Log In
Caldbeck Fells Mining Region, Cumbria, England, UKi
| Regional Level Types | |
|---|---|
| Caldbeck Fells Mining Region | Mining District |
| Cumbria | County |
| England | Constituent Country |
| UK | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Cooper & Stanley (1991):
"The Caldbeck Fells mining district is a loosely defined area covering some 25 square km to the south of the village of Caldbeck in the northeastern corner of the English Lake District, about 12 km north-northeast of Keswick. Before the county boundary changes of 1974, the Caldbeck Fells were part of the ancient county of Cumberland now absorbed in the new county of Cumbria.
For the most part, the Caldbeck Fells (the word "fell" generally refers to an upland pasture, moor or high plateau) consist of rolling, treeless moorland dissected by numerous watercourses running in steep-sided valleys known locally by the old Norse name of "gills". It was in these gills that the majority of mineral veins worked by the early miners were discovered.
The area is part of the Lake District National Park, and vehicular access is restricted; however, many of the mines may be reached without too strenuous a walk, the main hazard is the weather which is apt to be wet and dismal. Away from the mine dumps the Caldbeck Fells have a subtle beauty rarely seen by the countless casual visitors and tourists who flock to the central Lake District. It is surprising that despite hundreds of years of commercial exploitation and study by generations of mineralogists and collectors, the mineral localities continue to produce new discoveries of common and exotic mineral species."
"The Caldbeck Fells mining district is a loosely defined area covering some 25 square km to the south of the village of Caldbeck in the northeastern corner of the English Lake District, about 12 km north-northeast of Keswick. Before the county boundary changes of 1974, the Caldbeck Fells were part of the ancient county of Cumberland now absorbed in the new county of Cumbria.
For the most part, the Caldbeck Fells (the word "fell" generally refers to an upland pasture, moor or high plateau) consist of rolling, treeless moorland dissected by numerous watercourses running in steep-sided valleys known locally by the old Norse name of "gills". It was in these gills that the majority of mineral veins worked by the early miners were discovered.
The area is part of the Lake District National Park, and vehicular access is restricted; however, many of the mines may be reached without too strenuous a walk, the main hazard is the weather which is apt to be wet and dismal. Away from the mine dumps the Caldbeck Fells have a subtle beauty rarely seen by the countless casual visitors and tourists who flock to the central Lake District. It is surprising that despite hundreds of years of commercial exploitation and study by generations of mineralogists and collectors, the mineral localities continue to produce new discoveries of common and exotic mineral species."
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities229 valid minerals. 1 (TL) - type locality of valid minerals. 8 erroneous literature entries.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Acanthite Formula: Ag2S Localities: |
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 References: |
| ⓘ Adamite Formula: Zn2(AsO4)(OH) Localities: Reported from at least 9 localities in this region. |
| ⓘ Adamite var. Copper-bearing Adamite Formula: (Zn,Cu)2AsO4OH Localities: Habit: prismatic to bladed crystals (< 0.2mm) on gossany matrix Colour: pale to dark green zoned Description: Cooper & Stanley (1990): "A cuprian variety was identified at the BM(NH) (XRD) on a specimen from the D.R. Middleton Collection." |
| ⓘ 'Agardite' Localities: |
| ⓘ Agardite-(La) Formula: LaCu6(AsO4)3(OH)6 · 3H2O |
| ⓘ Aikinite Formula: CuPbBiS3 |
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ Albite var. Andesine Formula: (Na,Ca)[Al(Si,Al)Si2O8] References: |
| ⓘ Albite var. Anorthoclase Formula: (Na,K)AlSi3O8 References: |
| ⓘ Albite var. Oligoclase Formula: (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ Allophane Formula: (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| ⓘ Alunite Formula: KAl3(SO4)2(OH)6 |
| ⓘ 'Amphibole Supergroup' Formula: AB2C5(T8O22)W2 |
| ⓘ Anatase Formula: TiO2 |
| ⓘ Andalusite Formula: Al2(SiO4)O References: Rastall, R. H. (1910) The Skiddaw Granite and its Metamorphism. Journal of the Geological Society, 66 (1) 116-141 doi:10.1144/gsl.jgs.1910.066.01-04.08 |
| ⓘ Andalusite var. Chiastolite Formula: Al2(SiO4)O References: |
| ⓘ Anglesite Formula: PbSO4 Localities: Reported from at least 16 localities in this region. |
| ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 Localities: Reported from at least 12 localities in this region. |
| ⓘ Annabergite Formula: Ni3(AsO4)2 · 8H2O |
| ⓘ Antlerite Formula: Cu3(SO4)(OH)4 Localities: |
| ⓘ 'Apatite' Formula: Ca5(PO4)3A Localities: Reported from at least 7 localities in this region. |
| ⓘ 'Apatite Group' Localities: Reported from at least 8 localities in this region. |
| ⓘ Aragonite Formula: CaCO3 Localities: Reported from at least 8 localities in this region. |
| ⓘ Arsendescloizite Formula: PbZn(AsO4)(OH) |
| ⓘ Arseniosiderite Formula: Ca2Fe3+3(AsO4)3O2 · 3H2O Localities: Reported from at least 10 localities in this region. |
| ⓘ Arsenopyrite Formula: FeAsS Localities: Reported from at least 18 localities in this region. |
| ⓘ Arsentsumebite Formula: Pb2Cu(AsO4)(SO4)(OH) |
| ⓘ Asbolane Formula: (Ni,Co)2-xMn4+(O,OH)4 · nH2O |
| ⓘ Atacamite Formula: Cu2(OH)3Cl Localities: Reported from at least 6 localities in this region. |
| ⓘ Aurichalcite Formula: (Zn,Cu)5(CO3)2(OH)6 Localities: Reported from at least 13 localities in this region. |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 Localities: Reported from at least 11 localities in this region. |
| ⓘ Bariopharmacosiderite Formula: Ba0.5Fe3+4(AsO4)3(OH)4 · 5H2O Localities: Reported from at least 6 localities in this region. |
| ⓘ Baryte Formula: BaSO4 Localities: Reported from at least 28 localities in this region. |
| ⓘ Bayldonite Formula: PbCu3(AsO4)2(OH)2 Localities: Reported from at least 12 localities in this region. |
| ⓘ Beaverite-(Cu) Formula: Pb(Fe3+2Cu)(SO4)2(OH)6 Localities: Reported from at least 12 localities in this region. |
| ⓘ Bechererite Formula: Zn7Cu(OH)13[(SiO(OH)3(SO4)] |
| ⓘ Beraunite Formula: Fe3+6(PO4)4O(OH)4 · 6H2O |
| ⓘ Berthierite Formula: FeSb2S4 |
| ⓘ Beryl Formula: Be3Al2(Si6O18) |
| ⓘ Betpakdalite-CaMg Formula: [Ca2(H2O)17Mg(H2O)6][Mo8As2Fe3+3O36(OH)] |
| ⓘ Beudantite Formula: PbFe3+3(AsO4)(SO4)(OH)6 Localities: Reported from at least 22 localities in this region. |
| ⓘ Bindheimite Formula: Pb2Sb2O6O Localities: Reported from at least 14 localities in this region. |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Bismite Formula: Bi2O3 |
| ⓘ Bismuthinite Formula: Bi2S3 |
| ⓘ 'Bismuth Ochre' Description: Cooper & Stanley (1990): "the 'bismuth ochre' reported from 'Brandy Gill' as an associate of bismuth (Goodchild, 1882: 104) may have been bismite or bismutite." References: |
| ⓘ Bismutite Formula: (BiO)2CO3 |
| ⓘ Bornite Formula: Cu5FeS4 Localities: Reported from at least 7 localities in this region. |
| ⓘ Boulangerite Formula: Pb5Sb4S11 |
| ⓘ Bournonite Formula: PbCuSbS3 Localities: Caldbeck Fells Mining Region, Cumbria, England, UK Driggith Mine, Caldbeck, Allerdale, Cumbria, England, UK Nether Row Brow, Caldbeck, Allerdale, Cumbria, England, UK Roughton Gill Mine, Roughton Gill, Caldbeck, Allerdale, Cumbria, England, UK ? (more information) Higher Roughton Gill (Balliway Rigg), Roughton Gill, Caldbeck, Allerdale, Cumbria, England, UK ? (more information) |
| ⓘ Formula: Mn2+Mn3+6(SiO4)O8 Locality: Burdell Gill, Coombe Height, Caldbeck, Allerdale, Cumbria, England, UK - erroneously reported Description: Cooper & Stanley (1990): "Listed in error for beraunite in Young (1987)." |
| ⓘ Breithauptite ? Formula: NiSb |
| ⓘ 'Brewsterite Subgroup' ? Description: Cooper & Stanley (1990): "The 'brewsterite' recorded by Hall (1868) as an associate of tenorite and chalcopyrite is unlikely to be the zeolitic brewsterite (of Brooke) as assumed by Young (1987). It is more likely to be the 'brewsterite' listed by Branston (1910) and Postlethwaite (1913) as 'protoxide of copper'. Although the latter is a synonym of cuprite, the name brewsterite in this context does not appear in any standard mineralogy or synonymy known to the authors and the precise definition of the term appears to be lost." References: |
| ⓘ Brianyoungite Formula: Zn3(CO3,SO4)(OH)4 |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 Localities: Reported from at least 18 localities in this region. |
| ⓘ Brookite Formula: TiO2 |
| ⓘ Cacoxenite Formula: Fe3+24AlO6(PO4)17(OH)12 · 75H2O |
| ⓘ Calcite Formula: CaCO3 Localities: Reported from at least 23 localities in this region. |
| ⓘ Caledonite Formula: Pb5Cu2(SO4)3(CO3)(OH)6 Localities: Reported from at least 12 localities in this region. |
| ⓘ Carminite Formula: PbFe3+2(AsO4)2(OH)2 Localities: Reported from at least 17 localities in this region. |
| ⓘ Formula: Mn2+Al2(Si2O6)(OH)4 Localities: Habit: thin, fibrous-radiating aggregates Colour: pale yellow Description: Kingsbury reference. Cooper & Stanley (1990): "As unusually pale, almost cream yellow, 'thin, fibrous-radiating aggregates in joints in white vein-quartz... almost certainly from the Emerson vein' (Kingsbury & Hartley, 1957). Specimens in the Kingsbury Collection (BM(NH)) match this description." |
| ⓘ Cassiterite Formula: SnO2 |
| ⓘ Cerussite Formula: PbCO3 Localities: Reported from at least 25 localities in this region. |
| ⓘ Cesàrolite Formula: PbMn4+3O6(OH)2 |
| ⓘ Chalcanthite ? Formula: CuSO4 · 5H2O Description: Kingsbury reference. Cooper & Stanley (1990): "Specimens labelled chalcanthite, showing thin bluish crusts on quartz-sulphide matrix, are preserved in the Kingsbury Collection (BM(NH)). Kingsbury (unpublished manuscript) comments on the occurrence: 'x-ray photo has since shown it to be an 'unidentified' sulphate'. The persistence of chalcanthite in an area of such high rainfall is doubtful." |
| ⓘ Chalcocite Formula: Cu2S Localities: Reported from at least 9 localities in this region. |
| ⓘ Chalcophyllite Formula: Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 24 localities in this region. |
| ⓘ Chenevixite Formula: Cu2Fe3+2(AsO4)2(OH)4 |
| ⓘ Chenite Formula: Pb4Cu(SO4)2(OH)6 Localities: Habit: Equant, prismatic Colour: Sky Blue |
| ⓘ Chlorargyrite Formula: AgCl |
| ⓘ 'Chlorite Group' |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 Localities: Reported from at least 20 localities in this region. |
| ⓘ Cinnabar Formula: HgS Localities: Reported from at least 9 localities in this region. Description: Cooper & Stanley (1990): "'Some time last year [1880-1881]a notice went the round of our local newspaper to the effect that cinnabar... had been discovered somewhere or other out Caldbeck Fells way' (Goodchild, 1882: 105). Goodchild doubted the occurrence." |
| ⓘ Claudetite Formula: As2O3 |
| ⓘ Claudetite var. Antimony-bearing Claudetite Formula: (As,Sb)2O3 |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ 'Columbite-(Fe)-Columbite-(Mn) Series' Description: Cooper & Stanley (1990): "Forms minute grains (exceptionally up to 180µm, but mostly < 30µm) in arsenopyrite, scheelite and carbonate minerals replacing wolframite. Mangano-columbite is the dominant end-member at Carrock (Beddoe-Stephens & Fortey, 1981). |
| ⓘ Columbite-(Mn) Formula: Mn2+Nb2O6 |
| ⓘ Formula: CaCu(AsO4)(OH) Localities: Habit: crystalline crust on quartz Colour: dark green Description: Cooper & Stanley (1990): "Specimens labelled conichalcite are preserved in the Russell and Kingsbury Collections, BM(NH), but Kingsbury seems later to have considered the mineral to be a calcian duftite ('calcioduftite') although the X-ray powder pattern was 'close to (but by no means identical with) that of conichalcite (Kingsbury & Hartley, MS). Conichalcite has been found intimately associated with bayldonite forming a dark green crystalline crust on quartz (det. BM(NH): XRD, B. Young, pers. comm.)." |
| ⓘ Connellite Formula: Cu19(SO4)(OH)32Cl4 · 3H2O Localities: Reported from at least 6 localities in this region. |
| ⓘ 'Copper Pitch Ore' |
| ⓘ Cordierite Formula: Mg2Al4Si5O18 |
| ⓘ Corkite Formula: PbFe3+3(PO4)(SO4)(OH)6 |
| ⓘ Cornubite Formula: Cu5(AsO4)2(OH)4 |
| ⓘ Cornwallite Formula: Cu5(AsO4)2(OH)4 Localities: Reported from at least 6 localities in this region. |
| ⓘ Coronadite Formula: Pb(Mn4+6Mn3+2)O16 Localities: Caldbeck Fells Mining Region, Cumbria, England, UK Dry Gill Mine, Caldbeck, Allerdale, Cumbria, England, UK Hay Gill Copper Mine, Roughton Gill, Caldbeck, Allerdale, Cumbria, England, UK Roughton Gill Mine, Roughton Gill, Caldbeck, Allerdale, Cumbria, England, UK Higher Roughton Gill (Balliway Rigg), Roughton Gill, Caldbeck, Allerdale, Cumbria, England, UK |
| ⓘ Corundum Formula: Al2O3 References: |
| ⓘ Cosalite Formula: Pb2Bi2S5 |
| ⓘ Covellite Formula: CuS Localities: Reported from at least 14 localities in this region. |
| ⓘ Crocoite ? Formula: PbCr6+O4 Localities: |
| ⓘ Cryptomelane Formula: K(Mn4+7Mn3+)O16 |
| ⓘ Cubanite Formula: CuFe2S3 |
| ⓘ Cuprite Formula: Cu2O Localities: Reported from at least 15 localities in this region. |
| ⓘ Cyanotrichite Formula: Cu4Al2(SO4)(OH)12 · 2H2O |
| ⓘ Descloizite Formula: PbZn(VO4)(OH) |
| ⓘ Devilline Formula: CaCu4(SO4)2(OH)6 · 3H2O Localities: Caldbeck Fells Mining Region, Cumbria, England, UK Driggith Mine, Caldbeck, Allerdale, Cumbria, England, UK Old Sandbed Mine, Caldbeck, Allerdale, Cumbria, England, UK Brandy Gill Mine, Mungrisdale, Eden, Cumbria, England, UK ? (more information) Old Potts Gill Mine, Potts Gill, Caldbeck, Allerdale, Cumbria, England, UK ? (more information) |
| ⓘ Digenite Formula: Cu9S5 |
| ⓘ Formula: CuSiO3 · H2O Locality: Old Potts Gill Mine, Potts Gill, Caldbeck, Allerdale, Cumbria, England, UK - erroneously reported Description: Kingsbury reference. Cooper & Stanley (1990): "The first British record of dioptase. Specimens in the Kingsbury Collection, BM(NH), collected in 1953 from the 'old No. 1 cross-cut' dumps show attractive prismatic crystals (< a millimetre or so) on small pieces of matrix." References: |
| ⓘ Djurleite Formula: Cu31S16 |
| ⓘ Dolomite Formula: CaMg(CO3)2 Localities: Reported from at least 15 localities in this region. |
| ⓘ Dolomite var. Iron-bearing Dolomite Formula: Ca(Mg,Fe)(CO3)2 |
| ⓘ Dufrénite Formula: Ca0.5Fe2+Fe3+5(PO4)4(OH)6 · 2H2O |
| ⓘ Duftite Formula: PbCu(AsO4)(OH) Localities: Reported from at least 7 localities in this region. |
| ⓘ Duftite var. Calcio-duftite Formula: (Pb,Ca)CuAsO4(OH) Description: Cooper & Stanley (1990): Kingsbury & Hartley claimed that material they had collected resembled, but was not identical with duftite was actually an intermediate between duftite and conichalcite. They coined the term 'calcio-duftite' for this mineral on the basis of the intermediate nature of the x-ray powder spacings and a qualitative (spectrographic) analysis that showed significant calcium. Claringbull also mentioned the affinity of the x-ray pattern of Brandy Gill duftite with conichalcite and commented on the variation of refractive index within individual spherules of the mineral which, he suggested, resulted from a corresponding variation in composition with the core being richer in lead than the outer areas. |
| ⓘ Duftite var. Duftite-β Formula: PbCu(AsO4)(OH) Description: Cooper & Stanley (1990): "Most duftite from Brandy Gill appears to be β-duftite as defined by Guillemin (1956: 70), who re-examined Claringbull's (1951) x-ray data. Infra-red absorption spectrophotometry readily distinguishes α- and β-duftite and also shows the predominance of the latter at this locality (R.S.W. Braithwaite, pers. comm.)." |
| ⓘ 'Duftite-alpha' Formula: PbCu(AsO4)(OH) Habit: globular masses Description: Cooper & Stanley (1990): "a few specimens recently examined appear to be α-duftite which, at Brandy Gill, forms small globular masses on quartz (M.P. Cooper Collection, det. P.J. Dunn, Smithsonian Institution: XRD) or minute crystals with agardite-mixite (det. BM(NH): XRD, C.M. Leppington, pers. comm.)" |
| ⓘ Elyite Formula: Pb4Cu(SO4)O2(OH)4 · H2O |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ Erythrite Formula: Co3(AsO4)2 · 8H2O Localities: Caldbeck Fells Mining Region, Cumbria, England, UK Driggith Mine, Caldbeck, Allerdale, Cumbria, England, UK Roughton Gill Mine, Roughton Gill, Caldbeck, Allerdale, Cumbria, England, UK Old Sandbed Mine, Caldbeck, Allerdale, Cumbria, England, UK Ingray Gill, Caldbeck, Allerdale, Cumbria, England, UK ? (more information) |
| ⓘ 'Feldspar Group' Localities: Caldbeck Fells Mining Region, Cumbria, England, UK Arm O'Grain, Mungrisdale, Eden, Cumbria, England, UK Brandy Gill Mine, Mungrisdale, Eden, Cumbria, England, UK Carrock Mine, Mungrisdale, Eden, Cumbria, England, UK Higher Roughton Gill (Balliway Rigg), Roughton Gill, Caldbeck, Allerdale, Cumbria, England, UK |
| ⓘ Ferrimolybdite Formula: Fe2(MoO4)3 · nH2O |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F References: Finlayson, A. M. (1910) The Ore-bearing Pegmatites of Carrock Fell, and the Genetic Significance of Tungsten-ores. Geological Magazine, S. 5 Vol. 7 (1). 19-28 doi:10.1017/s0016756800132649(analysis of "apatite" from Carrock mine showing it to be a fluorapatite) |
| ⓘ Fluorite Formula: CaF2 |
| ⓘ Fraipontite Formula: (Zn,Al)3((Si,Al)2O5)(OH)4 |
| ⓘ Fülöppite Formula: Pb3Sb8S15 |
| ⓘ Galena Formula: PbS Localities: Reported from at least 32 localities in this region. |
| ⓘ Galena var. Silver-bearing Galena Formula: PbS with Ag |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 |
| ⓘ Gersdorffite Formula: NiAsS |
| ⓘ Goethite Formula: Fe3+O(OH) Localities: Reported from at least 23 localities in this region. |
| ⓘ 'Grünlingite' ? Localities: Description: Kingsbury reference. Kingsbury (1965): "For many years the bismuth telluride tetradymite (Bi2T2S) has been accepted as a British species, but this status has never been satisfactorily established. It was originally thought to occur in Brandy Gill, Carrock Fell, Cumberland, though in 1858 Greg and Lettsom had stated that the mineral appeared to differ much in composition from other tetradymites. The Carrock mineral was later regarded as a new species and was named grünlingite, but further investigations have shown that these specimens are not all identical and probably represent several varieties or phases of the allied mineral joséite, with compositions near Bi4TeS2: none of them, so far, have proved to be tetradymite." |
| ⓘ Gypsum Formula: CaSO4 · 2H2O |
| ⓘ Hedleyite Formula: Bi7Te3 |
| ⓘ Hedyphane Formula: Ca2Pb3(AsO4)3Cl |
| ⓘ Hematite Formula: Fe2O3 Localities: Reported from at least 10 localities in this region. |
| ⓘ Hemimorphite Formula: Zn4Si2O7(OH)2 · H2O Localities: Reported from at least 13 localities in this region. |
| ⓘ Hidalgoite ? Formula: PbAl3(AsO4)(SO4)(OH)6 |
| ⓘ Hinsdalite Formula: PbAl3(PO4)(SO4)(OH)6 Localities: Caldbeck Fells Mining Region, Cumbria, England, UK Iron Crag, Roughton Gill, Caldbeck, Allerdale, Cumbria, England, UK Old Potts Gill Mine, Potts Gill, Caldbeck, Allerdale, Cumbria, England, UK ? (more information) Roughton Gill Mine, Roughton Gill, Caldbeck, Allerdale, Cumbria, England, UK ? (more information) |
| ⓘ Hisingerite Formula: Fe3+2(Si2O5)(OH)4 · 2H2O |
| ⓘ Formula: MnWO4 Locality: Carrock Mine, Mungrisdale, Eden, Cumbria, England, UK - erroneously reported Description: Kingsbury reference? References: |
| ⓘ Hydrocerussite Formula: Pb3(CO3)2(OH)2 Localities: Reported from at least 14 localities in this region. |
| ⓘ Hydrozincite Formula: Zn5(CO3)2(OH)6 Localities: Reported from at least 8 localities in this region. |
| ⓘ Ianbruceite Formula: Zn2(AsO4)(OH) · 3H2O |
| ⓘ Ilmenite Formula: Fe2+TiO3 |
| ⓘ Ingodite Formula: Bi2TeS |
| ⓘ 'Iron oxide' |
| ⓘ Jamesonite Formula: Pb4FeSb6S14 Localities: Caldbeck Fells Mining Region, Cumbria, England, UK Nether Row Brow, Caldbeck, Allerdale, Cumbria, England, UK Wet Swine Gill, Coombe Height, Caldbeck, Allerdale, Cumbria, England, UK Carrock Mine, Mungrisdale, Eden, Cumbria, England, UK ? (more information) Grains Gill, Mungrisdale, Eden, Cumbria, England, UK ? (more information) |
| ⓘ Jarosite Formula: KFe3+3(SO4)2(OH)6 Localities: Reported from at least 17 localities in this region. |
| ⓘ 'Joséite' Formula: Bi4TeS2 References: |
| ⓘ Joséite-A Formula: Bi4TeS2 |
| ⓘ Joséite-B Formula: Bi4Te2S |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Kermesite ? Formula: Sb2S2O |
| ⓘ Kintoreite Formula: PbFe3(PO4)(PO3OH)(OH)6 |
| ⓘ Kipushite ? Formula: (Cu,Zn)5Zn(PO4)2(OH)6 · H2O |
| ⓘ Köttigite Formula: Zn3(AsO4)2 · 8H2O |
| ⓘ Krupkaite Formula: CuPbBi3S6 |
| ⓘ Lanarkite Formula: Pb2(SO4)O Localities: Reported from at least 8 localities in this region. |
| ⓘ Langite Formula: Cu4(SO4)(OH)6 · 2H2O Localities: Reported from at least 9 localities in this region. |
| ⓘ Lavendulan Formula: NaCaCu5(AsO4)4Cl · 5H2O |
| ⓘ Leadhillite Formula: Pb4(CO3)2(SO4)(OH)2 Localities: Reported from at least 12 localities in this region. |
| ⓘ Lepidocrocite Formula: Fe3+O(OH) Localities: Burdell Gill, Coombe Height, Caldbeck, Allerdale, Cumbria, England, UK Roughton Gill Mine, Roughton Gill, Caldbeck, Allerdale, Cumbria, England, UK Old Sandbed Mine, Caldbeck, Allerdale, Cumbria, England, UK Higher Roughton Gill (Balliway Rigg), Roughton Gill, Caldbeck, Allerdale, Cumbria, England, UK Iron Crag, Roughton Gill, Caldbeck, Allerdale, Cumbria, England, UK |
| ⓘ Libethenite Formula: Cu2(PO4)(OH) |
| ⓘ 'Limonite' Localities: Reported from at least 10 localities in this region. |
| ⓘ Linarite Formula: PbCu(SO4)(OH)2 Localities: Reported from at least 25 localities in this region. |
| ⓘ Formula: Cu3(MoO4)2(OH)2 Locality: Brandy Gill Mine, Mungrisdale, Eden, Cumbria, England, UK - erroneously reported Habit: bladed Colour: dark olive-green Description: Kingsbury reference. Cooper & Stanley (1990): "The first (and only) British occurrence (Kingsbury & Hartley, 1955). The mineral was found in specimens from the dumps of the eastern level as small (< 1.5mm), dark olive-green bladed crystals on a yellowish-green crystalline mineral (which 'gives [an x-ray powder] pattern and spacings very close to those of the well-known pale blue Cumberland plumbogummite' op. cit.: 724.) It was found in cavities in granophyre presumed to be from the vein wall. Only a few specimens were obtained (Kingsbury and Russell Collections, BM(NH)) and, despite the exertions of a generation of collectors, none has been found since." |
| ⓘ Liroconite ? Formula: Cu2Al(AsO4)(OH)4 · 4H2O |
| ⓘ Löllingite Formula: FeAs2 |
| ⓘ Macphersonite Formula: Pb4(CO3)2(SO4)(OH)2 |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 References: |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 Localities: Reported from at least 29 localities in this region. |
| ⓘ 'Manganese Oxides' |
| ⓘ Manganite Formula: Mn3+O(OH) Localities: Caldbeck Fells Mining Region, Cumbria, England, UK Burdell Gill, Coombe Height, Caldbeck, Allerdale, Cumbria, England, UK Low Pike north slopes, Caldbeck, Allerdale, Cumbria, England, UK Higher Roughton Gill (Balliway Rigg), Roughton Gill, Caldbeck, Allerdale, Cumbria, England, UK Thief Gills, Roughton Gill, Caldbeck, Allerdale, Cumbria, England, UK ? (more information) |
| ⓘ Marcasite Formula: FeS2 |
| ⓘ Mattheddleite Formula: Pb5(SiO4)1.5(SO4)1.5(Cl,OH) Localities: Reported from at least 8 localities in this region. |
| ⓘ Mawbyite Formula: PbFe3+2(AsO4)2(OH)2 |
| ⓘ Metavivianite Formula: Fe2+Fe3+2(PO4)2(OH)2 · 6H2O |
| ⓘ 'Mica Group' Localities: Colour: yellow |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ Mimetite Formula: Pb5(AsO4)3Cl Localities: Reported from at least 26 localities in this region. |
| ⓘ Mimetite var. Campylite Formula: Pb5(AsO4)3Cl Localities: Habit: rounded barrel-shaped crystals to globular aggregates Colour: orange-yellow; shades of brown; green (19th-century specimens) Description: May contain sufficient phosphorus to grade into an arsenatian pyromorphite. |
| ⓘ 'Mimetite-Pyromorphite Series' Localities: Reported from at least 12 localities in this region. |
| ⓘ Molybdenite Formula: MoS2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Montetrisaite ? Formula: Cu6(SO4)(OH)10 · 2H2O Locality: Higher Roughton Gill (Balliway Rigg), Roughton Gill, Caldbeck, Allerdale, Cumbria, England, UK Description: Green et al. (2008): "full confirmation (of redgillite vs. its dimorph montetrisaite) requires XRD for which there is insufficient material at present." |
| ⓘ Mottramite Formula: PbCu(VO4)(OH) Localities: Reported from at least 12 localities in this region. |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 10 localities in this region. |
| ⓘ Muscovite var. Gilbertite Formula: KAl2(AlSi3O10)(OH)2 References: |
| ⓘ Muscovite var. Illite Formula: K0.65Al2.0[Al0.65Si3.35O10](OH)2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Native Antimony Formula: Sb |
| ⓘ Native Bismuth Formula: Bi |
| ⓘ Native Copper Formula: Cu |
| ⓘ Native Gold Formula: Au Localities: Reported from at least 11 localities in this region. |
| ⓘ Native Mercury Formula: Hg Description: Cooper & Stanley (1990): "Mercury has been detected in ppm in the Wet Swine Gill 'antimony vein' (Fortey et al., 1984)." |
| ⓘ Native Silver Formula: Ag Localities: Reported from at least 8 localities in this region. |
| ⓘ Native Sulphur Formula: S8 Localities: Reported from at least 10 localities in this region. |
| ⓘ Olivenite Formula: Cu2(AsO4)(OH) Localities: Reported from at least 7 localities in this region. |
| ⓘ Orthoclase Formula: K(AlSi3O8) |
| ⓘ Palygorskite Formula: ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| ⓘ Formula: Zn3(PO4)2 · 4H2O |
| ⓘ Parasymplesite Formula: Fe2+3(AsO4)2 · 8H2O |
| ⓘ Parnauite Formula: Cu9(AsO4)2(SO4)(OH)10 · 7H2O |
| ⓘ Petitjeanite Formula: Bi3(PO4)2O(OH) |
| ⓘ Pharmacosiderite Formula: KFe3+4(AsO4)3(OH)4 · 6-7H2O Localities: Reported from at least 13 localities in this region. |
| ⓘ Phaunouxite Formula: Ca3(AsO4)2 · 11H2O |
| ⓘ Philipsburgite Formula: Cu5Zn(AsO4)(PO4)(OH)6 · H2O Localities: Reported from at least 7 localities in this region. |
| ⓘ Phosgenite Formula: Pb2CO3Cl2 |
| ⓘ Phosphohedyphane Formula: Ca2Pb3(PO4)3Cl Locality: Higher Roughton Gill (Balliway Rigg), Roughton Gill, Caldbeck, Allerdale, Cumbria, England, UK Habit: botryoidal crusts Colour: pale to dark green |
| ⓘ Pitticite Formula: (Fe, AsO4, H2O) (?) |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ Formula: Cu8(Si8O22)(OH)4 · H2O Locality: Driggith Mine, Caldbeck, Allerdale, Cumbria, England, UK - erroneously reported Description: Cooper & Stanley (1990): "Known only from two small specimens from the 30fm level dump (Kingsbury Collection, BM(NH); as a radiating fibrous mineral with chrysocolla. The first British occurrence. Listed by Kingsbury (MS1) but otherwise unpublished." References: |
| ⓘ Plumbogummite Formula: PbAl3(PO4)(PO3OH)(OH)6 Localities: Reported from at least 16 localities in this region. Habit: drusy encrustation Colour: dark turquoise blue; very pale blue to colourless; brown |
| ⓘ Plumbojarosite Formula: Pb0.5Fe3+3(SO4)2(OH)6 Localities: Reported from at least 8 localities in this region. |
| ⓘ Posnjakite Formula: Cu4(SO4)(OH)6 · H2O Localities: Caldbeck Fells Mining Region, Cumbria, England, UK Driggith Mine, Caldbeck, Allerdale, Cumbria, England, UK Old Potts Gill Mine, Potts Gill, Caldbeck, Allerdale, Cumbria, England, UK Old Sandbed Mine, Caldbeck, Allerdale, Cumbria, England, UK Silver Gill, Roughton Gill, Caldbeck, Allerdale, Cumbria, England, UK |
| ⓘ Powellite Formula: Ca(MoO4) |
| ⓘ Prehnite ? Formula: Ca2Al2Si3O10(OH)2 |
| ⓘ Preisingerite Formula: Bi3(AsO4)2O(OH) |
| ⓘ Pseudomalachite Formula: Cu5(PO4)2(OH)4 Localities: Reported from at least 7 localities in this region. |
| ⓘ 'Psilomelane' Localities: Reported from at least 19 localities in this region. |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 20 localities in this region. |
| ⓘ Pyrolusite Formula: Mn4+O2 Localities: Reported from at least 10 localities in this region. |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl Localities: Reported from at least 29 localities in this region. |
| ⓘ 'Pyroxene Group' Formula: ADSi2O6 |
| ⓘ Pyrrhotite Formula: Fe1-xS Localities: Reported from at least 6 localities in this region. |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 41 localities in this region. |
| ⓘ Quartz var. Chalcedony Formula: SiO2 Localities: |
| ⓘ Quartz var. Milky Quartz Formula: SiO2 |
| ⓘ Quartz var. Rock Crystal Formula: SiO2 |
| ⓘ Queitite Formula: Pb4Zn2(SO4)(SiO4)(Si2O7) |
| ⓘ Ramsbeckite Formula: (Cu,Zn)15(SO4)4(OH)22 · 6H2O |
| ⓘ Raspite Formula: Pb(WO4) |
| ⓘ Redgillite (TL) Formula: Cu6(SO4)(OH)10 · H2O Localities: Silver Gill, Roughton Gill, Caldbeck, Allerdale, Cumbria, England, UK Driggith Mine, Caldbeck, Allerdale, Cumbria, England, UK Red Gill Mine, Roughton Gill, Caldbeck, Allerdale, Cumbria, England, UK Old Sandbed Mine, Caldbeck, Allerdale, Cumbria, England, UK Higher Roughton Gill (Balliway Rigg), Roughton Gill, Caldbeck, Allerdale, Cumbria, England, UK Habit: crystalline crusts Description: Cooper & Stanley (1990): an 'unknown copper sulphate' on oxidized sulphides from the 'Golden Hugh' (D.R. Middleton Collection, det. BM(NH): XRD, 1987) and in an old ore pile on the west bank of the gill [NY29953415] (D.I. Green, pers. comm.) |
| ⓘ Rhodochrosite Formula: MnCO3 |
| ⓘ Rhodonite ? Formula: CaMn3Mn[Si5O15] |
| ⓘ Rockbridgeite Formula: (Fe2+0.5Fe3+0.5)2Fe3+3(PO4)3(OH)5 |
| ⓘ Romanèchite Formula: (Ba,H2O)2(Mn4+,Mn3+)5O10 Localities: Reported from at least 8 localities in this region. |
| ⓘ Rooseveltite Formula: Bi(AsO4) |
| ⓘ Rosasite Formula: (Cu,Zn)2(CO3)(OH)2 Localities: Reported from at least 8 localities in this region. |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Scheelite Formula: Ca(WO4) Localities: Reported from at least 8 localities in this region. |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Habit: brush-like clusters in quartz Description: As 'brush-like clusters in quartz' (Hitchen, 1934: 186); in a vein at the foot of the gill (R.S.W. Braithwaite, pers. comm.). References: |
| ⓘ Schulenbergite Formula: (Cu,Zn)7(SO4)2(OH)10 · 3H2O Localities: Driggith Mine, Caldbeck, Allerdale, Cumbria, England, UK Roughton Gill Mine, Roughton Gill, Caldbeck, Allerdale, Cumbria, England, UK Old Sandbed Mine, Caldbeck, Allerdale, Cumbria, England, UK Silver Gill, Roughton Gill, Caldbeck, Allerdale, Cumbria, England, UK Potts Gill Copper Mine, Potts Gill, Caldbeck, Allerdale, Cumbria, England, UK |
| ⓘ Schulténite Formula: Pb(HAsO4) |
| ⓘ Scorodite Formula: Fe3+AsO4 · 2H2O Localities: Reported from at least 16 localities in this region. |
| ⓘ Scotlandite Formula: PbSO3 Localities: Reported from at least 7 localities in this region. |
| ⓘ Segnitite Formula: PbFe3+3AsO4(AsO3OH)(OH)6 |
| ⓘ Semseyite Formula: Pb9Sb8S21 |
| ⓘ Senarmontite Formula: Sb2O3 |
| ⓘ Serpierite Formula: Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O Localities: Reported from at least 7 localities in this region. |
| ⓘ Siderite Formula: FeCO3 Localities: Description: Cooper & Stanley (1990: "From an unspecified site ('the only locality in the Lake District') with galena and cerussite (Wright, in Jenkinson, 1875: lxxxi)." |
| ⓘ 'Smectite Group' Formula: A0.3D2-3[T4O10]Z2 · nH2O |
| ⓘ Smithsonite Formula: ZnCO3 Localities: Reported from at least 7 localities in this region. |
| ⓘ Sphalerite Formula: ZnS Localities: Reported from at least 23 localities in this region. |
| ⓘ Sphalerite var. Marmatite Formula: (Zn,Fe)S Description: Shaw (1970: 67) records 'a small "lead" vein in the Endeavour level containing arsenopyrite, 'marmatite', and 'a very little galena'. |
| ⓘ Stibiconite Formula: Sb3+Sb5+2O6(OH) |
| ⓘ Stibioclaudetite Formula: AsSbO3 |
| ⓘ Stibnite Formula: Sb2S3 |
| ⓘ Stilbite-Ca ? Formula: NaCa4(Si27Al9)O72 · 28H2O Description: Erroneous entry for stibnite (Hartley, 1984) (Hartley, pers. comm., 1988). References: |
| ⓘ Stolzite Formula: Pb(WO4) Localities: |
| ⓘ Strashimirite Formula: Cu8(AsO4)4(OH)4 · 5H2O |
| ⓘ Strengite Formula: FePO4 · 2H2O |
| ⓘ Strontianite ? Formula: SrCO3 |
| ⓘ Susannite Formula: Pb4(CO3)2(SO4)(OH)2 Localities: Reported from at least 8 localities in this region. |
| ⓘ Switzerite Formula: Mn2+3(PO4)2 · 7H2O |
| ⓘ Sylvanite ? Formula: AgAuTe4 |
| ⓘ Symplesite Formula: Fe2+3(AsO4)2 · 8H2O |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 |
| ⓘ 'Tennantite Subgroup' Formula: Cu6(Cu4C2+2)As4S12S Localities: Caldbeck Fells Mining Region, Cumbria, England, UK Old Potts Gill Mine, Potts Gill, Caldbeck, Allerdale, Cumbria, England, UK Driggith Mine, Caldbeck, Allerdale, Cumbria, England, UK ? (more information) Higher Roughton Gill (Balliway Rigg), Roughton Gill, Caldbeck, Allerdale, Cumbria, England, UK ? (more information) |
| ⓘ Tenorite Formula: CuO Localities: Reported from at least 6 localities in this region. |
| ⓘ Tetradymite ? Formula: Bi2Te2S |
| ⓘ 'Tetrahedrite Group' Formula: M2(A6)M1(B4 C2)X3(D4)S1(Y12)S2(Z) Localities: Description: Kingsbury reference. From the 30fm dumps and the Driggith-Sandbeds vein outcrop workings. |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S Localities: Reported from at least 8 localities in this region. |
| ⓘ 'Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite' Formula: (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| ⓘ Titanite Formula: CaTiO(SiO4) |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z Localities: Reported from at least 6 localities in this region. |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ Tsumebite Formula: Pb2Cu(PO4)(SO4)(OH) |
| ⓘ Tungstite Formula: WO3 · H2O |
| ⓘ Turquoise Formula: CuAl6(PO4)4(OH)8 · 4H2O |
| ⓘ Tyrolite Formula: Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| ⓘ Uraninite Formula: UO2 |
| ⓘ Vanadinite Formula: Pb5(VO4)3Cl Localities: Reported from at least 8 localities in this region. |
| ⓘ Vivianite Formula: Fe2+Fe2+2(PO4)2 · 8H2O |
| ⓘ 'Wad' |
| ⓘ Witherite Formula: BaCO3 |
| ⓘ 'Wolframite Group' Localities: Reported from at least 7 localities in this region. |
| ⓘ Wooldridgeite Formula: Na2CaCu2+2(P2O7)2 · 10H2O Habit: tapering blades/prisms Colour: aquamarine blue Description: Cooper & Stanley (1990): "Sprays of tapering bladed aquamarine blue transparent crystals to 1.5mm on chrysocolla in quartz have been shown by XRD (BM(NH) & Leeds Univ.) and semi-quantitative EPMA (M. Rothwell, pers. comm.) to be a probable new species. Only two very small specimens have been found (J. Dickinson & P. Braithwaite Collections). The XRD pattern is closely related to that of the magnesium phosphate bobierrite (D.I. Green, pers. comm.)."
Bridges et al. (2011): "A copper calcium sodium pyro-phosphate hydrate occurring as ‘sprays of tapering bladed aquamarine crystals’ was described as an unknown species from the dumps of Roughton Gill Mine by Cooper and Stanley (1990, pp. 132-133). [...] Wooldridgeite was identified on a few small specimens collected by the late Peter Braithwaite and the late John Dickinson on the 90-fathom level dumps at Roughton Gill Mine. It occurs as pale ice-blue tapering prismatic crystals, which exceptionally reach 1.8 mm in length, but are usually much smaller than this. The crystals are commonly associated with ‘chrysocolla’ in porous quartz. They are very late in the paragenetic sequence. A few overgrow recent fractures in the quartz matrix which indicate a post-mining origin. It has not been found in this study." References: |
| ⓘ Wroewolfeite Formula: Cu4(SO4)(OH)6 · 2H2O Localities: Caldbeck Fells Mining Region, Cumbria, England, UK Driggith Mine, Caldbeck, Allerdale, Cumbria, England, UK Red Gill Mine, Roughton Gill, Caldbeck, Allerdale, Cumbria, England, UK Old Sandbed Mine, Caldbeck, Allerdale, Cumbria, England, UK Silver Gill, Roughton Gill, Caldbeck, Allerdale, Cumbria, England, UK |
| ⓘ Wulfenite Formula: Pb(MoO4) Localities: Reported from at least 14 localities in this region. |
| ⓘ Xenotime-(Y) Formula: Y(PO4) |
| ⓘ Yarrowite Formula: Cu9S8 |
| ⓘ Zálesíite Formula: CaCu6(AsO4)2(AsO3OH)(OH)6 · 3H2O |
| ⓘ Zinkenite Formula: Pb9Sb22S42 |
| ⓘ Zircon Formula: Zr(SiO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Native Gold | 1.AA.05 | Au |
| ⓘ | Native Silver | 1.AA.05 | Ag |
| ⓘ | Native Mercury | 1.AD.05 | Hg |
| ⓘ | Native Antimony | 1.CA.05 | Sb |
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| ⓘ | Native Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Djurleite | 2.BA.05 | Cu31S16 |
| ⓘ | Digenite | 2.BA.10 | Cu9S5 |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Yarrowite | 2.CA.05d | Cu9S8 |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | var. Marmatite | 2.CB.05a | (Zn,Fe)S |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Cubanite | 2.CB.55a | CuFe2S3 |
| ⓘ | Breithauptite ? | 2.CC.05 | NiSb |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | var. Silver-bearing Galena | 2.CD.10 | PbS with Ag |
| ⓘ | Cinnabar | 2.CD.15a | HgS |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Hedleyite | 2.DC.05 | Bi7Te3 |
| ⓘ | Ingodite | 2.DC.05 | Bi2TeS |
| ⓘ | 'Joséite' | 2.DC.05 | Bi4TeS2 |
| ⓘ | Joséite-A | 2.DC.05 | Bi4TeS2 |
| ⓘ | Joséite-B | 2.DC.05 | Bi4Te2S |
| ⓘ | Tetradymite ? | 2.DC.05 | Bi2Te2S |
| ⓘ | Sylvanite ? | 2.EA.05 | AgAuTe4 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Löllingite | 2.EB.15a | FeAs2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Gersdorffite | 2.EB.25 | NiAsS |
| ⓘ | Kermesite ? | 2.FD.05 | Sb2S2O |
| ⓘ | Bournonite | 2.GA.50 | PbCuSbS3 |
| ⓘ | 'Tennantite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)As4S12S |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | 'var. Silver-bearing Tetrahedrite' | 2.GB.05 | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| ⓘ | Berthierite | 2.HA.20 | FeSb2S4 |
| ⓘ | Aikinite | 2.HB.05a | CuPbBiS3 |
| ⓘ | Krupkaite | 2.HB.05a | CuPbBi3S6 |
| ⓘ | Jamesonite | 2.HB.15 | Pb4FeSb6S14 |
| ⓘ | Fülöppite | 2.HC.10a | Pb3Sb8S15 |
| ⓘ | Semseyite | 2.HC.10d | Pb9Sb8S21 |
| ⓘ | Boulangerite | 2.HC.15 | Pb5Sb4S11 |
| ⓘ | Cosalite | 2.JB.10 | Pb2Bi2S5 |
| ⓘ | Zinkenite | 2.JB.35a | Pb9Sb22S42 |
| Group 3 - Halides | |||
| ⓘ | Chlorargyrite | 3.AA.15 | AgCl |
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| ⓘ | Atacamite | 3.DA.10a | Cu2(OH)3Cl |
| ⓘ | Connellite | 3.DA.25 | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Cuprite | 4.AA.10 | Cu2O |
| ⓘ | Tenorite | 4.AB.10 | CuO |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Corundum | 4.CB.05 | Al2O3 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Claudetite | 4.CB.45 | As2O3 |
| ⓘ | var. Antimony-bearing Claudetite | 4.CB.45 | (As,Sb)2O3 |
| ⓘ | Stibioclaudetite | 4.CB.45 | AsSbO3 |
| ⓘ | Senarmontite | 4.CB.50 | Sb2O3 |
| ⓘ | Bismite | 4.CB.60 | Bi2O3 |
| ⓘ | Quartz var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Rock Crystal | 4.DA.05 | SiO2 |
| ⓘ | var. Milky Quartz | 4.DA.05 | SiO2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Hübnerite ? | 4.DB.30 | MnWO4 |
| ⓘ | 'Wolframite Group' | 4.DB.30 va | |
| ⓘ | Columbite-(Mn) | 4.DB.35 | Mn2+Nb2O6 |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Brookite | 4.DD.10 | TiO2 |
| ⓘ | Raspite | 4.DG.20 | Pb(WO4) |
| ⓘ | Bindheimite | 4.DH.20 | Pb2Sb2O6O |
| ⓘ | Stibiconite | 4.DH.20 | Sb3+Sb5+2O6(OH) |
| ⓘ | Coronadite | 4.DK.05a | Pb(Mn4+6Mn3+2)O16 |
| ⓘ | Cryptomelane | 4.DK.05a | K(Mn4+7Mn3+)O16 |
| ⓘ | Romanèchite | 4.DK.10 | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| ⓘ | Uraninite | 4.DL.05 | UO2 |
| ⓘ | Goethite | 4.FD.10 | Fe3+O(OH) |
| ⓘ | Manganite | 4.FD.15 | Mn3+O(OH) |
| ⓘ | Lepidocrocite | 4.FE.15 | Fe3+O(OH) |
| ⓘ | Cesàrolite | 4.FG.10 | PbMn4+3O6(OH)2 |
| ⓘ | Tungstite | 4.FJ.10 | WO3 · H2O |
| ⓘ | Asbolane | 4.FL.30 | (Ni,Co)2-xMn4+(O,OH)4 · nH2O |
| ⓘ | Scotlandite | 4.JE.20 | PbSO3 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Rhodochrosite | 5.AB.05 | MnCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Smithsonite | 5.AB.05 | ZnCO3 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | var. Iron-bearing Dolomite | 5.AB.10 | Ca(Mg,Fe)(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Strontianite ? | 5.AB.15 | SrCO3 |
| ⓘ | Witherite | 5.AB.15 | BaCO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Rosasite | 5.BA.10 | (Cu,Zn)2(CO3)(OH)2 |
| ⓘ | Aurichalcite | 5.BA.15 | (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ | Hydrozincite | 5.BA.15 | Zn5(CO3)2(OH)6 |
| ⓘ | Hydrocerussite | 5.BE.10 | Pb3(CO3)2(OH)2 |
| ⓘ | Phosgenite | 5.BE.20 | Pb2CO3Cl2 |
| ⓘ | Bismutite | 5.BE.25 | (BiO)2CO3 |
| ⓘ | Brianyoungite | 5.BF.30 | Zn3(CO3,SO4)(OH)4 |
| ⓘ | Leadhillite | 5.BF.40 | Pb4(CO3)2(SO4)(OH)2 |
| ⓘ | Macphersonite | 5.BF.40 | Pb4(CO3)2(SO4)(OH)2 |
| ⓘ | Susannite | 5.BF.40 | Pb4(CO3)2(SO4)(OH)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Antlerite | 7.BB.15 | Cu3(SO4)(OH)4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Alunite | 7.BC.10 | KAl3(SO4)2(OH)6 |
| ⓘ | Beaverite-(Cu) | 7.BC.10 | Pb(Fe3+2Cu)(SO4)2(OH)6 |
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Plumbojarosite | 7.BC.10 | Pb0.5Fe3+3(SO4)2(OH)6 |
| ⓘ | Caledonite | 7.BC.50 | Pb5Cu2(SO4)3(CO3)(OH)6 |
| ⓘ | Linarite | 7.BC.65 | PbCu(SO4)(OH)2 |
| ⓘ | Chenite | 7.BC.70 | Pb4Cu(SO4)2(OH)6 |
| ⓘ | Lanarkite | 7.BD.40 | Pb2(SO4)O |
| ⓘ | Chalcanthite ? | 7.CB.20 | CuSO4 · 5H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Langite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Posnjakite | 7.DD.10 | Cu4(SO4)(OH)6 · H2O |
| ⓘ | Wroewolfeite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Devilline | 7.DD.30 | CaCu4(SO4)2(OH)6 · 3H2O |
| ⓘ | Serpierite | 7.DD.30 | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| ⓘ | Bechererite | 7.DD.55 | Zn7Cu(OH)13[(SiO(OH)3(SO4)] |
| ⓘ | Ramsbeckite | 7.DD.60 | (Cu,Zn)15(SO4)4(OH)22 · 6H2O |
| ⓘ | Redgillite (TL) | 7.DD.70 | Cu6(SO4)(OH)10 · H2O |
| ⓘ | Schulenbergite | 7.DD.80 | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| ⓘ | Montetrisaite ? | 7.DD.85 | Cu6(SO4)(OH)10 · 2H2O |
| ⓘ | Cyanotrichite | 7.DE.10 | Cu4Al2(SO4)(OH)12 · 2H2O |
| ⓘ | Elyite | 7.DF.65 | Pb4Cu(SO4)O2(OH)4 · H2O |
| ⓘ | Crocoite ? | 7.FA.20 | PbCr6+O4 |
| ⓘ | Powellite | 7.GA.05 | Ca(MoO4) |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| ⓘ | Stolzite | 7.GA.05 | Pb(WO4) |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| ⓘ | Lindgrenite ? | 7.GB.05 | Cu3(MoO4)2(OH)2 |
| ⓘ | Ferrimolybdite | 7.GB.30 | Fe2(MoO4)3 · nH2O |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Schulténite | 8.AD.30 | Pb(HAsO4) |
| ⓘ | Xenotime-(Y) | 8.AD.35 | Y(PO4) |
| ⓘ | Rooseveltite | 8.AD.50 | Bi(AsO4) |
| ⓘ | Adamite | 8.BB.30 | Zn2(AsO4)(OH) |
| ⓘ | var. Copper-bearing Adamite | 8.BB.30 | (Zn,Cu)2AsO4OH |
| ⓘ | Libethenite | 8.BB.30 | Cu2(PO4)(OH) |
| ⓘ | Olivenite | 8.BB.30 | Cu2(AsO4)(OH) |
| ⓘ | Rockbridgeite | 8.BC.10 | (Fe2+0.5Fe3+0.5)2Fe3+3(PO4)3(OH)5 |
| ⓘ | Cornwallite | 8.BD.05 | Cu5(AsO4)2(OH)4 |
| ⓘ | Pseudomalachite | 8.BD.05 | Cu5(PO4)2(OH)4 |
| ⓘ | Cornubite | 8.BD.30 | Cu5(AsO4)2(OH)4 |
| ⓘ | Arsentsumebite | 8.BG.05 | Pb2Cu(AsO4)(SO4)(OH) |
| ⓘ | Tsumebite | 8.BG.05 | Pb2Cu(PO4)(SO4)(OH) |
| ⓘ | Carminite | 8.BH.30 | PbFe3+2(AsO4)2(OH)2 |
| ⓘ | Arsendescloizite | 8.BH.35 | PbZn(AsO4)(OH) |
| ⓘ | Duftite var. Calcio-duftite | 8.BH.35 | (Pb,Ca)CuAsO4(OH) |
| ⓘ | Conichalcite ? | 8.BH.35 | CaCu(AsO4)(OH) |
| ⓘ | Duftite | 8.BH.35 | PbCu(AsO4)(OH) |
| ⓘ | 'Duftite-alpha' | 8.BH.35 | PbCu(AsO4)(OH) |
| ⓘ | Duftite var. Duftite-β | 8.BH.35 | PbCu(AsO4)(OH) |
| ⓘ | Descloizite | 8.BH.40 | PbZn(VO4)(OH) |
| ⓘ | Mottramite | 8.BH.40 | PbCu(VO4)(OH) |
| ⓘ | Bayldonite | 8.BH.45 | PbCu3(AsO4)2(OH)2 |
| ⓘ | Beudantite | 8.BL.05 | PbFe3+3(AsO4)(SO4)(OH)6 |
| ⓘ | Corkite | 8.BL.05 | PbFe3+3(PO4)(SO4)(OH)6 |
| ⓘ | Hidalgoite ? | 8.BL.05 | PbAl3(AsO4)(SO4)(OH)6 |
| ⓘ | Hinsdalite | 8.BL.05 | PbAl3(PO4)(SO4)(OH)6 |
| ⓘ | Kintoreite | 8.BL.10 | PbFe3(PO4)(PO3OH)(OH)6 |
| ⓘ | Plumbogummite | 8.BL.10 | PbAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Segnitite | 8.BL.10 | PbFe3+3AsO4(AsO3OH)(OH)6 |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Hedyphane | 8.BN.05 | Ca2Pb3(AsO4)3Cl |
| ⓘ | Mimetite | 8.BN.05 | Pb5(AsO4)3Cl |
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Vanadinite | 8.BN.05 | Pb5(VO4)3Cl |
| ⓘ | Mimetite var. Campylite | 8.BN.05 | Pb5(AsO4)3Cl |
| ⓘ | Phosphohedyphane | 8.BN.05 | Ca2Pb3(PO4)3Cl |
| ⓘ | Preisingerite | 8.BO.10 | Bi3(AsO4)2O(OH) |
| ⓘ | Petitjeanite | 8.BO.10 | Bi3(PO4)2O(OH) |
| ⓘ | Parahopeite ? | 8.CA.70 | Zn3(PO4)2 · 4H2O |
| ⓘ | Scorodite | 8.CD.10 | Fe3+AsO4 · 2H2O |
| ⓘ | Strengite | 8.CD.10 | FePO4 · 2H2O |
| ⓘ | Switzerite | 8.CE.25 | Mn2+3(PO4)2 · 7H2O |
| ⓘ | Annabergite | 8.CE.40 | Ni3(AsO4)2 · 8H2O |
| ⓘ | Erythrite | 8.CE.40 | Co3(AsO4)2 · 8H2O |
| ⓘ | Köttigite | 8.CE.40 | Zn3(AsO4)2 · 8H2O |
| ⓘ | Parasymplesite | 8.CE.40 | Fe2+3(AsO4)2 · 8H2O |
| ⓘ | Vivianite | 8.CE.40 | Fe2+Fe2+2(PO4)2 · 8H2O |
| ⓘ | Symplesite | 8.CE.45 | Fe2+3(AsO4)2 · 8H2O |
| ⓘ | Mawbyite | 8.CG.15 | PbFe3+2(AsO4)2(OH)2 |
| ⓘ | Phaunouxite | 8.CJ.40 | Ca3(AsO4)2 · 11H2O |
| ⓘ | Pitticite | 8.DB.05 | (Fe, AsO4, H2O) (?) |
| ⓘ | Ianbruceite | 8.DC. | Zn2(AsO4)(OH) · 3H2O |
| ⓘ | Strashimirite | 8.DC.12 | Cu8(AsO4)4(OH)4 · 5H2O |
| ⓘ | Metavivianite | 8.DC.25 | Fe2+Fe3+2(PO4)2(OH)2 · 6H2O |
| ⓘ | Beraunite | 8.DC.27 | Fe3+6(PO4)4O(OH)4 · 6H2O |
| ⓘ | Cacoxenite | 8.DC.40 | Fe3+24AlO6(PO4)17(OH)12 · 75H2O |
| ⓘ | Chenevixite | 8.DD.05 | Cu2Fe3+2(AsO4)2(OH)4 |
| ⓘ | Turquoise | 8.DD.15 | CuAl6(PO4)4(OH)8 · 4H2O |
| ⓘ | Kipushite ? | 8.DE. | (Cu,Zn)5Zn(PO4)2(OH)6 · H2O |
| ⓘ | Philipsburgite | 8.DE.35 | Cu5Zn(AsO4)(PO4)(OH)6 · H2O |
| ⓘ | Liroconite ? | 8.DF.20 | Cu2Al(AsO4)(OH)4 · 4H2O |
| ⓘ | Chalcophyllite | 8.DF.30 | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| ⓘ | Parnauite | 8.DF.35 | Cu9(AsO4)2(SO4)(OH)10 · 7H2O |
| ⓘ | Lavendulan | 8.DG.05 | NaCaCu5(AsO4)4Cl · 5H2O |
| ⓘ | Arseniosiderite | 8.DH.30 | Ca2Fe3+3(AsO4)3O2 · 3H2O |
| ⓘ | Bariopharmacosiderite | 8.DK.10 | Ba0.5Fe3+4(AsO4)3(OH)4 · 5H2O |
| ⓘ | Pharmacosiderite | 8.DK.10 | KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| ⓘ | Dufrénite | 8.DK.15 | Ca0.5Fe2+Fe3+5(PO4)4(OH)6 · 2H2O |
| ⓘ | Agardite-(La) | 8.DL.15 | LaCu6(AsO4)3(OH)6 · 3H2O |
| ⓘ | Zálesíite | 8.DL.15 | CaCu6(AsO4)2(AsO3OH)(OH)6 · 3H2O |
| ⓘ | Betpakdalite-CaMg | 8.DM. | [Ca2(H2O)17Mg(H2O)6][Mo8As2Fe3+3O36(OH)] |
| ⓘ | Tyrolite | 8.DM.10 | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| ⓘ | Wooldridgeite | 8.FC.25 | Na2CaCu2+2(P2O7)2 · 10H2O |
| Group 9 - Silicates | |||
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | var. Chiastolite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Braunite ? | 9.AG.05 | Mn2+Mn3+6(SiO4)O8 |
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | Mattheddleite | 9.AH.25 | Pb5(SiO4)1.5(SO4)1.5(Cl,OH) |
| ⓘ | Hemimorphite | 9.BD.10 | Zn4Si2O7(OH)2 · H2O |
| ⓘ | Queitite | 9.BF.20 | Pb4Zn2(SO4)(SiO4)(Si2O7) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Cordierite | 9.CJ.10 | Mg2Al4Si5O18 |
| ⓘ | Dioptase ? | 9.CJ.30 | CuSiO3 · H2O |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Carpholite ? | 9.DB.05 | Mn2+Al2(Si2O6)(OH)4 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Rhodonite ? | 9.DK.05 | CaMn3Mn[Si5O15] |
| ⓘ | Prehnite ? | 9.DP.20 | Ca2Al2Si3O10(OH)2 |
| ⓘ | Plancheite ? | 9.DP.55 | Cu8(Si8O22)(OH)4 · H2O |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Muscovite var. Gilbertite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | var. Illite | 9.EC.15 | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Hisingerite | 9.ED.10 | Fe3+2(Si2O5)(OH)4 · 2H2O |
| ⓘ | Fraipontite | 9.ED.15 | (Zn,Al)3((Si,Al)2O5)(OH)4 |
| ⓘ | Allophane | 9.ED.20 | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Palygorskite | 9.EE.20 | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Andesine | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ | var. Anorthoclase | 9.FA.35 | (Na,K)AlSi3O8 |
| ⓘ | var. Oligoclase | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ | Stilbite-Ca ? | 9.GE.10 | NaCa4(Si27Al9)O72 · 28H2O |
| Unclassified | |||
| ⓘ | 'Agardite' | - | |
| ⓘ | 'Amphibole Supergroup' | - | AB2C5(T8O22)W2 |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Bismuth Ochre' | - | |
| ⓘ | 'Brewsterite Subgroup' ? | - | |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Psilomelane' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Wad' | - | |
| ⓘ | 'Mica Group' | - | |
| ⓘ | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
| ⓘ | 'Copper Pitch Ore' | - | |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Smectite Group' | - | A0.3D2-3[T4O10]Z2 · nH2O |
| ⓘ | 'Manganese Oxides' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
| ⓘ | 'Tetrahedrite Group' | - | M2(A6)M1(B4 C2)X3(D4)S1(Y12)S2(Z) |
| ⓘ | 'Apatite Group' | - | |
| ⓘ | 'Mimetite-Pyromorphite Series' | - | |
| ⓘ | 'Grünlingite' ? | - | |
| ⓘ | 'Iron oxide' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Adamite | Zn2(AsO4)(OH) |
| H | ⓘ Agardite-(La) | LaCu6(AsO4)3(OH)6 · 3H2O |
| H | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| H | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| H | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| H | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| H | ⓘ Arsendescloizite | PbZn(AsO4)(OH) |
| H | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| H | ⓘ Arsentsumebite | Pb2Cu(AsO4)(SO4)(OH) |
| H | ⓘ Asbolane | (Ni,Co)2-xMn4+(O,OH)4 · nH2O |
| H | ⓘ Atacamite | Cu2(OH)3Cl |
| H | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Bariopharmacosiderite | Ba0.5Fe43+(AsO4)3(OH)4 · 5H2O |
| H | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| H | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| H | ⓘ Bechererite | Zn7Cu(OH)13[(SiO(OH)3(SO4)] |
| H | ⓘ Beraunite | Fe63+(PO4)4O(OH)4 · 6H2O |
| H | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| H | ⓘ Duftite var. Calcio-duftite | (Pb,Ca)CuAsO4(OH) |
| H | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| H | ⓘ Carminite | PbFe23+(AsO4)2(OH)2 |
| H | ⓘ Carpholite | Mn2+Al2(Si2O6)(OH)4 |
| H | ⓘ Cesàrolite | PbMn34+O6(OH)2 |
| H | ⓘ Chalcanthite | CuSO4 · 5H2O |
| H | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| H | ⓘ Chenevixite | Cu2Fe23+(AsO4)2(OH)4 |
| H | ⓘ Chenite | Pb4Cu(SO4)2(OH)6 |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| H | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| H | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| H | ⓘ Cornubite | Cu5(AsO4)2(OH)4 |
| H | ⓘ Cornwallite | Cu5(AsO4)2(OH)4 |
| H | ⓘ Adamite var. Copper-bearing Adamite | (Zn,Cu)2AsO4OH |
| H | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| H | ⓘ Descloizite | PbZn(VO4)(OH) |
| H | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| H | ⓘ Dioptase | CuSiO3 · H2O |
| H | ⓘ Dufrénite | Ca0.5Fe2+Fe53+(PO4)4(OH)6 · 2H2O |
| H | ⓘ Duftite | PbCu(AsO4)(OH) |
| H | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| H | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| H | ⓘ Fraipontite | (Zn,Al)3((Si,Al)2O5)(OH)4 |
| H | ⓘ Muscovite var. Gilbertite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| H | ⓘ Hidalgoite | PbAl3(AsO4)(SO4)(OH)6 |
| H | ⓘ Hinsdalite | PbAl3(PO4)(SO4)(OH)6 |
| H | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| H | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| H | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| H | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Kintoreite | PbFe3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Kipushite | (Cu,Zn)5Zn(PO4)2(OH)6 · H2O |
| H | ⓘ Köttigite | Zn3(AsO4)2 · 8H2O |
| H | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| H | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| H | ⓘ Lepidocrocite | Fe3+O(OH) |
| H | ⓘ Libethenite | Cu2(PO4)(OH) |
| H | ⓘ Linarite | PbCu(SO4)(OH)2 |
| H | ⓘ Lindgrenite | Cu3(MoO4)2(OH)2 |
| H | ⓘ Liroconite | Cu2Al(AsO4)(OH)4 · 4H2O |
| H | ⓘ Macphersonite | Pb4(CO3)2(SO4)(OH)2 |
| H | ⓘ Manganite | Mn3+O(OH) |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Mattheddleite | Pb5(SiO4)1.5(SO4)1.5(Cl,OH) |
| H | ⓘ Mawbyite | PbFe23+(AsO4)2(OH)2 |
| H | ⓘ Metavivianite | Fe2+Fe23+(PO4)2(OH)2 · 6H2O |
| H | ⓘ Mottramite | PbCu(VO4)(OH) |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Olivenite | Cu2(AsO4)(OH) |
| H | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| H | ⓘ Parahopeite | Zn3(PO4)2 · 4H2O |
| H | ⓘ Parasymplesite | Fe32+(AsO4)2 · 8H2O |
| H | ⓘ Parnauite | Cu9(AsO4)2(SO4)(OH)10 · 7H2O |
| H | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| H | ⓘ Phaunouxite | Ca3(AsO4)2 · 11H2O |
| H | ⓘ Philipsburgite | Cu5Zn(AsO4)(PO4)(OH)6 · H2O |
| H | ⓘ Pitticite | (Fe, AsO4, H2O) (?) |
| H | ⓘ Plancheite | Cu8(Si8O22)(OH)4 · H2O |
| H | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| H | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| H | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| H | ⓘ Preisingerite | Bi3(AsO4)2O(OH) |
| H | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| H | ⓘ Petitjeanite | Bi3(PO4)2O(OH) |
| H | ⓘ Ramsbeckite | (Cu,Zn)15(SO4)4(OH)22 · 6H2O |
| H | ⓘ Rockbridgeite | (Fe2+0.5Fe3+0.5)2Fe33+(PO4)3(OH)5 |
| H | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| H | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| H | ⓘ Schulténite | Pb(HAsO4) |
| H | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| H | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| H | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| H | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| H | ⓘ Strashimirite | Cu8(AsO4)4(OH)4 · 5H2O |
| H | ⓘ Strengite | FePO4 · 2H2O |
| H | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| H | ⓘ Switzerite | Mn32+(PO4)2 · 7H2O |
| H | ⓘ Symplesite | Fe32+(AsO4)2 · 8H2O |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Tsumebite | Pb2Cu(PO4)(SO4)(OH) |
| H | ⓘ Tungstite | WO3 · H2O |
| H | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| H | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| H | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| H | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Duftite-alpha | PbCu(AsO4)(OH) |
| H | ⓘ Zálesíite | CaCu6(AsO4)2(AsO3OH)(OH)6 · 3H2O |
| H | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| H | ⓘ Wooldridgeite | Na2CaCu22+(P2O7)2 · 10H2O |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Redgillite | Cu6(SO4)(OH)10 · H2O |
| H | ⓘ Duftite var. Duftite-β | PbCu(AsO4)(OH) |
| H | ⓘ Smectite Group | A0.3D2-3[T4O10]Z2 · nH2O |
| H | ⓘ Montetrisaite | Cu6(SO4)(OH)10 · 2H2O |
| H | ⓘ Betpakdalite-CaMg | [Ca2(H2O)17Mg(H2O)6][Mo8As2Fe33+O36(OH)] |
| H | ⓘ Ianbruceite | Zn2(AsO4)(OH) · 3H2O |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Bismutite | (BiO)2CO3 |
| C | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| C | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| C | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| C | ⓘ Macphersonite | Pb4(CO3)2(SO4)(OH)2 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Phosgenite | Pb2CO3Cl2 |
| C | ⓘ Rhodochrosite | MnCO3 |
| C | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Smithsonite | ZnCO3 |
| C | ⓘ Strontianite | SrCO3 |
| C | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| C | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| C | ⓘ Witherite | BaCO3 |
| C | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Adamite | Zn2(AsO4)(OH) |
| O | ⓘ Agardite-(La) | LaCu6(AsO4)3(OH)6 · 3H2O |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| O | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| O | ⓘ Amphibole Supergroup | AB2C5(T8O22)W2 |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| O | ⓘ Albite var. Anorthoclase | (Na,K)AlSi3O8 |
| O | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Arsendescloizite | PbZn(AsO4)(OH) |
| O | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| O | ⓘ Arsentsumebite | Pb2Cu(AsO4)(SO4)(OH) |
| O | ⓘ Asbolane | (Ni,Co)2-xMn4+(O,OH)4 · nH2O |
| O | ⓘ Atacamite | Cu2(OH)3Cl |
| O | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Bariopharmacosiderite | Ba0.5Fe43+(AsO4)3(OH)4 · 5H2O |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| O | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| O | ⓘ Bechererite | Zn7Cu(OH)13[(SiO(OH)3(SO4)] |
| O | ⓘ Beraunite | Fe63+(PO4)4O(OH)4 · 6H2O |
| O | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| O | ⓘ Bindheimite | Pb2Sb2O6O |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Bismite | Bi2O3 |
| O | ⓘ Bismutite | (BiO)2CO3 |
| O | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| O | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Brookite | TiO2 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| O | ⓘ Duftite var. Calcio-duftite | (Pb,Ca)CuAsO4(OH) |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| O | ⓘ Carminite | PbFe23+(AsO4)2(OH)2 |
| O | ⓘ Carpholite | Mn2+Al2(Si2O6)(OH)4 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Cesàrolite | PbMn34+O6(OH)2 |
| O | ⓘ Chalcanthite | CuSO4 · 5H2O |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| O | ⓘ Chenevixite | Cu2Fe23+(AsO4)2(OH)4 |
| O | ⓘ Chenite | Pb4Cu(SO4)2(OH)6 |
| O | ⓘ Andalusite var. Chiastolite | Al2(SiO4)O |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Claudetite | As2O3 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| O | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| O | ⓘ Cordierite | Mg2Al4Si5O18 |
| O | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| O | ⓘ Cornubite | Cu5(AsO4)2(OH)4 |
| O | ⓘ Cornwallite | Cu5(AsO4)2(OH)4 |
| O | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| O | ⓘ Corundum | Al2O3 |
| O | ⓘ Crocoite | PbCr6+O4 |
| O | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Adamite var. Copper-bearing Adamite | (Zn,Cu)2AsO4OH |
| O | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| O | ⓘ Descloizite | PbZn(VO4)(OH) |
| O | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| O | ⓘ Dioptase | CuSiO3 · H2O |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Dufrénite | Ca0.5Fe2+Fe53+(PO4)4(OH)6 · 2H2O |
| O | ⓘ Duftite | PbCu(AsO4)(OH) |
| O | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| O | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Fraipontite | (Zn,Al)3((Si,Al)2O5)(OH)4 |
| O | ⓘ Muscovite var. Gilbertite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hedyphane | Ca2Pb3(AsO4)3Cl |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| O | ⓘ Hidalgoite | PbAl3(AsO4)(SO4)(OH)6 |
| O | ⓘ Hinsdalite | PbAl3(PO4)(SO4)(OH)6 |
| O | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| O | ⓘ Hübnerite | MnWO4 |
| O | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| O | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| O | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Kermesite | Sb2S2O |
| O | ⓘ Kintoreite | PbFe3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Kipushite | (Cu,Zn)5Zn(PO4)2(OH)6 · H2O |
| O | ⓘ Köttigite | Zn3(AsO4)2 · 8H2O |
| O | ⓘ Lanarkite | Pb2(SO4)O |
| O | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| O | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| O | ⓘ Lepidocrocite | Fe3+O(OH) |
| O | ⓘ Libethenite | Cu2(PO4)(OH) |
| O | ⓘ Linarite | PbCu(SO4)(OH)2 |
| O | ⓘ Lindgrenite | Cu3(MoO4)2(OH)2 |
| O | ⓘ Liroconite | Cu2Al(AsO4)(OH)4 · 4H2O |
| O | ⓘ Macphersonite | Pb4(CO3)2(SO4)(OH)2 |
| O | ⓘ Manganite | Mn3+O(OH) |
| O | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Mattheddleite | Pb5(SiO4)1.5(SO4)1.5(Cl,OH) |
| O | ⓘ Mawbyite | PbFe23+(AsO4)2(OH)2 |
| O | ⓘ Metavivianite | Fe2+Fe23+(PO4)2(OH)2 · 6H2O |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Mimetite | Pb5(AsO4)3Cl |
| O | ⓘ Mottramite | PbCu(VO4)(OH) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Olivenite | Cu2(AsO4)(OH) |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| O | ⓘ Parahopeite | Zn3(PO4)2 · 4H2O |
| O | ⓘ Parasymplesite | Fe32+(AsO4)2 · 8H2O |
| O | ⓘ Parnauite | Cu9(AsO4)2(SO4)(OH)10 · 7H2O |
| O | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| O | ⓘ Phaunouxite | Ca3(AsO4)2 · 11H2O |
| O | ⓘ Philipsburgite | Cu5Zn(AsO4)(PO4)(OH)6 · H2O |
| O | ⓘ Phosgenite | Pb2CO3Cl2 |
| O | ⓘ Pitticite | (Fe, AsO4, H2O) (?) |
| O | ⓘ Plancheite | Cu8(Si8O22)(OH)4 · H2O |
| O | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| O | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| O | ⓘ Powellite | Ca(MoO4) |
| O | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| O | ⓘ Preisingerite | Bi3(AsO4)2O(OH) |
| O | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Petitjeanite | Bi3(PO4)2O(OH) |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Queitite | Pb4Zn2(SO4)(SiO4)(Si2O7) |
| O | ⓘ Ramsbeckite | (Cu,Zn)15(SO4)4(OH)22 · 6H2O |
| O | ⓘ Raspite | Pb(WO4) |
| O | ⓘ Rhodochrosite | MnCO3 |
| O | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| O | ⓘ Rockbridgeite | (Fe2+0.5Fe3+0.5)2Fe33+(PO4)3(OH)5 |
| O | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| O | ⓘ Rooseveltite | Bi(AsO4) |
| O | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| O | ⓘ Schulténite | Pb(HAsO4) |
| O | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| O | ⓘ Scotlandite | PbSO3 |
| O | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| O | ⓘ Senarmontite | Sb2O3 |
| O | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Smithsonite | ZnCO3 |
| O | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| O | ⓘ Stolzite | Pb(WO4) |
| O | ⓘ Strashimirite | Cu8(AsO4)4(OH)4 · 5H2O |
| O | ⓘ Strengite | FePO4 · 2H2O |
| O | ⓘ Strontianite | SrCO3 |
| O | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| O | ⓘ Switzerite | Mn32+(PO4)2 · 7H2O |
| O | ⓘ Symplesite | Fe32+(AsO4)2 · 8H2O |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Tenorite | CuO |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Tsumebite | Pb2Cu(PO4)(SO4)(OH) |
| O | ⓘ Tungstite | WO3 · H2O |
| O | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| O | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Vanadinite | Pb5(VO4)3Cl |
| O | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| O | ⓘ Witherite | BaCO3 |
| O | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Xenotime-(Y) | Y(PO4) |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Duftite-alpha | PbCu(AsO4)(OH) |
| O | ⓘ Quartz var. Rock Crystal | SiO2 |
| O | ⓘ Quartz var. Milky Quartz | SiO2 |
| O | ⓘ Mimetite var. Campylite | Pb5(AsO4)3Cl |
| O | ⓘ Zálesíite | CaCu6(AsO4)2(AsO3OH)(OH)6 · 3H2O |
| O | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| O | ⓘ Wooldridgeite | Na2CaCu22+(P2O7)2 · 10H2O |
| O | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Pyroxene Group | ADSi2O6 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Claudetite var. Antimony-bearing Claudetite | (As,Sb)2O3 |
| O | ⓘ Redgillite | Cu6(SO4)(OH)10 · H2O |
| O | ⓘ Duftite var. Duftite-β | PbCu(AsO4)(OH) |
| O | ⓘ Smectite Group | A0.3D2-3[T4O10]Z2 · nH2O |
| O | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| O | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| O | ⓘ Apatite | Ca5(PO4)3A |
| O | ⓘ Montetrisaite | Cu6(SO4)(OH)10 · 2H2O |
| O | ⓘ Stibioclaudetite | AsSbO3 |
| O | ⓘ Mimetite-Pyromorphite Series | |
| O | ⓘ Betpakdalite-CaMg | [Ca2(H2O)17Mg(H2O)6][Mo8As2Fe33+O36(OH)] |
| O | ⓘ Ianbruceite | Zn2(AsO4)(OH) · 3H2O |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Albite var. Anorthoclase | (Na,K)AlSi3O8 |
| Na | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| Na | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| Na | ⓘ Wooldridgeite | Na2CaCu22+(P2O7)2 · 10H2O |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Cordierite | Mg2Al4Si5O18 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Mg | ⓘ Betpakdalite-CaMg | [Ca2(H2O)17Mg(H2O)6][Mo8As2Fe33+O36(OH)] |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Al | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Albite var. Anorthoclase | (Na,K)AlSi3O8 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| Al | ⓘ Carpholite | Mn2+Al2(Si2O6)(OH)4 |
| Al | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| Al | ⓘ Andalusite var. Chiastolite | Al2(SiO4)O |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Cordierite | Mg2Al4Si5O18 |
| Al | ⓘ Corundum | Al2O3 |
| Al | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Fraipontite | (Zn,Al)3((Si,Al)2O5)(OH)4 |
| Al | ⓘ Muscovite var. Gilbertite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Hidalgoite | PbAl3(AsO4)(SO4)(OH)6 |
| Al | ⓘ Hinsdalite | PbAl3(PO4)(SO4)(OH)6 |
| Al | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Liroconite | Cu2Al(AsO4)(OH)4 · 4H2O |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| Al | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| Al | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Albite var. Anorthoclase | (Na,K)AlSi3O8 |
| Si | ⓘ Bechererite | Zn7Cu(OH)13[(SiO(OH)3(SO4)] |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Carpholite | Mn2+Al2(Si2O6)(OH)4 |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Andalusite var. Chiastolite | Al2(SiO4)O |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Cordierite | Mg2Al4Si5O18 |
| Si | ⓘ Dioptase | CuSiO3 · H2O |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Fraipontite | (Zn,Al)3((Si,Al)2O5)(OH)4 |
| Si | ⓘ Muscovite var. Gilbertite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Si | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| Si | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Mattheddleite | Pb5(SiO4)1.5(SO4)1.5(Cl,OH) |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| Si | ⓘ Plancheite | Cu8(Si8O22)(OH)4 · H2O |
| Si | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Queitite | Pb4Zn2(SO4)(SiO4)(Si2O7) |
| Si | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Quartz var. Rock Crystal | SiO2 |
| Si | ⓘ Quartz var. Milky Quartz | SiO2 |
| Si | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Pyroxene Group | ADSi2O6 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| P | Phosphorus | |
| P | ⓘ Beraunite | Fe63+(PO4)4O(OH)4 · 6H2O |
| P | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| P | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| P | ⓘ Dufrénite | Ca0.5Fe2+Fe53+(PO4)4(OH)6 · 2H2O |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Hinsdalite | PbAl3(PO4)(SO4)(OH)6 |
| P | ⓘ Kintoreite | PbFe3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Kipushite | (Cu,Zn)5Zn(PO4)2(OH)6 · H2O |
| P | ⓘ Libethenite | Cu2(PO4)(OH) |
| P | ⓘ Metavivianite | Fe2+Fe23+(PO4)2(OH)2 · 6H2O |
| P | ⓘ Parahopeite | Zn3(PO4)2 · 4H2O |
| P | ⓘ Philipsburgite | Cu5Zn(AsO4)(PO4)(OH)6 · H2O |
| P | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Petitjeanite | Bi3(PO4)2O(OH) |
| P | ⓘ Rockbridgeite | (Fe2+0.5Fe3+0.5)2Fe33+(PO4)3(OH)5 |
| P | ⓘ Strengite | FePO4 · 2H2O |
| P | ⓘ Switzerite | Mn32+(PO4)2 · 7H2O |
| P | ⓘ Tsumebite | Pb2Cu(PO4)(SO4)(OH) |
| P | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| P | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| P | ⓘ Xenotime-(Y) | Y(PO4) |
| P | ⓘ Wooldridgeite | Na2CaCu22+(P2O7)2 · 10H2O |
| P | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| P | ⓘ Apatite | Ca5(PO4)3A |
| P | ⓘ Mimetite-Pyromorphite Series | |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Aikinite | CuPbBiS3 |
| S | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Arsentsumebite | Pb2Cu(AsO4)(SO4)(OH) |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| S | ⓘ Bechererite | Zn7Cu(OH)13[(SiO(OH)3(SO4)] |
| S | ⓘ Berthierite | FeSb2S4 |
| S | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Boulangerite | Pb5Sb4S11 |
| S | ⓘ Bournonite | PbCuSbS3 |
| S | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcanthite | CuSO4 · 5H2O |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| S | ⓘ Chenite | Pb4Cu(SO4)2(OH)6 |
| S | ⓘ Cinnabar | HgS |
| S | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| S | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| S | ⓘ Cosalite | Pb2Bi2S5 |
| S | ⓘ Covellite | CuS |
| S | ⓘ Cubanite | CuFe2S3 |
| S | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| S | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| S | ⓘ Digenite | Cu9S5 |
| S | ⓘ Djurleite | Cu31S16 |
| S | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| S | ⓘ Fülöppite | Pb3Sb8S15 |
| S | ⓘ Galena | PbS |
| S | ⓘ Gersdorffite | NiAsS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Hidalgoite | PbAl3(AsO4)(SO4)(OH)6 |
| S | ⓘ Hinsdalite | PbAl3(PO4)(SO4)(OH)6 |
| S | ⓘ Ingodite | Bi2TeS |
| S | ⓘ Jamesonite | Pb4FeSb6S14 |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Joséite | Bi4TeS2 |
| S | ⓘ Joséite-A | Bi4TeS2 |
| S | ⓘ Joséite-B | Bi4Te2S |
| S | ⓘ Kermesite | Sb2S2O |
| S | ⓘ Krupkaite | CuPbBi3S6 |
| S | ⓘ Lanarkite | Pb2(SO4)O |
| S | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| S | ⓘ Linarite | PbCu(SO4)(OH)2 |
| S | ⓘ Macphersonite | Pb4(CO3)2(SO4)(OH)2 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Mattheddleite | Pb5(SiO4)1.5(SO4)1.5(Cl,OH) |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Parnauite | Cu9(AsO4)2(SO4)(OH)10 · 7H2O |
| S | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| S | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Queitite | Pb4Zn2(SO4)(SiO4)(Si2O7) |
| S | ⓘ Ramsbeckite | (Cu,Zn)15(SO4)4(OH)22 · 6H2O |
| S | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| S | ⓘ Scotlandite | PbSO3 |
| S | ⓘ Semseyite | Pb9Sb8S21 |
| S | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Native Sulphur | S8 |
| S | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| S | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| S | ⓘ Tetradymite | Bi2Te2S |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Tsumebite | Pb2Cu(PO4)(SO4)(OH) |
| S | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Yarrowite | Cu9S8 |
| S | ⓘ Zinkenite | Pb9Sb22S42 |
| S | ⓘ Sphalerite var. Marmatite | (Zn,Fe)S |
| S | ⓘ Redgillite | Cu6(SO4)(OH)10 · H2O |
| S | ⓘ Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| S | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| S | ⓘ Tetrahedrite Group | M2(A6)M1(B4 C2)X3(D4)S1(Y12)S2(Z) |
| S | ⓘ Montetrisaite | Cu6(SO4)(OH)10 · 2H2O |
| Cl | Chlorine | |
| Cl | ⓘ Atacamite | Cu2(OH)3Cl |
| Cl | ⓘ Chlorargyrite | AgCl |
| Cl | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Cl | ⓘ Hedyphane | Ca2Pb3(AsO4)3Cl |
| Cl | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| Cl | ⓘ Mattheddleite | Pb5(SiO4)1.5(SO4)1.5(Cl,OH) |
| Cl | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Cl | ⓘ Phosgenite | Pb2CO3Cl2 |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Cl | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Cl | ⓘ Mimetite var. Campylite | Pb5(AsO4)3Cl |
| Cl | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| Cl | ⓘ Mimetite-Pyromorphite Series | |
| K | Potassium | |
| K | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| K | ⓘ Albite var. Anorthoclase | (Na,K)AlSi3O8 |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| K | ⓘ Muscovite var. Gilbertite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| Ca | ⓘ Duftite var. Calcio-duftite | (Pb,Ca)CuAsO4(OH) |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| Ca | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Dufrénite | Ca0.5Fe2+Fe53+(PO4)4(OH)6 · 2H2O |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Hedyphane | Ca2Pb3(AsO4)3Cl |
| Ca | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| Ca | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Phaunouxite | Ca3(AsO4)2 · 11H2O |
| Ca | ⓘ Powellite | Ca(MoO4) |
| Ca | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Ca | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| Ca | ⓘ Zálesíite | CaCu6(AsO4)2(AsO3OH)(OH)6 · 3H2O |
| Ca | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| Ca | ⓘ Wooldridgeite | Na2CaCu22+(P2O7)2 · 10H2O |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Ca | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ca | ⓘ Betpakdalite-CaMg | [Ca2(H2O)17Mg(H2O)6][Mo8As2Fe33+O36(OH)] |
| Ti | Titanium | |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Brookite | TiO2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| V | Vanadium | |
| V | ⓘ Descloizite | PbZn(VO4)(OH) |
| V | ⓘ Mottramite | PbCu(VO4)(OH) |
| V | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Cr | Chromium | |
| Cr | ⓘ Crocoite | PbCr6+O4 |
| Mn | Manganese | |
| Mn | ⓘ Asbolane | (Ni,Co)2-xMn4+(O,OH)4 · nH2O |
| Mn | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| Mn | ⓘ Carpholite | Mn2+Al2(Si2O6)(OH)4 |
| Mn | ⓘ Cesàrolite | PbMn34+O6(OH)2 |
| Mn | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| Mn | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| Mn | ⓘ Hübnerite | MnWO4 |
| Mn | ⓘ Manganite | Mn3+O(OH) |
| Mn | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Rhodochrosite | MnCO3 |
| Mn | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Mn | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| Mn | ⓘ Switzerite | Mn32+(PO4)2 · 7H2O |
| Mn | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| Fe | ⓘ Bariopharmacosiderite | Ba0.5Fe43+(AsO4)3(OH)4 · 5H2O |
| Fe | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| Fe | ⓘ Beraunite | Fe63+(PO4)4O(OH)4 · 6H2O |
| Fe | ⓘ Berthierite | FeSb2S4 |
| Fe | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| Fe | ⓘ Carminite | PbFe23+(AsO4)2(OH)2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chenevixite | Cu2Fe23+(AsO4)2(OH)4 |
| Fe | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| Fe | ⓘ Cubanite | CuFe2S3 |
| Fe | ⓘ Dufrénite | Ca0.5Fe2+Fe53+(PO4)4(OH)6 · 2H2O |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Jamesonite | Pb4FeSb6S14 |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Kintoreite | PbFe3(PO4)(PO3OH)(OH)6 |
| Fe | ⓘ Lepidocrocite | Fe3+O(OH) |
| Fe | ⓘ Löllingite | FeAs2 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Mawbyite | PbFe23+(AsO4)2(OH)2 |
| Fe | ⓘ Metavivianite | Fe2+Fe23+(PO4)2(OH)2 · 6H2O |
| Fe | ⓘ Parasymplesite | Fe32+(AsO4)2 · 8H2O |
| Fe | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| Fe | ⓘ Pitticite | (Fe, AsO4, H2O) (?) |
| Fe | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Rockbridgeite | (Fe2+0.5Fe3+0.5)2Fe33+(PO4)3(OH)5 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Fe | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Strengite | FePO4 · 2H2O |
| Fe | ⓘ Symplesite | Fe32+(AsO4)2 · 8H2O |
| Fe | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| Fe | ⓘ Sphalerite var. Marmatite | (Zn,Fe)S |
| Fe | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Fe | ⓘ Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| Fe | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Fe | ⓘ Betpakdalite-CaMg | [Ca2(H2O)17Mg(H2O)6][Mo8As2Fe33+O36(OH)] |
| Co | Cobalt | |
| Co | ⓘ Asbolane | (Ni,Co)2-xMn4+(O,OH)4 · nH2O |
| Co | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| Ni | Nickel | |
| Ni | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| Ni | ⓘ Asbolane | (Ni,Co)2-xMn4+(O,OH)4 · nH2O |
| Ni | ⓘ Breithauptite | NiSb |
| Ni | ⓘ Gersdorffite | NiAsS |
| Cu | Copper | |
| Cu | ⓘ Agardite-(La) | LaCu6(AsO4)3(OH)6 · 3H2O |
| Cu | ⓘ Aikinite | CuPbBiS3 |
| Cu | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| Cu | ⓘ Arsentsumebite | Pb2Cu(AsO4)(SO4)(OH) |
| Cu | ⓘ Atacamite | Cu2(OH)3Cl |
| Cu | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| Cu | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| Cu | ⓘ Bechererite | Zn7Cu(OH)13[(SiO(OH)3(SO4)] |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Bournonite | PbCuSbS3 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Duftite var. Calcio-duftite | (Pb,Ca)CuAsO4(OH) |
| Cu | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcanthite | CuSO4 · 5H2O |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| Cu | ⓘ Chenevixite | Cu2Fe23+(AsO4)2(OH)4 |
| Cu | ⓘ Chenite | Pb4Cu(SO4)2(OH)6 |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| Cu | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Cu | ⓘ Cornubite | Cu5(AsO4)2(OH)4 |
| Cu | ⓘ Cornwallite | Cu5(AsO4)2(OH)4 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cubanite | CuFe2S3 |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Adamite var. Copper-bearing Adamite | (Zn,Cu)2AsO4OH |
| Cu | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Cu | ⓘ Digenite | Cu9S5 |
| Cu | ⓘ Dioptase | CuSiO3 · H2O |
| Cu | ⓘ Djurleite | Cu31S16 |
| Cu | ⓘ Duftite | PbCu(AsO4)(OH) |
| Cu | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| Cu | ⓘ Kipushite | (Cu,Zn)5Zn(PO4)2(OH)6 · H2O |
| Cu | ⓘ Krupkaite | CuPbBi3S6 |
| Cu | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| Cu | ⓘ Libethenite | Cu2(PO4)(OH) |
| Cu | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Cu | ⓘ Lindgrenite | Cu3(MoO4)2(OH)2 |
| Cu | ⓘ Liroconite | Cu2Al(AsO4)(OH)4 · 4H2O |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Mottramite | PbCu(VO4)(OH) |
| Cu | ⓘ Olivenite | Cu2(AsO4)(OH) |
| Cu | ⓘ Parnauite | Cu9(AsO4)2(SO4)(OH)10 · 7H2O |
| Cu | ⓘ Philipsburgite | Cu5Zn(AsO4)(PO4)(OH)6 · H2O |
| Cu | ⓘ Plancheite | Cu8(Si8O22)(OH)4 · H2O |
| Cu | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| Cu | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| Cu | ⓘ Ramsbeckite | (Cu,Zn)15(SO4)4(OH)22 · 6H2O |
| Cu | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Cu | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| Cu | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| Cu | ⓘ Strashimirite | Cu8(AsO4)4(OH)4 · 5H2O |
| Cu | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Cu | ⓘ Tenorite | CuO |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Tsumebite | Pb2Cu(PO4)(SO4)(OH) |
| Cu | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| Cu | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| Cu | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Yarrowite | Cu9S8 |
| Cu | ⓘ Duftite-alpha | PbCu(AsO4)(OH) |
| Cu | ⓘ Zálesíite | CaCu6(AsO4)2(AsO3OH)(OH)6 · 3H2O |
| Cu | ⓘ Wooldridgeite | Na2CaCu22+(P2O7)2 · 10H2O |
| Cu | ⓘ Redgillite | Cu6(SO4)(OH)10 · H2O |
| Cu | ⓘ Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| Cu | ⓘ Duftite var. Duftite-β | PbCu(AsO4)(OH) |
| Cu | ⓘ Montetrisaite | Cu6(SO4)(OH)10 · 2H2O |
| Zn | Zinc | |
| Zn | ⓘ Adamite | Zn2(AsO4)(OH) |
| Zn | ⓘ Arsendescloizite | PbZn(AsO4)(OH) |
| Zn | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Zn | ⓘ Bechererite | Zn7Cu(OH)13[(SiO(OH)3(SO4)] |
| Zn | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| Zn | ⓘ Adamite var. Copper-bearing Adamite | (Zn,Cu)2AsO4OH |
| Zn | ⓘ Descloizite | PbZn(VO4)(OH) |
| Zn | ⓘ Fraipontite | (Zn,Al)3((Si,Al)2O5)(OH)4 |
| Zn | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Zn | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| Zn | ⓘ Kipushite | (Cu,Zn)5Zn(PO4)2(OH)6 · H2O |
| Zn | ⓘ Köttigite | Zn3(AsO4)2 · 8H2O |
| Zn | ⓘ Parahopeite | Zn3(PO4)2 · 4H2O |
| Zn | ⓘ Philipsburgite | Cu5Zn(AsO4)(PO4)(OH)6 · H2O |
| Zn | ⓘ Queitite | Pb4Zn2(SO4)(SiO4)(Si2O7) |
| Zn | ⓘ Ramsbeckite | (Cu,Zn)15(SO4)4(OH)22 · 6H2O |
| Zn | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Zn | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| Zn | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| Zn | ⓘ Smithsonite | ZnCO3 |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Sphalerite var. Marmatite | (Zn,Fe)S |
| Zn | ⓘ Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| Zn | ⓘ Ianbruceite | Zn2(AsO4)(OH) · 3H2O |
| As | Arsenic | |
| As | ⓘ Adamite | Zn2(AsO4)(OH) |
| As | ⓘ Agardite-(La) | LaCu6(AsO4)3(OH)6 · 3H2O |
| As | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Arsendescloizite | PbZn(AsO4)(OH) |
| As | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| As | ⓘ Arsentsumebite | Pb2Cu(AsO4)(SO4)(OH) |
| As | ⓘ Bariopharmacosiderite | Ba0.5Fe43+(AsO4)3(OH)4 · 5H2O |
| As | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| As | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| As | ⓘ Duftite var. Calcio-duftite | (Pb,Ca)CuAsO4(OH) |
| As | ⓘ Carminite | PbFe23+(AsO4)2(OH)2 |
| As | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| As | ⓘ Chenevixite | Cu2Fe23+(AsO4)2(OH)4 |
| As | ⓘ Claudetite | As2O3 |
| As | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| As | ⓘ Cornubite | Cu5(AsO4)2(OH)4 |
| As | ⓘ Cornwallite | Cu5(AsO4)2(OH)4 |
| As | ⓘ Adamite var. Copper-bearing Adamite | (Zn,Cu)2AsO4OH |
| As | ⓘ Duftite | PbCu(AsO4)(OH) |
| As | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| As | ⓘ Gersdorffite | NiAsS |
| As | ⓘ Hedyphane | Ca2Pb3(AsO4)3Cl |
| As | ⓘ Hidalgoite | PbAl3(AsO4)(SO4)(OH)6 |
| As | ⓘ Köttigite | Zn3(AsO4)2 · 8H2O |
| As | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| As | ⓘ Liroconite | Cu2Al(AsO4)(OH)4 · 4H2O |
| As | ⓘ Löllingite | FeAs2 |
| As | ⓘ Mawbyite | PbFe23+(AsO4)2(OH)2 |
| As | ⓘ Mimetite | Pb5(AsO4)3Cl |
| As | ⓘ Olivenite | Cu2(AsO4)(OH) |
| As | ⓘ Parasymplesite | Fe32+(AsO4)2 · 8H2O |
| As | ⓘ Parnauite | Cu9(AsO4)2(SO4)(OH)10 · 7H2O |
| As | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| As | ⓘ Phaunouxite | Ca3(AsO4)2 · 11H2O |
| As | ⓘ Philipsburgite | Cu5Zn(AsO4)(PO4)(OH)6 · H2O |
| As | ⓘ Pitticite | (Fe, AsO4, H2O) (?) |
| As | ⓘ Preisingerite | Bi3(AsO4)2O(OH) |
| As | ⓘ Rooseveltite | Bi(AsO4) |
| As | ⓘ Schulténite | Pb(HAsO4) |
| As | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| As | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| As | ⓘ Strashimirite | Cu8(AsO4)4(OH)4 · 5H2O |
| As | ⓘ Symplesite | Fe32+(AsO4)2 · 8H2O |
| As | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| As | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| As | ⓘ Duftite-alpha | PbCu(AsO4)(OH) |
| As | ⓘ Mimetite var. Campylite | Pb5(AsO4)3Cl |
| As | ⓘ Zálesíite | CaCu6(AsO4)2(AsO3OH)(OH)6 · 3H2O |
| As | ⓘ Claudetite var. Antimony-bearing Claudetite | (As,Sb)2O3 |
| As | ⓘ Duftite var. Duftite-β | PbCu(AsO4)(OH) |
| As | ⓘ Stibioclaudetite | AsSbO3 |
| As | ⓘ Mimetite-Pyromorphite Series | |
| As | ⓘ Betpakdalite-CaMg | [Ca2(H2O)17Mg(H2O)6][Mo8As2Fe33+O36(OH)] |
| As | ⓘ Ianbruceite | Zn2(AsO4)(OH) · 3H2O |
| Sr | Strontium | |
| Sr | ⓘ Strontianite | SrCO3 |
| Y | Yttrium | |
| Y | ⓘ Xenotime-(Y) | Y(PO4) |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| Nb | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Mo | Molybdenum | |
| Mo | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| Mo | ⓘ Lindgrenite | Cu3(MoO4)2(OH)2 |
| Mo | ⓘ Molybdenite | MoS2 |
| Mo | ⓘ Powellite | Ca(MoO4) |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Mo | ⓘ Betpakdalite-CaMg | [Ca2(H2O)17Mg(H2O)6][Mo8As2Fe33+O36(OH)] |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Chlorargyrite | AgCl |
| Ag | ⓘ Native Silver | Ag |
| Ag | ⓘ Sylvanite | AgAuTe4 |
| Ag | ⓘ Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| Ag | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sb | Antimony | |
| Sb | ⓘ Native Antimony | Sb |
| Sb | ⓘ Berthierite | FeSb2S4 |
| Sb | ⓘ Bindheimite | Pb2Sb2O6O |
| Sb | ⓘ Boulangerite | Pb5Sb4S11 |
| Sb | ⓘ Bournonite | PbCuSbS3 |
| Sb | ⓘ Breithauptite | NiSb |
| Sb | ⓘ Fülöppite | Pb3Sb8S15 |
| Sb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Sb | ⓘ Kermesite | Sb2S2O |
| Sb | ⓘ Semseyite | Pb9Sb8S21 |
| Sb | ⓘ Senarmontite | Sb2O3 |
| Sb | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Sb | ⓘ Zinkenite | Pb9Sb22S42 |
| Sb | ⓘ Claudetite var. Antimony-bearing Claudetite | (As,Sb)2O3 |
| Sb | ⓘ Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| Sb | ⓘ Stibioclaudetite | AsSbO3 |
| Te | Tellurium | |
| Te | ⓘ Hedleyite | Bi7Te3 |
| Te | ⓘ Ingodite | Bi2TeS |
| Te | ⓘ Joséite | Bi4TeS2 |
| Te | ⓘ Joséite-A | Bi4TeS2 |
| Te | ⓘ Joséite-B | Bi4Te2S |
| Te | ⓘ Sylvanite | AgAuTe4 |
| Te | ⓘ Tetradymite | Bi2Te2S |
| Ba | Barium | |
| Ba | ⓘ Bariopharmacosiderite | Ba0.5Fe43+(AsO4)3(OH)4 · 5H2O |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| Ba | ⓘ Witherite | BaCO3 |
| La | Lanthanum | |
| La | ⓘ Agardite-(La) | LaCu6(AsO4)3(OH)6 · 3H2O |
| W | Tungsten | |
| W | ⓘ Hübnerite | MnWO4 |
| W | ⓘ Raspite | Pb(WO4) |
| W | ⓘ Scheelite | Ca(WO4) |
| W | ⓘ Stolzite | Pb(WO4) |
| W | ⓘ Tungstite | WO3 · H2O |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| Au | ⓘ Sylvanite | AgAuTe4 |
| Hg | Mercury | |
| Hg | ⓘ Cinnabar | HgS |
| Hg | ⓘ Native Mercury | Hg |
| Pb | Lead | |
| Pb | ⓘ Aikinite | CuPbBiS3 |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Arsendescloizite | PbZn(AsO4)(OH) |
| Pb | ⓘ Arsentsumebite | Pb2Cu(AsO4)(SO4)(OH) |
| Pb | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| Pb | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| Pb | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| Pb | ⓘ Bindheimite | Pb2Sb2O6O |
| Pb | ⓘ Boulangerite | Pb5Sb4S11 |
| Pb | ⓘ Bournonite | PbCuSbS3 |
| Pb | ⓘ Duftite var. Calcio-duftite | (Pb,Ca)CuAsO4(OH) |
| Pb | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| Pb | ⓘ Carminite | PbFe23+(AsO4)2(OH)2 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Cesàrolite | PbMn34+O6(OH)2 |
| Pb | ⓘ Chenite | Pb4Cu(SO4)2(OH)6 |
| Pb | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| Pb | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| Pb | ⓘ Cosalite | Pb2Bi2S5 |
| Pb | ⓘ Crocoite | PbCr6+O4 |
| Pb | ⓘ Descloizite | PbZn(VO4)(OH) |
| Pb | ⓘ Duftite | PbCu(AsO4)(OH) |
| Pb | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| Pb | ⓘ Fülöppite | Pb3Sb8S15 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Hedyphane | Ca2Pb3(AsO4)3Cl |
| Pb | ⓘ Hidalgoite | PbAl3(AsO4)(SO4)(OH)6 |
| Pb | ⓘ Hinsdalite | PbAl3(PO4)(SO4)(OH)6 |
| Pb | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| Pb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Pb | ⓘ Kintoreite | PbFe3(PO4)(PO3OH)(OH)6 |
| Pb | ⓘ Krupkaite | CuPbBi3S6 |
| Pb | ⓘ Lanarkite | Pb2(SO4)O |
| Pb | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| Pb | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Pb | ⓘ Macphersonite | Pb4(CO3)2(SO4)(OH)2 |
| Pb | ⓘ Mattheddleite | Pb5(SiO4)1.5(SO4)1.5(Cl,OH) |
| Pb | ⓘ Mawbyite | PbFe23+(AsO4)2(OH)2 |
| Pb | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Pb | ⓘ Mottramite | PbCu(VO4)(OH) |
| Pb | ⓘ Phosgenite | Pb2CO3Cl2 |
| Pb | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| Pb | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Pb | ⓘ Queitite | Pb4Zn2(SO4)(SiO4)(Si2O7) |
| Pb | ⓘ Raspite | Pb(WO4) |
| Pb | ⓘ Schulténite | Pb(HAsO4) |
| Pb | ⓘ Scotlandite | PbSO3 |
| Pb | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| Pb | ⓘ Semseyite | Pb9Sb8S21 |
| Pb | ⓘ Stolzite | Pb(WO4) |
| Pb | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| Pb | ⓘ Tsumebite | Pb2Cu(PO4)(SO4)(OH) |
| Pb | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| Pb | ⓘ Zinkenite | Pb9Sb22S42 |
| Pb | ⓘ Duftite-alpha | PbCu(AsO4)(OH) |
| Pb | ⓘ Mimetite var. Campylite | Pb5(AsO4)3Cl |
| Pb | ⓘ Duftite var. Duftite-β | PbCu(AsO4)(OH) |
| Pb | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| Pb | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| Pb | ⓘ Mimetite-Pyromorphite Series | |
| Bi | Bismuth | |
| Bi | ⓘ Aikinite | CuPbBiS3 |
| Bi | ⓘ Bismite | Bi2O3 |
| Bi | ⓘ Native Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Bismutite | (BiO)2CO3 |
| Bi | ⓘ Cosalite | Pb2Bi2S5 |
| Bi | ⓘ Hedleyite | Bi7Te3 |
| Bi | ⓘ Ingodite | Bi2TeS |
| Bi | ⓘ Joséite | Bi4TeS2 |
| Bi | ⓘ Joséite-A | Bi4TeS2 |
| Bi | ⓘ Joséite-B | Bi4Te2S |
| Bi | ⓘ Krupkaite | CuPbBi3S6 |
| Bi | ⓘ Preisingerite | Bi3(AsO4)2O(OH) |
| Bi | ⓘ Petitjeanite | Bi3(PO4)2O(OH) |
| Bi | ⓘ Rooseveltite | Bi(AsO4) |
| Bi | ⓘ Tetradymite | Bi2Te2S |
| U | Uranium | |
| U | ⓘ Uraninite | UO2 |
Geochronology
Mineralization age: Phanerozoic : 282 Ma to 178 MaImportant note: This table is based only on rock and mineral ages recorded on mindat.org for this locality and is not necessarily a complete representation of the geochronology, but does give an indication of possible mineralization events relevant to this locality. As more age information is added this table may expand in the future. A break in the table simply indicates a lack of data entered here, not necessarily a break in the geologic sequence. Grey background entries are from different, related, localities.
| Geologic Time | Rocks, Minerals and Events | ||||||
|---|---|---|---|---|---|---|---|
| Phanerozoic | |||||||
| Mesozoic | |||||||
| Jurassic | |||||||
| Early Jurassic |
| ||||||
| Paleozoic | |||||||
| Permian | |||||||
| Cisuralian |
| ||||||
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Localities in this Region
- England
- Cumbria
- Allerdale
- Cumbria
- England
- Cumbria
- Allerdale
- Caldbeck
- Ireby and Uldale
- Eden
- ⭔LDNPA Amber Zone
- ⭔LDNPA Green Zone
- ⭔LDNPA Red Zone
- Allerdale
- Cumbria
Other Regions, Features and Areas that Intersect
British and Irish IslesGroup of Islands
Eurasian PlateTectonic Plate
- AvaloniaVolcanic Arc
EuropeContinent
UK
- England
- Cumbria
- Carrock FellFell
- Lake District National ParkNational Park
- LDNPA Amber ZoneMineral Collecting Permit Zone
- LDNPA Green ZoneMineral Collecting Permit Zone
- LDNPA Red ZoneMineral Collecting Permit Zone
- Cumbria
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
(1747) A Journey to Caudebec Fells, with a Map and Description of the Same. The Gentleman's Magazine and Historical Chronicle, 17. 522-525
(1875) “Wulfenite” at “Caldbeck Fell.”. Geological Magazine, S. 2 Vol. 2 (11) 565-566 doi:10.1017/s0016756800160546
Rastall, R. H. (1910) The Skiddaw Granite and its Metamorphism. Journal of the Geological Society, 66 (1) 116-141 doi:10.1144/gsl.jgs.1910.066.01-04.08
Rastall, R. H., Wilcockson, W. H. (1915) The Accessory Minerals of the Granitic Rocks of theEnglish Lake District. Journal of the Geological Society, 71 (1) 592-622 doi:10.1144/gsl.jgs.1915.071.01-04.22
Stansfield Kitchen, C. (1934) The Skiddaw Granite and its Residual Products. Journal of the Geological Society, 90 (1) 158-200 doi:10.1144/gsl.jgs.1934.090.01-04.07
Kingsbury, Arthur W. G., Hartley, J. (1956) New occurrences of vanadium minerals (mottramite, descloizite, and vanadinite) in the Caldbeck area of Cumberland. Mineralogical Magazine and Journal of the Mineralogical Society, 31 (235) 289-295 doi:10.1180/minmag.1956.031.235.02
Ineson, P. R., Mitchell, J. G. (1974) K-Ar isotopic age determinations from some Lake District mineral localities. Geological Magazine, 111 (6). 521-537 doi:10.1017/s0016756800041571
Braithwaite, R. S. W., Ryback, G. (1988) Philipsburgite from the Caldbeck Fells and Kipushite from Montana, and Their Infrared Spectra. Mineralogical Magazine, 52 (367) 529-533 doi:10.1180/minmag.1988.052.367.14
Quick NavTopCommoditiesMineral ListRock TypesGeochronologyFossilsLocalities in RegionOther RegionsReferences
Caldbeck Fells Mining Region, Cumbria, England, UK