | ⓘ Metacinnabar var. Selenium-bearing Metacinnabar | Hg(S,Se) |
| Hg | ⓘ Unnamed (Cu Selenide) | (Cu,Hg)1-xSbx(Se,S) |
| Hg | ⓘ UM1995-37-Se:CuHgSb | (Cu,Hg)1-0.7Sb0-0.3(Se,S) |
| Hg | ⓘ Tennantite-(Hg) | Cu6(Cu4Hg2)As4S12S |
| Tl | Thallium | |
| Tl | ⓘ Christite | TlHgAsS3 |
| Tl | ⓘ Imhofite | Tl5.8As15.4S26 |
| Tl | ⓘ Lorándite | TlAsS2 |
| Tl | ⓘ Raguinite | TlFeS2 |
| Tl | ⓘ Lanmuchangite | Tl+Al(SO4)2 · 12H2O |
| Tl | ⓘ Pyrite var. Thallium- and Arsenic-bearing Pyrite | (Fe,Tl)(S,As)2 |
| Tl | ⓘ Unnamed (Tl-Cu Arsenide-Sulphide) | Tl6CuAs16S40 |
| Tl | ⓘ Unnamed (Tl-Sn Arsenide-Sulphide) | TlSnAsS3 |
| Tl | ⓘ Unnamed (Tl Arsenide-Sulphide) | Tl2AsS3 |
| Pb | Lead | |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Clausthalite | PbSe |
| Pb | ⓘ Descloizite | PbZn(VO4)(OH) |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Gratonite | Pb9As4S15 |
| Pb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Pb | ⓘ Native Lead | Pb |
| Pb | ⓘ Parkerite | Ni3(Bi,Pb)2S2 |
| Pb | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Pb | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| Bi | Bismuth | |
| Bi | ⓘ Bismite | Bi2O3 |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Parkerite | Ni3(Bi,Pb)2S2 |
| U | Uranium | |
| U | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| U | ⓘ Boltwoodite | (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| U | ⓘ Brannerite | UTi2O6 |
| U | ⓘ Carnotite | K2(UO2)2(VO4)2 · 3H2O |
| U | ⓘ Coffinite | U(SiO4) · nH2O |
| U | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| U | ⓘ Metatyuyamunite | Ca(UO2)2(VO4)2 · 3H2O |
| U | ⓘ Metazeunerite | Cu(UO2)2(AsO4)2 · 8H2O |
| U | ⓘ Moluranite | H4U4+(UO2)3(MoO4)7 · 18H2O |
| U | ⓘ Uraninite var. Pitchblende | UO2 |
| U | ⓘ Sklodowskite | Mg(UO2)2(SiO3OH)2 · 6H2O |
| U | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| U | ⓘ Tyuyamunite | Ca(UO2)2(VO4)2 · 5-8H2O |
| U | ⓘ Uraninite | UO2 |
| U | ⓘ Zeunerite | Cu(UO2)2(AsO4)2 · 12H2O |
Geochronology
Mineralization age: Early/Lower Ordovician : 475.4 ± 7.5 MaImportant note: This table is based only on rock and mineral ages recorded on mindat.org for this locality and is not necessarily a complete representation of the geochronology, but does give an indication of possible mineralization events relevant to this locality. As more age information is added this table may expand in the future. A break in the table simply indicates a lack of data entered here, not necessarily a break in the geologic sequence. Grey background entries are from different, related, localities.
| Geologic Time | Rocks, Minerals and Events | ||||||
|---|---|---|---|---|---|---|---|
| Phanerozoic | |||||||
| Paleozoic | |||||||
| Ordovician | |||||||
| Early/Lower Ordovician |
| ||||||
Fossils
There are 10476 fossil localities from the PaleoBioDB database within this region.These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 10476 |
|---|---|
| Youngest Fossil Listed | 0.13 Ma (Pleistocene) |
| Oldest Fossil Listed | 1,000 Ma (Neoproterozoic) |
| Stratigraphic Units | Click here to view 183 stratigraphic units. |
| Fossils from Region | Click here to show the list. |
| Fossil Localities | Click to show 437 fossil localities |
- Guizhou
- Anshun
- Permian🐚 3GP1-68F10
- Late/Upper Triassic🐚 Baiyuncun of Xinpuxiang
- Permian🐚 Bandangguan
- Permian🐚 Banqiao Section
- Carboniferous🐚 Bianping
- Late/Upper Triassic🐚 BT3WC Bamaolin
- Permian🐚 Chang'er
- Permian🐚 Changliujing
- Permian🐚 Daying
- Triassic🐚 Guanling
- Early/Lower Triassic🐚 Guiling County
- Paleozoic🐚 Houchang
- Permian🐚 Houyao
- Permian🐚 Kabi
- Permian🐚 Kezuo
- Early/Lower Triassic🐚 Luosishan
- Permian🐚 Meichang Section
- Late/Upper Triassic🐚 Osteocrinus from Xiaowa village
- Permian🐚 QCC5B
- Permian🐚 Qincaiyuan
- Permian🐚 Shaiwa
- Triassic🐚 Shaiwa section
- Permian🐚 Shengouzhong
- Permian🐚 Shitouzhai Reef
- Permian🐚 Sidazhai
- Permian🐚 Sidazhai section
- Phanerozoic🐚 Weijiaping ridge
- Late/Upper Triassic🐚 Xiaowa Village
- Late/Upper Triassic🐚 Xinpu Ichthyosaur locality
- Late/Upper Triassic🐚 Xinpu Thalattosaur Locality
- Late/Upper Triassic🐚 XTZC15 Xiao'wa
- Triassic🐚 Yangjia River
- Paleozoic🐚 Yanjiao
- Permian🐚 Yemaojing Section
- Triassic🐚 Yongning section TY-02-12
- Late/Upper Triassic🐚 YTZC22 Wayao
- Permian🐚 Z1
- Triassic🐚 Zhuganpo Village TZ-03-15
- Permian🐚 Zhulinchong
- Permian🐚 Ziyundong
- Permian🐚 ZYD1
- Pingba County
- Puding County
- Xixiu District
- Zhenning County
- Bijie
- Phanerozoic🐚 Jianpo
- Cambrian🐚 Yankong
- Dafang County
- Nayong County
- Qixingguan District
- Weining County
- Zhijin County
- Permian🐚 Agong Section AP1
- Permian🐚 Agong Section AP12
- Permian🐚 Agong Section AP27
- Permian🐚 Bakuaitan BaMei1
- Permian🐚 Beimenyan
- Phanerozoic🐚 Chihchinghsien
- Permian🐚 Damaochang
- Cambrian🐚 Gezhongwu
- Permian🐚 Maochang
- Permian🐚 Pujia AP-19
- Permian🐚 Qimo
- Permian🐚 Shuidong
- Cambrian🐚 Xinhua Phosphorite Mine
- Permian🐚 Yanbeihou Section
- Cambrian🐚 Zhijin [Gezhongwu Section
- Permian🐚 Zhuzang Zhu5
- Guiyang
- Permian🐚 Azhe Section
- Permian🐚 Bangfujin
- Permian🐚 Erhp'u
- Late/Upper Triassic🐚 Erqiao
- Permian🐚 Guiyang Mineral Exploration Factory
- Late/Upper Triassic🐚 Sanqiao
- Permian🐚 T'uyunkuan
- Permian🐚 Wumats'ao
- Permian🐚 Xianrendong
- Phanerozoic🐚 Xiaochehe section
- Phanerozoic🐚 Yingpanpo section
- Baiyun District
- Huaxi District
- Triassic🐚 Bangtoupo F8
- Permian🐚 Changtso
- Permian🐚 Datiankan
- Phanerozoic🐚 Guiyang
- Triassic🐚 Leidapo
- Triassic🐚 Leidapo/Bangtoupo
- Triassic🐚 M Shell Bed
- Permian🐚 Machong
- Triassic🐚 Mentzelia Assemblage
- Phanerozoic🐚 Qingyan
- Triassic🐚 Sizishan KC278
- Permian🐚 Taiciqiao Section
- Triassic🐚 Yinshanpo KC252b
- Triassic🐚 Yinshanpo KC259a
- Kaiyang County
- Qingzhen County
- Wudang District
- Xiuwen County
- Liupanshui
- Liuzhi District
- Phanerozoic🐚 Heilajia Section Bed 10
- Permian🐚 Heishiht'ou
- Permian🐚 Kuzhulin
- Permian🐚 Ladang
- Early/Lower Triassic🐚 Langdai County
- Phanerozoic🐚 Langdai Section H26-4
- Permian🐚 Langdai Section H37-8
- Permian🐚 Langdai Section HG6
- Phanerozoic🐚 Liuzhi section
- Phanerozoic🐚 Lojiayakou KL004a
- Permian🐚 Luojiaya
- Triassic🐚 YangliujingFarm
- Permian🐚 Zhichang Section Z12
- Phanerozoic🐚 Zhongzai section
- Permian🐚 Zhongzhai bed 2
- Pan County
- Permian🐚 Baini Tangzi
- Permian🐚 Datianba 1801
- Permian🐚 Fadai
- Phanerozoic🐚 Huopu coal mine section
- Phanerozoic🐚 Huoshaopu
- Phanerozoic🐚 Laowuji Section Bed 21
- Triassic🐚 Near Yangjuan Village
- Triassic🐚 Panxian
- Phanerozoic🐚 Panxian County
- Pleistocene🐚 Panxian Dadong
- Phanerozoic🐚 Tucheng Section
- Triassic🐚 Xinmin
- Permian🐚 Yangchang Yang30-1
- Triassic🐚 Yangjuan
- Triassic🐚 Yangjuan Village
- Triassic🐚 Yangjuan-Chupiwa section
- Permian🐚 Yaoshang
- Permian🐚 Yueliangtian Mine
- Early/Lower Triassic🐚 Yunnanzhai
- Shuicheng County
- Zhongshan District
- Liuzhi District
- Qiandongnan
- Anshun
- Guizhou
- Qiannan
- Late/Upper Devonian🐚 Base of upper member
- Triassic🐚 BojishanFarm
- Permian🐚 Changtiankan Section
- Permian🐚 Duobai
- Phanerozoic🐚 GJ-14
- Permian🐚 Guiding
- Early/Lower Triassic🐚 Gujiao
- Permian🐚 Huishui
- Phanerozoic🐚 Jieshan Lake Section JL1
- Permian🐚 Laojialiang
- Paleozoic🐚 Mu-42
- Permian🐚 Pingtang County
- Phanerozoic🐚 Sample GMC-01
- Permian🐚 Shuichang
- Permian🐚 Taizishan
- Permian🐚 Weichai
- Permian🐚 Wenjiangsi Section
- Permian🐚 Western boundary of Guiding county
- Late/Upper Triassic🐚 XinpuXiang
- Permian🐚 Yandi Section
- Dushan County
- Duyun County
- Permian🐚 400 m west of Ch'it'u
- Phanerozoic🐚 Dading
- Permian🐚 Duyun railway station
- Permian🐚 Guanshang
- Permian🐚 Hsiaolungching
- Permian🐚 Huangliang South road
- Permian🐚 Ma'anshan
- Permian🐚 Maanshan
- Permian🐚 Maots'aop'ing
- Permian🐚 Matoupo
- Permian🐚 Panpienchiai
- Permian🐚 Taho
- Permian🐚 Yangliuchieh
- Permian🐚 Zhangjiamiao
- Fuquan County
- Huishui County
- Luodian County
- Triassic🐚 ZT2 52 ?
- Late/Upper Triassic🐚 Bianyang
- Middle Triassic🐚 Bianyang corals
- Paleozoic🐚 Biaoping
- Phanerozoic🐚 Dajiang 05PAJ22
- Phanerozoic🐚 Dajiang I
- Triassic🐚 Dajiang MDJ-02
- Triassic🐚 Dajiang MDJ-25
- Triassic🐚 Dajiang MDJ-47
- Phanerozoic🐚 Dajiang PDJ-055
- Phanerozoic🐚 Dajiang-1
- Phanerozoic🐚 Dawen PDW-008
- Phanerozoic🐚 Dawen-1
- Phanerozoic🐚 Dongjiawen-1
- Permian🐚 Goupizhai
- Permian🐚 Goutouzhai
- Triassic🐚 Guandao PGD-087
- Triassic🐚 Guandao PUG-001
- Phanerozoic🐚 Houchang-1
- Permian🐚 LD6
- Permian🐚 Pingyan
- Phanerozoic🐚 Rongbao-1
- Permian🐚 Shachang
- Permian🐚 Shaiwa
- Permian🐚 Shuiyanba
- Phanerozoic🐚 Youjianzhai-1
- Sandu County
- Weng'an County
- Qianxinan
- Tongren
- Zunyi
- Permian🐚 Anchang
- Paleozoic🐚 Aphanomena-Hirnantia-Dalmanitina Comm.
- Early/Lower Cretaceous🐚 Baoyuan tracksite
- Early/Lower Triassic🐚 Chengdong
- Permian🐚 Chumipu Section
- Permian🐚 Dingcun
- Ordovician🐚 Donggongsi Horizon 2
- Cambrian🐚 Heishapo
- Ordovician🐚 Honghuayuan
- Ordovician🐚 horizon 2
- Permian🐚 Huangchiawan
- Permian🐚 Huangshitian Section
- Triassic🐚 Jenhui
- Permian🐚 Kuomaiya
- Permian🐚 Kuomaya
- Permian🐚 Laomuding
- Permian🐚 Leishakan
- Paleozoic🐚 Loc. 22
- Permian🐚 Maliu
- Permian🐚 Maolixi
- Permian🐚 Meitangou
- Ordovician🐚 Northwester Guizhou
- Permian🐚 Panshan
- Paleozoic🐚 R2: Haitupo
- Paleozoic🐚 R50: Jiancaohe
- Paleozoic🐚 RS-13
- Phanerozoic🐚 Shangba tracksite
- Phanerozoic🐚 ShihniulanFarm
- Permian🐚 Shihtzup'u T39
- Permian🐚 Shizipu
- Permian🐚 Songlin Section
- Permian🐚 Ts'ingch'engch'iao
- Phanerozoic🐚 Tuanxi Section
- Paleozoic🐚 Tungye
- Paleozoic🐚 Units 47.5
- Phanerozoic🐚 Zhunyi
- Cambrian🐚 Zunyi
- Cambrian🐚 Zunyi [Niutitang Fm]
- Cambrian🐚 Zunyi [Songlin Section
- Permian🐚 Zushiguan
- Meitan County
- Wuchuan County
- Xishui County
- Yuqing County
- Qiannan
- Liaoning
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Guizhou |
|---|---|
| Wikidata ID: | Q47097 |
| GeoNames ID: | 1809445 |
Localities in this Region
- Guizhou
- ⭔Anshun
- ⭔Bijie
- ⭔Dafang County
- ⭔Hezhang County
- Bailachang Pb-Zn deposit
- Caoziping Pb-Zn deposit
- Feilaishi Pb-Zn deposit
- Fulaichang Pb-Zn deposit
- Kaiwu Mine
- Mangdong Pb-Zn deposit
- Maomaochang-Zhazichang Pb-Zn deposit
- Shaojiwan Pb-Zn deposit
- Shiyakou REE deposit
- Tianqiao Pb-Zn deposit
- Tiekuangshan Fe deposit
- Tonglushang Pb-Zn deposit
- Wuliping Mo-(Pb-Zn) deposit
- Yedugu Pb-Zn deposit (Yedougu Pb-Zn deposit)
- Yingpan Pb-Zn deposit
- Zhangkoudong Pb-Zn deposit
- Zhugongtang Pb-Zn Deposit
- ⭔Jinsha County
- ⭔Nayong County
- ⭔Qianxi County
- ⭔Qixingguan District
- ⭔Weining County
- ⭔Zhijin County
- ⭔Guiyang
- ⭔Liupanshui
- ⭔Qiandongnan
- ⭔Qiannan
- Guizhou
- Qiannan
- Dushan County
- ⭔Duyun County
- ⭔Fuquan County
- ⭔Huishui County
- ⭔Longli County
- ⭔Luodian County
- ⭔Sandu County
- ⭔Weng'an County
- ⭔Qianxinan
- ⭔Anlong County
- ⭔Ceheng County
- ⭔Pu'an County
- ⭔Qinglong County
- ⭔Wangmo County
- ⭔Xingren County
- ⭔Xingyi County
- ⭔Zhenfeng County
- Beiyinpo Au-Hg deposit
- Bolao Au deposit
- Huijiabao gold field
- Jiaoguan Au deposit
- Jinfeng Mine (Lannigou Mine)
- Kawu Au deposit
- Lage Au deposit
- Loudong Au deposit
- Mao'an Au deposit
- Nage Au deposit
- Pegao Au deposit
- Puzilong Au-Hg deposit
- Sanchahe Au deposit
- Tangxinzhai Au deposit
- Xiaotunxiang fluorite deposit
- ⭔Tongren
- ⭔Zunyi
- ⭔Bozhou District
- Changgou Mn deposit
- ⭔Daozhen County
- ⭔Fenggang County
- ⭔Meitan County
- Tongluojing Mn deposit
- ⭔Wuchuan County
- ⭔Xishui County
- ⭔Yuqing County
- ⭔Zheng'an County
- Qiannan
Other Regions, Features and Areas that Intersect
AsiaContinent
- Emeishan TrapsLarge Igneous Province
China
- Giant Sb metallogenic beltMineral Belt
- Sichuan-Yunnan-Guizhou Li Mineral BeltMineral Belt
- Sichuan-Yunnan-Guizhou metallogenic beltMineral Belt
- Xuefengshan Gold ClusterMining Area
- Youjiang metallogenic provinceMineral Province
Eurasian PlateTectonic Plate
- Eastern Yangtze CratonCraton
- Nanpanjiang BasinBasin
- West CathaysiaOrogenic Belt
- Western Yangtze CratonCraton
Yangtze PlateTectonic Plate
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Quick NavTopCommoditiesMineral ListRock TypesGeochronologyFossilsOther DatabasesLocalities in RegionOther Regions




Guizhou, China