Banatitic Magmatic and Metallogenetic Belt, Carpathian Mountains, Eurasian Platei
| Regional Level Types | |
|---|---|
| Banatitic Magmatic and Metallogenetic Belt | Mineral Belt |
| Carpathian Mountains | Volcanic Arc |
| Eurasian Plate | Tectonic Plate |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Sofia | 1,152,556 (2011) |
| Plovdiv | 340,494 (2016) |
| Burgas | 195,966 (2017) |
| Stara Zagora | 143,431 (2016) |
| Drobeta-Turnu Severin | 102,346 (2012) |
| Sliven | 96,368 (2016) |
Museums in region:
The 1,500-km-long Banatitic Magmatic and Metallogenetic Belt (BMMB) of Romania, Serbia and Bulgaria is a complex calc-alkaline magmatic arc of Late Cretaceous age. It hosts a variety of magmatic-hydrothermal Cu, Au, Mo, Zn, Pb and Fe deposits, including Europe’s only world-class porphyry-copper deposits. Regional metallogeny can be linked to subduction of the Vardar Ocean during the Late Cretaceous, as part of the closure of the Neotethys Ocean that had separated Europe and Africa in the Mesozoic. Porphyry Cu–(Au)– (Mo) and intimately associated epithermal massive sulphides dominate in the central segments of the belt in southernmost Banat (Romania), Serbia and north-west Bulgaria. These districts are the economically most important today, including major active Cu–Au mines at Moldova Noua˘ in Romania, Majdanpek, Veliki Krivelj and Bor in Serbia, and Elatsite, Assarel and Chelopech in Bulgaria. More numerous (and mostly mined in the past) are Fe, Cu and Zn–Pb skarns, which occur mainly at the two ends of the belt, in Eastern Bulgaria and in Romania.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities372 valid minerals. 13 (TL) - type locality of valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Acanthite Formula: Ag2S |
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ Afwillite Formula: Ca3[SiO4][SiO2(OH)2] · 2H2O References: |
| ⓘ Aikinite Formula: PbCuBiS3 |
| ⓘ Alabandite (TL) Formula: MnS Localities: Type Locality: Săcărâmb, Certeju de Sus, Hunedoara County, Romania |
| ⓘ Albite Formula: Na(AlSi3O8) Localities: Roșia Poieni Mine, Mușca, Lupșa, Alba County, Romania Bolcana Mine, Certeju de Sus, Hunedoara County, Romania Talagiu Cu-Au deposit, Chisindia, Arad County, Romania Avram Iancu mine, Băiţa mining district, Nucet, Bihor County, Romania Kanarata quarry, Hlyabovo, Topolovgrad Municipality, Haskovo Province, Bulgaria |
| ⓘ Alburnite Formula: Ag8GeTe2S4 |
| ⓘ Aleksite Formula: PbBi2Te2S2 |
| ⓘ Alloclasite Formula: Co1-xFexAsS |
| ⓘ Allophane Formula: (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 |
| ⓘ Altaite Formula: PbTe |
| ⓘ Alunite Formula: KAl3(SO4)2(OH)6 Localities: Reported from at least 6 localities in this region. |
| ⓘ Alunogen Formula: Al2(SO4)3 · 17H2O |
| ⓘ 'Amphibole Supergroup' Formula: AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ Anatase Formula: TiO2 |
| ⓘ Andersonite Formula: Na2Ca(UO2)(CO3)3 · 6H2O References: |
| ⓘ 'Andorite' Formula: AgPbSb3S6 References: |
| ⓘ Andradite Formula: Ca3Fe3+2(SiO4)3 Localities: Reported from at least 6 localities in this region. |
| ⓘ 'Andradite-Grossular Series' |
| ⓘ Anglesite Formula: PbSO4 |
| ⓘ Anhydrite Formula: CaSO4 Localities: Reported from at least 8 localities in this region. |
| ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 |
| ⓘ Annabergite Formula: Ni3(AsO4)2 · 8H2O References: |
| ⓘ Anorthite Formula: Ca(Al2Si2O8) References: Szopa, Krzysztof, Sałacińska, Anna, Gumsley, Ashley P., Chew, David, Petrov, Petko, Gawȩda, Aleksandra, Zagórska, Anna, Deput, Ewa, Gospodinov, Nikolay, Banasik, Kamila (2020) Two-Stage Late Jurassic to Early Cretaceous Hydrothermal Activity in the Sakar Unit of Southeastern Bulgaria. Minerals, 10 (3) 266 doi:10.3390/min10030266 |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) Localities: |
| ⓘ Apjohnite Formula: Mn2+Al2(SO4)4 · 22H2O |
| ⓘ Aragonite Formula: CaCO3 |
| ⓘ Ardealite Formula: Ca2(PO3OH)(SO4) · 4H2O |
| ⓘ Argyrodite Formula: Ag8GeS6 |
| ⓘ Arsenolite Formula: As2O3 |
| ⓘ Arsenopyrite Formula: FeAsS Localities: Reported from at least 10 localities in this region. |
| ⓘ Aschamalmite Formula: Pb6-3xBi2+xS9 References: |
| ⓘ Augite Formula: (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ Aurichalcite Formula: (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ Autunite Formula: Ca(UO2)2(PO4)2 · 10-12H2O References: |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 |
| ⓘ Baryte Formula: BaSO4 Localities: Reported from at least 6 localities in this region. |
| ⓘ Baumhauerite Formula: Pb12As16S36 References: |
| ⓘ Baumstarkite Formula: Ag3Sb3S6 References: |
| ⓘ Becquerelite Formula: Ca(UO2)6O4(OH)6 · 8H2O References: |
| ⓘ Benavidesite Formula: Pb4MnSb6S14 |
| ⓘ Benjaminite Formula: Ag3Bi7S12 References: |
| ⓘ Benleonardite Formula: [Ag6(Sb,As)2S6Te][Ag9Cu(S,Te)2Te2] References: |
| ⓘ Berlinite Formula: AlPO4 |
| ⓘ Bernarlottiite Formula: Pb6(As5Sb3)S18 References: |
| ⓘ Berryite Formula: Cu3Ag2Pb3Bi7S16 References: |
| ⓘ Berthierite Formula: FeSb2S4 |
| ⓘ Betekhtinite Formula: Pb2(Cu,Fe)22-24S15 References: |
| ⓘ 'Biharite' |
| ⓘ Billingsleyite Formula: Ag7AsS6 Description: Mark Feinglos specimen References: |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Bismite Formula: Bi2O3 References: |
| ⓘ Bismuthinite Formula: Bi2S3 Localities: |
| ⓘ Bornite Formula: Cu5FeS4 Localities: Reported from at least 9 localities in this region. |
| ⓘ Boscardinite Formula: TlPb4(Sb7As2)S18 References: |
| ⓘ Boulangerite Formula: Pb5Sb4S11 References: |
| ⓘ Bournonite Formula: PbCuSbS3 |
| ⓘ Brannerite Formula: UTi2O6 References: |
| ⓘ Braunite Formula: Mn2+Mn3+6(SiO4)O8 |
| ⓘ Brianyoungite Formula: Zn3(CO3,SO4)(OH)4 |
| ⓘ Briartite Formula: Cu2FeGeS4 |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 |
| ⓘ Brucite Formula: Mg(OH)2 |
| ⓘ Brushite Formula: Ca(PO3OH) · 2H2O References: Puşcaş, Cristina M., Kristaly, Ferenc, Stremţan, Ciprian C., Onac, Bogdan P., Effenberger, Herta S. (2014) Stability of cave phosphates: Case study from Liliecilor Cave (Trascău Mountains, Romania) Neues Jahrbuch für Mineralogie - Abhandlungen: Journal of Mineralogy and Geoche, 191 (2) 157-168 doi:10.1127/0077-7757/2014/0254 |
| ⓘ Buckhornite Formula: AuPb2BiTe2S3 |
| ⓘ 'Bursaite' Formula: Pb5Bi4S11 (?) References: |
| ⓘ Bustamite Formula: CaMn2+(Si2O6) References: |
| ⓘ 'Calamine' |
| ⓘ Calaverite Formula: AuTe2 |
| ⓘ Calcite Formula: CaCO3 Localities: Reported from at least 19 localities in this region. |
| ⓘ Calcite var. Cobalt-bearing Calcite Formula: (Ca,Co)CO3 |
| ⓘ Calcite var. Manganese-bearing Calcite Formula: (Ca,Mn)CO3 |
| ⓘ 'Calcium Amphibole Subgroup' Formula: AnCa2(Z2+5-mZ3+m)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| ⓘ 'Calcium Amphibole Subgroup var. Hornblende' Formula: AnCa2(Z2+5-mZ3+m)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| ⓘ Caledonite Formula: Pb5Cu2(SO4)3(CO3)(OH)6 |
| ⓘ Canfieldite Formula: Ag8SnS6 |
| ⓘ Cannizzarite Formula: Pb48Bi56S132 References: |
| ⓘ Carrollite Formula: CuCo2S4 References: |
| ⓘ Cassiterite Formula: SnO2 References: |
| ⓘ Cebollite Formula: Ca5Al2(SiO4)3(OH)4 |
| ⓘ Celadonite Formula: K(MgFe3+◻)(Si4O10)(OH)2 |
| ⓘ Cerussite Formula: PbCO3 |
| ⓘ Cervelleite Formula: Ag4TeS |
| ⓘ Chalcanthite Formula: CuSO4 · 5H2O References: |
| ⓘ Chalcocite Formula: Cu2S Localities: Reported from at least 8 localities in this region. |
| ⓘ Chalcophyllite Formula: Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O References: |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 24 localities in this region. |
| ⓘ Chamosite Formula: (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 References: Szopa, Krzysztof, Sałacińska, Anna, Gumsley, Ashley P., Chew, David, Petrov, Petko, Gawȩda, Aleksandra, Zagórska, Anna, Deput, Ewa, Gospodinov, Nikolay, Banasik, Kamila (2020) Two-Stage Late Jurassic to Early Cretaceous Hydrothermal Activity in the Sakar Unit of Southeastern Bulgaria. Minerals, 10 (3) 266 doi:10.3390/min10030266 |
| ⓘ 'Chlorite Group' Localities: Reported from at least 9 localities in this region. |
| ⓘ Chondrodite Formula: Mg5(SiO4)2F2 |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 References: |
| ⓘ Chrysotile Formula: Mg3(Si2O5)(OH)4 |
| ⓘ Clausthalite Formula: PbSe |
| ⓘ 'Clay minerals' |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 Localities: Băiţa mining district, Nucet, Bihor County, Romania Cornet Hill, Cerboia Valley, Vaţa de Jos, Hunedoara County, Romania Bolcana Mine, Certeju de Sus, Hunedoara County, Romania Avram Iancu mine, Băiţa mining district, Nucet, Bihor County, Romania Kanarata quarry, Hlyabovo, Topolovgrad Municipality, Haskovo Province, Bulgaria |
| ⓘ Clinochlore var. Pennine Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ 'Clinochlore-1MIa' Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ 'Clinochlore-1MIb' Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ Clinohumite Formula: Mg9(SiO4)4F2 References: |
| ⓘ Clinozoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ Cobaltite Formula: CoAsS |
| ⓘ Cobaltpentlandite Formula: Co9S8 |
| ⓘ Coffinite Formula: U(SiO4) · nH2O |
| ⓘ Coloradoite Formula: HgTe |
| ⓘ Colusite Formula: Cu13VAs3S16 |
| ⓘ Conichalcite Formula: CaCu(AsO4)(OH) References: |
| ⓘ Copiapite Formula: Fe2+Fe3+4(SO4)6(OH)2 · 20H2O |
| ⓘ Cordierite Formula: (Mg,Fe)2Al3(AlSi5O18) References: |
| ⓘ Corundum Formula: Al2O3 |
| ⓘ Cosalite Formula: Pb2Bi2S5 |
| ⓘ Cotunnite Formula: PbCl2 References: |
| ⓘ Covellite Formula: CuS Localities: Reported from at least 8 localities in this region. |
| ⓘ Crandallite Formula: CaAl3(PO4)(PO3OH)(OH)6 References: |
| ⓘ Crocoite Formula: PbCr6+O4 |
| ⓘ Cubanite Formula: CuFe2S3 |
| ⓘ Cuprobismutite Formula: Cu8AgBi13S24 References: |
| ⓘ Cupromakovickyite Formula: Cu4AgPb2Bi9S18 |
| ⓘ Cuproneyite (TL) Formula: Cu7Pb27Bi25S68 Type Locality: |
| ⓘ Cupropavonite Formula: Cu0.9Ag0.5Pb0.6Bi2.5S5 |
| ⓘ Cuspidine Formula: Ca8(Si2O7)2F4 |
| ⓘ Diaspore Formula: AlO(OH) |
| ⓘ Dickite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Dietrichite Formula: (Zn,Fe2+,Mn2+)Al2(SO4)4 · 22H2O |
| ⓘ Digenite Formula: Cu9S5 Localities: Băiţa mining district, Nucet, Bihor County, Romania Roșia Poieni Mine, Mușca, Lupșa, Alba County, Romania Deva Mine, Deva, Hunedoara County, Romania Bucium Tarnita porphyry Cu-Au deposit, Bucium, Bucium, Alba County, Romania Čoka Marin deposit, Vlaole-Jasikovo ore field, Bor District, Central Serbia, Serbia |
| ⓘ Diopside Formula: CaMgSi2O6 Localities: Reported from at least 7 localities in this region. |
| ⓘ Dioptase Formula: CuSiO3 · H2O |
| ⓘ Djerfisherite Formula: K6(Fe,Cu,Ni)25S26Cl |
| ⓘ Djurleite Formula: Cu31S16 References: |
| ⓘ 'Dognácskaite' |
| ⓘ Dolomite Formula: CaMg(CO3)2 |
| ⓘ Dufrénoysite Formula: Pb2As2S5 |
| ⓘ 'Ellestadite' |
| ⓘ Emplectite Formula: CuBiS2 |
| ⓘ Empressite Formula: AgTe References: |
| ⓘ Enargite Formula: Cu3AsS4 Localities: Băiţa mining district, Nucet, Bihor County, Romania Radka Mine, Levski, Panagyurishte Municipality, Pazardzhik Province, Bulgaria Roșia Poieni Mine, Mușca, Lupșa, Alba County, Romania Bucium Tarnita porphyry Cu-Au deposit, Bucium, Bucium, Alba County, Romania Čoka Marin deposit, Vlaole-Jasikovo ore field, Bor District, Central Serbia, Serbia |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) Localities: Reported from at least 8 localities in this region. |
| ⓘ Erythrite Formula: Co3(AsO4)2 · 8H2O |
| ⓘ Eucairite Formula: AgCuSe |
| ⓘ Evansite Formula: Al3(PO4)(OH)6 · 6H2O |
| ⓘ Falkmanite Formula: Pb3Sb2S6 |
| ⓘ Famatinite Formula: Cu3SbS4 |
| ⓘ 'Famatinite-Luzonite Series' |
| ⓘ 'Feldspar Group' |
| ⓘ Ferro-actinolite Formula: ◻Ca2Fe2+5(Si8O22)(OH)2 |
| ⓘ Fluoborite Formula: Mg3(BO3)(F,OH)3 |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F |
| ⓘ Fluorapophyllite-(K) Formula: KCa4(Si8O20)(F,OH) · 8H2O References: |
| ⓘ Fluorite Formula: CaF2 Localities: Băiţa mining district, Nucet, Bihor County, Romania Valea Morii prospect (Valei Morii prospect), Crișcior, Hunedoara County, Romania Kanarata quarry, Hlyabovo, Topolovgrad Municipality, Haskovo Province, Bulgaria Čoka Marin deposit, Vlaole-Jasikovo ore field, Bor District, Central Serbia, Serbia Valea Rea skarn, Pietroasa, Bihor County, Romania |
| ⓘ Forsterite Formula: Mg2SiO4 |
| ⓘ Foshagite Formula: Ca4(Si3O9)(OH)2 |
| ⓘ Francoanellite Formula: K3Al5(PO3OH)6(PO4)2 · 12H2O |
| ⓘ 'Freibergite Subgroup' ? Formula: (Ag6,[Ag6]4+)(Cu4 C2+2)Sb4S12S0-1 |
| ⓘ Friedrichite Formula: Pb5Cu5Bi7S18 |
| ⓘ Frohbergite Formula: FeTe2 References: |
| ⓘ Fukalite Formula: Ca4[Si2O6][CO3](OH)2 References: |
| ⓘ Fülöppite Formula: Pb3Sb8S15 References: |
| ⓘ Galena Formula: PbS Localities: Reported from at least 23 localities in this region. |
| ⓘ Galenobismutite Formula: PbBi2S4 |
| ⓘ Gallite Formula: CuGaS2 References: |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 |
| ⓘ Gehlenite Formula: Ca2Al[AlSiO7] |
| ⓘ Geigerite Formula: Mn2+5(AsO4)2(HAsO4)2 · 10H2O |
| ⓘ Geocronite Formula: Pb14Sb6S23 References: |
| ⓘ 'Geocronite-Jordanite Series' |
| ⓘ Germanite Formula: Cu13Fe2Ge2S16 |
| ⓘ Gersdorffite Formula: NiAsS |
| ⓘ 'Gismondine Subgroup' |
| ⓘ Goethite Formula: Fe3+O(OH) Localities: Reported from at least 8 localities in this region. |
| ⓘ Goldfieldite Formula: (Cu4◻2)(Cu4Cu+2)Te4S12S |
| ⓘ Greenockite Formula: CdS |
| ⓘ Greigite Formula: Fe2+Fe3+2S4 References: |
| ⓘ Grossular Formula: Ca3Al2(SiO4)3 |
| ⓘ Grossular var. Hibschite Formula: Ca3Al2(SiO4)3-x(OH)4x |
| ⓘ Guettardite Formula: Pb8(Sb0.56As0.44)16S32 |
| ⓘ Gustavite Formula: AgPbBi3S6 |
| ⓘ Gypsum Formula: CaSO4 · 2H2O Localities: Reported from at least 7 localities in this region. |
| ⓘ Halite Formula: NaCl |
| ⓘ Halloysite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Halotrichite Formula: FeAl2(SO4)4 · 22H2O |
| ⓘ Hammarite Formula: Pb2Cu2Bi4S9 |
| ⓘ Hedenbergite Formula: CaFe2+Si2O6 |
| ⓘ Hedenbergite var. Manganese-bearing Hedenbergite Formula: Ca(Fe,Mn)2+Si2O6 |
| ⓘ Hematite Formula: Fe2O3 Localities: Reported from at least 14 localities in this region. |
| ⓘ Hematite var. Specularite Formula: Fe2O3 |
| ⓘ Hemimorphite (TL) Formula: Zn4Si2O7(OH)2 · H2O Localities: Type Locality: Băiţa mining district, Nucet, Bihor County, Romania |
| ⓘ Hessite Formula: Ag2Te Localities: Reported from at least 7 localities in this region. |
| ⓘ Heteromorphite Formula: Pb7Sb8S19 References: |
| ⓘ Heyrovskýite Formula: Pb6Bi2S9 References: |
| ⓘ Hodrušite Formula: Cu8Bi12S22 |
| ⓘ Hollandite Formula: Ba(Mn4+6Mn3+2)O16 |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| ⓘ Hörnesite Formula: Mg3(AsO4)2 · 8H2O |
| ⓘ Hydromagnesite Formula: Mg5(CO3)4(OH)2 · 4H2O References: |
| ⓘ Hydroxylapatite Formula: Ca5(PO4)3(OH) Localities: Gaura cu Musca Cave, Locva Mountains (Locvei Mountains), Caraş-Severin County, Romania Bats’ Cave (Pestera Liliecilor; Gura Ponicovei Cave; Ponicova Cave), Dubova, Mehedinti County, Romania Pereßii Corlatului cave, Băiţa mining district, Nucet, Bihor County, Romania Izvorul Crişului Negru cave, Băiţa mining district, Nucet, Bihor County, Romania |
| ⓘ Hydroxylapatite var. Carbonate-rich Hydroxylapatite Formula: Ca5(PO4,CO3)3(OH,O) |
| ⓘ Hydroxylellestadite Formula: Ca5(SiO4)1.5(SO4)1.5(OH) |
| ⓘ Idaite Formula: Cu5FeS6 |
| ⓘ 'Illite-2M' Formula: K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ Ilmenite Formula: Fe2+TiO3 |
| ⓘ Ilvaite Formula: CaFe3+Fe2+2(Si2O7)O(OH) Locality: Iara Mine, Iara, Cluj County, Romania |
| ⓘ Imiterite Formula: Ag2HgS2 |
| ⓘ Ingodite Formula: Bi2TeS |
| ⓘ Jarosite Formula: KFe3+3(SO4)2(OH)6 |
| ⓘ Jôkokuite Formula: MnSO4 · 5H2O |
| ⓘ Johannsenite Formula: CaMn2+Si2O6 |
| ⓘ Jordanite Formula: Pb14As6S23 References: |
| ⓘ Joséite-A Formula: Bi4TeS2 References: |
| ⓘ Junoite Formula: Cu2Pb3Bi8(S,Se)16 |
| ⓘ Kalinite Formula: KAl(SO4)2 · 11H2O |
| ⓘ Kamaishilite Formula: Ca2(Al2SiO6)(OH)2 |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 Localities: Reported from at least 7 localities in this region. |
| ⓘ Kasolite Formula: Pb(UO2)(SiO4) · H2O References: |
| ⓘ Kësterite Formula: Cu2ZnSnS4 References: |
| ⓘ Keutschite Formula: Cu2AgAsS4 References: |
| ⓘ 'K Feldspar' |
| ⓘ 'K Feldspar var. Adularia' Formula: KAlSi3O8 |
| ⓘ Kiddcreekite Formula: Cu6SnWS8 References: |
| ⓘ Klockmannite Formula: CuSe |
| ⓘ Kotoite Formula: Mg3[BO3]2 |
| ⓘ Krautite (TL) Formula: Mn(HAsO4) · H2O Type Locality: |
| ⓘ Krennerite (TL) Formula: Au3AgTe8 Localities: Type Locality: Săcărâmb, Certeju de Sus, Hunedoara County, Romania |
| ⓘ Krupkaite Formula: PbCuBi3S6 |
| ⓘ Kupčíkite Formula: Cu3.4Fe0.6Bi5S10 |
| ⓘ Kushiroite Formula: CaAlAlSiO6 References: Pascal, M.-L., Katona, I., Fonteilles, M., Verkaeren, J. (2005) Relics of high-temperature clinopyroxene on the join Di-CaTs with up to 72 mol% Ca(Al,Fe3+)AlSiO6 in the skarns of Ciclova and Magureaua Vaţei, Carpathians, Romania. The Canadian Mineralogist, 43 (3). 857-881 doi:10.2113/gscanmin.43.3.857 |
| ⓘ Kutnohorite Formula: CaMn2+(CO3)2 |
| ⓘ Langite Formula: Cu4(SO4)(OH)6 · 2H2O |
| ⓘ Laumontite Formula: CaAl2Si4O12 · 4H2O References: |
| ⓘ Lepidocrocite Formula: Fe3+O(OH) |
| ⓘ Leucophosphite Formula: KFe3+2(PO4)2(OH) · 2H2O |
| ⓘ 'Leucoxene' References: |
| ⓘ Lillianite Formula: Pb3-2xAgxBi2+xS6 References: |
| ⓘ 'Limonite' |
| ⓘ Linarite Formula: PbCu(SO4)(OH)2 |
| ⓘ Linnaeite Formula: Co2+Co3+2S4 |
| ⓘ Liveingite Formula: Pb9As13S28 |
| ⓘ Lizardite Formula: Mg3(Si2O5)(OH)4 |
| ⓘ Lopatkaite Formula: Pb5Sb3AsS11 References: |
| ⓘ Löllingite Formula: FeAs2 |
| ⓘ Ludwigite Formula: Mg2Fe3+(BO3)O2 |
| ⓘ Luzonite Formula: Cu3AsS4 |
| ⓘ Magnesite Formula: MgCO3 |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 Localities: Reported from at least 20 localities in this region. |
| ⓘ Makovickyite (TL) Formula: Cu1.12Ag0.81Pb0.27Bi5.35S9 Type Locality: Băiţa mining district, Nucet, Bihor County, Romania |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 |
| ⓘ Maldonite Formula: Au2Bi References: |
| ⓘ 'Manganese Oxides' |
| ⓘ Manganilvaite Formula: CaFe2+Fe3+Mn2+(Si2O7)O(OH) |
| ⓘ Manganite Formula: Mn3+O(OH) |
| ⓘ Manganoquadratite Formula: AgMnAsS3 |
| ⓘ Marcasite Formula: FeS2 Localities: Reported from at least 10 localities in this region. |
| ⓘ Marrite Formula: AgPbAsS3 References: |
| ⓘ Mawsonite Formula: Cu6Fe2SnS8 References: |
| ⓘ Melanterite Formula: Fe2+(H2O)6SO4 · H2O |
| ⓘ 'Melilite Group' Formula: Ca2M(XSiO7) |
| ⓘ 'Melnikovite' |
| ⓘ Melonite Formula: NiTe2 References: |
| ⓘ Menchettiite Formula: AgPb2.40Mn1.60Sb3As2S12 References: |
| ⓘ 'Mica Group' |
| ⓘ Miharaite Formula: Cu4FePbBiS6 |
| ⓘ Millerite Formula: NiS |
| ⓘ Mimetite Formula: Pb5(AsO4)3Cl |
| ⓘ 'Mn-rich fizeleyite analogue' Formula: Ag5Mn7Pb7Sb21S48 References: |
| ⓘ Molybdenite Formula: MoS2 Localities: Reported from at least 13 localities in this region. |
| ⓘ 'Monazite Group' Formula: REE(PO4) |
| ⓘ Monetite Formula: Ca(PO3OH) References: Puşcaş, Cristina M., Kristaly, Ferenc, Stremţan, Ciprian C., Onac, Bogdan P., Effenberger, Herta S. (2014) Stability of cave phosphates: Case study from Liliecilor Cave (Trascău Mountains, Romania) Neues Jahrbuch für Mineralogie - Abhandlungen: Journal of Mineralogy and Geoche, 191 (2) 157-168 doi:10.1127/0077-7757/2014/0254 |
| ⓘ Monticellite Formula: CaMgSiO4 |
| ⓘ Montmorillonite Formula: (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ Mottramite Formula: PbCu(VO4)(OH) References: |
| ⓘ Mountainite Formula: KNa2Ca2[Si8O19(OH)] · 6H2O |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 13 localities in this region. |
| ⓘ Muscovite var. Illite Formula: K0.65Al2.0[Al0.65Si3.35O10](OH)2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 11 localities in this region. |
| ⓘ Museumite (TL) Formula: [Pb2(Pb,Sb)2S8][(Te,Au)2] Type Locality: |
| ⓘ Muthmannite (TL) Formula: AuAgTe2 Type Locality: |
| ⓘ Nagyágite (TL) Formula: [Pb3(Pb,Sb)3S6](Au,Te)3 Type Locality: References: Afifi, Abdulkader M., Kelly, William C., Essene, Eric J. (1988) Phase relations among tellurides, sulfides, and oxides; Pt. II, Applications to telluride-bearing ore deposits. Economic Geology, 83 (2) 395-404 doi:10.2113/gsecongeo.83.2.395 |
| ⓘ Native Arsenic Formula: As |
| ⓘ Native Bismuth Formula: Bi |
| ⓘ Native Copper Formula: Cu References: |
| ⓘ Native Gold Formula: Au Localities: Reported from at least 15 localities in this region. |
| ⓘ Native Gold var. Electrum Formula: (Au,Ag) |
| ⓘ Native Silver Formula: Ag Localities: Reported from at least 7 localities in this region. |
| ⓘ Native Sulphur Formula: S8 References: |
| ⓘ Native Tellurium Formula: Te |
| ⓘ Natrojarosite Formula: NaFe3(SO4)2(OH)6 |
| ⓘ Natrolite Formula: Na2Al2Si3O10 · 2H2O |
| ⓘ Naumannite Formula: Ag2Se |
| ⓘ Neyite Formula: Ag2Cu6Pb25Bi26S68 |
| ⓘ Nickeline Formula: NiAs |
| ⓘ Norbergite Formula: Mg3(SiO4)F2 |
| ⓘ Nuffieldite Formula: Cu1.4Pb2.4Bi2.4Sb0.2S7 Locality: Valea Seacă, Cluj County, Romania |
| ⓘ 'Olivine Group' Formula: M2SiO4 |
| ⓘ Opal Formula: SiO2 · nH2O |
| ⓘ Orpiment Formula: As2S3 References: |
| ⓘ Orthoclase Formula: K(AlSi3O8) |
| ⓘ Oyonite Formula: Ag3Mn2Pb4Sb7As4S24 References: |
| ⓘ Padĕraite (TL) Formula: Cu7[(Cu,Ag)0.33Pb1.33Bi11.33]S22 Type Locality: Băiţa mining district, Nucet, Bihor County, Romania Description: Specimen labeled "rezbanyite" from Rezbanya (now Baita Bihorului), Romania.
The specimen was collected in 1874 and is now in the collection of the Mineralogical Department of Charles University. |
| ⓘ Pearceite Formula: [Ag6As2S7][Ag9CuS4] |
| ⓘ Pekoite Formula: PbCuBi11S18 |
| ⓘ Pentlandite Formula: (NixFey)Σ9S8 |
| ⓘ Perovskite Formula: CaTiO3 |
| ⓘ Petzite (TL) Formula: Ag3AuTe2 Localities: Type Locality: Săcărâmb, Certeju de Sus, Hunedoara County, Romania |
| ⓘ Pharmacosiderite Formula: KFe3+4(AsO4)3(OH)4 · 6-7H2O References: |
| ⓘ Phlogopite Formula: KMg3(AlSi3O10)(OH)2 |
| ⓘ Pickeringite Formula: MgAl2(SO4)4 · 22H2O |
| ⓘ Pigeonite Formula: (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ Pilsenite Formula: Bi4Te3 |
| ⓘ Pirquitasite Formula: Ag2ZnSnS4 |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ Plagionite Formula: Pb5Sb8S17 References: |
| ⓘ Plombièrite Formula: Ca5Si6O16(OH)2 · 7H2O |
| ⓘ Polybasite Formula: [Ag6Sb2S7][Ag9CuS4] |
| ⓘ Polydymite Formula: Ni2+Ni3+2S4 |
| ⓘ Portlandite Formula: Ca(OH)2 |
| ⓘ Powellite Formula: Ca(MoO4) References: |
| ⓘ Proustite Formula: Ag3AsS3 Localities: |
| ⓘ Pseudomalachite Formula: Cu5(PO4)2(OH)4 |
| ⓘ Pyrargyrite Formula: Ag3SbS3 |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 29 localities in this region. |
| ⓘ Pyrite var. Bravoite Formula: (Fe,Ni)S2 |
| ⓘ Pyrite var. Copper-bearing Pyrite Formula: (Fe,Cu)S2 |
| ⓘ Pyrolusite Formula: Mn4+O2 |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl References: |
| ⓘ Pyrophyllite Formula: Al2Si4O10(OH)2 |
| ⓘ 'Pyroxene Group' Formula: ADSi2O6 |
| ⓘ Pyrrhotite Formula: Fe1-xS Localities: Reported from at least 8 localities in this region. |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 22 localities in this region. |
| ⓘ Quartz var. Amethyst Formula: SiO2 References: |
| ⓘ Quartz var. Chalcedony Formula: SiO2 |
| ⓘ Quartz var. Milky Quartz Formula: SiO2 References: Szopa, Krzysztof, Sałacińska, Anna, Gumsley, Ashley P., Chew, David, Petrov, Petko, Gawȩda, Aleksandra, Zagórska, Anna, Deput, Ewa, Gospodinov, Nikolay, Banasik, Kamila (2020) Two-Stage Late Jurassic to Early Cretaceous Hydrothermal Activity in the Sakar Unit of Southeastern Bulgaria. Minerals, 10 (3) 266 doi:10.3390/min10030266 |
| ⓘ Quartz var. Rock Crystal Formula: SiO2 |
| ⓘ Quatrandorite Formula: AgPbSb3S6 |
| ⓘ Rammelsbergite Formula: NiAs2 |
| ⓘ Ranciéite Formula: (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| ⓘ Rankinite Formula: Ca3Si2O7 |
| ⓘ Realgar Formula: As4S4 References: |
| ⓘ Renierite Formula: (Cu1+,Zn)11Fe4(Ge4+,As5+)2S16 |
| ⓘ 'Rezbanyite (of Frenzel)' Formula: Pb3Cu2Bi10S19 Description: Rezbanyite is between Krupkaite and Gladite in the Aikinite-Bismuthinite Series. |
| ⓘ Rhodochrosite Formula: MnCO3 |
| ⓘ Rhodonite Formula: CaMn3Mn[Si5O15] |
| ⓘ Rickardite Formula: Cu7Te5 |
| ⓘ Riversideite Formula: Ca5Si6O16(OH)2 · 2H2O |
| ⓘ Robinsonite Formula: Pb4Sb6S13 |
| ⓘ Romanèchite Formula: (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| ⓘ Roquesite Formula: CuInS2 |
| ⓘ Rozenite Formula: FeSO4 · 4H2O |
| ⓘ Rutile Formula: TiO2 Localities: Reported from at least 9 localities in this region. |
| ⓘ Saddlebackite Formula: Pb2Bi2Te2S3 |
| ⓘ Scawtite Formula: Ca7(Si3O9)2CO3 · 2H2O |
| ⓘ Schapbachite Formula: Ag0.4Pb0.2Bi0.4S References: |
| ⓘ Scheelite Formula: Ca(WO4) |
| ⓘ 'Schirmerite' Formula: PbAgBi3S6 - Pb3Ag1.5Bi3.5S9 |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) References: Szopa, Krzysztof, Sałacińska, Anna, Gumsley, Ashley P., Chew, David, Petrov, Petko, Gawȩda, Aleksandra, Zagórska, Anna, Deput, Ewa, Gospodinov, Nikolay, Banasik, Kamila (2020) Two-Stage Late Jurassic to Early Cretaceous Hydrothermal Activity in the Sakar Unit of Southeastern Bulgaria. Minerals, 10 (3) 266 doi:10.3390/min10030266 |
| ⓘ Scorodite Formula: Fe3+AsO4 · 2H2O |
| ⓘ Seligmannite Formula: PbCuAsS3 |
| ⓘ Semseyite Formula: Pb9Sb8S21 |
| ⓘ Senandorite Formula: AgPbSb3S6 References: |
| ⓘ 'Serpentine Subgroup' Formula: D3[Si2O5](OH)4 |
| ⓘ Siderite Formula: FeCO3 |
| ⓘ Siegenite Formula: CoNi2S4 |
| ⓘ Skutterudite Formula: CoAs3 References: |
| ⓘ 'Smectite Group' Formula: A0.3D2-3[T4O10]Z2 · nH2O |
| ⓘ Smithsonite Formula: ZnCO3 |
| ⓘ Spertiniite Formula: Cu(OH)2 |
| ⓘ Sphalerite Formula: ZnS Localities: Reported from at least 24 localities in this region. |
| ⓘ Sphalerite var. Cleiophane Formula: ZnS |
| ⓘ Sphalerite var. Marmatite Formula: (Zn,Fe)S |
| ⓘ Spinel Formula: MgAl2O4 |
| ⓘ Spurrite Formula: Ca5(SiO4)2(CO3) |
| ⓘ Stannite Formula: Cu2FeSnS4 |
| ⓘ Stannoidite Formula: Cu+6Cu2+2(Fe2+,Zn)3Sn2S12 |
| ⓘ Stephanite Formula: Ag5SbS4 |
| ⓘ Stibnite Formula: Sb2S3 |
| ⓘ 'Stilbite Subgroup' Formula: M6-7[Al8-9Si27-28O72] · nH2O |
| ⓘ Stromeyerite Formula: AgCuS |
| ⓘ Stützite (TL) Formula: Ag5-xTe3, x = 0.24-0.36 Localities: Type Locality: Săcărâmb, Certeju de Sus, Hunedoara County, Romania |
| ⓘ Suanite Formula: Mg2[B2O5] |
| ⓘ Svanbergite Formula: SrAl3(PO4)(SO4)(OH)6 |
| ⓘ Sylvanite Formula: AgAuTe4 |
| ⓘ Sylvite Formula: KCl Description: Microinclusions (in brine inclusions) in quartz. |
| ⓘ Symplesite Formula: Fe2+3(AsO4)2 · 8H2O |
| ⓘ Szaibélyite (TL) Formula: MgBO2(OH) Type Locality: References: |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 |
| ⓘ Taranakite Formula: K3Al5(PO3OH)6(PO4)2 · 18H2O |
| ⓘ Tellurantimony Formula: Sb2Te3 References: |
| ⓘ Tellurite Formula: TeO2 |
| ⓘ Tellurobismuthite Formula: Bi2Te3 |
| ⓘ Tennantite-(Cu) Formula: Cu6(Cu4Cu2)As4S12S References: Kouzmanov, K., Ramboz, C., Bailly, L., Bogdanov, K. (2004) Genesis of high sulfidation vinciennite-bearing Cu-As-Sn (±Au) assemblage from the Radka epithermal copper deposit, Bulgaria: Evidence from mineralogy and infrared microthermometry of enargite. The Canadian Mineralogist, 42 (5) 1501-1521 doi:10.2113/gscanmin.42.5.1501 |
| ⓘ Tennantite-(Fe) Formula: Cu6(Cu4Fe2+2)As4S12S References: |
| ⓘ Tennantite-(Mn) Formula: Cu6(Cu4Mn2)As4S12S References: |
| ⓘ 'Tennantite Subgroup' Formula: Cu6(Cu4C2+2)As4S12S Localities: Reported from at least 8 localities in this region. |
| ⓘ 'Tennantite-Tetrahedrite Series' |
| ⓘ Tetradymite Formula: Bi2Te2S |
| ⓘ Tetrahedrite-(Fe) Formula: Cu6(Cu4Fe2+2)Sb4S12S References: |
| ⓘ Tetrahedrite-(Mn) Formula: Cu6(Cu4Mn2)Sb4S12S References: |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S Localities: Reported from at least 14 localities in this region. |
| ⓘ Tetrahedrite-(Zn) Formula: Cu6(Cu4Zn2)Sb4S12S References: |
| ⓘ Thaumasite Formula: Ca3(SO4)[Si(OH)6](CO3) · 12H2O References: |
| ⓘ Theisite Formula: Cu5Zn5(AsO4,SbO4)2(OH)14 |
| ⓘ 'Thomsonite Subgroup' |
| ⓘ 'Thrombolite (of Breithaupt)' |
| ⓘ Tilleyite Formula: Ca5(Si2O7)(CO3)2 |
| ⓘ Titanite Formula: CaTi(SiO4)O |
| ⓘ Tobermorite Formula: Ca5Si6O17 · 5H2O Description: Tobermorite-11 Å variant. |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z |
| ⓘ Trechmannite Formula: AgAsS2 References: |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ Tsumoite Formula: BiTe |
| ⓘ Tyrolite Formula: Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| ⓘ Ulvöspinel Formula: TiFe2+2O4 References: Puşcaş, Cristina M., Kristaly, Ferenc, Stremţan, Ciprian C., Onac, Bogdan P., Effenberger, Herta S. (2014) Stability of cave phosphates: Case study from Liliecilor Cave (Trascău Mountains, Romania) Neues Jahrbuch für Mineralogie - Abhandlungen: Journal of Mineralogy and Geoche, 191 (2) 157-168 doi:10.1127/0077-7757/2014/0254 |
| ⓘ 'UM1986-36-S:AsCuFeGe' Formula: Cu11Fe4GeAsS16 References: |
| ⓘ 'UM2003-15-S:AgCuTe' Formula: Ag2Cu2TeS |
| ⓘ Uraninite Formula: UO2 References: |
| ⓘ Uranophane Formula: Ca(UO2)2(SiO3OH)2 · 5H2O References: |
| ⓘ Uytenbogaardtite Formula: Ag3AuS2 |
| ⓘ Vaesite Formula: NiS2 References: |
| ⓘ Valentinite Formula: Sb2O3 References: |
| ⓘ Vashegyite Formula: Al11(PO4)9(OH)6 · 38H2O References: |
| ⓘ Vermiculite Formula: Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O References: |
| ⓘ Vesuvianite Formula: Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ Vikingite Formula: Ag5Pb8Bi13S30 |
| ⓘ Villyaellenite Formula: (Mn,Ca)Mn2Ca2(AsO3OH)2(AsO4)2 · 4H2O |
| ⓘ Vinciennite Formula: Cu+7Cu2+3Fe2+2Fe3+2Sn(As,Sb)S16 References: Bogdanov, K., Tsonev, D., Popov, K. (2004) Mineral Assemblages And Genesis Of The Cu-Au Epithermal Deposits In The Southern Part Of The Panaguyrishte Ore District, Bulgaria. Bulletin of the Geological Society of Greece, 36 (1). 406-415 doi:10.12681/bgsg.16726 Kouzmanov, K., Ramboz, C., Bailly, L., Bogdanov, K. (2004) Genesis of high sulfidation vinciennite-bearing Cu-As-Sn (±Au) assemblage from the Radka epithermal copper deposit, Bulgaria: Evidence from mineralogy and infrared microthermometry of enargite. The Canadian Mineralogist, 42 (5) 1501-1521 doi:10.2113/gscanmin.42.5.1501 |
| ⓘ Vivianite Formula: Fe2+Fe2+2(PO4)2 · 8H2O |
| ⓘ Vulcanite Formula: CuTe References: |
| ⓘ Weissite Formula: Cu2-xTe |
| ⓘ Whitlockite Formula: Ca9Mg(PO4)6(PO3OH) References: Puşcaş, Cristina M., Kristaly, Ferenc, Stremţan, Ciprian C., Onac, Bogdan P., Effenberger, Herta S. (2014) Stability of cave phosphates: Case study from Liliecilor Cave (Trascău Mountains, Romania) Neues Jahrbuch für Mineralogie - Abhandlungen: Journal of Mineralogy and Geoche, 191 (2) 157-168 doi:10.1127/0077-7757/2014/0254 |
| ⓘ Wittichenite Formula: Cu3BiS3 |
| ⓘ Wittite ? Formula: Pb9Bi12(S,Se)27 |
| ⓘ Wollastonite Formula: Ca3(Si3O9) Localities: Băiţa mining district, Nucet, Bihor County, Romania Dognecea mine, Dognecea, Caraş-Severin County, Romania Cornet Hill, Cerboia Valley, Vaţa de Jos, Hunedoara County, Romania Upper Cerboaia Valley, Cerboia Valley, Vaţa de Jos, Hunedoara County, Romania Magureaua Vatei, Cerboia Valley, Vaţa de Jos, Hunedoara County, Romania |
| ⓘ 'Wollastonite-1A' Formula: CaSiO3 |
| ⓘ Woodhouseite Formula: CaAl3(PO4)(SO4)(OH)6 |
| ⓘ Wulfenite Formula: Pb(MoO4) |
| ⓘ Wurtzite Formula: (Zn,Fe)S |
| ⓘ Xanthoconite Formula: Ag3AsS3 References: |
| ⓘ Xonotlite Formula: Ca6(Si6O17)(OH)2 References: Marincea, Ş., Bilal, E., Verkaeren, J., Pascal, M.-L., Fonteilles, M. (2001) Superposed paragenesis in spurrite-, tilleyite- and gehlenite-bearing skarns from Cornet Hill, Apuseni Mountains, Romania. The Canadian Mineralogist, 39 (5). 1435-1453 doi:10.2113/gscanmin.39.5.1435 |
| ⓘ Zavyalovite Formula: Ag2TeS3 |
| ⓘ 'Zeolite Group' |
| ⓘ Zinkenite Formula: Pb9Sb22S42 |
| ⓘ Zippeite Formula: K3(UO2)4(SO4)2O3(OH) · 3H2O References: |
| ⓘ Zircon Formula: Zr(SiO4) |
| ⓘ Zunyite Formula: Al13Si5O20(OH,F)18Cl |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Native Gold var. Electrum | 1.AA.05 | (Au,Ag) |
| ⓘ | 1.AA.05 | Au | |
| ⓘ | Native Silver | 1.AA.05 | Ag |
| ⓘ | Native Arsenic | 1.CA.05 | As |
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| ⓘ | Native Sulphur | 1.CC.05 | S8 |
| ⓘ | Native Tellurium | 1.CC.10 | Te |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Maldonite | 2.AA.40 | Au2Bi |
| ⓘ | Alburnite | 2.BA. | Ag8GeTe2S4 |
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Djurleite | 2.BA.05 | Cu31S16 |
| ⓘ | Digenite | 2.BA.10 | Cu9S5 |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Rickardite | 2.BA.30 | Cu7Te5 |
| ⓘ | Weissite | 2.BA.30 | Cu2-xTe |
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Stromeyerite | 2.BA.40 | AgCuS |
| ⓘ | Eucairite | 2.BA.50 | AgCuSe |
| ⓘ | Naumannite | 2.BA.55 | Ag2Se |
| ⓘ | Cervelleite | 2.BA.60 | Ag4TeS |
| ⓘ | Hessite | 2.BA.60 | Ag2Te |
| ⓘ | Stützite (TL) | 2.BA.65 | Ag5-xTe3, x = 0.24-0.36 |
| ⓘ | Argyrodite | 2.BA.70 | Ag8GeS6 |
| ⓘ | Canfieldite | 2.BA.70 | Ag8SnS6 |
| ⓘ | Petzite (TL) | 2.BA.75 | Ag3AuTe2 |
| ⓘ | Uytenbogaardtite | 2.BA.75 | Ag3AuS2 |
| ⓘ | Cobaltpentlandite | 2.BB.15 | Co9S8 |
| ⓘ | Pentlandite | 2.BB.15 | (NixFey)Σ9S8 |
| ⓘ | Imiterite | 2.BD.05 | Ag2HgS2 |
| ⓘ | Betekhtinite | 2.BE.05 | Pb2(Cu,Fe)22-24S15 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Klockmannite | 2.CA.05b | CuSe |
| ⓘ | Coloradoite | 2.CB.05a | HgTe |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | var. Marmatite | 2.CB.05a | (Zn,Fe)S |
| ⓘ | var. Cleiophane | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Gallite | 2.CB.10a | CuGaS2 |
| ⓘ | Roquesite | 2.CB.10a | CuInS2 |
| ⓘ | Idaite | 2.CB.15a | Cu5FeS6 |
| ⓘ | Kësterite | 2.CB.15a | Cu2ZnSnS4 |
| ⓘ | Pirquitasite | 2.CB.15a | Ag2ZnSnS4 |
| ⓘ | Stannite | 2.CB.15a | Cu2FeSnS4 |
| ⓘ | Stannoidite | 2.CB.15c | Cu+6Cu2+2(Fe2+,Zn)3Sn2S12 |
| ⓘ | Mawsonite | 2.CB.20 | Cu6Fe2SnS8 |
| ⓘ | Colusite | 2.CB.30 | Cu13VAs3S16 |
| ⓘ | Germanite | 2.CB.30 | Cu13Fe2Ge2S16 |
| ⓘ | Kiddcreekite | 2.CB.35a | Cu6SnWS8 |
| ⓘ | Renierite | 2.CB.35a | (Cu1+,Zn)11Fe4(Ge4+,As5+)2S16 |
| ⓘ | Vinciennite | 2.CB.35a | Cu+7Cu2+3Fe2+2Fe3+2Sn(As,Sb)S16 |
| ⓘ | Greenockite | 2.CB.45 | CdS |
| ⓘ | Wurtzite | 2.CB.45 | (Zn,Fe)S |
| ⓘ | Cubanite | 2.CB.55a | CuFe2S3 |
| ⓘ | Vulcanite | 2.CB.75 | CuTe |
| ⓘ | Empressite | 2.CB.80 | AgTe |
| ⓘ | Muthmannite (TL) | 2.CB.85 | AuAgTe2 |
| ⓘ | Nickeline | 2.CC.05 | NiAs |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Millerite | 2.CC.20 | NiS |
| ⓘ | Alabandite (TL) | 2.CD.10 | MnS |
| ⓘ | Altaite | 2.CD.10 | PbTe |
| ⓘ | Clausthalite | 2.CD.10 | PbSe |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Carrollite | 2.DA.05 | CuCo2S4 |
| ⓘ | Greigite | 2.DA.05 | Fe2+Fe3+2S4 |
| ⓘ | Linnaeite | 2.DA.05 | Co2+Co3+2S4 |
| ⓘ | Polydymite | 2.DA.05 | Ni2+Ni3+2S4 |
| ⓘ | Siegenite | 2.DA.05 | CoNi2S4 |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Ingodite | 2.DC.05 | Bi2TeS |
| ⓘ | Joséite-A | 2.DC.05 | Bi4TeS2 |
| ⓘ | Pilsenite | 2.DC.05 | Bi4Te3 |
| ⓘ | Tellurantimony | 2.DC.05 | Sb2Te3 |
| ⓘ | Tellurobismuthite | 2.DC.05 | Bi2Te3 |
| ⓘ | Tetradymite | 2.DC.05 | Bi2Te2S |
| ⓘ | Tsumoite | 2.DC.05 | BiTe |
| ⓘ | Zavyalovite | 2.EA. | Ag2TeS3 |
| ⓘ | Sylvanite | 2.EA.05 | AgAuTe4 |
| ⓘ | Calaverite | 2.EA.10 | AuTe2 |
| ⓘ | Krennerite (TL) | 2.EA.15 | Au3AgTe8 |
| ⓘ | Melonite | 2.EA.20 | NiTe2 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite var. Bravoite | 2.EB.05a | (Fe,Ni)S2 |
| ⓘ | 2.EB.05a | FeS2 | |
| ⓘ | Vaesite | 2.EB.05a | NiS2 |
| ⓘ | Pyrite var. Copper-bearing Pyrite | 2.EB.05a | (Fe,Cu)S2 |
| ⓘ | Frohbergite | 2.EB.10a | FeTe2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Alloclasite | 2.EB.10b | Co1-xFexAsS |
| ⓘ | Löllingite | 2.EB.15a | FeAs2 |
| ⓘ | Rammelsbergite | 2.EB.15a | NiAs2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Cobaltite | 2.EB.25 | CoAsS |
| ⓘ | Gersdorffite | 2.EB.25 | NiAsS |
| ⓘ | Skutterudite | 2.EC.05 | CoAs3 |
| ⓘ | Realgar | 2.FA.15a | As4S4 |
| ⓘ | Orpiment | 2.FA.30 | As2S3 |
| ⓘ | Djerfisherite | 2.FC.05 | K6(Fe,Cu,Ni)25S26Cl |
| ⓘ | Proustite | 2.GA.05 | Ag3AsS3 |
| ⓘ | Pyrargyrite | 2.GA.05 | Ag3SbS3 |
| ⓘ | Xanthoconite | 2.GA.10 | Ag3AsS3 |
| ⓘ | Wittichenite | 2.GA.20 | Cu3BiS3 |
| ⓘ | Bournonite | 2.GA.50 | PbCuSbS3 |
| ⓘ | Seligmannite | 2.GA.50 | PbCuAsS3 |
| ⓘ | Tennantite-(Cu) | 2.GB. | Cu6(Cu4Cu2)As4S12S |
| ⓘ | Tetrahedrite-(Mn) | 2.GB. | Cu6(Cu4Mn2)Sb4S12S |
| ⓘ | Tennantite-(Mn) | 2.GB. | Cu6(Cu4Mn2)As4S12S |
| ⓘ | 'Freibergite Subgroup' ? | 2.GB.05 | (Ag6,[Ag6]4+)(Cu4 C2+2)Sb4S12S0-1 |
| ⓘ | Goldfieldite | 2.GB.05 | (Cu4◻2)(Cu4Cu+2)Te4S12S |
| ⓘ | 'Tennantite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)As4S12S |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | Tetrahedrite-(Zn) | 2.GB.05 | Cu6(Cu4Zn2)Sb4S12S |
| ⓘ | Tennantite-(Fe) | 2.GB.05 | Cu6(Cu4Fe2+2)As4S12S |
| ⓘ | Tetrahedrite-(Fe) | 2.GB.05 | Cu6(Cu4Fe2+2)Sb4S12S |
| ⓘ | Stephanite | 2.GB.10 | Ag5SbS4 |
| ⓘ | Pearceite | 2.GB.15 | [Ag6As2S7][Ag9CuS4] |
| ⓘ | Polybasite | 2.GB.15 | [Ag6Sb2S7][Ag9CuS4] |
| ⓘ | Manganoquadratite | 2.GC.25 | AgMnAsS3 |
| ⓘ | Trechmannite | 2.GC.35 | AgAsS2 |
| ⓘ | Aleksite | 2.GC.40a | PbBi2Te2S2 |
| ⓘ | Saddlebackite | 2.GC.40d | Pb2Bi2Te2S3 |
| ⓘ | Emplectite | 2.HA.05 | CuBiS2 |
| ⓘ | Berthierite | 2.HA.20 | FeSb2S4 |
| ⓘ | Baumstarkite | 2.HA.25 | Ag3Sb3S6 |
| ⓘ | Aikinite | 2.HB.05a | PbCuBiS3 |
| ⓘ | Friedrichite | 2.HB.05a | Pb5Cu5Bi7S18 |
| ⓘ | Hammarite | 2.HB.05a | Pb2Cu2Bi4S9 |
| ⓘ | Krupkaite | 2.HB.05a | PbCuBi3S6 |
| ⓘ | Pekoite | 2.HB.05a | PbCuBi11S18 |
| ⓘ | Benavidesite | 2.HB.15 | Pb4MnSb6S14 |
| ⓘ | Nagyágite (TL) | 2.HB.20a | [Pb3(Pb,Sb)3S6](Au,Te)3 |
| ⓘ | Buckhornite | 2.HB.20b | AuPb2BiTe2S3 |
| ⓘ | Museumite (TL) | 2.HB.20c | [Pb2(Pb,Sb)2S8][(Te,Au)2] |
| ⓘ | Berryite | 2.HB.20d | Cu3Ag2Pb3Bi7S16 |
| ⓘ | Bernarlottiite | 2.HC. | Pb6(As5Sb3)S18 |
| ⓘ | Guettardite | 2.HC.05a | Pb8(Sb0.56As0.44)16S32 |
| ⓘ | Baumhauerite | 2.HC.05b | Pb12As16S36 |
| ⓘ | Liveingite | 2.HC.05c | Pb9As13S28 |
| ⓘ | Dufrénoysite | 2.HC.05d | Pb2As2S5 |
| ⓘ | Fülöppite | 2.HC.10a | Pb3Sb8S15 |
| ⓘ | Plagionite | 2.HC.10b | Pb5Sb8S17 |
| ⓘ | Heteromorphite | 2.HC.10c | Pb7Sb8S19 |
| ⓘ | Semseyite | 2.HC.10d | Pb9Sb8S21 |
| ⓘ | Boulangerite | 2.HC.15 | Pb5Sb4S11 |
| ⓘ | Falkmanite | 2.HC.15 | Pb3Sb2S6 |
| ⓘ | Robinsonite | 2.HC.20 | Pb4Sb6S13 |
| ⓘ | Lopatkaite | 2.HC.50 | Pb5Sb3AsS11 |
| ⓘ | Boscardinite | 2.HD. | TlPb4(Sb7As2)S18 |
| ⓘ | Cupropavonite | 2.JA.05a | Cu0.9Ag0.5Pb0.6Bi2.5S5 |
| ⓘ | Makovickyite (TL) | 2.JA.05d | Cu1.12Ag0.81Pb0.27Bi5.35S9 |
| ⓘ | Cupromakovickyite | 2.JA.05d | Cu4AgPb2Bi9S18 |
| ⓘ | Benjaminite | 2.JA.05e | Ag3Bi7S12 |
| ⓘ | Cuprobismutite | 2.JA.10a | Cu8AgBi13S24 |
| ⓘ | Kupčíkite | 2.JA.10b | Cu3.4Fe0.6Bi5S10 |
| ⓘ | Hodrušite | 2.JA.10c | Cu8Bi12S22 |
| ⓘ | Padĕraite (TL) | 2.JA.10e | Cu7[(Cu,Ag)0.33Pb1.33Bi11.33]S22 |
| ⓘ | Schapbachite | 2.JA.15 | Ag0.4Pb0.2Bi0.4S |
| ⓘ | Senandorite | 2.JB. | AgPbSb3S6 |
| ⓘ | Cosalite | 2.JB.10 | Pb2Bi2S5 |
| ⓘ | Marrite | 2.JB.15 | AgPbAsS3 |
| ⓘ | Cannizzarite | 2.JB.20 | Pb48Bi56S132 |
| ⓘ | Wittite ? | 2.JB.20 | Pb9Bi12(S,Se)27 |
| ⓘ | Junoite | 2.JB.25a | Cu2Pb3Bi8(S,Se)16 |
| ⓘ | Nuffieldite | 2.JB.25g | Cu1.4Pb2.4Bi2.4Sb0.2S7 |
| ⓘ | Neyite | 2.JB.25i | Ag2Cu6Pb25Bi26S68 |
| ⓘ | Cuproneyite (TL) | 2.JB.25i | Cu7Pb27Bi25S68 |
| ⓘ | Geocronite | 2.JB.30a | Pb14Sb6S23 |
| ⓘ | Jordanite | 2.JB.30a | Pb14As6S23 |
| ⓘ | Zinkenite | 2.JB.35a | Pb9Sb22S42 |
| ⓘ | 'Bursaite' | 2.JB.40a | Pb5Bi4S11 (?) |
| ⓘ | Gustavite | 2.JB.40a | AgPbBi3S6 |
| ⓘ | Lillianite | 2.JB.40a | Pb3-2xAgxBi2+xS6 |
| ⓘ | Vikingite | 2.JB.40a | Ag5Pb8Bi13S30 |
| ⓘ | Quatrandorite | 2.JB.40a | AgPbSb3S6 |
| ⓘ | Menchettiite | 2.JB.40a | AgPb2.40Mn1.60Sb3As2S12 |
| ⓘ | Oyonite | 2.JB.40a | Ag3Mn2Pb4Sb7As4S24 |
| ⓘ | Aschamalmite | 2.JB.40b | Pb6-3xBi2+xS9 |
| ⓘ | Heyrovskýite | 2.JB.40b | Pb6Bi2S9 |
| ⓘ | 'Schirmerite' | 2.JB.40d | PbAgBi3S6 - Pb3Ag1.5Bi3.5S9 |
| ⓘ | Galenobismutite | 2.JC.25e | PbBi2S4 |
| ⓘ | Enargite | 2.KA.05 | Cu3AsS4 |
| ⓘ | Briartite | 2.KA.10 | Cu2FeGeS4 |
| ⓘ | Famatinite | 2.KA.10 | Cu3SbS4 |
| ⓘ | Luzonite | 2.KA.10 | Cu3AsS4 |
| ⓘ | Keutschite | 2.KA.10 | Cu2AgAsS4 |
| ⓘ | Billingsleyite | 2.KB.05 | Ag7AsS6 |
| ⓘ | Benleonardite | 2.LA.50 | [Ag6(Sb,As)2S6Te][Ag9Cu(S,Te)2Te2] |
| ⓘ | Miharaite | 2.LB.05 | Cu4FePbBiS6 |
| Group 3 - Halides | |||
| ⓘ | Halite | 3.AA.20 | NaCl |
| ⓘ | Sylvite | 3.AA.20 | KCl |
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| ⓘ | Cotunnite | 3.AB.85 | PbCl2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
| ⓘ | Ulvöspinel | 4.BB.05 | TiFe2+2O4 |
| ⓘ | Corundum | 4.CB.05 | Al2O3 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Hematite var. Specularite | 4.CB.05 | Fe2O3 |
| ⓘ | Arsenolite | 4.CB.50 | As2O3 |
| ⓘ | Valentinite | 4.CB.55 | Sb2O3 |
| ⓘ | Bismite | 4.CB.60 | Bi2O3 |
| ⓘ | Perovskite | 4.CC.30 | CaTiO3 |
| ⓘ | Quartz var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Rock Crystal | 4.DA.05 | SiO2 |
| ⓘ | var. Milky Quartz | 4.DA.05 | SiO2 |
| ⓘ | Opal | 4.DA.10 | SiO2 · nH2O |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Tellurite | 4.DE.20 | TeO2 |
| ⓘ | Brannerite | 4.DH.05 | UTi2O6 |
| ⓘ | Hollandite | 4.DK.05a | Ba(Mn4+6Mn3+2)O16 |
| ⓘ | Romanèchite | 4.DK.10 | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| ⓘ | Uraninite | 4.DL.05 | UO2 |
| ⓘ | Spertiniite | 4.FD.05 | Cu(OH)2 |
| ⓘ | Diaspore | 4.FD.10 | AlO(OH) |
| ⓘ | Manganite | 4.FD.15 | Mn3+O(OH) |
| ⓘ | Brucite | 4.FE.05 | Mg(OH)2 |
| ⓘ | Portlandite | 4.FE.05 | Ca(OH)2 |
| ⓘ | Lepidocrocite | 4.FE.15 | Fe3+O(OH) |
| ⓘ | Ranciéite | 4.FL.40 | (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| ⓘ | Becquerelite | 4.GB.10 | Ca(UO2)6O4(OH)6 · 8H2O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | var. Cobalt-bearing Calcite | 5.AB.05 | (Ca,Co)CO3 |
| ⓘ | Magnesite | 5.AB.05 | MgCO3 |
| ⓘ | Calcite var. Manganese-bearing Calcite | 5.AB.05 | (Ca,Mn)CO3 |
| ⓘ | Rhodochrosite | 5.AB.05 | MnCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Smithsonite | 5.AB.05 | ZnCO3 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Kutnohorite | 5.AB.10 | CaMn2+(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Aurichalcite | 5.BA.15 | (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ | Brianyoungite | 5.BF.30 | Zn3(CO3,SO4)(OH)4 |
| ⓘ | Hydromagnesite | 5.DA.05 | Mg5(CO3)4(OH)2 · 4H2O |
| ⓘ | Andersonite | 5.ED.30 | Na2Ca(UO2)(CO3)3 · 6H2O |
| Group 6 - Borates | |||
| ⓘ | Kotoite | 6.AA.35 | Mg3[BO3]2 |
| ⓘ | Ludwigite | 6.AB.30 | Mg2Fe3+(BO3)O2 |
| ⓘ | Fluoborite | 6.AB.50 | Mg3(BO3)(F,OH)3 |
| ⓘ | Suanite | 6.BA.05 | Mg2[B2O5] |
| ⓘ | Szaibélyite (TL) | 6.BA.15 | MgBO2(OH) |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anhydrite | 7.AD.30 | CaSO4 |
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Alunite | 7.BC.10 | KAl3(SO4)2(OH)6 |
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Natrojarosite | 7.BC.10 | NaFe3(SO4)2(OH)6 |
| ⓘ | Caledonite | 7.BC.50 | Pb5Cu2(SO4)3(CO3)(OH)6 |
| ⓘ | Linarite | 7.BC.65 | PbCu(SO4)(OH)2 |
| ⓘ | Rozenite | 7.CB.15 | FeSO4 · 4H2O |
| ⓘ | Chalcanthite | 7.CB.20 | CuSO4 · 5H2O |
| ⓘ | Jôkokuite | 7.CB.20 | MnSO4 · 5H2O |
| ⓘ | Melanterite | 7.CB.35 | Fe2+(H2O)6SO4 · H2O |
| ⓘ | Alunogen | 7.CB.45 | Al2(SO4)3 · 17H2O |
| ⓘ | Apjohnite | 7.CB.85 | Mn2+Al2(SO4)4 · 22H2O |
| ⓘ | Dietrichite | 7.CB.85 | (Zn,Fe2+,Mn2+)Al2(SO4)4 · 22H2O |
| ⓘ | Halotrichite | 7.CB.85 | FeAl2(SO4)4 · 22H2O |
| ⓘ | Pickeringite | 7.CB.85 | MgAl2(SO4)4 · 22H2O |
| ⓘ | Kalinite | 7.CC.15 | KAl(SO4)2 · 11H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Copiapite | 7.DB.35 | Fe2+Fe3+4(SO4)6(OH)2 · 20H2O |
| ⓘ | Langite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Thaumasite | 7.DG.15 | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| ⓘ | Zippeite | 7.EC.05 | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| ⓘ | Crocoite | 7.FA.20 | PbCr6+O4 |
| ⓘ | Powellite | 7.GA.05 | Ca(MoO4) |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Berlinite | 8.AA.05 | AlPO4 |
| ⓘ | Whitlockite | 8.AC.45 | Ca9Mg(PO4)6(PO3OH) |
| ⓘ | Monetite | 8.AD.10 | Ca(PO3OH) |
| ⓘ | Pseudomalachite | 8.BD.05 | Cu5(PO4)2(OH)4 |
| ⓘ | Theisite | 8.BE.75 | Cu5Zn5(AsO4,SbO4)2(OH)14 |
| ⓘ | Conichalcite | 8.BH.35 | CaCu(AsO4)(OH) |
| ⓘ | Mottramite | 8.BH.40 | PbCu(VO4)(OH) |
| ⓘ | Svanbergite | 8.BL.05 | SrAl3(PO4)(SO4)(OH)6 |
| ⓘ | Woodhouseite | 8.BL.05 | CaAl3(PO4)(SO4)(OH)6 |
| ⓘ | Crandallite | 8.BL.10 | CaAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Hydroxylapatite var. Carbonate-rich Hydroxylapatite | 8.BN.05 | Ca5(PO4,CO3)3(OH,O) |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Hydroxylapatite | 8.BN.05 | Ca5(PO4)3(OH) |
| ⓘ | Mimetite | 8.BN.05 | Pb5(AsO4)3Cl |
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Villyaellenite | 8.CB.10 | (Mn,Ca)Mn2Ca2(AsO3OH)2(AsO4)2 · 4H2O |
| ⓘ | Krautite (TL) | 8.CB.15 | Mn(HAsO4) · H2O |
| ⓘ | Scorodite | 8.CD.10 | Fe3+AsO4 · 2H2O |
| ⓘ | Geigerite | 8.CE.05 | Mn2+5(AsO4)2(HAsO4)2 · 10H2O |
| ⓘ | Annabergite | 8.CE.40 | Ni3(AsO4)2 · 8H2O |
| ⓘ | Erythrite | 8.CE.40 | Co3(AsO4)2 · 8H2O |
| ⓘ | Hörnesite | 8.CE.40 | Mg3(AsO4)2 · 8H2O |
| ⓘ | Vivianite | 8.CE.40 | Fe2+Fe2+2(PO4)2 · 8H2O |
| ⓘ | Symplesite | 8.CE.45 | Fe2+3(AsO4)2 · 8H2O |
| ⓘ | Francoanellite | 8.CH.25 | K3Al5(PO3OH)6(PO4)2 · 12H2O |
| ⓘ | Taranakite | 8.CH.25 | K3Al5(PO3OH)6(PO4)2 · 18H2O |
| ⓘ | Ardealite | 8.CJ.50 | Ca2(PO3OH)(SO4) · 4H2O |
| ⓘ | Brushite | 8.CJ.50 | Ca(PO3OH) · 2H2O |
| ⓘ | Vashegyite | 8.DB.10 | Al11(PO4)9(OH)6 · 38H2O |
| ⓘ | Evansite | 8.DF.10 | Al3(PO4)(OH)6 · 6H2O |
| ⓘ | Chalcophyllite | 8.DF.30 | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| ⓘ | Leucophosphite | 8.DH.10 | KFe3+2(PO4)2(OH) · 2H2O |
| ⓘ | Pharmacosiderite | 8.DK.10 | KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| ⓘ | Tyrolite | 8.DM.10 | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| ⓘ | Autunite | 8.EB.05 | Ca(UO2)2(PO4)2 · 10-12H2O |
| Group 9 - Silicates | |||
| ⓘ | Chrysotile | 9.00. | Mg3(Si2O5)(OH)4 |
| ⓘ | Forsterite | 9.AC.05 | Mg2SiO4 |
| ⓘ | Monticellite | 9.AC.10 | CaMgSiO4 |
| ⓘ | Andradite | 9.AD.25 | Ca3Fe3+2(SiO4)3 |
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Grossular | 9.AD.25 | Ca3Al2(SiO4)3 |
| ⓘ | var. Hibschite | 9.AD.25 | Ca3Al2(SiO4)3-x(OH)4x |
| ⓘ | Coffinite | 9.AD.30 | U(SiO4) · nH2O |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Norbergite | 9.AF.40 | Mg3(SiO4)F2 |
| ⓘ | Chondrodite | 9.AF.45 | Mg5(SiO4)2F2 |
| ⓘ | Clinohumite | 9.AF.55 | Mg9(SiO4)4F2 |
| ⓘ | Braunite | 9.AG.05 | Mn2+Mn3+6(SiO4)O8 |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Afwillite | 9.AG.75 | Ca3[SiO4][SiO2(OH)2] · 2H2O |
| ⓘ | Spurrite | 9.AH.15 | Ca5(SiO4)2(CO3) |
| ⓘ | Hydroxylellestadite | 9.AH.25 | Ca5(SiO4)1.5(SO4)1.5(OH) |
| ⓘ | Kasolite | 9.AK.15 | Pb(UO2)(SiO4) · H2O |
| ⓘ | Uranophane | 9.AK.15 | Ca(UO2)2(SiO3OH)2 · 5H2O |
| ⓘ | Cebollite | 9.BB.10 | Ca5Al2(SiO4)3(OH)4 |
| ⓘ | Gehlenite | 9.BB.10 | Ca2Al[AlSiO7] |
| ⓘ | Rankinite | 9.BC.15 | Ca3Si2O7 |
| ⓘ | Hemimorphite (TL) | 9.BD.10 | Zn4Si2O7(OH)2 · H2O |
| ⓘ | Ilvaite | 9.BE.07 | CaFe3+Fe2+2(Si2O7)O(OH) |
| ⓘ | Manganilvaite | 9.BE.07 | CaFe2+Fe3+Mn2+(Si2O7)O(OH) |
| ⓘ | Cuspidine | 9.BE.17 | Ca8(Si2O7)2F4 |
| ⓘ | Tilleyite | 9.BE.82 | Ca5(Si2O7)(CO3)2 |
| ⓘ | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Vesuvianite | 9.BG.35 | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ | Zunyite | 9.BJ.55 | Al13Si5O20(OH,F)18Cl |
| ⓘ | Cordierite | 9.CJ.10 | (Mg,Fe)2Al3(AlSi5O18) |
| ⓘ | Dioptase | 9.CJ.30 | CuSiO3 · H2O |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Scawtite | 9.CK.15 | Ca7(Si3O9)2CO3 · 2H2O |
| ⓘ | Pigeonite | 9.DA.10 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Augite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Hedenbergite | 9.DA.15 | CaFe2+Si2O6 |
| ⓘ | Johannsenite | 9.DA.15 | CaMn2+Si2O6 |
| ⓘ | Hedenbergite var. Manganese-bearing Hedenbergite | 9.DA.15 | Ca(Fe,Mn)2+Si2O6 |
| ⓘ | Kushiroite | 9.DA.15 | CaAlAlSiO6 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Ferro-actinolite | 9.DE.10 | ◻Ca2Fe2+5(Si8O22)(OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Bustamite | 9.DG.05 | CaMn2+(Si2O6) |
| ⓘ | Wollastonite | 9.DG.05 | Ca3(Si3O9) |
| ⓘ | 'Wollastonite-1A' | 9.DG.05 | CaSiO3 |
| ⓘ | Plombièrite | 9.DG.08 | Ca5Si6O16(OH)2 · 7H2O |
| ⓘ | Riversideite | 9.DG.10 | Ca5Si6O16(OH)2 · 2H2O |
| ⓘ | Tobermorite | 9.DG.10 | Ca5Si6O17 · 5H2O |
| ⓘ | Foshagite | 9.DG.15 | Ca4(Si3O9)(OH)2 |
| ⓘ | Xonotlite | 9.DG.35 | Ca6(Si6O17)(OH)2 |
| ⓘ | Rhodonite | 9.DK.05 | CaMn3Mn[Si5O15] |
| ⓘ | Fukalite | 9.DQ.05 | Ca4[Si2O6][CO3](OH)2 |
| ⓘ | Fluorapophyllite-(K) | 9.EA.15 | KCa4(Si8O20)(F,OH) · 8H2O |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Pyrophyllite | 9.EC.10 | Al2Si4O10(OH)2 |
| ⓘ | Celadonite | 9.EC.15 | K(MgFe3+◻)(Si4O10)(OH)2 |
| ⓘ | Muscovite var. Illite | 9.EC.15 | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Montmorillonite | 9.EC.40 | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ | Vermiculite | 9.EC.50 | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| ⓘ | Chamosite | 9.EC.55 | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | var. Pennine | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Dickite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Halloysite | 9.ED.10 | Al2(Si2O5)(OH)4 |
| ⓘ | Lizardite | 9.ED.15 | Mg3(Si2O5)(OH)4 |
| ⓘ | Allophane | 9.ED.20 | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Anorthite | 9.FA.35 | Ca(Al2Si2O8) |
| ⓘ | Kamaishilite | 9.FB.10 | Ca2(Al2SiO6)(OH)2 |
| ⓘ | 'Zeolite Group' | 9.G0. | |
| ⓘ | Natrolite | 9.GA.05 | Na2Al2Si3O10 · 2H2O |
| ⓘ | Laumontite | 9.GB.10 | CaAl2Si4O12 · 4H2O |
| ⓘ | Mountainite | 9.GG.10 | KNa2Ca2[Si8O19(OH)] · 6H2O |
| Unclassified | |||
| ⓘ | 'K Feldspar var. Adularia' | - | KAlSi3O8 |
| ⓘ | 'Amphibole Supergroup' | - | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ | 'Andorite' | - | AgPbSb3S6 |
| ⓘ | 'Biharite' | - | |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Clay minerals' | - | |
| ⓘ | 'Ellestadite' | - | |
| ⓘ | 'Tennantite-Tetrahedrite Series' | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Calcium Amphibole Subgroup var. Hornblende' | - | AnCa2(Z2+5-mZ3+m)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Monazite Group' | - | REE(PO4) |
| ⓘ | 'Stilbite Subgroup' | - | M6-7[Al8-9Si27-28O72] · nH2O |
| ⓘ | 'Thrombolite (of Breithaupt)' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Melnikovite' | - | |
| ⓘ | 'Leucoxene' | - | |
| ⓘ | 'Mica Group' | - | |
| ⓘ | 'Calamine' | - | |
| ⓘ | 'Andradite-Grossular Series' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| ⓘ | 'Geocronite-Jordanite Series' | - | |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Gismondine Subgroup' | - | |
| ⓘ | 'Smectite Group' | - | A0.3D2-3[T4O10]Z2 · nH2O |
| ⓘ | 'Serpentine Subgroup' | - | D3[Si2O5](OH)4 |
| ⓘ | 'Manganese Oxides' | - | |
| ⓘ | 'Thomsonite Subgroup' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'Olivine Group' | - | M2SiO4 |
| ⓘ | 'Melilite Group' | - | Ca2M(XSiO7) |
| ⓘ | 'Calcium Amphibole Subgroup' | - | AnCa2(Z2+5-mZ3+m)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| ⓘ | 'Famatinite-Luzonite Series' | - | |
| ⓘ | 'Dognácskaite' | - | |
| ⓘ | 'Rezbanyite (of Frenzel)' | - | Pb3Cu2Bi10S19 |
| ⓘ | 'Illite-2M' | - | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ | 'Clinochlore-1MIa' | - | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | 'Clinochlore-1MIb' | - | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | 'UM1986-36-S:AsCuFeGe' | - | Cu11Fe4GeAsS16 |
| ⓘ | 'UM2003-15-S:AgCuTe' | - | Ag2Cu2TeS |
| ⓘ | 'Mn-rich fizeleyite analogue' | - | Ag5Mn7Pb7Sb21S48 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Afwillite | Ca3[SiO4][SiO2(OH)2] · 2H2O |
| H | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| H | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| H | ⓘ Alunogen | Al2(SO4)3 · 17H2O |
| H | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| H | ⓘ Andersonite | Na2Ca(UO2)(CO3)3 · 6H2O |
| H | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| H | ⓘ Apjohnite | Mn2+Al2(SO4)4 · 22H2O |
| H | ⓘ Ardealite | Ca2(PO3OH)(SO4) · 4H2O |
| H | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| H | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Becquerelite | Ca(UO2)6O4(OH)6 · 8H2O |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Brushite | Ca(PO3OH) · 2H2O |
| H | ⓘ Brucite | Mg(OH)2 |
| H | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| H | ⓘ Hydroxylapatite var. Carbonate-rich Hydroxylapatite | Ca5(PO4,CO3)3(OH,O) |
| H | ⓘ Cebollite | Ca5Al2(SiO4)3(OH)4 |
| H | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| H | ⓘ Chalcanthite | CuSO4 · 5H2O |
| H | ⓘ Chamosite | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| H | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| H | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Coffinite | U(SiO4) · nH2O |
| H | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| H | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| H | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Diaspore | AlO(OH) |
| H | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| H | ⓘ Dietrichite | (Zn,Fe2+,Mn2+)Al2(SO4)4 · 22H2O |
| H | ⓘ Dioptase | CuSiO3 · H2O |
| H | ⓘ Ellestadite | |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| H | ⓘ Evansite | Al3(PO4)(OH)6 · 6H2O |
| H | ⓘ Ferro-actinolite | ◻Ca2Fe52+(Si8O22)(OH)2 |
| H | ⓘ Fluoborite | Mg3(BO3)(F,OH)3 |
| H | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| H | ⓘ Foshagite | Ca4(Si3O9)(OH)2 |
| H | ⓘ Francoanellite | K3Al5(PO3OH)6(PO4)2 · 12H2O |
| H | ⓘ Fukalite | Ca4[Si2O6][CO3](OH)2 |
| H | ⓘ Geigerite | Mn52+(AsO4)2(HAsO4)2 · 10H2O |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Halloysite | Al2(Si2O5)(OH)4 |
| H | ⓘ Halotrichite | FeAl2(SO4)4 · 22H2O |
| H | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| H | ⓘ Grossular var. Hibschite | Ca3Al2(SiO4)3-x(OH)4x |
| H | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| H | ⓘ Hörnesite | Mg3(AsO4)2 · 8H2O |
| H | ⓘ Hydroxylellestadite | Ca5(SiO4)1.5(SO4)1.5(OH) |
| H | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| H | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| H | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| H | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Jôkokuite | MnSO4 · 5H2O |
| H | ⓘ Kalinite | KAl(SO4)2 · 11H2O |
| H | ⓘ Kamaishilite | Ca2(Al2SiO6)(OH)2 |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Kasolite | Pb(UO2)(SiO4) · H2O |
| H | ⓘ Krautite | Mn(HAsO4) · H2O |
| H | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| H | ⓘ Lepidocrocite | Fe3+O(OH) |
| H | ⓘ Leucophosphite | KFe23+(PO4)2(OH) · 2H2O |
| H | ⓘ Linarite | PbCu(SO4)(OH)2 |
| H | ⓘ Lizardite | Mg3(Si2O5)(OH)4 |
| H | ⓘ Manganite | Mn3+O(OH) |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| H | ⓘ Monetite | Ca(PO3OH) |
| H | ⓘ Mottramite | PbCu(VO4)(OH) |
| H | ⓘ Mountainite | KNa2Ca2[Si8O19(OH)] · 6H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| H | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| H | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Pickeringite | MgAl2(SO4)4 · 22H2O |
| H | ⓘ Plombièrite | Ca5Si6O16(OH)2 · 7H2O |
| H | ⓘ Portlandite | Ca(OH)2 |
| H | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| H | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| H | ⓘ Ranciéite | (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| H | ⓘ Riversideite | Ca5Si6O16(OH)2 · 2H2O |
| H | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| H | ⓘ Rozenite | FeSO4 · 4H2O |
| H | ⓘ Scawtite | Ca7(Si3O9)2CO3 · 2H2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| H | ⓘ Spertiniite | Cu(OH)2 |
| H | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| H | ⓘ Svanbergite | SrAl3(PO4)(SO4)(OH)6 |
| H | ⓘ Symplesite | Fe32+(AsO4)2 · 8H2O |
| H | ⓘ Szaibélyite | MgBO2(OH) |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Taranakite | K3Al5(PO3OH)6(PO4)2 · 18H2O |
| H | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| H | ⓘ Theisite | Cu5Zn5(AsO4,SbO4)2(OH)14 |
| H | ⓘ Tobermorite | Ca5Si6O17 · 5H2O |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| H | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| H | ⓘ Vashegyite | Al11(PO4)9(OH)6 · 38H2O |
| H | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| H | ⓘ Villyaellenite | (Mn,Ca)Mn2Ca2(AsO3OH)2(AsO4)2 · 4H2O |
| H | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| H | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| H | ⓘ Whitlockite | Ca9Mg(PO4)6(PO3OH) |
| H | ⓘ Woodhouseite | CaAl3(PO4)(SO4)(OH)6 |
| H | ⓘ Xonotlite | Ca6(Si6O17)(OH)2 |
| H | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| H | ⓘ Zunyite | Al13Si5O20(OH,F)18Cl |
| H | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Smectite Group | A0.3D2-3[T4O10]Z2 · nH2O |
| H | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| H | ⓘ Manganilvaite | CaFe2+Fe3+Mn2+(Si2O7)O(OH) |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| H | ⓘ Calcium Amphibole Subgroup | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| H | ⓘ Illite-2M | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| H | ⓘ Clinochlore-1MIa | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Clinochlore-1MIb | Mg5Al(AlSi3O10)(OH)8 |
| B | Boron | |
| B | ⓘ Fluoborite | Mg3(BO3)(F,OH)3 |
| B | ⓘ Kotoite | Mg3[BO3]2 |
| B | ⓘ Ludwigite | Mg2Fe3+(BO3)O2 |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Suanite | Mg2[B2O5] |
| B | ⓘ Szaibélyite | MgBO2(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Andersonite | Na2Ca(UO2)(CO3)3 · 6H2O |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| C | ⓘ Hydroxylapatite var. Carbonate-rich Hydroxylapatite | Ca5(PO4,CO3)3(OH,O) |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Calcite var. Cobalt-bearing Calcite | (Ca,Co)CO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Fukalite | Ca4[Si2O6][CO3](OH)2 |
| C | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| C | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| C | ⓘ Magnesite | MgCO3 |
| C | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Rhodochrosite | MnCO3 |
| C | ⓘ Scawtite | Ca7(Si3O9)2CO3 · 2H2O |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Smithsonite | ZnCO3 |
| C | ⓘ Spurrite | Ca5(SiO4)2(CO3) |
| C | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| C | ⓘ Tilleyite | Ca5(Si2O7)(CO3)2 |
| C | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| O | ⓘ Afwillite | Ca3[SiO4][SiO2(OH)2] · 2H2O |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| O | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| O | ⓘ Alunogen | Al2(SO4)3 · 17H2O |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Andersonite | Na2Ca(UO2)(CO3)3 · 6H2O |
| O | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Anhydrite | CaSO4 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| O | ⓘ Anorthite | Ca(Al2Si2O8) |
| O | ⓘ Apjohnite | Mn2+Al2(SO4)4 · 22H2O |
| O | ⓘ Arsenolite | As2O3 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Ardealite | Ca2(PO3OH)(SO4) · 4H2O |
| O | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| O | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Becquerelite | Ca(UO2)6O4(OH)6 · 8H2O |
| O | ⓘ Berlinite | AlPO4 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Bismite | Bi2O3 |
| O | ⓘ Brannerite | UTi2O6 |
| O | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| O | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Brushite | Ca(PO3OH) · 2H2O |
| O | ⓘ Bustamite | CaMn2+(Si2O6) |
| O | ⓘ Brucite | Mg(OH)2 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| O | ⓘ Hydroxylapatite var. Carbonate-rich Hydroxylapatite | Ca5(PO4,CO3)3(OH,O) |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Cebollite | Ca5Al2(SiO4)3(OH)4 |
| O | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Chalcanthite | CuSO4 · 5H2O |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Chamosite | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| O | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| O | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| O | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Clinohumite | Mg9(SiO4)4F2 |
| O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Calcite var. Cobalt-bearing Calcite | (Ca,Co)CO3 |
| O | ⓘ Coffinite | U(SiO4) · nH2O |
| O | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| O | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| O | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| O | ⓘ Corundum | Al2O3 |
| O | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Crocoite | PbCr6+O4 |
| O | ⓘ Cuspidine | Ca8(Si2O7)2F4 |
| O | ⓘ Diaspore | AlO(OH) |
| O | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| O | ⓘ Dietrichite | (Zn,Fe2+,Mn2+)Al2(SO4)4 · 22H2O |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dioptase | CuSiO3 · H2O |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Ellestadite | |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| O | ⓘ Evansite | Al3(PO4)(OH)6 · 6H2O |
| O | ⓘ Ferro-actinolite | ◻Ca2Fe52+(Si8O22)(OH)2 |
| O | ⓘ Fluoborite | Mg3(BO3)(F,OH)3 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| O | ⓘ Forsterite | Mg2SiO4 |
| O | ⓘ Foshagite | Ca4(Si3O9)(OH)2 |
| O | ⓘ Francoanellite | K3Al5(PO3OH)6(PO4)2 · 12H2O |
| O | ⓘ Fukalite | Ca4[Si2O6][CO3](OH)2 |
| O | ⓘ Gehlenite | Ca2Al[AlSiO7] |
| O | ⓘ Geigerite | Mn52+(AsO4)2(HAsO4)2 · 10H2O |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Grossular | Ca3Al2(SiO4)3 |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Halloysite | Al2(Si2O5)(OH)4 |
| O | ⓘ Halotrichite | FeAl2(SO4)4 · 22H2O |
| O | ⓘ Hedenbergite | CaFe2+Si2O6 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| O | ⓘ Grossular var. Hibschite | Ca3Al2(SiO4)3-x(OH)4x |
| O | ⓘ Hollandite | Ba(Mn64+Mn23+)O16 |
| O | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| O | ⓘ Hörnesite | Mg3(AsO4)2 · 8H2O |
| O | ⓘ Hydroxylellestadite | Ca5(SiO4)1.5(SO4)1.5(OH) |
| O | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| O | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| O | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Johannsenite | CaMn2+Si2O6 |
| O | ⓘ Jôkokuite | MnSO4 · 5H2O |
| O | ⓘ Kalinite | KAl(SO4)2 · 11H2O |
| O | ⓘ Kamaishilite | Ca2(Al2SiO6)(OH)2 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Kasolite | Pb(UO2)(SiO4) · H2O |
| O | ⓘ Kotoite | Mg3[BO3]2 |
| O | ⓘ Krautite | Mn(HAsO4) · H2O |
| O | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| O | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| O | ⓘ Lepidocrocite | Fe3+O(OH) |
| O | ⓘ Leucophosphite | KFe23+(PO4)2(OH) · 2H2O |
| O | ⓘ Linarite | PbCu(SO4)(OH)2 |
| O | ⓘ Lizardite | Mg3(Si2O5)(OH)4 |
| O | ⓘ Ludwigite | Mg2Fe3+(BO3)O2 |
| O | ⓘ Magnesite | MgCO3 |
| O | ⓘ Manganite | Mn3+O(OH) |
| O | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| O | ⓘ Mimetite | Pb5(AsO4)3Cl |
| O | ⓘ Monazite Group | REE(PO4) |
| O | ⓘ Monetite | Ca(PO3OH) |
| O | ⓘ Monticellite | CaMgSiO4 |
| O | ⓘ Mottramite | PbCu(VO4)(OH) |
| O | ⓘ Mountainite | KNa2Ca2[Si8O19(OH)] · 6H2O |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| O | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| O | ⓘ Norbergite | Mg3(SiO4)F2 |
| O | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Perovskite | CaTiO3 |
| O | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Pickeringite | MgAl2(SO4)4 · 22H2O |
| O | ⓘ Pigeonite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Plombièrite | Ca5Si6O16(OH)2 · 7H2O |
| O | ⓘ Portlandite | Ca(OH)2 |
| O | ⓘ Powellite | Ca(MoO4) |
| O | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Ranciéite | (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| O | ⓘ Rankinite | Ca3Si2O7 |
| O | ⓘ Rhodochrosite | MnCO3 |
| O | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| O | ⓘ Riversideite | Ca5Si6O16(OH)2 · 2H2O |
| O | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| O | ⓘ Rozenite | FeSO4 · 4H2O |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Scawtite | Ca7(Si3O9)2CO3 · 2H2O |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Smithsonite | ZnCO3 |
| O | ⓘ Spertiniite | Cu(OH)2 |
| O | ⓘ Spinel | MgAl2O4 |
| O | ⓘ Spurrite | Ca5(SiO4)2(CO3) |
| O | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| O | ⓘ Suanite | Mg2[B2O5] |
| O | ⓘ Svanbergite | SrAl3(PO4)(SO4)(OH)6 |
| O | ⓘ Symplesite | Fe32+(AsO4)2 · 8H2O |
| O | ⓘ Szaibélyite | MgBO2(OH) |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Taranakite | K3Al5(PO3OH)6(PO4)2 · 18H2O |
| O | ⓘ Tellurite | TeO2 |
| O | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| O | ⓘ Theisite | Cu5Zn5(AsO4,SbO4)2(OH)14 |
| O | ⓘ Tilleyite | Ca5(Si2O7)(CO3)2 |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Tobermorite | Ca5Si6O17 · 5H2O |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| O | ⓘ Ulvöspinel | TiFe22+O4 |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| O | ⓘ Valentinite | Sb2O3 |
| O | ⓘ Vashegyite | Al11(PO4)9(OH)6 · 38H2O |
| O | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| O | ⓘ Villyaellenite | (Mn,Ca)Mn2Ca2(AsO3OH)2(AsO4)2 · 4H2O |
| O | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| O | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| O | ⓘ Whitlockite | Ca9Mg(PO4)6(PO3OH) |
| O | ⓘ Woodhouseite | CaAl3(PO4)(SO4)(OH)6 |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Wollastonite | Ca3(Si3O9) |
| O | ⓘ Xonotlite | Ca6(Si6O17)(OH)2 |
| O | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Zunyite | Al13Si5O20(OH,F)18Cl |
| O | ⓘ Hematite var. Specularite | Fe2O3 |
| O | ⓘ Quartz var. Rock Crystal | SiO2 |
| O | ⓘ Quartz var. Milky Quartz | SiO2 |
| O | ⓘ Wollastonite-1A | CaSiO3 |
| O | ⓘ Andradite-Grossular Series | |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Pyroxene Group | ADSi2O6 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Smectite Group | A0.3D2-3[T4O10]Z2 · nH2O |
| O | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| O | ⓘ Manganilvaite | CaFe2+Fe3+Mn2+(Si2O7)O(OH) |
| O | ⓘ Hedenbergite var. Manganese-bearing Hedenbergite | Ca(Fe,Mn)2+Si2O6 |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | ⓘ Olivine Group | M2SiO4 |
| O | ⓘ Melilite Group | Ca2M(XSiO7) |
| O | ⓘ Calcium Amphibole Subgroup | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| O | ⓘ Illite-2M | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| O | ⓘ Clinochlore-1MIa | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Clinochlore-1MIb | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Kushiroite | CaAlAlSiO6 |
| F | Fluorine | |
| F | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| F | ⓘ Clinohumite | Mg9(SiO4)4F2 |
| F | ⓘ Cuspidine | Ca8(Si2O7)2F4 |
| F | ⓘ Ellestadite | |
| F | ⓘ Fluoborite | Mg3(BO3)(F,OH)3 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| F | ⓘ Norbergite | Mg3(SiO4)F2 |
| F | ⓘ Zunyite | Al13Si5O20(OH,F)18Cl |
| F | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | ⓘ Calcium Amphibole Subgroup | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Andersonite | Na2Ca(UO2)(CO3)3 · 6H2O |
| Na | ⓘ Halite | NaCl |
| Na | ⓘ Mountainite | KNa2Ca2[Si8O19(OH)] · 6H2O |
| Na | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Na | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| Na | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Brucite | Mg(OH)2 |
| Mg | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| Mg | ⓘ Chamosite | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| Mg | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Clinohumite | Mg9(SiO4)4F2 |
| Mg | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Fluoborite | Mg3(BO3)(F,OH)3 |
| Mg | ⓘ Forsterite | Mg2SiO4 |
| Mg | ⓘ Hörnesite | Mg3(AsO4)2 · 8H2O |
| Mg | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| Mg | ⓘ Kotoite | Mg3[BO3]2 |
| Mg | ⓘ Lizardite | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Ludwigite | Mg2Fe3+(BO3)O2 |
| Mg | ⓘ Magnesite | MgCO3 |
| Mg | ⓘ Monticellite | CaMgSiO4 |
| Mg | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Mg | ⓘ Norbergite | Mg3(SiO4)F2 |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Pickeringite | MgAl2(SO4)4 · 22H2O |
| Mg | ⓘ Pigeonite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Spinel | MgAl2O4 |
| Mg | ⓘ Suanite | Mg2[B2O5] |
| Mg | ⓘ Szaibélyite | MgBO2(OH) |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Mg | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Mg | ⓘ Whitlockite | Ca9Mg(PO4)6(PO3OH) |
| Mg | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Clinochlore-1MIa | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Clinochlore-1MIb | Mg5Al(AlSi3O10)(OH)8 |
| Al | Aluminium | |
| Al | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Al | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| Al | ⓘ Alunogen | Al2(SO4)3 · 17H2O |
| Al | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Al | ⓘ Anorthite | Ca(Al2Si2O8) |
| Al | ⓘ Apjohnite | Mn2+Al2(SO4)4 · 22H2O |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Berlinite | AlPO4 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Cebollite | Ca5Al2(SiO4)3(OH)4 |
| Al | ⓘ Chamosite | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| Al | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Al | ⓘ Corundum | Al2O3 |
| Al | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Diaspore | AlO(OH) |
| Al | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Dietrichite | (Zn,Fe2+,Mn2+)Al2(SO4)4 · 22H2O |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Evansite | Al3(PO4)(OH)6 · 6H2O |
| Al | ⓘ Francoanellite | K3Al5(PO3OH)6(PO4)2 · 12H2O |
| Al | ⓘ Gehlenite | Ca2Al[AlSiO7] |
| Al | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Al | ⓘ Halloysite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Halotrichite | FeAl2(SO4)4 · 22H2O |
| Al | ⓘ Grossular var. Hibschite | Ca3Al2(SiO4)3-x(OH)4x |
| Al | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| Al | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Al | ⓘ Kalinite | KAl(SO4)2 · 11H2O |
| Al | ⓘ Kamaishilite | Ca2(Al2SiO6)(OH)2 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Al | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Pickeringite | MgAl2(SO4)4 · 22H2O |
| Al | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Spinel | MgAl2O4 |
| Al | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Al | ⓘ Svanbergite | SrAl3(PO4)(SO4)(OH)6 |
| Al | ⓘ Taranakite | K3Al5(PO3OH)6(PO4)2 · 18H2O |
| Al | ⓘ Vashegyite | Al11(PO4)9(OH)6 · 38H2O |
| Al | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Al | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | ⓘ Woodhouseite | CaAl3(PO4)(SO4)(OH)6 |
| Al | ⓘ Zunyite | Al13Si5O20(OH,F)18Cl |
| Al | ⓘ Andradite-Grossular Series | |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Al | ⓘ Calcium Amphibole Subgroup | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| Al | ⓘ Illite-2M | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Al | ⓘ Clinochlore-1MIa | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Clinochlore-1MIb | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Kushiroite | CaAlAlSiO6 |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Si | ⓘ Afwillite | Ca3[SiO4][SiO2(OH)2] · 2H2O |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Si | ⓘ Anorthite | Ca(Al2Si2O8) |
| Si | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| Si | ⓘ Bustamite | CaMn2+(Si2O6) |
| Si | ⓘ Cebollite | Ca5Al2(SiO4)3(OH)4 |
| Si | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Chamosite | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| Si | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Clinohumite | Mg9(SiO4)4F2 |
| Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Coffinite | U(SiO4) · nH2O |
| Si | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Si | ⓘ Cuspidine | Ca8(Si2O7)2F4 |
| Si | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Dioptase | CuSiO3 · H2O |
| Si | ⓘ Ellestadite | |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Ferro-actinolite | ◻Ca2Fe52+(Si8O22)(OH)2 |
| Si | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| Si | ⓘ Forsterite | Mg2SiO4 |
| Si | ⓘ Foshagite | Ca4(Si3O9)(OH)2 |
| Si | ⓘ Fukalite | Ca4[Si2O6][CO3](OH)2 |
| Si | ⓘ Gehlenite | Ca2Al[AlSiO7] |
| Si | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Si | ⓘ Halloysite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Si | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Si | ⓘ Grossular var. Hibschite | Ca3Al2(SiO4)3-x(OH)4x |
| Si | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| Si | ⓘ Hydroxylellestadite | Ca5(SiO4)1.5(SO4)1.5(OH) |
| Si | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Si | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| Si | ⓘ Johannsenite | CaMn2+Si2O6 |
| Si | ⓘ Kamaishilite | Ca2(Al2SiO6)(OH)2 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Kasolite | Pb(UO2)(SiO4) · H2O |
| Si | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Si | ⓘ Lizardite | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Monticellite | CaMgSiO4 |
| Si | ⓘ Mountainite | KNa2Ca2[Si8O19(OH)] · 6H2O |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Si | ⓘ Norbergite | Mg3(SiO4)F2 |
| Si | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Pigeonite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Plombièrite | Ca5Si6O16(OH)2 · 7H2O |
| Si | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Rankinite | Ca3Si2O7 |
| Si | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Si | ⓘ Riversideite | Ca5Si6O16(OH)2 · 2H2O |
| Si | ⓘ Scawtite | Ca7(Si3O9)2CO3 · 2H2O |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Spurrite | Ca5(SiO4)2(CO3) |
| Si | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| Si | ⓘ Tilleyite | Ca5(Si2O7)(CO3)2 |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Tobermorite | Ca5Si6O17 · 5H2O |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Si | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Si | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Si | ⓘ Wollastonite | Ca3(Si3O9) |
| Si | ⓘ Xonotlite | Ca6(Si6O17)(OH)2 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Zunyite | Al13Si5O20(OH,F)18Cl |
| Si | ⓘ Quartz var. Rock Crystal | SiO2 |
| Si | ⓘ Quartz var. Milky Quartz | SiO2 |
| Si | ⓘ Wollastonite-1A | CaSiO3 |
| Si | ⓘ Andradite-Grossular Series | |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Pyroxene Group | ADSi2O6 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| Si | ⓘ Manganilvaite | CaFe2+Fe3+Mn2+(Si2O7)O(OH) |
| Si | ⓘ Hedenbergite var. Manganese-bearing Hedenbergite | Ca(Fe,Mn)2+Si2O6 |
| Si | ⓘ Olivine Group | M2SiO4 |
| Si | ⓘ Melilite Group | Ca2M(XSiO7) |
| Si | ⓘ Calcium Amphibole Subgroup | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| Si | ⓘ Illite-2M | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Si | ⓘ Clinochlore-1MIa | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Clinochlore-1MIb | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Kushiroite | CaAlAlSiO6 |
| P | Phosphorus | |
| P | ⓘ Ardealite | Ca2(PO3OH)(SO4) · 4H2O |
| P | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| P | ⓘ Berlinite | AlPO4 |
| P | ⓘ Brushite | Ca(PO3OH) · 2H2O |
| P | ⓘ Hydroxylapatite var. Carbonate-rich Hydroxylapatite | Ca5(PO4,CO3)3(OH,O) |
| P | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Evansite | Al3(PO4)(OH)6 · 6H2O |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Francoanellite | K3Al5(PO3OH)6(PO4)2 · 12H2O |
| P | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| P | ⓘ Leucophosphite | KFe23+(PO4)2(OH) · 2H2O |
| P | ⓘ Monazite Group | REE(PO4) |
| P | ⓘ Monetite | Ca(PO3OH) |
| P | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Svanbergite | SrAl3(PO4)(SO4)(OH)6 |
| P | ⓘ Taranakite | K3Al5(PO3OH)6(PO4)2 · 18H2O |
| P | ⓘ Vashegyite | Al11(PO4)9(OH)6 · 38H2O |
| P | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| P | ⓘ Whitlockite | Ca9Mg(PO4)6(PO3OH) |
| P | ⓘ Woodhouseite | CaAl3(PO4)(SO4)(OH)6 |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Aikinite | PbCuBiS3 |
| S | ⓘ Alabandite | MnS |
| S | ⓘ Aleksite | PbBi2Te2S2 |
| S | ⓘ Alloclasite | Co1-xFexAsS |
| S | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| S | ⓘ Alunogen | Al2(SO4)3 · 17H2O |
| S | ⓘ Andorite | AgPbSb3S6 |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Anhydrite | CaSO4 |
| S | ⓘ Apjohnite | Mn2+Al2(SO4)4 · 22H2O |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Ardealite | Ca2(PO3OH)(SO4) · 4H2O |
| S | ⓘ Argyrodite | Ag8GeS6 |
| S | ⓘ Aschamalmite | Pb6-3xBi2+xS9 |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Baumhauerite | Pb12As16S36 |
| S | ⓘ Benavidesite | Pb4MnSb6S14 |
| S | ⓘ Benjaminite | Ag3Bi7S12 |
| S | ⓘ Berryite | Cu3Ag2Pb3Bi7S16 |
| S | ⓘ Berthierite | FeSb2S4 |
| S | ⓘ Betekhtinite | Pb2(Cu,Fe)22-24S15 |
| S | ⓘ Billingsleyite | Ag7AsS6 |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Boulangerite | Pb5Sb4S11 |
| S | ⓘ Bournonite | PbCuSbS3 |
| S | ⓘ Pyrite var. Bravoite | (Fe,Ni)S2 |
| S | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| S | ⓘ Briartite | Cu2FeGeS4 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Buckhornite | AuPb2BiTe2S3 |
| S | ⓘ Bursaite | Pb5Bi4S11 (?) |
| S | ⓘ Benleonardite | [Ag6(Sb,As)2S6Te][Ag9Cu(S,Te)2Te2] |
| S | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| S | ⓘ Canfieldite | Ag8SnS6 |
| S | ⓘ Cannizzarite | Pb48Bi56S132 |
| S | ⓘ Carrollite | CuCo2S4 |
| S | ⓘ Cervelleite | Ag4TeS |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcanthite | CuSO4 · 5H2O |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| S | ⓘ Cobaltite | CoAsS |
| S | ⓘ Cobaltpentlandite | Co9S8 |
| S | ⓘ Colusite | Cu13VAs3S16 |
| S | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| S | ⓘ Cosalite | Pb2Bi2S5 |
| S | ⓘ Covellite | CuS |
| S | ⓘ Cubanite | CuFe2S3 |
| S | ⓘ Cuprobismutite | Cu8AgBi13S24 |
| S | ⓘ Cupropavonite | Cu0.9Ag0.5Pb0.6Bi2.5S5 |
| S | ⓘ Dietrichite | (Zn,Fe2+,Mn2+)Al2(SO4)4 · 22H2O |
| S | ⓘ Digenite | Cu9S5 |
| S | ⓘ Djerfisherite | K6(Fe,Cu,Ni)25S26Cl |
| S | ⓘ Djurleite | Cu31S16 |
| S | ⓘ Dufrénoysite | Pb2As2S5 |
| S | ⓘ Ellestadite | |
| S | ⓘ Emplectite | CuBiS2 |
| S | ⓘ Enargite | Cu3AsS4 |
| S | ⓘ Tennantite-Tetrahedrite Series | |
| S | ⓘ Falkmanite | Pb3Sb2S6 |
| S | ⓘ Famatinite | Cu3SbS4 |
| S | ⓘ Fülöppite | Pb3Sb8S15 |
| S | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| S | ⓘ Friedrichite | Pb5Cu5Bi7S18 |
| S | ⓘ Galena | PbS |
| S | ⓘ Galenobismutite | PbBi2S4 |
| S | ⓘ Gallite | CuGaS2 |
| S | ⓘ Geocronite | Pb14Sb6S23 |
| S | ⓘ Germanite | Cu13Fe2Ge2S16 |
| S | ⓘ Gersdorffite | NiAsS |
| S | ⓘ Goldfieldite | (Cu4◻2)(Cu4Cu2+)Te4S12S |
| S | ⓘ Greenockite | CdS |
| S | ⓘ Greigite | Fe2+Fe23+S4 |
| S | ⓘ Guettardite | Pb8(Sb0.56As0.44)16S32 |
| S | ⓘ Gustavite | AgPbBi3S6 |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Halotrichite | FeAl2(SO4)4 · 22H2O |
| S | ⓘ Hammarite | Pb2Cu2Bi4S9 |
| S | ⓘ Heteromorphite | Pb7Sb8S19 |
| S | ⓘ Hodrušite | Cu8Bi12S22 |
| S | ⓘ Hydroxylellestadite | Ca5(SiO4)1.5(SO4)1.5(OH) |
| S | ⓘ Idaite | Cu5FeS6 |
| S | ⓘ Imiterite | Ag2HgS2 |
| S | ⓘ Ingodite | Bi2TeS |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Jôkokuite | MnSO4 · 5H2O |
| S | ⓘ Jordanite | Pb14As6S23 |
| S | ⓘ Joséite-A | Bi4TeS2 |
| S | ⓘ Junoite | Cu2Pb3Bi8(S,Se)16 |
| S | ⓘ Kalinite | KAl(SO4)2 · 11H2O |
| S | ⓘ Kësterite | Cu2ZnSnS4 |
| S | ⓘ Kiddcreekite | Cu6SnWS8 |
| S | ⓘ Krupkaite | PbCuBi3S6 |
| S | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Lillianite | Pb3-2xAgxBi2+xS6 |
| S | ⓘ Linarite | PbCu(SO4)(OH)2 |
| S | ⓘ Linnaeite | Co2+Co23+S4 |
| S | ⓘ Liveingite | Pb9As13S28 |
| S | ⓘ Luzonite | Cu3AsS4 |
| S | ⓘ Makovickyite | Cu1.12Ag0.81Pb0.27Bi5.35S9 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Marrite | AgPbAsS3 |
| S | ⓘ Mawsonite | Cu6Fe2SnS8 |
| S | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| S | ⓘ Miharaite | Cu4FePbBiS6 |
| S | ⓘ Millerite | NiS |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Nagyágite | [Pb3(Pb,Sb)3S6](Au,Te)3 |
| S | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| S | ⓘ Neyite | Ag2Cu6Pb25Bi26S68 |
| S | ⓘ Nuffieldite | Cu1.4Pb2.4Bi2.4Sb0.2S7 |
| S | ⓘ Orpiment | As2S3 |
| S | ⓘ Padĕraite | Cu7[(Cu,Ag)0.33Pb1.33Bi11.33]S22 |
| S | ⓘ Pearceite | [Ag6As2S7][Ag9CuS4] |
| S | ⓘ Pekoite | PbCuBi11S18 |
| S | ⓘ Pentlandite | (NixFey)Σ9S8 |
| S | ⓘ Pickeringite | MgAl2(SO4)4 · 22H2O |
| S | ⓘ Pirquitasite | Ag2ZnSnS4 |
| S | ⓘ Plagionite | Pb5Sb8S17 |
| S | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| S | ⓘ Polydymite | Ni2+Ni23+S4 |
| S | ⓘ Proustite | Ag3AsS3 |
| S | ⓘ Pyrargyrite | Ag3SbS3 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Realgar | As4S4 |
| S | ⓘ Renierite | (Cu1+,Zn)11Fe4(Ge4+,As5+)2S16 |
| S | ⓘ Robinsonite | Pb4Sb6S13 |
| S | ⓘ Roquesite | CuInS2 |
| S | ⓘ Rozenite | FeSO4 · 4H2O |
| S | ⓘ Schapbachite | Ag0.4Pb0.2Bi0.4S |
| S | ⓘ Schirmerite | PbAgBi3S6 - Pb3Ag1.5Bi3.5S9 |
| S | ⓘ Seligmannite | PbCuAsS3 |
| S | ⓘ Semseyite | Pb9Sb8S21 |
| S | ⓘ Siegenite | CoNi2S4 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stannite | Cu2FeSnS4 |
| S | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| S | ⓘ Stephanite | Ag5SbS4 |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Stromeyerite | AgCuS |
| S | ⓘ Native Sulphur | S8 |
| S | ⓘ Svanbergite | SrAl3(PO4)(SO4)(OH)6 |
| S | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| S | ⓘ Tetradymite | Bi2Te2S |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| S | ⓘ Trechmannite | AgAsS2 |
| S | ⓘ Uytenbogaardtite | Ag3AuS2 |
| S | ⓘ Vaesite | NiS2 |
| S | ⓘ Vikingite | Ag5Pb8Bi13S30 |
| S | ⓘ Vinciennite | Cu7+Cu32+Fe22+Fe23+Sn(As,Sb)S16 |
| S | ⓘ Wittichenite | Cu3BiS3 |
| S | ⓘ Wittite | Pb9Bi12(S,Se)27 |
| S | ⓘ Woodhouseite | CaAl3(PO4)(SO4)(OH)6 |
| S | ⓘ Wurtzite | (Zn,Fe)S |
| S | ⓘ Xanthoconite | Ag3AsS3 |
| S | ⓘ Zinkenite | Pb9Sb22S42 |
| S | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| S | ⓘ Sphalerite var. Marmatite | (Zn,Fe)S |
| S | ⓘ Heyrovskýite | Pb6Bi2S9 |
| S | ⓘ Saddlebackite | Pb2Bi2Te2S3 |
| S | ⓘ Sphalerite var. Cleiophane | ZnS |
| S | ⓘ Geocronite-Jordanite Series | |
| S | ⓘ Baumstarkite | Ag3Sb3S6 |
| S | ⓘ Quatrandorite | AgPbSb3S6 |
| S | ⓘ Cupromakovickyite | Cu4AgPb2Bi9S18 |
| S | ⓘ Kupčíkite | Cu3.4Fe0.6Bi5S10 |
| S | ⓘ Museumite | [Pb2(Pb,Sb)2S8][(Te,Au)2] |
| S | ⓘ Senandorite | AgPbSb3S6 |
| S | ⓘ Famatinite-Luzonite Series | |
| S | ⓘ Rezbanyite (of Frenzel) | Pb3Cu2Bi10S19 |
| S | ⓘ Cuproneyite | Cu7Pb27Bi25S68 |
| S | ⓘ Menchettiite | AgPb2.40Mn1.60Sb3As2S12 |
| S | ⓘ Manganoquadratite | AgMnAsS3 |
| S | ⓘ Boscardinite | TlPb4(Sb7As2)S18 |
| S | ⓘ Alburnite | Ag8GeTe2S4 |
| S | ⓘ Lopatkaite | Pb5Sb3AsS11 |
| S | ⓘ Bernarlottiite | Pb6(As5Sb3)S18 |
| S | ⓘ Keutschite | Cu2AgAsS4 |
| S | ⓘ Pyrite var. Copper-bearing Pyrite | (Fe,Cu)S2 |
| S | ⓘ UM1986-36-S:AsCuFeGe | Cu11Fe4GeAsS16 |
| S | ⓘ Oyonite | Ag3Mn2Pb4Sb7As4S24 |
| S | ⓘ Tetrahedrite-(Zn) | Cu6(Cu4Zn2)Sb4S12S |
| S | ⓘ Tennantite-(Fe) | Cu6(Cu4Fe22+)As4S12S |
| S | ⓘ Tetrahedrite-(Fe) | Cu6(Cu4Fe22+)Sb4S12S |
| S | ⓘ UM2003-15-S:AgCuTe | Ag2Cu2TeS |
| S | ⓘ Tennantite-(Cu) | Cu6(Cu4Cu2)As4S12S |
| S | ⓘ Tetrahedrite-(Mn) | Cu6(Cu4Mn2)Sb4S12S |
| S | ⓘ Tennantite-(Mn) | Cu6(Cu4Mn2)As4S12S |
| S | ⓘ Mn-rich fizeleyite analogue | Ag5Mn7Pb7Sb21S48 |
| S | ⓘ Zavyalovite | Ag2TeS3 |
| Cl | Chlorine | |
| Cl | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Cl | ⓘ Cotunnite | PbCl2 |
| Cl | ⓘ Djerfisherite | K6(Fe,Cu,Ni)25S26Cl |
| Cl | ⓘ Halite | NaCl |
| Cl | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| Cl | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Cl | ⓘ Sylvite | KCl |
| Cl | ⓘ Zunyite | Al13Si5O20(OH,F)18Cl |
| Cl | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Cl | ⓘ Calcium Amphibole Subgroup | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| K | Potassium | |
| K | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| K | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| K | ⓘ Djerfisherite | K6(Fe,Cu,Ni)25S26Cl |
| K | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| K | ⓘ Francoanellite | K3Al5(PO3OH)6(PO4)2 · 12H2O |
| K | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| K | ⓘ Kalinite | KAl(SO4)2 · 11H2O |
| K | ⓘ Leucophosphite | KFe23+(PO4)2(OH) · 2H2O |
| K | ⓘ Mountainite | KNa2Ca2[Si8O19(OH)] · 6H2O |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| K | ⓘ Sylvite | KCl |
| K | ⓘ Taranakite | K3Al5(PO3OH)6(PO4)2 · 18H2O |
| K | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Illite-2M | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Afwillite | Ca3[SiO4][SiO2(OH)2] · 2H2O |
| Ca | ⓘ Andersonite | Na2Ca(UO2)(CO3)3 · 6H2O |
| Ca | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Ca | ⓘ Anhydrite | CaSO4 |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Anorthite | Ca(Al2Si2O8) |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Ardealite | Ca2(PO3OH)(SO4) · 4H2O |
| Ca | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| Ca | ⓘ Becquerelite | Ca(UO2)6O4(OH)6 · 8H2O |
| Ca | ⓘ Brushite | Ca(PO3OH) · 2H2O |
| Ca | ⓘ Bustamite | CaMn2+(Si2O6) |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Hydroxylapatite var. Carbonate-rich Hydroxylapatite | Ca5(PO4,CO3)3(OH,O) |
| Ca | ⓘ Cebollite | Ca5Al2(SiO4)3(OH)4 |
| Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Calcite var. Cobalt-bearing Calcite | (Ca,Co)CO3 |
| Ca | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| Ca | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| Ca | ⓘ Cuspidine | Ca8(Si2O7)2F4 |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Ellestadite | |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Ferro-actinolite | ◻Ca2Fe52+(Si8O22)(OH)2 |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Foshagite | Ca4(Si3O9)(OH)2 |
| Ca | ⓘ Fukalite | Ca4[Si2O6][CO3](OH)2 |
| Ca | ⓘ Gehlenite | Ca2Al[AlSiO7] |
| Ca | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Ca | ⓘ Grossular var. Hibschite | Ca3Al2(SiO4)3-x(OH)4x |
| Ca | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| Ca | ⓘ Hydroxylellestadite | Ca5(SiO4)1.5(SO4)1.5(OH) |
| Ca | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| Ca | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| Ca | ⓘ Johannsenite | CaMn2+Si2O6 |
| Ca | ⓘ Kamaishilite | Ca2(Al2SiO6)(OH)2 |
| Ca | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| Ca | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Ca | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| Ca | ⓘ Monetite | Ca(PO3OH) |
| Ca | ⓘ Monticellite | CaMgSiO4 |
| Ca | ⓘ Mountainite | KNa2Ca2[Si8O19(OH)] · 6H2O |
| Ca | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Ca | ⓘ Perovskite | CaTiO3 |
| Ca | ⓘ Pigeonite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Plombièrite | Ca5Si6O16(OH)2 · 7H2O |
| Ca | ⓘ Portlandite | Ca(OH)2 |
| Ca | ⓘ Powellite | Ca(MoO4) |
| Ca | ⓘ Ranciéite | (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| Ca | ⓘ Rankinite | Ca3Si2O7 |
| Ca | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Ca | ⓘ Riversideite | Ca5Si6O16(OH)2 · 2H2O |
| Ca | ⓘ Scawtite | Ca7(Si3O9)2CO3 · 2H2O |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Spurrite | Ca5(SiO4)2(CO3) |
| Ca | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| Ca | ⓘ Tilleyite | Ca5(Si2O7)(CO3)2 |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ca | ⓘ Tobermorite | Ca5Si6O17 · 5H2O |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| Ca | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Ca | ⓘ Villyaellenite | (Mn,Ca)Mn2Ca2(AsO3OH)2(AsO4)2 · 4H2O |
| Ca | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Ca | ⓘ Whitlockite | Ca9Mg(PO4)6(PO3OH) |
| Ca | ⓘ Woodhouseite | CaAl3(PO4)(SO4)(OH)6 |
| Ca | ⓘ Wollastonite | Ca3(Si3O9) |
| Ca | ⓘ Xonotlite | Ca6(Si6O17)(OH)2 |
| Ca | ⓘ Wollastonite-1A | CaSiO3 |
| Ca | ⓘ Andradite-Grossular Series | |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Manganilvaite | CaFe2+Fe3+Mn2+(Si2O7)O(OH) |
| Ca | ⓘ Hedenbergite var. Manganese-bearing Hedenbergite | Ca(Fe,Mn)2+Si2O6 |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ca | ⓘ Melilite Group | Ca2M(XSiO7) |
| Ca | ⓘ Calcium Amphibole Subgroup | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| Ca | ⓘ Kushiroite | CaAlAlSiO6 |
| Ti | Titanium | |
| Ti | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Brannerite | UTi2O6 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Perovskite | CaTiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| Ti | ⓘ Ulvöspinel | TiFe22+O4 |
| V | Vanadium | |
| V | ⓘ Colusite | Cu13VAs3S16 |
| V | ⓘ Mottramite | PbCu(VO4)(OH) |
| Cr | Chromium | |
| Cr | ⓘ Crocoite | PbCr6+O4 |
| Mn | Manganese | |
| Mn | ⓘ Alabandite | MnS |
| Mn | ⓘ Apjohnite | Mn2+Al2(SO4)4 · 22H2O |
| Mn | ⓘ Benavidesite | Pb4MnSb6S14 |
| Mn | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| Mn | ⓘ Bustamite | CaMn2+(Si2O6) |
| Mn | ⓘ Dietrichite | (Zn,Fe2+,Mn2+)Al2(SO4)4 · 22H2O |
| Mn | ⓘ Geigerite | Mn52+(AsO4)2(HAsO4)2 · 10H2O |
| Mn | ⓘ Hollandite | Ba(Mn64+Mn23+)O16 |
| Mn | ⓘ Johannsenite | CaMn2+Si2O6 |
| Mn | ⓘ Jôkokuite | MnSO4 · 5H2O |
| Mn | ⓘ Krautite | Mn(HAsO4) · H2O |
| Mn | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| Mn | ⓘ Manganite | Mn3+O(OH) |
| Mn | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Ranciéite | (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| Mn | ⓘ Rhodochrosite | MnCO3 |
| Mn | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Mn | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| Mn | ⓘ Villyaellenite | (Mn,Ca)Mn2Ca2(AsO3OH)2(AsO4)2 · 4H2O |
| Mn | ⓘ Manganilvaite | CaFe2+Fe3+Mn2+(Si2O7)O(OH) |
| Mn | ⓘ Hedenbergite var. Manganese-bearing Hedenbergite | Ca(Fe,Mn)2+Si2O6 |
| Mn | ⓘ Menchettiite | AgPb2.40Mn1.60Sb3As2S12 |
| Mn | ⓘ Manganoquadratite | AgMnAsS3 |
| Mn | ⓘ Oyonite | Ag3Mn2Pb4Sb7As4S24 |
| Mn | ⓘ Tetrahedrite-(Mn) | Cu6(Cu4Mn2)Sb4S12S |
| Mn | ⓘ Tennantite-(Mn) | Cu6(Cu4Mn2)As4S12S |
| Mn | ⓘ Mn-rich fizeleyite analogue | Ag5Mn7Pb7Sb21S48 |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Alloclasite | Co1-xFexAsS |
| Fe | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Berthierite | FeSb2S4 |
| Fe | ⓘ Betekhtinite | Pb2(Cu,Fe)22-24S15 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Pyrite var. Bravoite | (Fe,Ni)S2 |
| Fe | ⓘ Briartite | Cu2FeGeS4 |
| Fe | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chamosite | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| Fe | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| Fe | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Fe | ⓘ Cubanite | CuFe2S3 |
| Fe | ⓘ Dietrichite | (Zn,Fe2+,Mn2+)Al2(SO4)4 · 22H2O |
| Fe | ⓘ Djerfisherite | K6(Fe,Cu,Ni)25S26Cl |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Ferro-actinolite | ◻Ca2Fe52+(Si8O22)(OH)2 |
| Fe | ⓘ Frohbergite | FeTe2 |
| Fe | ⓘ Germanite | Cu13Fe2Ge2S16 |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Greigite | Fe2+Fe23+S4 |
| Fe | ⓘ Halotrichite | FeAl2(SO4)4 · 22H2O |
| Fe | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Idaite | Cu5FeS6 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Lepidocrocite | Fe3+O(OH) |
| Fe | ⓘ Leucophosphite | KFe23+(PO4)2(OH) · 2H2O |
| Fe | ⓘ Löllingite | FeAs2 |
| Fe | ⓘ Ludwigite | Mg2Fe3+(BO3)O2 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Mawsonite | Cu6Fe2SnS8 |
| Fe | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| Fe | ⓘ Miharaite | Cu4FePbBiS6 |
| Fe | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| Fe | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Fe | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| Fe | ⓘ Pigeonite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Renierite | (Cu1+,Zn)11Fe4(Ge4+,As5+)2S16 |
| Fe | ⓘ Rozenite | FeSO4 · 4H2O |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Stannite | Cu2FeSnS4 |
| Fe | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| Fe | ⓘ Symplesite | Fe32+(AsO4)2 · 8H2O |
| Fe | ⓘ Ulvöspinel | TiFe22+O4 |
| Fe | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Fe | ⓘ Vinciennite | Cu7+Cu32+Fe22+Fe23+Sn(As,Sb)S16 |
| Fe | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| Fe | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Fe | ⓘ Wurtzite | (Zn,Fe)S |
| Fe | ⓘ Hematite var. Specularite | Fe2O3 |
| Fe | ⓘ Sphalerite var. Marmatite | (Zn,Fe)S |
| Fe | ⓘ Andradite-Grossular Series | |
| Fe | ⓘ Manganilvaite | CaFe2+Fe3+Mn2+(Si2O7)O(OH) |
| Fe | ⓘ Kupčíkite | Cu3.4Fe0.6Bi5S10 |
| Fe | ⓘ Hedenbergite var. Manganese-bearing Hedenbergite | Ca(Fe,Mn)2+Si2O6 |
| Fe | ⓘ Pyrite var. Copper-bearing Pyrite | (Fe,Cu)S2 |
| Fe | ⓘ UM1986-36-S:AsCuFeGe | Cu11Fe4GeAsS16 |
| Fe | ⓘ Tennantite-(Fe) | Cu6(Cu4Fe22+)As4S12S |
| Fe | ⓘ Tetrahedrite-(Fe) | Cu6(Cu4Fe22+)Sb4S12S |
| Co | Cobalt | |
| Co | ⓘ Alloclasite | Co1-xFexAsS |
| Co | ⓘ Carrollite | CuCo2S4 |
| Co | ⓘ Cobaltite | CoAsS |
| Co | ⓘ Calcite var. Cobalt-bearing Calcite | (Ca,Co)CO3 |
| Co | ⓘ Cobaltpentlandite | Co9S8 |
| Co | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| Co | ⓘ Linnaeite | Co2+Co23+S4 |
| Co | ⓘ Siegenite | CoNi2S4 |
| Co | ⓘ Skutterudite | CoAs3 |
| Ni | Nickel | |
| Ni | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| Ni | ⓘ Pyrite var. Bravoite | (Fe,Ni)S2 |
| Ni | ⓘ Djerfisherite | K6(Fe,Cu,Ni)25S26Cl |
| Ni | ⓘ Gersdorffite | NiAsS |
| Ni | ⓘ Melonite | NiTe2 |
| Ni | ⓘ Millerite | NiS |
| Ni | ⓘ Nickeline | NiAs |
| Ni | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Ni | ⓘ Polydymite | Ni2+Ni23+S4 |
| Ni | ⓘ Rammelsbergite | NiAs2 |
| Ni | ⓘ Siegenite | CoNi2S4 |
| Ni | ⓘ Vaesite | NiS2 |
| Cu | Copper | |
| Cu | ⓘ Aikinite | PbCuBiS3 |
| Cu | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Berryite | Cu3Ag2Pb3Bi7S16 |
| Cu | ⓘ Betekhtinite | Pb2(Cu,Fe)22-24S15 |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Bournonite | PbCuSbS3 |
| Cu | ⓘ Briartite | Cu2FeGeS4 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Benleonardite | [Ag6(Sb,As)2S6Te][Ag9Cu(S,Te)2Te2] |
| Cu | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| Cu | ⓘ Carrollite | CuCo2S4 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcanthite | CuSO4 · 5H2O |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Colusite | Cu13VAs3S16 |
| Cu | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cubanite | CuFe2S3 |
| Cu | ⓘ Cuprobismutite | Cu8AgBi13S24 |
| Cu | ⓘ Cupropavonite | Cu0.9Ag0.5Pb0.6Bi2.5S5 |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Digenite | Cu9S5 |
| Cu | ⓘ Dioptase | CuSiO3 · H2O |
| Cu | ⓘ Djerfisherite | K6(Fe,Cu,Ni)25S26Cl |
| Cu | ⓘ Djurleite | Cu31S16 |
| Cu | ⓘ Emplectite | CuBiS2 |
| Cu | ⓘ Enargite | Cu3AsS4 |
| Cu | ⓘ Eucairite | AgCuSe |
| Cu | ⓘ Tennantite-Tetrahedrite Series | |
| Cu | ⓘ Famatinite | Cu3SbS4 |
| Cu | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Cu | ⓘ Friedrichite | Pb5Cu5Bi7S18 |
| Cu | ⓘ Gallite | CuGaS2 |
| Cu | ⓘ Germanite | Cu13Fe2Ge2S16 |
| Cu | ⓘ Goldfieldite | (Cu4◻2)(Cu4Cu2+)Te4S12S |
| Cu | ⓘ Hammarite | Pb2Cu2Bi4S9 |
| Cu | ⓘ Hodrušite | Cu8Bi12S22 |
| Cu | ⓘ Idaite | Cu5FeS6 |
| Cu | ⓘ Junoite | Cu2Pb3Bi8(S,Se)16 |
| Cu | ⓘ Kësterite | Cu2ZnSnS4 |
| Cu | ⓘ Kiddcreekite | Cu6SnWS8 |
| Cu | ⓘ Klockmannite | CuSe |
| Cu | ⓘ Krupkaite | PbCuBi3S6 |
| Cu | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Cu | ⓘ Luzonite | Cu3AsS4 |
| Cu | ⓘ Makovickyite | Cu1.12Ag0.81Pb0.27Bi5.35S9 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Mawsonite | Cu6Fe2SnS8 |
| Cu | ⓘ Miharaite | Cu4FePbBiS6 |
| Cu | ⓘ Mottramite | PbCu(VO4)(OH) |
| Cu | ⓘ Neyite | Ag2Cu6Pb25Bi26S68 |
| Cu | ⓘ Nuffieldite | Cu1.4Pb2.4Bi2.4Sb0.2S7 |
| Cu | ⓘ Padĕraite | Cu7[(Cu,Ag)0.33Pb1.33Bi11.33]S22 |
| Cu | ⓘ Pearceite | [Ag6As2S7][Ag9CuS4] |
| Cu | ⓘ Pekoite | PbCuBi11S18 |
| Cu | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| Cu | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| Cu | ⓘ Renierite | (Cu1+,Zn)11Fe4(Ge4+,As5+)2S16 |
| Cu | ⓘ Rickardite | Cu7Te5 |
| Cu | ⓘ Roquesite | CuInS2 |
| Cu | ⓘ Seligmannite | PbCuAsS3 |
| Cu | ⓘ Spertiniite | Cu(OH)2 |
| Cu | ⓘ Stannite | Cu2FeSnS4 |
| Cu | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| Cu | ⓘ Stromeyerite | AgCuS |
| Cu | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Theisite | Cu5Zn5(AsO4,SbO4)2(OH)14 |
| Cu | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| Cu | ⓘ Vinciennite | Cu7+Cu32+Fe22+Fe23+Sn(As,Sb)S16 |
| Cu | ⓘ Vulcanite | CuTe |
| Cu | ⓘ Weissite | Cu2-xTe |
| Cu | ⓘ Wittichenite | Cu3BiS3 |
| Cu | ⓘ Cupromakovickyite | Cu4AgPb2Bi9S18 |
| Cu | ⓘ Kupčíkite | Cu3.4Fe0.6Bi5S10 |
| Cu | ⓘ Famatinite-Luzonite Series | |
| Cu | ⓘ Rezbanyite (of Frenzel) | Pb3Cu2Bi10S19 |
| Cu | ⓘ Cuproneyite | Cu7Pb27Bi25S68 |
| Cu | ⓘ Keutschite | Cu2AgAsS4 |
| Cu | ⓘ Pyrite var. Copper-bearing Pyrite | (Fe,Cu)S2 |
| Cu | ⓘ UM1986-36-S:AsCuFeGe | Cu11Fe4GeAsS16 |
| Cu | ⓘ Tetrahedrite-(Zn) | Cu6(Cu4Zn2)Sb4S12S |
| Cu | ⓘ Tennantite-(Fe) | Cu6(Cu4Fe22+)As4S12S |
| Cu | ⓘ Tetrahedrite-(Fe) | Cu6(Cu4Fe22+)Sb4S12S |
| Cu | ⓘ UM2003-15-S:AgCuTe | Ag2Cu2TeS |
| Cu | ⓘ Tennantite-(Cu) | Cu6(Cu4Cu2)As4S12S |
| Cu | ⓘ Tetrahedrite-(Mn) | Cu6(Cu4Mn2)Sb4S12S |
| Cu | ⓘ Tennantite-(Mn) | Cu6(Cu4Mn2)As4S12S |
| Zn | Zinc | |
| Zn | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Zn | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| Zn | ⓘ Dietrichite | (Zn,Fe2+,Mn2+)Al2(SO4)4 · 22H2O |
| Zn | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Zn | ⓘ Kësterite | Cu2ZnSnS4 |
| Zn | ⓘ Pirquitasite | Ag2ZnSnS4 |
| Zn | ⓘ Renierite | (Cu1+,Zn)11Fe4(Ge4+,As5+)2S16 |
| Zn | ⓘ Smithsonite | ZnCO3 |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| Zn | ⓘ Theisite | Cu5Zn5(AsO4,SbO4)2(OH)14 |
| Zn | ⓘ Wurtzite | (Zn,Fe)S |
| Zn | ⓘ Sphalerite var. Marmatite | (Zn,Fe)S |
| Zn | ⓘ Sphalerite var. Cleiophane | ZnS |
| Zn | ⓘ Tetrahedrite-(Zn) | Cu6(Cu4Zn2)Sb4S12S |
| Ga | Gallium | |
| Ga | ⓘ Gallite | CuGaS2 |
| Ge | Germanium | |
| Ge | ⓘ Argyrodite | Ag8GeS6 |
| Ge | ⓘ Briartite | Cu2FeGeS4 |
| Ge | ⓘ Germanite | Cu13Fe2Ge2S16 |
| Ge | ⓘ Renierite | (Cu1+,Zn)11Fe4(Ge4+,As5+)2S16 |
| Ge | ⓘ Alburnite | Ag8GeTe2S4 |
| Ge | ⓘ UM1986-36-S:AsCuFeGe | Cu11Fe4GeAsS16 |
| As | Arsenic | |
| As | ⓘ Alloclasite | Co1-xFexAsS |
| As | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| As | ⓘ Arsenolite | As2O3 |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Native Arsenic | As |
| As | ⓘ Baumhauerite | Pb12As16S36 |
| As | ⓘ Billingsleyite | Ag7AsS6 |
| As | ⓘ Benleonardite | [Ag6(Sb,As)2S6Te][Ag9Cu(S,Te)2Te2] |
| As | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| As | ⓘ Cobaltite | CoAsS |
| As | ⓘ Colusite | Cu13VAs3S16 |
| As | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| As | ⓘ Dufrénoysite | Pb2As2S5 |
| As | ⓘ Enargite | Cu3AsS4 |
| As | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| As | ⓘ Tennantite-Tetrahedrite Series | |
| As | ⓘ Geigerite | Mn52+(AsO4)2(HAsO4)2 · 10H2O |
| As | ⓘ Gersdorffite | NiAsS |
| As | ⓘ Guettardite | Pb8(Sb0.56As0.44)16S32 |
| As | ⓘ Hörnesite | Mg3(AsO4)2 · 8H2O |
| As | ⓘ Jordanite | Pb14As6S23 |
| As | ⓘ Krautite | Mn(HAsO4) · H2O |
| As | ⓘ Liveingite | Pb9As13S28 |
| As | ⓘ Löllingite | FeAs2 |
| As | ⓘ Luzonite | Cu3AsS4 |
| As | ⓘ Marrite | AgPbAsS3 |
| As | ⓘ Mimetite | Pb5(AsO4)3Cl |
| As | ⓘ Nickeline | NiAs |
| As | ⓘ Orpiment | As2S3 |
| As | ⓘ Pearceite | [Ag6As2S7][Ag9CuS4] |
| As | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| As | ⓘ Proustite | Ag3AsS3 |
| As | ⓘ Rammelsbergite | NiAs2 |
| As | ⓘ Realgar | As4S4 |
| As | ⓘ Renierite | (Cu1+,Zn)11Fe4(Ge4+,As5+)2S16 |
| As | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| As | ⓘ Seligmannite | PbCuAsS3 |
| As | ⓘ Skutterudite | CoAs3 |
| As | ⓘ Symplesite | Fe32+(AsO4)2 · 8H2O |
| As | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| As | ⓘ Theisite | Cu5Zn5(AsO4,SbO4)2(OH)14 |
| As | ⓘ Trechmannite | AgAsS2 |
| As | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| As | ⓘ Villyaellenite | (Mn,Ca)Mn2Ca2(AsO3OH)2(AsO4)2 · 4H2O |
| As | ⓘ Vinciennite | Cu7+Cu32+Fe22+Fe23+Sn(As,Sb)S16 |
| As | ⓘ Xanthoconite | Ag3AsS3 |
| As | ⓘ Geocronite-Jordanite Series | |
| As | ⓘ Famatinite-Luzonite Series | |
| As | ⓘ Menchettiite | AgPb2.40Mn1.60Sb3As2S12 |
| As | ⓘ Manganoquadratite | AgMnAsS3 |
| As | ⓘ Boscardinite | TlPb4(Sb7As2)S18 |
| As | ⓘ Lopatkaite | Pb5Sb3AsS11 |
| As | ⓘ Bernarlottiite | Pb6(As5Sb3)S18 |
| As | ⓘ Keutschite | Cu2AgAsS4 |
| As | ⓘ UM1986-36-S:AsCuFeGe | Cu11Fe4GeAsS16 |
| As | ⓘ Oyonite | Ag3Mn2Pb4Sb7As4S24 |
| As | ⓘ Tennantite-(Fe) | Cu6(Cu4Fe22+)As4S12S |
| As | ⓘ Tennantite-(Cu) | Cu6(Cu4Cu2)As4S12S |
| As | ⓘ Tennantite-(Mn) | Cu6(Cu4Mn2)As4S12S |
| Se | Selenium | |
| Se | ⓘ Clausthalite | PbSe |
| Se | ⓘ Eucairite | AgCuSe |
| Se | ⓘ Junoite | Cu2Pb3Bi8(S,Se)16 |
| Se | ⓘ Klockmannite | CuSe |
| Se | ⓘ Naumannite | Ag2Se |
| Se | ⓘ Wittite | Pb9Bi12(S,Se)27 |
| Sr | Strontium | |
| Sr | ⓘ Svanbergite | SrAl3(PO4)(SO4)(OH)6 |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Mo | ⓘ Powellite | Ca(MoO4) |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Andorite | AgPbSb3S6 |
| Ag | ⓘ Argyrodite | Ag8GeS6 |
| Ag | ⓘ Benjaminite | Ag3Bi7S12 |
| Ag | ⓘ Berryite | Cu3Ag2Pb3Bi7S16 |
| Ag | ⓘ Billingsleyite | Ag7AsS6 |
| Ag | ⓘ Benleonardite | [Ag6(Sb,As)2S6Te][Ag9Cu(S,Te)2Te2] |
| Ag | ⓘ Canfieldite | Ag8SnS6 |
| Ag | ⓘ Cervelleite | Ag4TeS |
| Ag | ⓘ Cuprobismutite | Cu8AgBi13S24 |
| Ag | ⓘ Cupropavonite | Cu0.9Ag0.5Pb0.6Bi2.5S5 |
| Ag | ⓘ Native Gold var. Electrum | (Au,Ag) |
| Ag | ⓘ Empressite | AgTe |
| Ag | ⓘ Eucairite | AgCuSe |
| Ag | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Ag | ⓘ Gustavite | AgPbBi3S6 |
| Ag | ⓘ Hessite | Ag2Te |
| Ag | ⓘ Imiterite | Ag2HgS2 |
| Ag | ⓘ Krennerite | Au3AgTe8 |
| Ag | ⓘ Lillianite | Pb3-2xAgxBi2+xS6 |
| Ag | ⓘ Makovickyite | Cu1.12Ag0.81Pb0.27Bi5.35S9 |
| Ag | ⓘ Marrite | AgPbAsS3 |
| Ag | ⓘ Muthmannite | AuAgTe2 |
| Ag | ⓘ Naumannite | Ag2Se |
| Ag | ⓘ Neyite | Ag2Cu6Pb25Bi26S68 |
| Ag | ⓘ Padĕraite | Cu7[(Cu,Ag)0.33Pb1.33Bi11.33]S22 |
| Ag | ⓘ Pearceite | [Ag6As2S7][Ag9CuS4] |
| Ag | ⓘ Petzite | Ag3AuTe2 |
| Ag | ⓘ Pirquitasite | Ag2ZnSnS4 |
| Ag | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| Ag | ⓘ Proustite | Ag3AsS3 |
| Ag | ⓘ Pyrargyrite | Ag3SbS3 |
| Ag | ⓘ Schapbachite | Ag0.4Pb0.2Bi0.4S |
| Ag | ⓘ Schirmerite | PbAgBi3S6 - Pb3Ag1.5Bi3.5S9 |
| Ag | ⓘ Native Silver | Ag |
| Ag | ⓘ Stephanite | Ag5SbS4 |
| Ag | ⓘ Stromeyerite | AgCuS |
| Ag | ⓘ Stützite | Ag5-xTe3, x = 0.24-0.36 |
| Ag | ⓘ Sylvanite | AgAuTe4 |
| Ag | ⓘ Trechmannite | AgAsS2 |
| Ag | ⓘ Uytenbogaardtite | Ag3AuS2 |
| Ag | ⓘ Vikingite | Ag5Pb8Bi13S30 |
| Ag | ⓘ Xanthoconite | Ag3AsS3 |
| Ag | ⓘ Baumstarkite | Ag3Sb3S6 |
| Ag | ⓘ Quatrandorite | AgPbSb3S6 |
| Ag | ⓘ Cupromakovickyite | Cu4AgPb2Bi9S18 |
| Ag | ⓘ Senandorite | AgPbSb3S6 |
| Ag | ⓘ Menchettiite | AgPb2.40Mn1.60Sb3As2S12 |
| Ag | ⓘ Manganoquadratite | AgMnAsS3 |
| Ag | ⓘ Alburnite | Ag8GeTe2S4 |
| Ag | ⓘ Keutschite | Cu2AgAsS4 |
| Ag | ⓘ Oyonite | Ag3Mn2Pb4Sb7As4S24 |
| Ag | ⓘ UM2003-15-S:AgCuTe | Ag2Cu2TeS |
| Ag | ⓘ Mn-rich fizeleyite analogue | Ag5Mn7Pb7Sb21S48 |
| Ag | ⓘ Zavyalovite | Ag2TeS3 |
| Cd | Cadmium | |
| Cd | ⓘ Greenockite | CdS |
| In | Indium | |
| In | ⓘ Roquesite | CuInS2 |
| Sn | Tin | |
| Sn | ⓘ Canfieldite | Ag8SnS6 |
| Sn | ⓘ Cassiterite | SnO2 |
| Sn | ⓘ Kësterite | Cu2ZnSnS4 |
| Sn | ⓘ Kiddcreekite | Cu6SnWS8 |
| Sn | ⓘ Mawsonite | Cu6Fe2SnS8 |
| Sn | ⓘ Pirquitasite | Ag2ZnSnS4 |
| Sn | ⓘ Stannite | Cu2FeSnS4 |
| Sn | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| Sn | ⓘ Vinciennite | Cu7+Cu32+Fe22+Fe23+Sn(As,Sb)S16 |
| Sb | Antimony | |
| Sb | ⓘ Andorite | AgPbSb3S6 |
| Sb | ⓘ Benavidesite | Pb4MnSb6S14 |
| Sb | ⓘ Berthierite | FeSb2S4 |
| Sb | ⓘ Boulangerite | Pb5Sb4S11 |
| Sb | ⓘ Bournonite | PbCuSbS3 |
| Sb | ⓘ Benleonardite | [Ag6(Sb,As)2S6Te][Ag9Cu(S,Te)2Te2] |
| Sb | ⓘ Tennantite-Tetrahedrite Series | |
| Sb | ⓘ Falkmanite | Pb3Sb2S6 |
| Sb | ⓘ Famatinite | Cu3SbS4 |
| Sb | ⓘ Fülöppite | Pb3Sb8S15 |
| Sb | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Sb | ⓘ Geocronite | Pb14Sb6S23 |
| Sb | ⓘ Guettardite | Pb8(Sb0.56As0.44)16S32 |
| Sb | ⓘ Heteromorphite | Pb7Sb8S19 |
| Sb | ⓘ Nagyágite | [Pb3(Pb,Sb)3S6](Au,Te)3 |
| Sb | ⓘ Nuffieldite | Cu1.4Pb2.4Bi2.4Sb0.2S7 |
| Sb | ⓘ Plagionite | Pb5Sb8S17 |
| Sb | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| Sb | ⓘ Pyrargyrite | Ag3SbS3 |
| Sb | ⓘ Robinsonite | Pb4Sb6S13 |
| Sb | ⓘ Semseyite | Pb9Sb8S21 |
| Sb | ⓘ Stephanite | Ag5SbS4 |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Tellurantimony | Sb2Te3 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Sb | ⓘ Theisite | Cu5Zn5(AsO4,SbO4)2(OH)14 |
| Sb | ⓘ Valentinite | Sb2O3 |
| Sb | ⓘ Vinciennite | Cu7+Cu32+Fe22+Fe23+Sn(As,Sb)S16 |
| Sb | ⓘ Zinkenite | Pb9Sb22S42 |
| Sb | ⓘ Geocronite-Jordanite Series | |
| Sb | ⓘ Baumstarkite | Ag3Sb3S6 |
| Sb | ⓘ Quatrandorite | AgPbSb3S6 |
| Sb | ⓘ Museumite | [Pb2(Pb,Sb)2S8][(Te,Au)2] |
| Sb | ⓘ Senandorite | AgPbSb3S6 |
| Sb | ⓘ Famatinite-Luzonite Series | |
| Sb | ⓘ Menchettiite | AgPb2.40Mn1.60Sb3As2S12 |
| Sb | ⓘ Boscardinite | TlPb4(Sb7As2)S18 |
| Sb | ⓘ Lopatkaite | Pb5Sb3AsS11 |
| Sb | ⓘ Bernarlottiite | Pb6(As5Sb3)S18 |
| Sb | ⓘ Oyonite | Ag3Mn2Pb4Sb7As4S24 |
| Sb | ⓘ Tetrahedrite-(Zn) | Cu6(Cu4Zn2)Sb4S12S |
| Sb | ⓘ Tetrahedrite-(Fe) | Cu6(Cu4Fe22+)Sb4S12S |
| Sb | ⓘ Tetrahedrite-(Mn) | Cu6(Cu4Mn2)Sb4S12S |
| Sb | ⓘ Mn-rich fizeleyite analogue | Ag5Mn7Pb7Sb21S48 |
| Te | Tellurium | |
| Te | ⓘ Aleksite | PbBi2Te2S2 |
| Te | ⓘ Altaite | PbTe |
| Te | ⓘ Buckhornite | AuPb2BiTe2S3 |
| Te | ⓘ Benleonardite | [Ag6(Sb,As)2S6Te][Ag9Cu(S,Te)2Te2] |
| Te | ⓘ Calaverite | AuTe2 |
| Te | ⓘ Cervelleite | Ag4TeS |
| Te | ⓘ Coloradoite | HgTe |
| Te | ⓘ Empressite | AgTe |
| Te | ⓘ Frohbergite | FeTe2 |
| Te | ⓘ Goldfieldite | (Cu4◻2)(Cu4Cu2+)Te4S12S |
| Te | ⓘ Hessite | Ag2Te |
| Te | ⓘ Ingodite | Bi2TeS |
| Te | ⓘ Joséite-A | Bi4TeS2 |
| Te | ⓘ Krennerite | Au3AgTe8 |
| Te | ⓘ Melonite | NiTe2 |
| Te | ⓘ Muthmannite | AuAgTe2 |
| Te | ⓘ Nagyágite | [Pb3(Pb,Sb)3S6](Au,Te)3 |
| Te | ⓘ Petzite | Ag3AuTe2 |
| Te | ⓘ Pilsenite | Bi4Te3 |
| Te | ⓘ Rickardite | Cu7Te5 |
| Te | ⓘ Stützite | Ag5-xTe3, x = 0.24-0.36 |
| Te | ⓘ Sylvanite | AgAuTe4 |
| Te | ⓘ Tellurantimony | Sb2Te3 |
| Te | ⓘ Tellurite | TeO2 |
| Te | ⓘ Native Tellurium | Te |
| Te | ⓘ Tellurobismuthite | Bi2Te3 |
| Te | ⓘ Tetradymite | Bi2Te2S |
| Te | ⓘ Tsumoite | BiTe |
| Te | ⓘ Vulcanite | CuTe |
| Te | ⓘ Weissite | Cu2-xTe |
| Te | ⓘ Saddlebackite | Pb2Bi2Te2S3 |
| Te | ⓘ Museumite | [Pb2(Pb,Sb)2S8][(Te,Au)2] |
| Te | ⓘ Alburnite | Ag8GeTe2S4 |
| Te | ⓘ UM2003-15-S:AgCuTe | Ag2Cu2TeS |
| Te | ⓘ Zavyalovite | Ag2TeS3 |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Hollandite | Ba(Mn64+Mn23+)O16 |
| Ba | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| W | Tungsten | |
| W | ⓘ Kiddcreekite | Cu6SnWS8 |
| W | ⓘ Scheelite | Ca(WO4) |
| Au | Gold | |
| Au | ⓘ Buckhornite | AuPb2BiTe2S3 |
| Au | ⓘ Calaverite | AuTe2 |
| Au | ⓘ Native Gold var. Electrum | (Au,Ag) |
| Au | ⓘ Native Gold | Au |
| Au | ⓘ Krennerite | Au3AgTe8 |
| Au | ⓘ Maldonite | Au2Bi |
| Au | ⓘ Muthmannite | AuAgTe2 |
| Au | ⓘ Nagyágite | [Pb3(Pb,Sb)3S6](Au,Te)3 |
| Au | ⓘ Petzite | Ag3AuTe2 |
| Au | ⓘ Sylvanite | AgAuTe4 |
| Au | ⓘ Uytenbogaardtite | Ag3AuS2 |
| Au | ⓘ Museumite | [Pb2(Pb,Sb)2S8][(Te,Au)2] |
| Hg | Mercury | |
| Hg | ⓘ Coloradoite | HgTe |
| Hg | ⓘ Imiterite | Ag2HgS2 |
| Tl | Thallium | |
| Tl | ⓘ Boscardinite | TlPb4(Sb7As2)S18 |
| Pb | Lead | |
| Pb | ⓘ Aikinite | PbCuBiS3 |
| Pb | ⓘ Aleksite | PbBi2Te2S2 |
| Pb | ⓘ Altaite | PbTe |
| Pb | ⓘ Andorite | AgPbSb3S6 |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Aschamalmite | Pb6-3xBi2+xS9 |
| Pb | ⓘ Baumhauerite | Pb12As16S36 |
| Pb | ⓘ Benavidesite | Pb4MnSb6S14 |
| Pb | ⓘ Berryite | Cu3Ag2Pb3Bi7S16 |
| Pb | ⓘ Betekhtinite | Pb2(Cu,Fe)22-24S15 |
| Pb | ⓘ Boulangerite | Pb5Sb4S11 |
| Pb | ⓘ Bournonite | PbCuSbS3 |
| Pb | ⓘ Buckhornite | AuPb2BiTe2S3 |
| Pb | ⓘ Bursaite | Pb5Bi4S11 (?) |
| Pb | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| Pb | ⓘ Cannizzarite | Pb48Bi56S132 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Clausthalite | PbSe |
| Pb | ⓘ Cosalite | Pb2Bi2S5 |
| Pb | ⓘ Cotunnite | PbCl2 |
| Pb | ⓘ Crocoite | PbCr6+O4 |
| Pb | ⓘ Cupropavonite | Cu0.9Ag0.5Pb0.6Bi2.5S5 |
| Pb | ⓘ Dufrénoysite | Pb2As2S5 |
| Pb | ⓘ Falkmanite | Pb3Sb2S6 |
| Pb | ⓘ Fülöppite | Pb3Sb8S15 |
| Pb | ⓘ Friedrichite | Pb5Cu5Bi7S18 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Galenobismutite | PbBi2S4 |
| Pb | ⓘ Geocronite | Pb14Sb6S23 |
| Pb | ⓘ Guettardite | Pb8(Sb0.56As0.44)16S32 |
| Pb | ⓘ Gustavite | AgPbBi3S6 |
| Pb | ⓘ Hammarite | Pb2Cu2Bi4S9 |
| Pb | ⓘ Heteromorphite | Pb7Sb8S19 |
| Pb | ⓘ Jordanite | Pb14As6S23 |
| Pb | ⓘ Junoite | Cu2Pb3Bi8(S,Se)16 |
| Pb | ⓘ Kasolite | Pb(UO2)(SiO4) · H2O |
| Pb | ⓘ Krupkaite | PbCuBi3S6 |
| Pb | ⓘ Lillianite | Pb3-2xAgxBi2+xS6 |
| Pb | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Pb | ⓘ Liveingite | Pb9As13S28 |
| Pb | ⓘ Makovickyite | Cu1.12Ag0.81Pb0.27Bi5.35S9 |
| Pb | ⓘ Marrite | AgPbAsS3 |
| Pb | ⓘ Miharaite | Cu4FePbBiS6 |
| Pb | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Pb | ⓘ Mottramite | PbCu(VO4)(OH) |
| Pb | ⓘ Nagyágite | [Pb3(Pb,Sb)3S6](Au,Te)3 |
| Pb | ⓘ Neyite | Ag2Cu6Pb25Bi26S68 |
| Pb | ⓘ Nuffieldite | Cu1.4Pb2.4Bi2.4Sb0.2S7 |
| Pb | ⓘ Padĕraite | Cu7[(Cu,Ag)0.33Pb1.33Bi11.33]S22 |
| Pb | ⓘ Pekoite | PbCuBi11S18 |
| Pb | ⓘ Plagionite | Pb5Sb8S17 |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Pb | ⓘ Robinsonite | Pb4Sb6S13 |
| Pb | ⓘ Schapbachite | Ag0.4Pb0.2Bi0.4S |
| Pb | ⓘ Schirmerite | PbAgBi3S6 - Pb3Ag1.5Bi3.5S9 |
| Pb | ⓘ Seligmannite | PbCuAsS3 |
| Pb | ⓘ Semseyite | Pb9Sb8S21 |
| Pb | ⓘ Vikingite | Ag5Pb8Bi13S30 |
| Pb | ⓘ Wittite | Pb9Bi12(S,Se)27 |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| Pb | ⓘ Zinkenite | Pb9Sb22S42 |
| Pb | ⓘ Heyrovskýite | Pb6Bi2S9 |
| Pb | ⓘ Saddlebackite | Pb2Bi2Te2S3 |
| Pb | ⓘ Geocronite-Jordanite Series | |
| Pb | ⓘ Quatrandorite | AgPbSb3S6 |
| Pb | ⓘ Cupromakovickyite | Cu4AgPb2Bi9S18 |
| Pb | ⓘ Museumite | [Pb2(Pb,Sb)2S8][(Te,Au)2] |
| Pb | ⓘ Senandorite | AgPbSb3S6 |
| Pb | ⓘ Rezbanyite (of Frenzel) | Pb3Cu2Bi10S19 |
| Pb | ⓘ Cuproneyite | Cu7Pb27Bi25S68 |
| Pb | ⓘ Menchettiite | AgPb2.40Mn1.60Sb3As2S12 |
| Pb | ⓘ Boscardinite | TlPb4(Sb7As2)S18 |
| Pb | ⓘ Lopatkaite | Pb5Sb3AsS11 |
| Pb | ⓘ Bernarlottiite | Pb6(As5Sb3)S18 |
| Pb | ⓘ Oyonite | Ag3Mn2Pb4Sb7As4S24 |
| Pb | ⓘ Mn-rich fizeleyite analogue | Ag5Mn7Pb7Sb21S48 |
| Bi | Bismuth | |
| Bi | ⓘ Aikinite | PbCuBiS3 |
| Bi | ⓘ Aleksite | PbBi2Te2S2 |
| Bi | ⓘ Aschamalmite | Pb6-3xBi2+xS9 |
| Bi | ⓘ Benjaminite | Ag3Bi7S12 |
| Bi | ⓘ Berryite | Cu3Ag2Pb3Bi7S16 |
| Bi | ⓘ Bismite | Bi2O3 |
| Bi | ⓘ Native Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Buckhornite | AuPb2BiTe2S3 |
| Bi | ⓘ Bursaite | Pb5Bi4S11 (?) |
| Bi | ⓘ Cannizzarite | Pb48Bi56S132 |
| Bi | ⓘ Cosalite | Pb2Bi2S5 |
| Bi | ⓘ Cuprobismutite | Cu8AgBi13S24 |
| Bi | ⓘ Cupropavonite | Cu0.9Ag0.5Pb0.6Bi2.5S5 |
| Bi | ⓘ Emplectite | CuBiS2 |
| Bi | ⓘ Friedrichite | Pb5Cu5Bi7S18 |
| Bi | ⓘ Galenobismutite | PbBi2S4 |
| Bi | ⓘ Gustavite | AgPbBi3S6 |
| Bi | ⓘ Hammarite | Pb2Cu2Bi4S9 |
| Bi | ⓘ Hodrušite | Cu8Bi12S22 |
| Bi | ⓘ Ingodite | Bi2TeS |
| Bi | ⓘ Joséite-A | Bi4TeS2 |
| Bi | ⓘ Junoite | Cu2Pb3Bi8(S,Se)16 |
| Bi | ⓘ Krupkaite | PbCuBi3S6 |
| Bi | ⓘ Lillianite | Pb3-2xAgxBi2+xS6 |
| Bi | ⓘ Makovickyite | Cu1.12Ag0.81Pb0.27Bi5.35S9 |
| Bi | ⓘ Maldonite | Au2Bi |
| Bi | ⓘ Miharaite | Cu4FePbBiS6 |
| Bi | ⓘ Neyite | Ag2Cu6Pb25Bi26S68 |
| Bi | ⓘ Nuffieldite | Cu1.4Pb2.4Bi2.4Sb0.2S7 |
| Bi | ⓘ Padĕraite | Cu7[(Cu,Ag)0.33Pb1.33Bi11.33]S22 |
| Bi | ⓘ Pekoite | PbCuBi11S18 |
| Bi | ⓘ Pilsenite | Bi4Te3 |
| Bi | ⓘ Schapbachite | Ag0.4Pb0.2Bi0.4S |
| Bi | ⓘ Schirmerite | PbAgBi3S6 - Pb3Ag1.5Bi3.5S9 |
| Bi | ⓘ Tellurobismuthite | Bi2Te3 |
| Bi | ⓘ Tetradymite | Bi2Te2S |
| Bi | ⓘ Tsumoite | BiTe |
| Bi | ⓘ Vikingite | Ag5Pb8Bi13S30 |
| Bi | ⓘ Wittichenite | Cu3BiS3 |
| Bi | ⓘ Wittite | Pb9Bi12(S,Se)27 |
| Bi | ⓘ Heyrovskýite | Pb6Bi2S9 |
| Bi | ⓘ Saddlebackite | Pb2Bi2Te2S3 |
| Bi | ⓘ Cupromakovickyite | Cu4AgPb2Bi9S18 |
| Bi | ⓘ Kupčíkite | Cu3.4Fe0.6Bi5S10 |
| Bi | ⓘ Rezbanyite (of Frenzel) | Pb3Cu2Bi10S19 |
| Bi | ⓘ Cuproneyite | Cu7Pb27Bi25S68 |
| U | Uranium | |
| U | ⓘ Andersonite | Na2Ca(UO2)(CO3)3 · 6H2O |
| U | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| U | ⓘ Becquerelite | Ca(UO2)6O4(OH)6 · 8H2O |
| U | ⓘ Brannerite | UTi2O6 |
| U | ⓘ Coffinite | U(SiO4) · nH2O |
| U | ⓘ Kasolite | Pb(UO2)(SiO4) · H2O |
| U | ⓘ Uraninite | UO2 |
| U | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| U | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
Geochronology
Mineralization age: Phanerozoic : 80.93 Ma to 12.71 ± 0.13 MaImportant note: This table is based only on rock and mineral ages recorded on mindat.org for this locality and is not necessarily a complete representation of the geochronology, but does give an indication of possible mineralization events relevant to this locality. As more age information is added this table may expand in the future. A break in the table simply indicates a lack of data entered here, not necessarily a break in the geologic sequence. Grey background entries are from different, related, localities.
| Geologic Time | Rocks, Minerals and Events | |||||||||
|---|---|---|---|---|---|---|---|---|---|---|
| Phanerozoic | ||||||||||
| Cenozoic | ||||||||||
| Neogene | ||||||||||
| Miocene |
| |||||||||
| Mesozoic | ||||||||||
| Cretaceous | ||||||||||
| Late/Upper Cretaceous |
| |||||||||
Fossils
There are 285 fossil localities from the PaleoBioDB database within this region.These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 4758 |
|---|---|
| Youngest Fossil Listed | 0.01 Ma (Pleistocene) |
| Oldest Fossil Listed | 445 Ma (Late/Upper Ordovician) |
| Stratigraphic Units | Click here to view 48 stratigraphic units. |
| Fossils from Region | Click here to show the list. |
| Fossil Localities | Click to show 280 fossil localities |
- Burgas Province
- Haskovo Province
- Kyustendil Province
- Lovech Province
- Montana Province
- Pazardzhik Province
- Pernik Province
- Plovdiv Province
- Shumen Province
- Sliven Province
- Sofia City Province
- Sofia Province
- Stara Zagora Province
- Varna Province
- Late/Upper Cretaceous🐚 Beloslav
- Cenozoic🐚 Byala
- Late/Upper Cretaceous🐚 Devnya
- Paleogene🐚 Dolni Chiflik
- Paleogene🐚 Fundukliyska Reka
- Paleogene🐚 Goren Chiflik
- Paleocene🐚 Komunari
- Paleocene🐚 Povelyanovo
- Paleocene🐚 Razdelna
- Paleogene🐚 Rudnik
- Cenozoic🐚 Shkorpilovtsi
- Eocene🐚 Sindel
- Paleogene🐚 Slunchevo
- Eocene🐚 Strashimirovo
- Paleocene🐚 Trustikovo
- Eocene🐚 Varna
- Provadia Municipality
- Vidin Province
- Vratsa Province
- Yambol Province
- Bihor County
- Caraş-Severin County
- Cluj County
- Eocene🐚 Andrásháza
- Paleogene🐚 Baciu
- Eocene🐚 Baisoara
- Eocene🐚 Bedeciu
- Eocene🐚 Calatele
- Eocene🐚 Capusul Mare
- Oligocene🐚 Cetatuia Hill
- Paleogene🐚 Cluj
- Eocene🐚 Dumbrava
- Eocene🐚 Floresti
- Late/Upper Cretaceous🐚 Gilau Mountains
- Eocene🐚 Inucu
- Eocene🐚 Leghia
- Eocene🐚 Lita de Sus
- Eocene🐚 Lona
- Eocene🐚 Manastireni
- Paleogene🐚 Mera
- Paleogene🐚 Morlaca
- Paleogene🐚 Nadasel
- Oligocene🐚 Sard
- Eocene🐚 Savadisla
- Paleogene🐚 Somes Dam
- Paleogene🐚 Stolna
- Paleogene🐚 Suceag
- Oligocene🐚 Suceag 1
- Eocene🐚 Tauti
- Paleogene🐚 Turea
- Eocene🐚 Valeni
- Eocene🐚 Vlaha
- Hunedoara County
- Late/Upper Cretaceous🐚 Budurone Creek
- Late/Upper Cretaceous🐚 Cr?gui?
- Pleistocene🐚 Curata Cave
- Late/Upper Cretaceous🐚 DV 54
- Late/Upper Cretaceous🐚 General Berthelot 1
- Late/Upper Cretaceous🐚 Groapa
- Late/Upper Cretaceous🐚 Hateg Basin
- Miocene🐚 Lapugiu
- Miocene🐚 Lapugiul de Sus
- Late/Upper Cretaceous🐚 Livezi
- Early/Lower Cretaceous🐚 Mures Mountains
- Late/Upper Cretaceous🐚 Ohaba locality
- Miocene🐚 Panc
- Late/Upper Cretaceous🐚 Site I
- Miocene🐚 Tompa
- Late/Upper Cretaceous🐚 Tote?ti-baraj
- Late/Upper Cretaceous🐚 Tu?tea-Oltoane nesting site
- Late/Upper Cretaceous🐚 V?lioara-Fântânele 1
- Brad
- Hunedoara
- Mehedinti County
- Sălaj County
- Eocene🐚 Aghires
- Paleogene🐚 Bodia
- Paleogene🐚 Brebi
- Miocene🐚 Buciumi
- Paleogene🐚 Buciumi
- Oligocene🐚 Ciocmani
- Paleogene🐚 Ciomirna
- Eocene🐚 Giurtelecu Simleului
- Eocene🐚 Goraslau
- Eocene🐚 Jac
- Paleogene🐚 Jebuc
- Paleogene🐚 Jibou
- Eocene🐚 Jibou area
- Paleocene🐚 Jibou B
- Paleogene🐚 Plesca Valley
- Miocene🐚 Plopis Mountains
- Eocene🐚 Prodanesti
- Paleocene🐚 Rona 1
- Miocene🐚 Simleu Basin
- Paleogene🐚 Singiorgiul-Mesesului
- Late/Upper Cretaceous🐚 Somes Odorhei
- Paleogene🐚 Stana
- Paleogene🐚 Tresnea
- Paleogene🐚 Turbuta
- Timiș
- Middle Jurassic🐚 Mala Cuka Borehole in eastern Serbia
- Central Serbia
- Bor District
- Braničevo District
- Nišava District
- Pirot District
- Zaječar District
- Late/Upper Cretaceous🐚 Baevica locality
- Pleistocene🐚 Baranica I Cave
- Late Jurassic🐚 Bogovina
- Early/Lower Cretaceous🐚 Boljevac
- Silurian🐚 cross-section in the river Bogovinska Reka
- Late/Upper Cretaceous🐚 East of Paracin
- Early/Lower Cretaceous🐚 Faca Vajali
- Paleozoic🐚 near Bogovina
- Silurian🐚 NW from Bogovinski Kamen
- Late Jurassic🐚 Rgotina
- Early/Lower Cretaceous🐚 Tupiznica-Tepos area
- Late/Upper Cretaceous🐚 Vrbovac Reef
- Early/Lower Cretaceous🐚 Zljebine Creek near Donja Kamenica
- Late/Upper Cretaceous🐚 Zubetinac
Localities in this Region
- Burgas Province
- Karnobat Municipality
- Haskovo Province
- Mineralni Bani Municipality
- Topolovgrad Municipality
- Pazardzhik Province
- Panagyurishte Municipality
- Levski
- Panagyurishte Municipality
- Plovdiv Province
- Laki Municipality
- Laki
- Djurkovo Complex
- Laki
- Laki Municipality
- Sofia Province
- Botevgrad Municipality
- Alba County
- Almașu Mare
- Baia de Arieș
- Bucium
- Lupșa
- Mușca
- Roșia Montană
- Zlatna
- Arad County
- Chisindia
- Bihor County
- Bihor County
- Nucet
- Băiţa mining district
- Pietroasa
- Nucet
- Caraş-Severin County
- Dognecea
- Lăpușnicu Mare
- Locva Mountains (Locvei Mountains)
- Oraviţa
- Cluj County
- Iara
- Valea Seacă
- Hunedoara County
- Băița
- Brad
- Bunila
- Certeju de Sus
- Crișcior
- Deva
- Șoimuș
- Vaţa de Jos
- Vețel
- Vorța
- Mehedinti County
- Central Serbia
- Bor District
- Vlaole-Jasikovo ore field
- Bor District
Other Regions, Features and Areas that Intersect
Bulgaria
- Ihtimanska Sredna Gora (Ikhtiman Sredna Gora)Mountain Range
- RilaMountain Range
- Sredna GoraMountain Range
- Sashtinska Sredna GoraMountain Range
Eurasian PlateTectonic Plate
- Carpathian MountainsVolcanic Arc
- Moesian PlatformCraton
- Panonian BasinWide Rift
- Rhodope-Strandja MassifMagmatic Province
Europe
- Balkan MountainsMountain Range
- Carpathian MountainsMountain Range
- Dervent HeightsRange of Hills
- Rhodope MountainsMountain Range
- Bihor County
- Apuseni MountainsMountain Range
- Highiş MassifMassif
- Caraş-Severin County
- Almăj MountainsMountain Range
- Banat MountainsMountain Range
- Cerna valleyValley
- Moldova Nouă-Sasca Cu-Mo ore fieldOre Field
- Ocna de Fier-Dognecea DistrictMining District
- Oraviţa-Ciclova Cu-Mo-(W) ore fieldOre Field
- Golden Quadrangle (Golden Quadrilateral; Apuseni District)Mining District
- Hunedoara County
- Domogled - Cernei Valley National ParkProtected Area
- Poiana Ruscă MountainsMountain Range
- Sălaj County
- Boiului PlateauPlateau
Serbia
- Central Serbia
- Bor District
- Bor-Majdanpek mining districtMining District
- Bor District
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Quick NavTopCommoditiesMineral ListRock TypesGeochronologyFossilsLocalities in RegionOther RegionsReferences
Roşia Montană, Roșia Montană, Alba County, Romania