Log In
Mungrisdale, Eden, Cumbria, England, UKi
| Regional Level Types | |
|---|---|
| Mungrisdale | Civil Parish |
| Eden | District |
| Cumbria | County |
| England | Constituent Country |
| UK | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Other/historical names associated with this locality:
North and Western Region; Cumberland
Other Languages:
French:
Mungrisdale, Eden, Cumbria, Angleterre, Royaume-Uni
Italian:
Mungrisdale, Eden, Cumbria, Inghilterra, Regno Unito
Cebuano:
Mungrisdale, Eden District, Cumbria, Inglatera, Hiniusang Gingharian
Dutch:
Mungrisdale, Eden, Cumbria, Engeland, Verenigd Koninkrijk
Farsi/Persian:
مانگریزدیل, منطقه ادن, کامبریا, انگلستان, بریتانیا
Japanese:
マングリズデール, エデン , カンブリア, イングランド, イギリス
Minnan / Hokkien-Taiwanese:
Mungrisdale, Cumbria, Eng-tē, Liân-ha̍p Ông-kok
Polish:
Mungrisdale, Eden, Kumbria, Anglia, Wielka Brytania
Swedish:
Mungrisdale, Eden, Cumbria, England, Storbritannien
Welsh:
Mungrisdale, Eden, Cumbria, Lloegr, Y Deyrnas Unedig
Mungrisdale is a small village and civil parish in the northeast of the English Lake District in Cumbria. It is also the name of the valley in which the village sits. Mungrisdale is a popular starting point for ascents of the nearby hills, such as Bowscale Fell, Bannerdale Crags and Souther Fell. It lies on the River Glenderamackin, a tributary of the Greta. The civil parish of Mungrisdale is made up of the hamlets of Berrier, Bowscale, Haltcliff Bridge, Heggle Lane, Hutton Roof, Mosedale, Mungrisdale and Murrah.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities135 valid minerals. 6 erroneous literature entries.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 References: |
| ⓘ 'Agardite' Habit: minute sprays of needles Colour: pale green Description: Identified on a small specimen from the upper west level submitted to MPC by W. van den Berg. EPMA shows the presence of Ce, La, and Nd; Bi was not detected. Small grain size prevented quantitative results. [...] Agardite-mixite has subsequently been identified (BM(NH): XRD) on a specimen from the C.M. Leppington Collection. |
| ⓘ Agardite-(La) Formula: LaCu6(AsO4)3(OH)6 · 3H2O |
| ⓘ Aikinite ? Formula: CuPbBiS3 Localities: Description: Kingsbury reference? Cooper & Stanley (1990): "As minute crystals in quartz stringers in greisen; the first British locality (previous references to 'aikinite' in Britain concern wolframite pseudomorphs after scheelite from Wheal Maudlin, Cornwall)." |
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ Allophane Formula: (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| ⓘ Alunite ? Formula: KAl3(SO4)2(OH)6 Localities: Description: Kingsbury reference. |
| ⓘ 'Amphibole Supergroup' Formula: AB2C5(T8O22)W2 |
| ⓘ Anatase Formula: TiO2 |
| ⓘ Andalusite Formula: Al2(SiO4)O |
| ⓘ Andalusite var. Chiastolite Formula: Al2(SiO4)O |
| ⓘ Anglesite Formula: PbSO4 Localities: Description: Associated with the wulfenite (Goodchild, 1875) that was shown by Russell (1936) to have originated here; listed by Hartley (1984). |
| ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 |
| ⓘ 'Apatite' Formula: Ca5(PO4)3A Localities: Colour: blue Description: Cooper & Stanley (1990): "Blue apatite crystals embedded in quartz with pyrite have recently been found in the old No. 1 level (north) on the Harding vein (D. Hacker, pers. comm.)." |
| ⓘ 'Apatite Group' |
| ⓘ Aragonite Formula: CaCO3 |
| ⓘ Formula: Ca2Fe3+3(AsO4)3O2 · 3H2O Localities: Habit: drusy, slightly botryoidal aggregates of minute scales Colour: brown Description: Kingsbury reference. Kingsbury and Hartley (1957): "drusy, slightly botryoidal aggregates of minute, brown, glistening scales coating quartz and arsenopyrite." |
| ⓘ Arsenopyrite Formula: FeAsS Localities: |
| ⓘ Azurite ? Formula: Cu3(CO3)2(OH)2 Localities: Description: Kingsbury reference. |
| ⓘ Baryte Formula: BaSO4 Localities: Reported from at least 6 localities in this region. |
| ⓘ Bayldonite Formula: PbCu3(AsO4)2(OH)2 |
| ⓘ Beaverite-(Cu) ? Formula: Pb(Fe3+2Cu)(SO4)2(OH)6 |
| ⓘ Beryl ? Formula: Be3Al2(Si6O18) Description: Kingsbury reference. Cooper & Stanley (1990): "As small poor crystals in 'gilbertite' in specimens in the Kingsbury & Russell Collections, BM(NH), collected by the former who noted 'from north-west branch (= south drive on the Harding vein) of the new low-level cross-cut to the Harding vein - the vein in which beryl occurs is apparently an early member of the suite; also in iron-stained mica on dump' (Kingsbury, unpublished manuscript). The reference of Lysons & Lysons (1816: cx) to beryl from 'Caldew-beck ... found by the Rev. Mr. Mandall' probably refers to apatite." References: |
| ⓘ Betpakdalite-CaMg Formula: [Ca2(H2O)17Mg(H2O)6][Mo8As2Fe3+3O36(OH)] |
| ⓘ Beudantite Formula: PbFe3+3(AsO4)(SO4)(OH)6 Localities: Habit: granular crusts; small acute rhombohedra; zoned hexagonal plates to 2 mm Colour: yellow, yellow-green, olive green, greenish-brown, and brown Description: occasionally as epimorphs/pseudomorphs after mimetite/carminite crystals (Cooper & Stanley, 1990-1991) |
| ⓘ Bindheimite Formula: Pb2Sb2O6O |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Bismite Formula: Bi2O3 Colour: yellowish white Description: Cooper & Stanley (1990): "the 'bismuth ochre' reported from 'Brandy Gill' as an associate of bismuth (Goodchild, 1882: 104) may have been bismite or bismutite. Bismite has been recorded from Carrock mine 'in minute amounts' as a yellowish white alteration of bismuthinite (Davidson & Thomson, 1951); and from the dumps of an old level 'at, or near, the junction of the east-west lead veins with the Emerson vein at the foot of Brandy Gill' (Hartley, 1984)." References: |
| ⓘ Bismuthinite Formula: Bi2S3 Localities: Habit: acicular crystals to 25mm; small masses with typical fibrous-lamellar cleavage Description: Cooper & Stanley (1990): "in association with bismuth, josëite, ingodite, molybdenite etc. in quartz. Phillips (1837) first noted the occurrence. In its finely fibrous form, it is difficult to distinguish from acicular sulphosalts such as cosalite, jamesonite, and boulangerite and was described by Davidson & Thomson (1951: 142) as 'tufts of delicate hair-like crystals which easily become detached from the matrix and blow away in the wind.'" |
| ⓘ 'Bismuth Ochre' Description: Cooper & Stanley (1990): "the 'bismuth ochre' reported from 'Brandy Gill' as an associate of bismuth (Goodchild, 1882: 104) may have been bismite or bismutite." References: |
| ⓘ Bismutite Formula: (BiO)2CO3 Description: Cooper & Stanley (1990): "Recorded by Hitchen (1934) and listed from the 'main dump' by Hartley (1984). The 'bismuth ochre' reported from 'Brandy Gill' as an associate of bismuth (Goodchild, 1882: 104) may have been bismite or bismutite." |
| ⓘ Bornite Formula: Cu5FeS4 |
| ⓘ Formula: Pb5Sb4S11 Localities: Habit: acicular; fibrous; tufts; wool-like aggregates Colour: dark grey Description: Kingsbury reference. Cooper & Stanley (1990): "'As dark grey minute acicular crystals or fibres, tufts, or wool-like aggregates, or small fibrous patches' very similar to zinckenite and jamesonite which also occur here. Associated with pyrite, arsenopyrite, chalcopyrite, and galena (Kingsbury & Hartley, 1956: 298)." |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 |
| ⓘ Brookite Formula: TiO2 |
| ⓘ Calcite Formula: CaCO3 Localities: |
| ⓘ Caledonite Formula: Pb5Cu2(SO4)3(CO3)(OH)6 |
| ⓘ Carminite Formula: PbFe3+2(AsO4)2(OH)2 Colour: carmine-red Description: Cooper & Stanley (1990): "Vein exposures near the mine, on the east side of Brandy Gill and in the dry tributary valley to the east [NY32403335] have yielded a few fairly rich specimens of carminite as minutes crystals and drusy crusts on quartz with beudantite (D.R. Middleton & M.P. Cooper Collections, det. University of Manchester Institute of Science and Technology (UMIST): IR)."
Cooper & Stanley (1991): "occasionally as epimorphs after small mimetite crystals." References: Kingsbury, Arthur W.G., Hartley, J. (1957) Beaverite from the Lake District. Mineralogical Magazine and Journal of the Mineralogical Society, 31 (239). 700-702 doi:10.1180/minmag.1957.31.239.10 |
| ⓘ Formula: Mn2+Al2(Si2O6)(OH)4 Localities: Habit: thin, fibrous-radiating aggregates Colour: pale yellow Description: Kingsbury reference. Cooper & Stanley (1990): "As unusually pale, almost cream yellow, 'thin, fibrous-radiating aggregates in joints in white vein-quartz... almost certainly from the Emerson vein' (Kingsbury & Hartley, 1957). Specimens in the Kingsbury Collection (BM(NH)) match this description." |
| ⓘ Cassiterite Formula: SnO2 Localities: Description: Cooper & Stanley (1990): "A few small crystal sections, embedded in quartz and mica, were found by Kingsbury in 1953 from the Harding vein 'new low-level cross-cut, south drive' and are represented by specimens in the Russell and Kingsbury Collections, BM(NH).
In addition, the King Collection (National Museum of Wales, Cardiff (NMW)) contains a good grey-brown incomplete geniculate twin, originally labelled scheelite, which, if authentic, is undoubtedly the best Carrock specimen extant. It may have been found during the 1940s working and was obtained by King from the H.F. Harwood collection (R.J. King, pers. comm.)
The 'ores of tin, both of a resinous and nearly black colour' in a matrix 'nearly as hard as tempered steel', reported by Parson & White (1829) from 'a vein at Brandy Gill near the Caldew' no doubt refer to scheelite and wolframite." |
| ⓘ Cerussite Formula: PbCO3 Localities: Reported from at least 6 localities in this region. Habit: stellate macles, like six-rayed stars in the interiors of corroded galena (Goodchild, 1884) |
| ⓘ Chalcocite Formula: Cu2S |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ Chenevixite Formula: Cu2Fe3+2(AsO4)2(OH)4 References: |
| ⓘ Chenite Formula: Pb4Cu(SO4)2(OH)6 |
| ⓘ 'Chlorite Group' |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ 'Columbite-(Fe)-Columbite-(Mn) Series' Description: Cooper & Stanley (1990): "Forms minute grains (exceptionally up to 180µm, but mostly < 30µm) in arsenopyrite, scheelite and carbonate minerals replacing wolframite. Mangano-columbite is the dominant end-member at Carrock (Beddoe-Stephens & Fortey, 1981). |
| ⓘ Columbite-(Mn) Formula: Mn2+Nb2O6 References: |
| ⓘ Formula: CaCu(AsO4)(OH) Locality: Brandy Gill Mine, Mungrisdale, Eden, Cumbria, England, UK - erroneously reported Habit: crystalline crust on quartz Colour: dark green Description: Cooper & Stanley (1990): "Specimens labelled conichalcite are preserved in the Russell and Kingsbury Collections, BM(NH), but Kingsbury seems later to have considered the mineral to be a calcian duftite ('calcioduftite') although the X-ray powder pattern was 'close to (but by no means identical with) that of conichalcite (Kingsbury & Hartley, MS). Conichalcite has been found intimately associated with bayldonite forming a dark green crystalline crust on quartz (det. BM(NH): XRD, B. Young, pers. comm.)." References: |
| ⓘ Connellite Formula: Cu19(SO4)(OH)32Cl4 · 3H2O References: |
| ⓘ Cordierite Formula: Mg2Al4Si5O18 References: |
| ⓘ Corkite Formula: PbFe3+3(PO4)(SO4)(OH)6 Localities: Colour: Yellow to Brown |
| ⓘ Corundum Formula: Al2O3 References: |
| ⓘ Cosalite Formula: Pb2Bi2S5 Localities: Habit: (tufts of) capillary fibres and (compact) fibrous patches Colour: steel grey; very dark grey with bluish or yellowish tarnish Description: Cooper & Stanley (1990): "Recently identified (by C.J. Stanley) in polished section, in association with bismuthinite, krupkaite, and bismuth tellurides." |
| ⓘ Covellite Formula: CuS Localities: Description: Replacing chalcopyrite (Thimmaiah, 1956). |
| ⓘ Crocoite ? Formula: PbCr6+O4 Localities: Description: Cooper & Stanley (1990): "A specimen, formerly part of the R.C. Walsh Collection, now in the King Collection (National Museum of Wales, Cardiff) is said to have originated in the Brandy Gill area. It is almost certainly incorrectly provenanced (R.J. King, pers. comm.)." |
| ⓘ Cubanite Formula: CuFe2S3 References: |
| ⓘ Cuprite Formula: Cu2O |
| ⓘ Descloizite ? Formula: PbZn(VO4)(OH) Colour: greenish brown, brown, reddish brown Description: Kingsbury reference. |
| ⓘ Devilline ? Formula: CaCu4(SO4)2(OH)6 · 3H2O Description: Cooper & Stanley (1990): "The only record is that of Van Den Berg (1985) who cannot now substantiate the record by specimen or reference (pers. comm., 1988). Requires confirmation." References: |
| ⓘ Djurleite Formula: Cu31S16 |
| ⓘ Dolomite Formula: CaMg(CO3)2 |
| ⓘ Dolomite var. Iron-bearing Dolomite Formula: Ca(Mg,Fe)(CO3)2 |
| ⓘ Duftite Formula: PbCu(AsO4)(OH) Localities: Habit: thin botryoidal coatings Colour: pale emerald green to deep moss green Description: occasionally as epimorphs/pseudomorphs after small mimetite crystals (Cooper & Stanley, 1990-1991) |
| ⓘ Duftite var. Calcio-duftite Formula: (Pb,Ca)CuAsO4(OH) Description: Cooper & Stanley (1990): Kingsbury & Hartley claimed that material they had collected resembled, but was not identical with duftite was actually an intermediate between duftite and conichalcite. They coined the term 'calcio-duftite' for this mineral on the basis of the intermediate nature of the x-ray powder spacings and a qualitative (spectrographic) analysis that showed significant calcium. Claringbull also mentioned the affinity of the x-ray pattern of Brandy Gill duftite with conichalcite and commented on the variation of refractive index within individual spherules of the mineral which, he suggested, resulted from a corresponding variation in composition with the core being richer in lead than the outer areas. |
| ⓘ Duftite var. Duftite-β Formula: PbCu(AsO4)(OH) Description: Cooper & Stanley (1990): "Most duftite from Brandy Gill appears to be β-duftite as defined by Guillemin (1956: 70), who re-examined Claringbull's (1951) x-ray data. Infra-red absorption spectrophotometry readily distinguishes α- and β-duftite and also shows the predominance of the latter at this locality (R.S.W. Braithwaite, pers. comm.)." |
| ⓘ 'Duftite-alpha' Formula: PbCu(AsO4)(OH) Habit: globular masses Description: Cooper & Stanley (1990): "a few specimens recently examined appear to be α-duftite which, at Brandy Gill, forms small globular masses on quartz (M.P. Cooper Collection, det. P.J. Dunn, Smithsonian Institution: XRD) or minute crystals with agardite-mixite (det. BM(NH): XRD, C.M. Leppington, pers. comm.)" |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ 'Feldspar Group' |
| ⓘ Ferrimolybdite Formula: Fe2(MoO4)3 · nH2O Localities: Habit: fibrous to powdery Colour: yellow |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F References: Finlayson, A. M. (1910) The Ore-bearing Pegmatites of Carrock Fell, and the Genetic Significance of Tungsten-ores. Geological Magazine, S. 5 Vol. 7 (1). 19-28 doi:10.1017/s0016756800132649(analysis of "apatite" from Carrock mine showing it to be a fluorapatite) |
| ⓘ Fluorite Formula: CaF2 Localities: Habit: sharp octahedra Colour: green-purple-colourless (zoned); pale green Description: Cooper & Stanley (1990): In 1987, sharp octahedral crystals of green to purple zoned crystals (< 6mm) were found in cavities in quartz with calcite and iridescent pyrite from recent workings on the Smith vein. [...] The fluorite octahedra have green cores with later purple and colourless zones, and covered areas to about 40 x 20 mm (D.R. Hacker Collection). On the opposite side of the same level, pale green unzoned octahedra have subsequently been found (D.I. Green, pers. comm.)." |
| ⓘ Galena Formula: PbS Localities: Reported from at least 9 localities in this region. Description: From an old working on an E-W lead-zinc vein. |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 |
| ⓘ Goethite Formula: Fe3+O(OH) Localities: Harding vein, Carrock Mine, Mungrisdale, Eden, Cumbria, England, UK Brandy Gill Mine, Mungrisdale, Eden, Cumbria, England, UK Arm O'Grain, Mungrisdale, Eden, Cumbria, England, UK Saddleback Old Mine, Mungrisdale, Eden, Cumbria, England, UK Carrock Mine, Mungrisdale, Eden, Cumbria, England, UK ? (more information) Description: Cooper & Stanley (1990): "R.J. King (pers. comm.) found a small sprig of gold on goethite-encrusted quartz in situ in the Harding vein working[...]" |
| ⓘ Graphite Formula: C |
| ⓘ Greenockite Formula: CdS |
| ⓘ 'Grünlingite' ? Localities: Description: Kingsbury reference. Kingsbury (1965): "For many years the bismuth telluride tetradymite (Bi2T2S) has been accepted as a British species, but this status has never been satisfactorily established. It was originally thought to occur in Brandy Gill, Carrock Fell, Cumberland, though in 1858 Greg and Lettsom had stated that the mineral appeared to differ much in composition from other tetradymites. The Carrock mineral was later regarded as a new species and was named grünlingite, but further investigations have shown that these specimens are not all identical and probably represent several varieties or phases of the allied mineral joséite, with compositions near Bi4TeS2: none of them, so far, have proved to be tetradymite." |
| ⓘ Gypsum Formula: CaSO4 · 2H2O Habit: crystalline crust on quartz Colour: white Description: In the BM(NH) Collection from the No. 3 level (Young, 1987). References: |
| ⓘ Hedleyite Formula: Bi7Te3 Description: grains up to 200µm in greisen in the BM(NH) collection |
| ⓘ Hedyphane Formula: Ca2Pb3(AsO4)3Cl Habit: club-shaped aggregates of prismatic crystals Colour: creamy Description: Cooper & Stanley (1990): "As club-shaped aggregates of creamy prismatic crystals to 2mm with duftite on quartz on a few specimens found in situ in the top west level in 1985 (det. BM(NH): XRD; R. Starkey, pers. comm., 1985). The first British record." |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ Hinsdalite Formula: PbAl3(PO4)(SO4)(OH)6 |
| ⓘ Hisingerite Formula: Fe3+2(Si2O5)(OH)4 · 2H2O Description: From the upper west level dump. References: |
| ⓘ Hollandite Formula: Ba(Mn4+6Mn3+2)O16 |
| ⓘ Formula: MnWO4 Locality: Carrock Mine, Mungrisdale, Eden, Cumbria, England, UK - erroneously reported Description: Kingsbury reference? References: |
| ⓘ Hydrocerussite Formula: Pb3(CO3)2(OH)2 |
| ⓘ Ilmenite Formula: Fe2+TiO3 |
| ⓘ Ingodite Formula: Bi2TeS References: Zav'yalov, E.N. and Begizov, V.D. (1981) Once more on the problem of grünlingite. Zapiski Vsesoyuznogo Mineralogicheskogo Obshchestva, 110, 633-635.[Mineralogical Abstracts, 33, 82M/3316] Zav'yalov, E.N. and Begizov, V.D. (1981) New bismuth mineral ingodite Bi2TeS. Zapiski Vsesoyuznogo Mineralogicheskogo Obshchestva: 110(5): 594-600.(Mineralogical Abstracts, 33, 82M/3350) |
| ⓘ Jamesonite Formula: Pb4FeSb6S14 Localities: Description: In a small quartz vein exposed by the side of the track below Coomb Height, just north-east of Wet Swine Gill [NY32103215](Fortey et al., 1984). |
| ⓘ Jarosite ? Formula: KFe3+3(SO4)2(OH)6 Localities: Description: Kingsbury reference. Kingsbury & Hartley (1958): "crusts of very small golden-yellow to brown crystals on white vein-quartz from the 'granitic' suite of veins; it is associated with pale yellowish-buff, fine-grained, earthy ferriferous alunite (B.M. 1956, 76; 1958, 43)." |
| ⓘ 'Joséite' Formula: Bi4TeS2 References: |
| ⓘ Joséite-A Formula: Bi4TeS2 References: Zav'yalov, E.N. and Begizov, V.D. (1981) Once more on the problem of grünlingite. Zapiski Vsesoyuznogo Mineralogicheskogo Obshchestva, 110, 633-635.[Mineralogical Abstracts, 33, 82M/3316] Zav'yalov, E.N. and Begizov, V.D. (1981) New bismuth mineral ingodite Bi2TeS. Zapiski Vsesoyuznogo Mineralogicheskogo Obshchestva: 110(5): 594-600.(Mineralogical Abstracts, 33, 82M/3350) |
| ⓘ Joséite-B Formula: Bi4Te2S Description: Cooper & Stanley (1990): Specimens in the BM(NH) labelled tetradymite and grünlingite contain joséite-B (among other species). References: |
| ⓘ Krupkaite Formula: CuPbBi3S6 Description: Cooper & Stanley (1990): "Electron microprobe analyses (by CJS) of a mineral replacing bismuthinite in a telluride-rich specimen (BM(NH)) give a formula consistent with that of krupkaite. Grains are minute (30-60µm)." |
| ⓘ Langite Formula: Cu4(SO4)(OH)6 · 2H2O |
| ⓘ Leadhillite Formula: Pb4(CO3)2(SO4)(OH)2 Localities: Habit: poorly crystalline aggregates Colour: brownish Description: Cooper & Stanley (1990): "Minute, poorly crystalline brownish aggregates on quartz have been identified (BM(NH): XRD) as leadhillite-susannite (B. Yates Collection)." |
| ⓘ Linarite Formula: PbCu(SO4)(OH)2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Formula: Cu3(MoO4)2(OH)2 Locality: Brandy Gill Mine, Mungrisdale, Eden, Cumbria, England, UK - erroneously reported Habit: bladed Colour: dark olive-green Description: Kingsbury reference. Cooper & Stanley (1990): "The first (and only) British occurrence (Kingsbury & Hartley, 1955). The mineral was found in specimens from the dumps of the eastern level as small (< 1.5mm), dark olive-green bladed crystals on a yellowish-green crystalline mineral (which 'gives [an x-ray powder] pattern and spacings very close to those of the well-known pale blue Cumberland plumbogummite' op. cit.: 724.) It was found in cavities in granophyre presumed to be from the vein wall. Only a few specimens were obtained (Kingsbury and Russell Collections, BM(NH)) and, despite the exertions of a generation of collectors, none has been found since." |
| ⓘ Lithiophorite Formula: (Al,Li)MnO2(OH)2 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Manganite Formula: Mn3+O(OH) |
| ⓘ Marcasite Formula: FeS2 References: |
| ⓘ 'Mica Group' Localities: Colour: yellow |
| ⓘ Microcline Formula: K(AlSi3O8) Localities: Habit: drusy crystalline aggregates to c. 10mm Colour: white Description: From the recent workings on the adit level on the Smith vein (D.R. Hacker, pers. comm., det. University of Manchester Institute of Science and Technology (UMIST): IR.) |
| ⓘ Mimetite Formula: Pb5(AsO4)3Cl |
| ⓘ 'Mimetite-Pyromorphite Series' |
| ⓘ Molybdenite Formula: MoS2 Localities: Harding vein, Carrock Mine, Mungrisdale, Eden, Cumbria, England, UK Emerson vein, Carrock Mine, Mungrisdale, Eden, Cumbria, England, UK Carrock Mine, Mungrisdale, Eden, Cumbria, England, UK Brandy Gill Mine, Mungrisdale, Eden, Cumbria, England, UK Grains Gill, Mungrisdale, Eden, Cumbria, England, UK ? (more information) Description: Fortey (1978) describes an unusual occurrence of molybdenite from the Harding vein as 'thin-walled spheres of the order of 1 mm in diameter, embedded in the margins of arsenopyrite patches and filled with Bi-sulphides. May involve the development of droplets of a Bi-rich liquid." |
| ⓘ Mottramite Formula: PbCu(VO4)(OH) Localities: Habit: 'rice grains' Colour: brownish black Description: Det. BM(NH): XRD (D.R. Middleton, pers. comm.). |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Muscovite var. Gilbertite Formula: KAl2(AlSi3O10)(OH)2 References: |
| ⓘ Muscovite var. Illite Formula: K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Native Bismuth Formula: Bi Localities: Habit: small cleavable masses Description: Cooper & Stanley (1990): "the 'bismuth ochre' reported from 'Brandy Gill' as an associate of bismuth (Goodchild, 1882: 104) may have been bismite or bismutite." |
| ⓘ Native Gold Formula: Au Localities: Description: Cooper & Stanley (1990): "R.J. King (pers. comm.) found a small sprig of gold on goethite-encrusted quartz in situ in the Harding vein working[...]" |
| ⓘ Olivenite ? Formula: Cu2(AsO4)(OH) Habit: tufts of minute needles Colour: very pale green Description: Kingsbury reference. Cooper & Stanley (1990): "Small tufts of minute, very pale green needles in cavities in quartz from the dumps below the Harding vein (Kingsbury & Hartley, MS)." References: |
| ⓘ Orthoclase Formula: K(AlSi3O8) Localities: Description: Cooper & Stanley (1990): "'Present in vein margins where they cut altered gabbro of the Carrock Fell Complex' (Fortey, 1980)." |
| ⓘ Pectolite Formula: NaCa2Si3O8(OH) |
| ⓘ Petitjeanite Formula: Bi3(PO4)2O(OH) |
| ⓘ Pharmacosiderite Formula: KFe3+4(AsO4)3(OH)4 · 6-7H2O Localities: Description: T.F. Bridges (pers. comm., 1984). |
| ⓘ Pitticite ? Formula: (Fe, AsO4, H2O) (?) Habit: resinous Colour: dark reddish brown Description: Kingsbury reference. References: |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ Plumbogummite Formula: PbAl3(PO4)(PO3OH)(OH)6 |
| ⓘ Plumbojarosite ? Formula: Pb0.5Fe3+3(SO4)2(OH)6 |
| ⓘ Powellite Formula: Ca(MoO4) Description: The first British occurrence (Hartley, 1984). References: |
| ⓘ Preisingerite Formula: Bi3(AsO4)2O(OH) |
| ⓘ Pseudomalachite Formula: Cu5(PO4)2(OH)4 |
| ⓘ 'Psilomelane' |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 6 localities in this region. Colour: iridescent |
| ⓘ Pyrolusite Formula: Mn4+O2 |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl Localities: Reported from at least 6 localities in this region. Colour: pale green |
| ⓘ 'Pyroxene Group' Formula: ADSi2O6 |
| ⓘ Pyrrhotite Formula: Fe1-xS |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 9 localities in this region. |
| ⓘ Quartz var. Rock Crystal Formula: SiO2 |
| ⓘ Raspite Formula: Pb(WO4) |
| ⓘ Rhodochrosite ? Formula: MnCO3 Description: Cooper & Stanley (1990): "Listed by Fortey (1978) but Fortey & Bland (1979) state 'rhodochrosite may be present but has not yet been located by the present writer.' The occurrence is doubtful." References: |
| ⓘ Rooseveltite Formula: Bi(AsO4) |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Scheelite Formula: Ca(WO4) Localities: Carrock Mine, Mungrisdale, Eden, Cumbria, England, UK Smith vein, Carrock Mine, Mungrisdale, Eden, Cumbria, England, UK Brandy Gill Mine, Mungrisdale, Eden, Cumbria, England, UK Harding vein, Carrock Mine, Mungrisdale, Eden, Cumbria, England, UK ? (more information) Grains Gill, Mungrisdale, Eden, Cumbria, England, UK ? (more information) Colour: colourless through wine yellow to clove brown |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Description: Cooper & Stanley (1990): "From the flank of Coomb Height (Davidson & Thomson, 1951: 144) schorl 'about 1/4 mile [0.4km] east of Burdle Gill. In a quartz vein with jamesonite north-east of Wet Swine Gill (Fortey et al., 1984)." References: |
| ⓘ Scorodite Formula: Fe3+AsO4 · 2H2O Localities: Description: From a quartz vein just downstream of the waterfall at the foot of Brandy Gill as an alteration product of arsenopyrite. |
| ⓘ Scotlandite Formula: PbSO3 |
| ⓘ Siderite Formula: FeCO3 Description: Cooper & Stanley (1990: "From an unspecified site ('the only locality in the Lake District') with galena and cerussite (Wright, in Jenkinson, 1875: lxxxi)." References: |
| ⓘ Smithsonite Formula: ZnCO3 |
| ⓘ Sphalerite Formula: ZnS Localities: Bannerdale Graphite Mine, Bannerdale, Mungrisdale, Eden, Cumbria, England, UK Harding vein, Carrock Mine, Mungrisdale, Eden, Cumbria, England, UK Carrock Mine, Mungrisdale, Eden, Cumbria, England, UK Grains Gill, Mungrisdale, Eden, Cumbria, England, UK ? (more information) Brandy Gill Mine, Mungrisdale, Eden, Cumbria, England, UK ? (more information) |
| ⓘ Stibiconite Formula: Sb3+Sb5+2O6(OH) Colour: light grey Description: Cooper & Stanley (1990): "Stibiconite was tentatively identified as light grey patches in a jamesonite-bearing vein at the foot of Coomb Height to the NE of Wet Swine Gill (Fortey et al., 1984)." References: |
| ⓘ Stibnite Formula: Sb2S3 |
| ⓘ Stilbite-Ca ? Formula: NaCa4(Si27Al9)O72 · 28H2O Description: Erroneous entry for stibnite (Hartley, 1984) (Hartley, pers. comm., 1988). References: |
| ⓘ Stolzite Formula: Pb(WO4) Localities: Habit: very thin incomplete plates Colour: creamy Description: Cooper & Stanley (1990): "Stolzite has recently been found as very thin, incomplete, creamy plates in a gossany quartz matrix from the main dump; it is not distinctive in appearance and may easily be overlooked (J.G. Wilson, pers. comm., 1987, det. BM(NH): XRD)." |
| ⓘ Strengite Formula: FePO4 · 2H2O Localities: Habit: glassy spherules Colour: brown Description: Cooper & Stanley (1990): "As minute, glassy, brown spherules on wolframite from an exposure on the Harding vein (det. BM(NH): XRD, D. McCallum, pers. comm.)." |
| ⓘ Susannite Formula: Pb4(CO3)2(SO4)(OH)2 Description: Cooper & Stanley (1990) list it as "leadhillite-susannite" from the B. Yates Collection (det. BM(NH): XRD). |
| ⓘ Sylvanite ? Formula: AgAuTe4 Description: Cooper & Stanley (1990): "The presence of sylvanite in 'grünlingite' is mentioned in a letter of 1943 from W. Hemingway to Anthony Wilson (leaseholder of the mine) preserved in the Cumbria Record Office, Carlisle (DX/955/3v.). No other reference can be found." |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 |
| ⓘ Tetradymite ? Formula: Bi2Te2S Description: Cooper & Stanley (1990): "Specimens in the BM(NH) recently examined by CJS using optical and electron microprobe techniques show that those [specimens] labelled tetradymite contain mostly ingodite and joséite-B. [...] However, Clarke (1974) records an analysis (EPMA) of a Carrock mine sample that corresponds to tetradymite. Requires confirmation." References: |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S Description: As inclusions in iron-rich sphalerite (Thimmaiah, 1956). References: |
| ⓘ Titanite Formula: CaTiO(SiO4) |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z Localities: Reported from at least 7 localities in this region. |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 Localities: Description: Cooper & Stanley (1990): "'Sparingly in a fibrous form, as an alteration product, on metamorphosed diabase from the Harding vein' (Davidson & Thomson, 1951: 143)." |
| ⓘ Tungstite Formula: WO3 · H2O Habit: powdery Colour: yellow Description: alteration product of wolframite. References: Finlayson, A. M. (1910) The Ore-bearing Pegmatites of Carrock Fell, and the Genetic Significance of Tungsten-ores. Geological Magazine, S. 5 Vol. 7 (1). 19-28 doi:10.1017/s0016756800132649 |
| ⓘ Uraninite Formula: UO2 Description: Cooper & Stanley (1990): "Found as minute grains (0.01 - 0.20mm) in the greisen wall-rock of a vein 'immediately west of the former smithy serving Carrock Mine'. Since radioactivity was restricted to the vicinity of the vein, the authors (Dawson & Harrison, 1966) suggested that the uraninite was associated with the vein mineralization." References: |
| ⓘ Vanadinite Formula: Pb5(VO4)3Cl Localities: Habit: short-prismatic or barrel-shaped crystals or globular aggregates; radiating fibrous crystals Colour: cream to grey; pale buff to reddish brown Description: Cooper & Stanley (1990 and 1991) mention (apart from the Kingsbury finds) a single specimen collected by T. Wolloxall from Brandy Gill Lead mine which has been identified by XRD at the BM(NH). |
| ⓘ Witherite Formula: BaCO3 |
| ⓘ 'Wolframite Group' |
| ⓘ Wulfenite Formula: Pb(MoO4) Localities: Reported from at least 6 localities in this region. |
| ⓘ Xenotime-(Y) Formula: Y(PO4) |
| ⓘ Zinkenite ? Formula: Pb9Sb22S42 Localities: Habit: minute acicular crystals or fibres, tufts or wool-like aggregates, or small fibrous patches. Colour: dark grey Description: Kingsbury reference. |
| ⓘ Zircon Formula: Zr(SiO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Gold | 1.AA.05 | Au |
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| ⓘ | Graphite | 1.CB.05a | C |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Djurleite | 2.BA.05 | Cu31S16 |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Greenockite | 2.CB.45 | CdS |
| ⓘ | Cubanite | 2.CB.55a | CuFe2S3 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Hedleyite | 2.DC.05 | Bi7Te3 |
| ⓘ | Ingodite | 2.DC.05 | Bi2TeS |
| ⓘ | 'Joséite' | 2.DC.05 | Bi4TeS2 |
| ⓘ | Joséite-A | 2.DC.05 | Bi4TeS2 |
| ⓘ | Joséite-B | 2.DC.05 | Bi4Te2S |
| ⓘ | Tetradymite ? | 2.DC.05 | Bi2Te2S |
| ⓘ | Sylvanite ? | 2.EA.05 | AgAuTe4 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | Aikinite ? | 2.HB.05a | CuPbBiS3 |
| ⓘ | Krupkaite | 2.HB.05a | CuPbBi3S6 |
| ⓘ | Jamesonite | 2.HB.15 | Pb4FeSb6S14 |
| ⓘ | Boulangerite ? | 2.HC.15 | Pb5Sb4S11 |
| ⓘ | Cosalite | 2.JB.10 | Pb2Bi2S5 |
| ⓘ | Zinkenite ? | 2.JB.35a | Pb9Sb22S42 |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| ⓘ | Connellite | 3.DA.25 | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | Cuprite | 4.AA.10 | Cu2O |
| ⓘ | Corundum | 4.CB.05 | Al2O3 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Bismite | 4.CB.60 | Bi2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Rock Crystal | 4.DA.05 | SiO2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Hübnerite ? | 4.DB.30 | MnWO4 |
| ⓘ | 'Wolframite Group' | 4.DB.30 va | |
| ⓘ | Columbite-(Mn) | 4.DB.35 | Mn2+Nb2O6 |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Brookite | 4.DD.10 | TiO2 |
| ⓘ | Raspite | 4.DG.20 | Pb(WO4) |
| ⓘ | Bindheimite | 4.DH.20 | Pb2Sb2O6O |
| ⓘ | Stibiconite | 4.DH.20 | Sb3+Sb5+2O6(OH) |
| ⓘ | Hollandite | 4.DK.05a | Ba(Mn4+6Mn3+2)O16 |
| ⓘ | Uraninite | 4.DL.05 | UO2 |
| ⓘ | Manganite | 4.FD.15 | Mn3+O(OH) |
| ⓘ | Lithiophorite | 4.FE.25 | (Al,Li)MnO2(OH)2 |
| ⓘ | Tungstite | 4.FJ.10 | WO3 · H2O |
| ⓘ | Scotlandite | 4.JE.20 | PbSO3 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Rhodochrosite ? | 5.AB.05 | MnCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Smithsonite | 5.AB.05 | ZnCO3 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | var. Iron-bearing Dolomite | 5.AB.10 | Ca(Mg,Fe)(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Witherite | 5.AB.15 | BaCO3 |
| ⓘ | Azurite ? | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Hydrocerussite | 5.BE.10 | Pb3(CO3)2(OH)2 |
| ⓘ | Bismutite | 5.BE.25 | (BiO)2CO3 |
| ⓘ | Leadhillite | 5.BF.40 | Pb4(CO3)2(SO4)(OH)2 |
| ⓘ | Susannite | 5.BF.40 | Pb4(CO3)2(SO4)(OH)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Alunite ? | 7.BC.10 | KAl3(SO4)2(OH)6 |
| ⓘ | Beaverite-(Cu) ? | 7.BC.10 | Pb(Fe3+2Cu)(SO4)2(OH)6 |
| ⓘ | Jarosite ? | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Plumbojarosite ? | 7.BC.10 | Pb0.5Fe3+3(SO4)2(OH)6 |
| ⓘ | Caledonite | 7.BC.50 | Pb5Cu2(SO4)3(CO3)(OH)6 |
| ⓘ | Linarite | 7.BC.65 | PbCu(SO4)(OH)2 |
| ⓘ | Chenite | 7.BC.70 | Pb4Cu(SO4)2(OH)6 |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Langite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Devilline ? | 7.DD.30 | CaCu4(SO4)2(OH)6 · 3H2O |
| ⓘ | Crocoite ? | 7.FA.20 | PbCr6+O4 |
| ⓘ | Powellite | 7.GA.05 | Ca(MoO4) |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| ⓘ | Stolzite | 7.GA.05 | Pb(WO4) |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| ⓘ | Lindgrenite ? | 7.GB.05 | Cu3(MoO4)2(OH)2 |
| ⓘ | Ferrimolybdite | 7.GB.30 | Fe2(MoO4)3 · nH2O |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Xenotime-(Y) | 8.AD.35 | Y(PO4) |
| ⓘ | Rooseveltite | 8.AD.50 | Bi(AsO4) |
| ⓘ | Olivenite ? | 8.BB.30 | Cu2(AsO4)(OH) |
| ⓘ | Pseudomalachite | 8.BD.05 | Cu5(PO4)2(OH)4 |
| ⓘ | Carminite | 8.BH.30 | PbFe3+2(AsO4)2(OH)2 |
| ⓘ | Duftite var. Calcio-duftite | 8.BH.35 | (Pb,Ca)CuAsO4(OH) |
| ⓘ | Conichalcite ? | 8.BH.35 | CaCu(AsO4)(OH) |
| ⓘ | Duftite | 8.BH.35 | PbCu(AsO4)(OH) |
| ⓘ | 'Duftite-alpha' | 8.BH.35 | PbCu(AsO4)(OH) |
| ⓘ | Duftite var. Duftite-β | 8.BH.35 | PbCu(AsO4)(OH) |
| ⓘ | Descloizite ? | 8.BH.40 | PbZn(VO4)(OH) |
| ⓘ | Mottramite | 8.BH.40 | PbCu(VO4)(OH) |
| ⓘ | Bayldonite | 8.BH.45 | PbCu3(AsO4)2(OH)2 |
| ⓘ | Beudantite | 8.BL.05 | PbFe3+3(AsO4)(SO4)(OH)6 |
| ⓘ | Corkite | 8.BL.05 | PbFe3+3(PO4)(SO4)(OH)6 |
| ⓘ | Hinsdalite | 8.BL.05 | PbAl3(PO4)(SO4)(OH)6 |
| ⓘ | Plumbogummite | 8.BL.10 | PbAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Hedyphane | 8.BN.05 | Ca2Pb3(AsO4)3Cl |
| ⓘ | Mimetite | 8.BN.05 | Pb5(AsO4)3Cl |
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Vanadinite | 8.BN.05 | Pb5(VO4)3Cl |
| ⓘ | Preisingerite | 8.BO.10 | Bi3(AsO4)2O(OH) |
| ⓘ | Petitjeanite | 8.BO.10 | Bi3(PO4)2O(OH) |
| ⓘ | Scorodite | 8.CD.10 | Fe3+AsO4 · 2H2O |
| ⓘ | Strengite | 8.CD.10 | FePO4 · 2H2O |
| ⓘ | Pitticite ? | 8.DB.05 | (Fe, AsO4, H2O) (?) |
| ⓘ | Chenevixite | 8.DD.05 | Cu2Fe3+2(AsO4)2(OH)4 |
| ⓘ | Arseniosiderite ? | 8.DH.30 | Ca2Fe3+3(AsO4)3O2 · 3H2O |
| ⓘ | Pharmacosiderite | 8.DK.10 | KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| ⓘ | Agardite-(La) | 8.DL.15 | LaCu6(AsO4)3(OH)6 · 3H2O |
| ⓘ | Betpakdalite-CaMg | 8.DM. | [Ca2(H2O)17Mg(H2O)6][Mo8As2Fe3+3O36(OH)] |
| Group 9 - Silicates | |||
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | var. Chiastolite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Beryl ? | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Cordierite | 9.CJ.10 | Mg2Al4Si5O18 |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Carpholite ? | 9.DB.05 | Mn2+Al2(Si2O6)(OH)4 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Pectolite | 9.DG.05 | NaCa2Si3O8(OH) |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Muscovite var. Gilbertite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | var. Illite | 9.EC.15 | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Hisingerite | 9.ED.10 | Fe3+2(Si2O5)(OH)4 · 2H2O |
| ⓘ | Allophane | 9.ED.20 | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Stilbite-Ca ? | 9.GE.10 | NaCa4(Si27Al9)O72 · 28H2O |
| Unclassified | |||
| ⓘ | 'Agardite' | - | |
| ⓘ | 'Amphibole Supergroup' | - | AB2C5(T8O22)W2 |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Bismuth Ochre' | - | |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Psilomelane' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Mica Group' | - | |
| ⓘ | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
| ⓘ | 'Apatite Group' | - | |
| ⓘ | 'Mimetite-Pyromorphite Series' | - | |
| ⓘ | 'Grünlingite' ? | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Agardite-(La) | LaCu6(AsO4)3(OH)6 · 3H2O |
| H | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| H | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| H | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| H | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| H | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Duftite var. Calcio-duftite | (Pb,Ca)CuAsO4(OH) |
| H | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| H | ⓘ Carminite | PbFe23+(AsO4)2(OH)2 |
| H | ⓘ Carpholite | Mn2+Al2(Si2O6)(OH)4 |
| H | ⓘ Chenevixite | Cu2Fe23+(AsO4)2(OH)4 |
| H | ⓘ Chenite | Pb4Cu(SO4)2(OH)6 |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| H | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| H | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| H | ⓘ Descloizite | PbZn(VO4)(OH) |
| H | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| H | ⓘ Duftite | PbCu(AsO4)(OH) |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| H | ⓘ Muscovite var. Gilbertite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Hinsdalite | PbAl3(PO4)(SO4)(OH)6 |
| H | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| H | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| H | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| H | ⓘ Linarite | PbCu(SO4)(OH)2 |
| H | ⓘ Lindgrenite | Cu3(MoO4)2(OH)2 |
| H | ⓘ Lithiophorite | (Al,Li)MnO2(OH)2 |
| H | ⓘ Manganite | Mn3+O(OH) |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Mottramite | PbCu(VO4)(OH) |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Olivenite | Cu2(AsO4)(OH) |
| H | ⓘ Pectolite | NaCa2Si3O8(OH) |
| H | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| H | ⓘ Pitticite | (Fe, AsO4, H2O) (?) |
| H | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| H | ⓘ Preisingerite | Bi3(AsO4)2O(OH) |
| H | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| H | ⓘ Petitjeanite | Bi3(PO4)2O(OH) |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| H | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| H | ⓘ Strengite | FePO4 · 2H2O |
| H | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Tungstite | WO3 · H2O |
| H | ⓘ Duftite-alpha | PbCu(AsO4)(OH) |
| H | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Duftite var. Duftite-β | PbCu(AsO4)(OH) |
| H | ⓘ Betpakdalite-CaMg | [Ca2(H2O)17Mg(H2O)6][Mo8As2Fe33+O36(OH)] |
| Li | Lithium | |
| Li | ⓘ Lithiophorite | (Al,Li)MnO2(OH)2 |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Bismutite | (BiO)2CO3 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Graphite | C |
| C | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| C | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Rhodochrosite | MnCO3 |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Smithsonite | ZnCO3 |
| C | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| C | ⓘ Witherite | BaCO3 |
| C | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Agardite-(La) | LaCu6(AsO4)3(OH)6 · 3H2O |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| O | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| O | ⓘ Amphibole Supergroup | AB2C5(T8O22)W2 |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| O | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| O | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| O | ⓘ Bindheimite | Pb2Sb2O6O |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Bismite | Bi2O3 |
| O | ⓘ Bismutite | (BiO)2CO3 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Brookite | TiO2 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Duftite var. Calcio-duftite | (Pb,Ca)CuAsO4(OH) |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| O | ⓘ Carminite | PbFe23+(AsO4)2(OH)2 |
| O | ⓘ Carpholite | Mn2+Al2(Si2O6)(OH)4 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Chenevixite | Cu2Fe23+(AsO4)2(OH)4 |
| O | ⓘ Chenite | Pb4Cu(SO4)2(OH)6 |
| O | ⓘ Andalusite var. Chiastolite | Al2(SiO4)O |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| O | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| O | ⓘ Cordierite | Mg2Al4Si5O18 |
| O | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| O | ⓘ Corundum | Al2O3 |
| O | ⓘ Crocoite | PbCr6+O4 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Descloizite | PbZn(VO4)(OH) |
| O | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Duftite | PbCu(AsO4)(OH) |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Muscovite var. Gilbertite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hedyphane | Ca2Pb3(AsO4)3Cl |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hinsdalite | PbAl3(PO4)(SO4)(OH)6 |
| O | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| O | ⓘ Hollandite | Ba(Mn64+Mn23+)O16 |
| O | ⓘ Hübnerite | MnWO4 |
| O | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| O | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| O | ⓘ Linarite | PbCu(SO4)(OH)2 |
| O | ⓘ Lindgrenite | Cu3(MoO4)2(OH)2 |
| O | ⓘ Lithiophorite | (Al,Li)MnO2(OH)2 |
| O | ⓘ Manganite | Mn3+O(OH) |
| O | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Mimetite | Pb5(AsO4)3Cl |
| O | ⓘ Mottramite | PbCu(VO4)(OH) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Olivenite | Cu2(AsO4)(OH) |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Pectolite | NaCa2Si3O8(OH) |
| O | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| O | ⓘ Pitticite | (Fe, AsO4, H2O) (?) |
| O | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| O | ⓘ Powellite | Ca(MoO4) |
| O | ⓘ Preisingerite | Bi3(AsO4)2O(OH) |
| O | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Petitjeanite | Bi3(PO4)2O(OH) |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Raspite | Pb(WO4) |
| O | ⓘ Rhodochrosite | MnCO3 |
| O | ⓘ Rooseveltite | Bi(AsO4) |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| O | ⓘ Scotlandite | PbSO3 |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Smithsonite | ZnCO3 |
| O | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| O | ⓘ Stolzite | Pb(WO4) |
| O | ⓘ Strengite | FePO4 · 2H2O |
| O | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Tungstite | WO3 · H2O |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Vanadinite | Pb5(VO4)3Cl |
| O | ⓘ Witherite | BaCO3 |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Xenotime-(Y) | Y(PO4) |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Duftite-alpha | PbCu(AsO4)(OH) |
| O | ⓘ Quartz var. Rock Crystal | SiO2 |
| O | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| O | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Pyroxene Group | ADSi2O6 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Duftite var. Duftite-β | PbCu(AsO4)(OH) |
| O | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| O | ⓘ Apatite | Ca5(PO4)3A |
| O | ⓘ Mimetite-Pyromorphite Series | |
| O | ⓘ Betpakdalite-CaMg | [Ca2(H2O)17Mg(H2O)6][Mo8As2Fe33+O36(OH)] |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Pectolite | NaCa2Si3O8(OH) |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Cordierite | Mg2Al4Si5O18 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Mg | ⓘ Betpakdalite-CaMg | [Ca2(H2O)17Mg(H2O)6][Mo8As2Fe33+O36(OH)] |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Al | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Carpholite | Mn2+Al2(Si2O6)(OH)4 |
| Al | ⓘ Andalusite var. Chiastolite | Al2(SiO4)O |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Cordierite | Mg2Al4Si5O18 |
| Al | ⓘ Corundum | Al2O3 |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Muscovite var. Gilbertite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Hinsdalite | PbAl3(PO4)(SO4)(OH)6 |
| Al | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Al | ⓘ Lithiophorite | (Al,Li)MnO2(OH)2 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Carpholite | Mn2+Al2(Si2O6)(OH)4 |
| Si | ⓘ Andalusite var. Chiastolite | Al2(SiO4)O |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Cordierite | Mg2Al4Si5O18 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Muscovite var. Gilbertite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| Si | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Pectolite | NaCa2Si3O8(OH) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Quartz var. Rock Crystal | SiO2 |
| Si | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Pyroxene Group | ADSi2O6 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| P | Phosphorus | |
| P | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Hinsdalite | PbAl3(PO4)(SO4)(OH)6 |
| P | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Petitjeanite | Bi3(PO4)2O(OH) |
| P | ⓘ Strengite | FePO4 · 2H2O |
| P | ⓘ Xenotime-(Y) | Y(PO4) |
| P | ⓘ Apatite | Ca5(PO4)3A |
| P | ⓘ Mimetite-Pyromorphite Series | |
| S | Sulfur | |
| S | ⓘ Aikinite | CuPbBiS3 |
| S | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| S | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Boulangerite | Pb5Sb4S11 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Chenite | Pb4Cu(SO4)2(OH)6 |
| S | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| S | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| S | ⓘ Cosalite | Pb2Bi2S5 |
| S | ⓘ Covellite | CuS |
| S | ⓘ Cubanite | CuFe2S3 |
| S | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| S | ⓘ Djurleite | Cu31S16 |
| S | ⓘ Galena | PbS |
| S | ⓘ Greenockite | CdS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Hinsdalite | PbAl3(PO4)(SO4)(OH)6 |
| S | ⓘ Ingodite | Bi2TeS |
| S | ⓘ Jamesonite | Pb4FeSb6S14 |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Joséite | Bi4TeS2 |
| S | ⓘ Joséite-A | Bi4TeS2 |
| S | ⓘ Joséite-B | Bi4Te2S |
| S | ⓘ Krupkaite | CuPbBi3S6 |
| S | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| S | ⓘ Linarite | PbCu(SO4)(OH)2 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Scotlandite | PbSO3 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| S | ⓘ Tetradymite | Bi2Te2S |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Zinkenite | Pb9Sb22S42 |
| Cl | Chlorine | |
| Cl | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Cl | ⓘ Hedyphane | Ca2Pb3(AsO4)3Cl |
| Cl | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Cl | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Cl | ⓘ Mimetite-Pyromorphite Series | |
| K | Potassium | |
| K | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Muscovite var. Gilbertite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| Ca | ⓘ Duftite var. Calcio-duftite | (Pb,Ca)CuAsO4(OH) |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| Ca | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Hedyphane | Ca2Pb3(AsO4)3Cl |
| Ca | ⓘ Pectolite | NaCa2Si3O8(OH) |
| Ca | ⓘ Powellite | Ca(MoO4) |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ca | ⓘ Betpakdalite-CaMg | [Ca2(H2O)17Mg(H2O)6][Mo8As2Fe33+O36(OH)] |
| Ti | Titanium | |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Brookite | TiO2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| V | Vanadium | |
| V | ⓘ Descloizite | PbZn(VO4)(OH) |
| V | ⓘ Mottramite | PbCu(VO4)(OH) |
| V | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Cr | Chromium | |
| Cr | ⓘ Crocoite | PbCr6+O4 |
| Mn | Manganese | |
| Mn | ⓘ Carpholite | Mn2+Al2(Si2O6)(OH)4 |
| Mn | ⓘ Hollandite | Ba(Mn64+Mn23+)O16 |
| Mn | ⓘ Hübnerite | MnWO4 |
| Mn | ⓘ Lithiophorite | (Al,Li)MnO2(OH)2 |
| Mn | ⓘ Manganite | Mn3+O(OH) |
| Mn | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Rhodochrosite | MnCO3 |
| Mn | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| Fe | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| Fe | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Carminite | PbFe23+(AsO4)2(OH)2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chenevixite | Cu2Fe23+(AsO4)2(OH)4 |
| Fe | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| Fe | ⓘ Cubanite | CuFe2S3 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Jamesonite | Pb4FeSb6S14 |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| Fe | ⓘ Pitticite | (Fe, AsO4, H2O) (?) |
| Fe | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Strengite | FePO4 · 2H2O |
| Fe | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Fe | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Fe | ⓘ Betpakdalite-CaMg | [Ca2(H2O)17Mg(H2O)6][Mo8As2Fe33+O36(OH)] |
| Cu | Copper | |
| Cu | ⓘ Agardite-(La) | LaCu6(AsO4)3(OH)6 · 3H2O |
| Cu | ⓘ Aikinite | CuPbBiS3 |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| Cu | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Duftite var. Calcio-duftite | (Pb,Ca)CuAsO4(OH) |
| Cu | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Chenevixite | Cu2Fe23+(AsO4)2(OH)4 |
| Cu | ⓘ Chenite | Pb4Cu(SO4)2(OH)6 |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| Cu | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cubanite | CuFe2S3 |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Cu | ⓘ Djurleite | Cu31S16 |
| Cu | ⓘ Duftite | PbCu(AsO4)(OH) |
| Cu | ⓘ Krupkaite | CuPbBi3S6 |
| Cu | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Cu | ⓘ Lindgrenite | Cu3(MoO4)2(OH)2 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Mottramite | PbCu(VO4)(OH) |
| Cu | ⓘ Olivenite | Cu2(AsO4)(OH) |
| Cu | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Duftite-alpha | PbCu(AsO4)(OH) |
| Cu | ⓘ Duftite var. Duftite-β | PbCu(AsO4)(OH) |
| Zn | Zinc | |
| Zn | ⓘ Descloizite | PbZn(VO4)(OH) |
| Zn | ⓘ Smithsonite | ZnCO3 |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Agardite-(La) | LaCu6(AsO4)3(OH)6 · 3H2O |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| As | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| As | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| As | ⓘ Duftite var. Calcio-duftite | (Pb,Ca)CuAsO4(OH) |
| As | ⓘ Carminite | PbFe23+(AsO4)2(OH)2 |
| As | ⓘ Chenevixite | Cu2Fe23+(AsO4)2(OH)4 |
| As | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| As | ⓘ Duftite | PbCu(AsO4)(OH) |
| As | ⓘ Hedyphane | Ca2Pb3(AsO4)3Cl |
| As | ⓘ Mimetite | Pb5(AsO4)3Cl |
| As | ⓘ Olivenite | Cu2(AsO4)(OH) |
| As | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| As | ⓘ Pitticite | (Fe, AsO4, H2O) (?) |
| As | ⓘ Preisingerite | Bi3(AsO4)2O(OH) |
| As | ⓘ Rooseveltite | Bi(AsO4) |
| As | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| As | ⓘ Duftite-alpha | PbCu(AsO4)(OH) |
| As | ⓘ Duftite var. Duftite-β | PbCu(AsO4)(OH) |
| As | ⓘ Mimetite-Pyromorphite Series | |
| As | ⓘ Betpakdalite-CaMg | [Ca2(H2O)17Mg(H2O)6][Mo8As2Fe33+O36(OH)] |
| Y | Yttrium | |
| Y | ⓘ Xenotime-(Y) | Y(PO4) |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| Nb | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Mo | Molybdenum | |
| Mo | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| Mo | ⓘ Lindgrenite | Cu3(MoO4)2(OH)2 |
| Mo | ⓘ Molybdenite | MoS2 |
| Mo | ⓘ Powellite | Ca(MoO4) |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Mo | ⓘ Betpakdalite-CaMg | [Ca2(H2O)17Mg(H2O)6][Mo8As2Fe33+O36(OH)] |
| Ag | Silver | |
| Ag | ⓘ Sylvanite | AgAuTe4 |
| Cd | Cadmium | |
| Cd | ⓘ Greenockite | CdS |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sb | Antimony | |
| Sb | ⓘ Bindheimite | Pb2Sb2O6O |
| Sb | ⓘ Boulangerite | Pb5Sb4S11 |
| Sb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Sb | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Sb | ⓘ Zinkenite | Pb9Sb22S42 |
| Te | Tellurium | |
| Te | ⓘ Hedleyite | Bi7Te3 |
| Te | ⓘ Ingodite | Bi2TeS |
| Te | ⓘ Joséite | Bi4TeS2 |
| Te | ⓘ Joséite-A | Bi4TeS2 |
| Te | ⓘ Joséite-B | Bi4Te2S |
| Te | ⓘ Sylvanite | AgAuTe4 |
| Te | ⓘ Tetradymite | Bi2Te2S |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Hollandite | Ba(Mn64+Mn23+)O16 |
| Ba | ⓘ Witherite | BaCO3 |
| La | Lanthanum | |
| La | ⓘ Agardite-(La) | LaCu6(AsO4)3(OH)6 · 3H2O |
| W | Tungsten | |
| W | ⓘ Hübnerite | MnWO4 |
| W | ⓘ Raspite | Pb(WO4) |
| W | ⓘ Scheelite | Ca(WO4) |
| W | ⓘ Stolzite | Pb(WO4) |
| W | ⓘ Tungstite | WO3 · H2O |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| Au | ⓘ Sylvanite | AgAuTe4 |
| Pb | Lead | |
| Pb | ⓘ Aikinite | CuPbBiS3 |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| Pb | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| Pb | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| Pb | ⓘ Bindheimite | Pb2Sb2O6O |
| Pb | ⓘ Boulangerite | Pb5Sb4S11 |
| Pb | ⓘ Duftite var. Calcio-duftite | (Pb,Ca)CuAsO4(OH) |
| Pb | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| Pb | ⓘ Carminite | PbFe23+(AsO4)2(OH)2 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Chenite | Pb4Cu(SO4)2(OH)6 |
| Pb | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| Pb | ⓘ Cosalite | Pb2Bi2S5 |
| Pb | ⓘ Crocoite | PbCr6+O4 |
| Pb | ⓘ Descloizite | PbZn(VO4)(OH) |
| Pb | ⓘ Duftite | PbCu(AsO4)(OH) |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Hedyphane | Ca2Pb3(AsO4)3Cl |
| Pb | ⓘ Hinsdalite | PbAl3(PO4)(SO4)(OH)6 |
| Pb | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| Pb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Pb | ⓘ Krupkaite | CuPbBi3S6 |
| Pb | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| Pb | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Pb | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Pb | ⓘ Mottramite | PbCu(VO4)(OH) |
| Pb | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| Pb | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Pb | ⓘ Raspite | Pb(WO4) |
| Pb | ⓘ Scotlandite | PbSO3 |
| Pb | ⓘ Stolzite | Pb(WO4) |
| Pb | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| Pb | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| Pb | ⓘ Zinkenite | Pb9Sb22S42 |
| Pb | ⓘ Duftite-alpha | PbCu(AsO4)(OH) |
| Pb | ⓘ Duftite var. Duftite-β | PbCu(AsO4)(OH) |
| Pb | ⓘ Mimetite-Pyromorphite Series | |
| Bi | Bismuth | |
| Bi | ⓘ Aikinite | CuPbBiS3 |
| Bi | ⓘ Bismite | Bi2O3 |
| Bi | ⓘ Native Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Bismutite | (BiO)2CO3 |
| Bi | ⓘ Cosalite | Pb2Bi2S5 |
| Bi | ⓘ Hedleyite | Bi7Te3 |
| Bi | ⓘ Ingodite | Bi2TeS |
| Bi | ⓘ Joséite | Bi4TeS2 |
| Bi | ⓘ Joséite-A | Bi4TeS2 |
| Bi | ⓘ Joséite-B | Bi4Te2S |
| Bi | ⓘ Krupkaite | CuPbBi3S6 |
| Bi | ⓘ Preisingerite | Bi3(AsO4)2O(OH) |
| Bi | ⓘ Petitjeanite | Bi3(PO4)2O(OH) |
| Bi | ⓘ Rooseveltite | Bi(AsO4) |
| Bi | ⓘ Tetradymite | Bi2Te2S |
| U | Uranium | |
| U | ⓘ Uraninite | UO2 |
Geochronology
Mineralization age: Phanerozoic : 282 Ma to 197 MaImportant note: This table is based only on rock and mineral ages recorded on mindat.org for this locality and is not necessarily a complete representation of the geochronology, but does give an indication of possible mineralization events relevant to this locality. As more age information is added this table may expand in the future. A break in the table simply indicates a lack of data entered here, not necessarily a break in the geologic sequence. Grey background entries are from different, related, localities.
| Geologic Time | Rocks, Minerals and Events | ||||||
|---|---|---|---|---|---|---|---|
| Phanerozoic | |||||||
| Mesozoic | |||||||
| Jurassic | |||||||
| Early Jurassic |
| ||||||
| Paleozoic | |||||||
| Permian | |||||||
| Cisuralian |
| ||||||
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Mungrisdale |
|---|---|
| Wikidata ID: | Q3242426 |
| GeoNames ID: | 2641960 |
Localities in this Region
- England
- Cumbria
- England
- Cumbria
- Eden
- Mungrisdale
- Eden
- Cumbria
Other Regions, Features and Areas that Intersect
British and Irish IslesGroup of Islands
Eurasian PlateTectonic Plate
- AvaloniaVolcanic Arc
EuropeContinent
UK
- England
- Cumbria
- Caldbeck Fells Mining RegionMining District
- Cumbria
- England
- Cumbria
- Carrock FellFell
- Lake District National ParkNational Park
- LDNPA Amber ZoneMineral Collecting Permit Zone
- LDNPA Green ZoneMineral Collecting Permit Zone
- LDNPA Red ZoneMineral Collecting Permit Zone
- Cumbria
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Quick NavTopCommoditiesMineral ListRock TypesGeochronologyFossilsOther DatabasesLocalities in RegionOther RegionsReferences
Carrock Mine, Mungrisdale, Eden, Cumbria, England, UK