Log In
Meekatharra Shire, Western Australia, Australiai
| Regional Level Types | |
|---|---|
| Meekatharra Shire | Shire |
| Western Australia | State |
| Australia | Country |
This page is currently not sponsored. Click here to sponsor this page.
The Meekatharra Shire is found in the Mid-West region of Western Australia, about half way between Perth and Port Hedland. The shire is 100 789 square kilometres. It is about the same area as Scotland/Wales combined, or Nevada USA.
The shire has a population of 1521 (est. 2013), mainly in its only town also called Meekatharra. The town has basic services including accommodation (motel) and a small supermarket. Only one major road is found, being the Great Northern Highway, which bisects the shire from south to north. There are several gravel roads connecting other areas of the shire, which are usually in a reasonable condition, unless it rains. Little in the way of services exists away from the highway. Many areas are remote and travellers should be well prepared.
The shire is semi arid, covered in mulga scrub, and pastoral stations. Generally the shire is flat in the south, but ranges of hills increase in the north. The main industries is pastoral, mining and tourism. Summer is unbearably hot, with plagues of flies. The best travelling months is winter (May to October), when days are reasonable, and nights cold, which in turn has killed off all the flies. Tourist attractions are limited, and outside of the town at great distances. Much requires local knowledge as these places have little money to develop attractions. It is however a great place to look for rocks.
Meekatharra was once the centre of a major gold mining operation. Gold is found in greenstone belts at varying distances either side of the highway. These have operated at various times from the 1890's to present. Some of the goldfields are little changed since discovery, whilst others contain several large modern pits. At the time of writing only a few of the gold mines were operational, with many others mined out. The shire also contains a major talc mine, some base metal deposits including the major Degrussa copper mine, variscite deposits, and a chromite mine.
An area of gold mineralisation (strong quartz carbonate-pyrite alteration in high magnesium ultramafic).
Exploration and mining re-started in the 1980s.
Gold exploration recommenced at Meekatharra in late 2004, with the intention of re-establishing a mining inventory and production through the Bluebird processing plant.
Meekatharra is an aboriginal word for 'place of little water'. As is usual with the local language it succinctly describes the whole region in one word.
The shire has a population of 1521 (est. 2013), mainly in its only town also called Meekatharra. The town has basic services including accommodation (motel) and a small supermarket. Only one major road is found, being the Great Northern Highway, which bisects the shire from south to north. There are several gravel roads connecting other areas of the shire, which are usually in a reasonable condition, unless it rains. Little in the way of services exists away from the highway. Many areas are remote and travellers should be well prepared.
The shire is semi arid, covered in mulga scrub, and pastoral stations. Generally the shire is flat in the south, but ranges of hills increase in the north. The main industries is pastoral, mining and tourism. Summer is unbearably hot, with plagues of flies. The best travelling months is winter (May to October), when days are reasonable, and nights cold, which in turn has killed off all the flies. Tourist attractions are limited, and outside of the town at great distances. Much requires local knowledge as these places have little money to develop attractions. It is however a great place to look for rocks.
Meekatharra was once the centre of a major gold mining operation. Gold is found in greenstone belts at varying distances either side of the highway. These have operated at various times from the 1890's to present. Some of the goldfields are little changed since discovery, whilst others contain several large modern pits. At the time of writing only a few of the gold mines were operational, with many others mined out. The shire also contains a major talc mine, some base metal deposits including the major Degrussa copper mine, variscite deposits, and a chromite mine.
An area of gold mineralisation (strong quartz carbonate-pyrite alteration in high magnesium ultramafic).
Exploration and mining re-started in the 1980s.
Gold exploration recommenced at Meekatharra in late 2004, with the intention of re-establishing a mining inventory and production through the Bluebird processing plant.
Meekatharra is an aboriginal word for 'place of little water'. As is usual with the local language it succinctly describes the whole region in one word.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities138 valid minerals. 2 erroneous literature entries.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Native Gold var. Electrum | 1.AA.05 | (Au,Ag) |
| ⓘ | 1.AA.05 | Au | |
| ⓘ | Native Silver | 1.AA.05 | Ag |
| ⓘ | Native Zinc ? | 1.AB.05 | Zn |
| ⓘ | Native Iron | 1.AE.05 | Fe |
| ⓘ | var. Kamacite | 1.AE.05 | (Fe,Ni) |
| ⓘ | Taenite | 1.AE.10 | (Ni,Fe) |
| ⓘ | Tetrataenite | 1.AE.10 | FeNi |
| ⓘ | Cohenite | 1.BA.05 | Fe3C |
| ⓘ | Schreibersite | 1.BD.05 | (Fe,Ni)3P |
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| ⓘ | Graphite | 1.CB.05a | C |
| ⓘ | Native Selenium | 1.CC.10 | Se |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Digenite | 2.BA.10 | Cu9S5 |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Pentlandite | 2.BB.15 | (NixFey)Σ9S8 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Troilite | 2.CC.10 | FeS |
| ⓘ | Altaite | 2.CD.10 | PbTe |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Gersdorffite | 2.EB.25 | NiAsS |
| ⓘ | Bournonite | 2.GA.50 | PbCuSbS3 |
| ⓘ | 'Tennantite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)As4S12S |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| Group 3 - Halides | |||
| ⓘ | Iodargyrite | 3.AA.10 | AgI |
| ⓘ | Chlorargyrite | 3.AA.15 | AgCl |
| ⓘ | Atacamite | 3.DA.10a | Cu2(OH)3Cl |
| ⓘ | Paratacamite | 3.DA.10c | Cu3(Cu,Zn)(OH)6Cl2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Cuprite | 4.AA.10 | Cu2O |
| ⓘ | var. Tile ore | 4.AA.10 | Cu2O |
| ⓘ | Tenorite | 4.AB.10 | CuO |
| ⓘ | Chromite | 4.BB.05 | Fe2+Cr3+2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
| ⓘ | Magnetite var. Titanium-bearing Magnetite | 4.BB.05 | Fe2+(Fe3+,Ti)2O4 |
| ⓘ | var. Vanadium-bearing Magnetite | 4.BB.05 | Fe2+(Fe3+,V3+ )2O4 |
| ⓘ | Maghemite | 4.BB.15 | (Fe3+0.67◻0.33)Fe3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Hematite var. Martite | 4.CB.05 | Fe2O3 |
| ⓘ | Quartz var. Agate | 4.DA.05 | SiO2 |
| ⓘ | var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | var. Onyx | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Carnelian | 4.DA.05 | SiO2 |
| ⓘ | var. Chrome-Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | Opal | 4.DA.10 | SiO2 · nH2O |
| ⓘ | var. Opaline | 4.DA.10 | SiO2 · nH2O |
| ⓘ | Tridymite | 4.DA.10 | SiO2 |
| ⓘ | Opal var. Common Opal | 4.DA.10 | SiO2 · nH2O |
| ⓘ | Moganite | 4.DA.20 | SiO2 |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Pyrolusite var. Polianite | 4.DB.05 | morphological variety |
| ⓘ | Baddeleyite | 4.DE.35 | ZrO2 |
| ⓘ | Goethite | 4.FD.10 | Fe3+O(OH) |
| ⓘ | Manganite | 4.FD.15 | Mn3+O(OH) |
| ⓘ | Carnotite | 4.HB.05 | K2(UO2)2(VO4)2 · 3H2O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Magnesite | 5.AB.05 | MgCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Magnesite var. Breunnerite | 5.AB.05 | (Mg,Fe)CO3 |
| ⓘ | var. Mesitine Spar | 5.AB.05 | (Mg,Fe)CO3 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | var. Iron-bearing Dolomite | 5.AB.10 | Ca(Mg,Fe)(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Georgeite ? | 5.BA.10 | [Cu(OH)2-x(H2O)x][CO3]x/2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Mcguinnessite | 5.BA.10 | (Mg,Cu)2(CO3)(OH)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Alunite | 7.BC.10 | KAl3(SO4)2(OH)6 |
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Natroalunite | 7.BC.10 | NaAl3(SO4)2(OH)6 |
| ⓘ | Natrojarosite | 7.BC.10 | NaFe3(SO4)2(OH)6 |
| ⓘ | Osarizawaite | 7.BC.10 | Pb(Al2Cu2+)(SO4)2(OH)6 |
| ⓘ | Melanterite | 7.CB.35 | Fe2+(H2O)6(SO4) · H2O |
| ⓘ | Epsomite | 7.CB.40 | MgSO4 · 7H2O |
| ⓘ | Goslarite | 7.CB.40 | ZnSO4 · 7H2O |
| ⓘ | Alunogen | 7.CB.45 | Al2(SO4)3 · 17H2O |
| ⓘ | Pickeringite | 7.CB.85 | MgAl2(SO4)4 · 22H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | var. Selenite | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Copiapite | 7.DB.35 | Fe2+Fe3+4(SO4)6(OH)2 · 20H2O |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Berlinite | 8.AA.05 | AlPO4 |
| ⓘ | Merrillite | 8.AC.45 | Ca9NaMg(PO4)7 |
| ⓘ | Rockbridgeite | 8.BC.10 | (Fe2+0.5Fe3+0.5)2Fe3+3(PO4)3(OH)5 |
| ⓘ | Conichalcite | 8.BH.35 | CaCu(AsO4)(OH) |
| ⓘ | Mottramite | 8.BH.40 | PbCu(VO4)(OH) |
| ⓘ | Crandallite | 8.BL.10 | CaAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Goyazite | 8.BL.10 | SrAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Hydroxylapatite | 8.BN.05 | Ca5(PO4)3(OH) |
| ⓘ | Metavariscite | 8.CD.05 | AlPO4 · 2H2O |
| ⓘ | Scorodite | 8.CD.10 | Fe3+AsO4 · 2H2O |
| ⓘ | Strengite ? | 8.CD.10 | FePO4 · 2H2O |
| ⓘ | Variscite | 8.CD.10 | AlPO4 · 2H2O |
| ⓘ | Collinsite | 8.CG.05 | Ca2Mg(PO4)2 · 2H2O |
| ⓘ | Brushite | 8.CJ.50 | Ca(PO3OH) · 2H2O |
| ⓘ | Churchite-(Y) | 8.CJ.50 | Y(PO4) · 2H2O |
| ⓘ | Gordonite | 8.DC.30 | MgAl2(PO4)2(OH)2 · 8H2O |
| ⓘ | Turquoise | 8.DD.15 | CuAl6(PO4)4(OH)8 · 4H2O |
| ⓘ | Leucophosphite | 8.DH.10 | KFe3+2(PO4)2(OH) · 2H2O |
| ⓘ | Overite ? | 8.DH.20 | CaMgAl(PO4)2(OH) · 4H2O |
| ⓘ | Segelerite | 8.DH.20 | Ca2 Mg2 Fe3+2(PO4)4(OH)2 · 8H2O |
| ⓘ | Montgomeryite | 8.DH.25 | Ca4MgAl4(PO4)6(OH)4 · 12H2O |
| ⓘ | Mitridatite | 8.DH.30 | Ca2Fe3+3(PO4)3O2 · 3H2O |
| ⓘ | Dufrénite | 8.DK.15 | Ca0.5Fe2+Fe3+5(PO4)4(OH)6 · 2H2O |
| ⓘ | Foggite | 8.DL.05 | CaAl(PO4)(OH)2 · H2O |
| ⓘ | Cyrilovite | 8.DL.10 | NaFe3+3(PO4)2(OH)4 · 2H2O |
| ⓘ | Millisite ? | 8.DL.10 | (Na,K)CaAl6(PO4)4(OH)9 · 3H2O |
| ⓘ | Wardite | 8.DL.10 | NaAl3(PO4)2(OH)4 · 2H2O |
| Group 9 - Silicates | |||
| ⓘ | Chrysotile | 9.00. | Mg3(Si2O5)(OH)4 |
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Reidite | 9.AD.45 | Zr(SiO4) |
| ⓘ | Sillimanite | 9.AF.05 | Al2(SiO4)O |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Kyanite | 9.AF.15 | Al2(SiO4)O |
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | Hemimorphite | 9.BD.10 | Zn4Si2O7(OH)2 · H2O |
| ⓘ | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Zoisite | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | var. Heliodor | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Enstatite | 9.DA.05 | Mg2Si2O6 |
| ⓘ | var. Bronzite | 9.DA.05 | (Mg,Fe2+)2[SiO3]2 |
| ⓘ | Pigeonite | 9.DA.10 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Augite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Magnesiocarpholite | 9.DB.05 | MgAl2Si2O6(OH)4 |
| ⓘ | Gedrite | 9.DD.05 | ◻Mg2(Mg3Al2)(Al2Si6O22)(OH)2 |
| ⓘ | Grunerite | 9.DE.05 | ◻Fe2+2Fe2+5(Si8O22)(OH)2 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Muscovite var. Fuchsite | 9.EC.15 | K(Al,Cr)3Si3O10(OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | Aluminoceladonite | 9.EC.15 | K(MgAl◻)(Si4O10)(OH)2 |
| ⓘ | Muscovite var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Baileychlore | 9.EC.55 | Zn5Al(AlSi3O10)(OH)8 |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | var. Chromium-bearing Clinochlore | 9.EC.55 | Mg5(Al,Cr)2Si3O10(OH)8 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | var. Chrome-Kaolinite | 9.ED.05 | (Al,Cr)2(Si2O5)(OH)4 |
| ⓘ | Antigorite | 9.ED.15 | Mg3(Si2O5)(OH)4 |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Microcline var. Hyalophane | 9.FA.30 | (K,Ba)[Al(Si,Al)Si2O8] |
| ⓘ | 9.FA.30 | K(AlSi3O8) | |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Anorthite | 9.FA.35 | Ca(Al2Si2O8) |
| ⓘ | var. Bytownite | 9.FA.35 | (Ca,Na)[Al(Al,Si)Si2O8] |
| ⓘ | var. Labradorite | 9.FA.35 | (Ca,Na)[Al(Al,Si)Si2O8] |
| Unclassified | |||
| ⓘ | 'Alexandrolite' | - | Cr2Al4Si8O25 · 6H2O Or near |
| ⓘ | 'Amphibole Supergroup' | - | AB2C5(T8O22)W2 |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chrysoprase' | - | |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Hypersthene' | - | (Mg,Fe)SiO3 |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Monazite Group' | - | REE(PO4) |
| ⓘ | 'Psilomelane' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Amphibole Supergroup var. Uralite' | - | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ | 'Xenotime' | - | |
| ⓘ | 'Mica Group' | - | |
| ⓘ | 'Kerolite' | - | (Mg,Ni)3Si4O10(OH)2 · nH2O (n ~ 1) |
| ⓘ | 'Bloodstone' | - | SiO2 |
| ⓘ | 'Clinopyroxene Subgroup' | - | |
| ⓘ | 'Fayalite-Forsterite Series' | - | |
| ⓘ | 'Chromite-Magnesiochromite Series' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'Soapstone' | - | |
| ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Silica' | - | |
| ⓘ | 'Orthopyroxene Subgroup' | - | |
| ⓘ | 'Smectite Group' | - | A0.3D2-3[T4O10]Z2 · nH2O |
| ⓘ | 'Serpentine Subgroup' | - | D3[Si2O5](OH)4 |
| ⓘ | 'Manganese Oxides' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
| ⓘ | 'Axinite Group' | - | |
| ⓘ | 'Whiteite Subgroup' | - | XM1M22M32(H2O)8(OH)2(PO4)4 |
| ⓘ | 'Jahnsite Group' | - | XM1M22M32(H2O)8(OH)2(PO4)4 |
| ⓘ | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| ⓘ | 'Jahnsite Subgroup' | - | XM1M22M32(H2O)8(OH)2(PO4)4 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Alexandrolite | Cr2Al4Si8O25 · 6H2O Or near |
| H | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| H | ⓘ Alunogen | Al2(SO4)3 · 17H2O |
| H | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| H | ⓘ Atacamite | Cu2(OH)3Cl |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Baileychlore | Zn5Al(AlSi3O10)(OH)8 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Brushite | Ca(PO3OH) · 2H2O |
| H | ⓘ Carnotite | K2(UO2)2(VO4)2 · 3H2O |
| H | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Churchite-(Y) | Y(PO4) · 2H2O |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Collinsite | Ca2Mg(PO4)2 · 2H2O |
| H | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| H | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| H | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Cyrilovite | NaFe33+(PO4)2(OH)4 · 2H2O |
| H | ⓘ Dufrénite | Ca0.5Fe2+Fe53+(PO4)4(OH)6 · 2H2O |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Epsomite | MgSO4 · 7H2O |
| H | ⓘ Foggite | CaAl(PO4)(OH)2 · H2O |
| H | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| H | ⓘ Gedrite | ◻Mg2(Mg3Al2)(Al2Si6O22)(OH)2 |
| H | ⓘ Georgeite | [Cu(OH)2-x(H2O)x][CO3]x/2 |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gordonite | MgAl2(PO4)2(OH)2 · 8H2O |
| H | ⓘ Goslarite | ZnSO4 · 7H2O |
| H | ⓘ Grunerite | ◻Fe22+Fe52+(Si8O22)(OH)2 |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| H | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Leucophosphite | KFe23+(PO4)2(OH) · 2H2O |
| H | ⓘ Magnesiocarpholite | MgAl2Si2O6(OH)4 |
| H | ⓘ Manganite | Mn3+O(OH) |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Mcguinnessite | (Mg,Cu)2(CO3)(OH)2 |
| H | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| H | ⓘ Metavariscite | AlPO4 · 2H2O |
| H | ⓘ Millisite | (Na,K)CaAl6(PO4)4(OH)9 · 3H2O |
| H | ⓘ Mitridatite | Ca2Fe33+(PO4)3O2 · 3H2O |
| H | ⓘ Montgomeryite | Ca4MgAl4(PO4)6(OH)4 · 12H2O |
| H | ⓘ Mottramite | PbCu(VO4)(OH) |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Natroalunite | NaAl3(SO4)2(OH)6 |
| H | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Opal var. Opaline | SiO2 · nH2O |
| H | ⓘ Osarizawaite | Pb(Al2Cu2+)(SO4)2(OH)6 |
| H | ⓘ Overite | CaMgAl(PO4)2(OH) · 4H2O |
| H | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Pickeringite | MgAl2(SO4)4 · 22H2O |
| H | ⓘ Rockbridgeite | (Fe2+0.5Fe3+0.5)2Fe33+(PO4)3(OH)5 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| H | ⓘ Segelerite | Ca2 Mg2 Fe23+(PO4)4(OH)2 · 8H2O |
| H | ⓘ Strengite | FePO4 · 2H2O |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| H | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| H | ⓘ Variscite | AlPO4 · 2H2O |
| H | ⓘ Wardite | NaAl3(PO4)2(OH)4 · 2H2O |
| H | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| H | ⓘ Opal var. Common Opal | SiO2 · nH2O |
| H | ⓘ Aluminoceladonite | K(MgAl◻)(Si4O10)(OH)2 |
| H | ⓘ Kerolite | (Mg,Ni)3Si4O10(OH)2 · nH2O (n ~ 1) |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Kaolinite var. Chrome-Kaolinite | (Al,Cr)2(Si2O5)(OH)4 |
| H | ⓘ Smectite Group | A0.3D2-3[T4O10]Z2 · nH2O |
| H | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| H | ⓘ Whiteite Subgroup | XM1M22M32(H2O)8(OH)2(PO4)4 |
| H | ⓘ Jahnsite Group | XM1M22M32(H2O)8(OH)2(PO4)4 |
| H | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| H | ⓘ Jahnsite Subgroup | XM1M22M32(H2O)8(OH)2(PO4)4 |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Beryl var. Heliodor | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Cohenite | Fe3C |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Georgeite | [Cu(OH)2-x(H2O)x][CO3]x/2 |
| C | ⓘ Graphite | C |
| C | ⓘ Magnesite | MgCO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Mcguinnessite | (Mg,Cu)2(CO3)(OH)2 |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Magnesite var. Breunnerite | (Mg,Fe)CO3 |
| C | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| C | ⓘ Magnesite var. Mesitine Spar | (Mg,Fe)CO3 |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Quartz var. Agate | SiO2 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Alexandrolite | Cr2Al4Si8O25 · 6H2O Or near |
| O | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| O | ⓘ Alunogen | Al2(SO4)3 · 17H2O |
| O | ⓘ Amphibole Supergroup | AB2C5(T8O22)W2 |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Anorthite | Ca(Al2Si2O8) |
| O | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Atacamite | Cu2(OH)3Cl |
| O | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Baddeleyite | ZrO2 |
| O | ⓘ Baileychlore | Zn5Al(AlSi3O10)(OH)8 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Berlinite | AlPO4 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Brushite | Ca(PO3OH) · 2H2O |
| O | ⓘ Anorthite var. Bytownite | (Ca,Na)[Al(Al,Si)Si2O8] |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Carnotite | K2(UO2)2(VO4)2 · 3H2O |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| O | ⓘ Chromite | Fe2+Cr23+O4 |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Churchite-(Y) | Y(PO4) · 2H2O |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Collinsite | Ca2Mg(PO4)2 · 2H2O |
| O | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| O | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| O | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Cyrilovite | NaFe33+(PO4)2(OH)4 · 2H2O |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Dufrénite | Ca0.5Fe2+Fe53+(PO4)4(OH)6 · 2H2O |
| O | ⓘ Enstatite | Mg2Si2O6 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Epsomite | MgSO4 · 7H2O |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Foggite | CaAl(PO4)(OH)2 · H2O |
| O | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| O | ⓘ Gedrite | ◻Mg2(Mg3Al2)(Al2Si6O22)(OH)2 |
| O | ⓘ Georgeite | [Cu(OH)2-x(H2O)x][CO3]x/2 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Gordonite | MgAl2(PO4)2(OH)2 · 8H2O |
| O | ⓘ Goslarite | ZnSO4 · 7H2O |
| O | ⓘ Grunerite | ◻Fe22+Fe52+(Si8O22)(OH)2 |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| O | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| O | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| O | ⓘ Hypersthene | (Mg,Fe)SiO3 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Kyanite | Al2(SiO4)O |
| O | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| O | ⓘ Leucophosphite | KFe23+(PO4)2(OH) · 2H2O |
| O | ⓘ Magnesite | MgCO3 |
| O | ⓘ Magnesiocarpholite | MgAl2Si2O6(OH)4 |
| O | ⓘ Manganite | Mn3+O(OH) |
| O | ⓘ Maghemite | (Fe3+0.67◻0.33)Fe23+O4 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Hematite var. Martite | Fe2O3 |
| O | ⓘ Mcguinnessite | (Mg,Cu)2(CO3)(OH)2 |
| O | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| O | ⓘ Metavariscite | AlPO4 · 2H2O |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Millisite | (Na,K)CaAl6(PO4)4(OH)9 · 3H2O |
| O | ⓘ Mitridatite | Ca2Fe33+(PO4)3O2 · 3H2O |
| O | ⓘ Moganite | SiO2 |
| O | ⓘ Monazite Group | REE(PO4) |
| O | ⓘ Montgomeryite | Ca4MgAl4(PO4)6(OH)4 · 12H2O |
| O | ⓘ Mottramite | PbCu(VO4)(OH) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Natroalunite | NaAl3(SO4)2(OH)6 |
| O | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| O | ⓘ Quartz var. Onyx | SiO2 |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Opal var. Opaline | SiO2 · nH2O |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Osarizawaite | Pb(Al2Cu2+)(SO4)2(OH)6 |
| O | ⓘ Overite | CaMgAl(PO4)2(OH) · 4H2O |
| O | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Pickeringite | MgAl2(SO4)4 · 22H2O |
| O | ⓘ Pigeonite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rockbridgeite | (Fe2+0.5Fe3+0.5)2Fe33+(PO4)3(OH)5 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| O | ⓘ Segelerite | Ca2 Mg2 Fe23+(PO4)4(OH)2 · 8H2O |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Sillimanite | Al2(SiO4)O |
| O | ⓘ Spinel | MgAl2O4 |
| O | ⓘ Strengite | FePO4 · 2H2O |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Tenorite | CuO |
| O | ⓘ Cuprite var. Tile ore | Cu2O |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Magnetite var. Titanium-bearing Magnetite | Fe2+(Fe3+,Ti)2O4 |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Tridymite | SiO2 |
| O | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| O | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| O | ⓘ Variscite | AlPO4 · 2H2O |
| O | ⓘ Wardite | NaAl3(PO4)2(OH)4 · 2H2O |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Enstatite var. Bronzite | (Mg,Fe2+)2[SiO3]2 |
| O | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| O | ⓘ Opal var. Common Opal | SiO2 · nH2O |
| O | ⓘ Merrillite | Ca9NaMg(PO4)7 |
| O | ⓘ Beryl var. Heliodor | Be3Al2(Si6O18) |
| O | ⓘ Aluminoceladonite | K(MgAl◻)(Si4O10)(OH)2 |
| O | ⓘ Kerolite | (Mg,Ni)3Si4O10(OH)2 · nH2O (n ~ 1) |
| O | ⓘ Bloodstone | SiO2 |
| O | ⓘ Magnesite var. Breunnerite | (Mg,Fe)CO3 |
| O | ⓘ Fayalite-Forsterite Series | |
| O | ⓘ Chromite-Magnesiochromite Series | |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Quartz var. Carnelian | SiO2 |
| O | ⓘ Pyroxene Group | ADSi2O6 |
| O | ⓘ Kaolinite var. Chrome-Kaolinite | (Al,Cr)2(Si2O5)(OH)4 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Smectite Group | A0.3D2-3[T4O10]Z2 · nH2O |
| O | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| O | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| O | ⓘ Reidite | Zr(SiO4) |
| O | ⓘ Magnesite var. Mesitine Spar | (Mg,Fe)CO3 |
| O | ⓘ Apatite | Ca5(PO4)3A |
| O | ⓘ Whiteite Subgroup | XM1M22M32(H2O)8(OH)2(PO4)4 |
| O | ⓘ Magnetite var. Vanadium-bearing Magnetite | Fe2+(Fe3+,V3+ )2O4 |
| O | ⓘ Quartz var. Chrome-Chalcedony | SiO2 |
| O | ⓘ Jahnsite Group | XM1M22M32(H2O)8(OH)2(PO4)4 |
| O | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| O | ⓘ Jahnsite Subgroup | XM1M22M32(H2O)8(OH)2(PO4)4 |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Anorthite var. Bytownite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Na | ⓘ Cyrilovite | NaFe33+(PO4)2(OH)4 · 2H2O |
| Na | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Na | ⓘ Millisite | (Na,K)CaAl6(PO4)4(OH)9 · 3H2O |
| Na | ⓘ Natroalunite | NaAl3(SO4)2(OH)6 |
| Na | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Wardite | NaAl3(PO4)2(OH)4 · 2H2O |
| Na | ⓘ Merrillite | Ca9NaMg(PO4)7 |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Collinsite | Ca2Mg(PO4)2 · 2H2O |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Enstatite | Mg2Si2O6 |
| Mg | ⓘ Epsomite | MgSO4 · 7H2O |
| Mg | ⓘ Gedrite | ◻Mg2(Mg3Al2)(Al2Si6O22)(OH)2 |
| Mg | ⓘ Gordonite | MgAl2(PO4)2(OH)2 · 8H2O |
| Mg | ⓘ Hypersthene | (Mg,Fe)SiO3 |
| Mg | ⓘ Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| Mg | ⓘ Magnesite | MgCO3 |
| Mg | ⓘ Magnesiocarpholite | MgAl2Si2O6(OH)4 |
| Mg | ⓘ Mcguinnessite | (Mg,Cu)2(CO3)(OH)2 |
| Mg | ⓘ Montgomeryite | Ca4MgAl4(PO4)6(OH)4 · 12H2O |
| Mg | ⓘ Overite | CaMgAl(PO4)2(OH) · 4H2O |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Pickeringite | MgAl2(SO4)4 · 22H2O |
| Mg | ⓘ Pigeonite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Segelerite | Ca2 Mg2 Fe23+(PO4)4(OH)2 · 8H2O |
| Mg | ⓘ Spinel | MgAl2O4 |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Enstatite var. Bronzite | (Mg,Fe2+)2[SiO3]2 |
| Mg | ⓘ Merrillite | Ca9NaMg(PO4)7 |
| Mg | ⓘ Aluminoceladonite | K(MgAl◻)(Si4O10)(OH)2 |
| Mg | ⓘ Kerolite | (Mg,Ni)3Si4O10(OH)2 · nH2O (n ~ 1) |
| Mg | ⓘ Magnesite var. Breunnerite | (Mg,Fe)CO3 |
| Mg | ⓘ Fayalite-Forsterite Series | |
| Mg | ⓘ Chromite-Magnesiochromite Series | |
| Mg | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Mg | ⓘ Magnesite var. Mesitine Spar | (Mg,Fe)CO3 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Alexandrolite | Cr2Al4Si8O25 · 6H2O Or near |
| Al | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| Al | ⓘ Alunogen | Al2(SO4)3 · 17H2O |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Anorthite | Ca(Al2Si2O8) |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Baileychlore | Zn5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Berlinite | AlPO4 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Anorthite var. Bytownite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Foggite | CaAl(PO4)(OH)2 · H2O |
| Al | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Al | ⓘ Gedrite | ◻Mg2(Mg3Al2)(Al2Si6O22)(OH)2 |
| Al | ⓘ Gordonite | MgAl2(PO4)2(OH)2 · 8H2O |
| Al | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| Al | ⓘ Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Kyanite | Al2(SiO4)O |
| Al | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Al | ⓘ Magnesiocarpholite | MgAl2Si2O6(OH)4 |
| Al | ⓘ Metavariscite | AlPO4 · 2H2O |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Millisite | (Na,K)CaAl6(PO4)4(OH)9 · 3H2O |
| Al | ⓘ Montgomeryite | Ca4MgAl4(PO4)6(OH)4 · 12H2O |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Natroalunite | NaAl3(SO4)2(OH)6 |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Osarizawaite | Pb(Al2Cu2+)(SO4)2(OH)6 |
| Al | ⓘ Overite | CaMgAl(PO4)2(OH) · 4H2O |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Pickeringite | MgAl2(SO4)4 · 22H2O |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Sillimanite | Al2(SiO4)O |
| Al | ⓘ Spinel | MgAl2O4 |
| Al | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| Al | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Al | ⓘ Variscite | AlPO4 · 2H2O |
| Al | ⓘ Wardite | NaAl3(PO4)2(OH)4 · 2H2O |
| Al | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Beryl var. Heliodor | Be3Al2(Si6O18) |
| Al | ⓘ Aluminoceladonite | K(MgAl◻)(Si4O10)(OH)2 |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Al | ⓘ Kaolinite var. Chrome-Kaolinite | (Al,Cr)2(Si2O5)(OH)4 |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ Quartz var. Agate | SiO2 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Alexandrolite | Cr2Al4Si8O25 · 6H2O Or near |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Anorthite | Ca(Al2Si2O8) |
| Si | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Baileychlore | Zn5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Anorthite var. Bytownite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Enstatite | Mg2Si2O6 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Si | ⓘ Gedrite | ◻Mg2(Mg3Al2)(Al2Si6O22)(OH)2 |
| Si | ⓘ Grunerite | ◻Fe22+Fe52+(Si8O22)(OH)2 |
| Si | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Si | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| Si | ⓘ Hypersthene | (Mg,Fe)SiO3 |
| Si | ⓘ Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Kyanite | Al2(SiO4)O |
| Si | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Si | ⓘ Magnesiocarpholite | MgAl2Si2O6(OH)4 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Moganite | SiO2 |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz var. Onyx | SiO2 |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Opal var. Opaline | SiO2 · nH2O |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Pigeonite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Sillimanite | Al2(SiO4)O |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Tridymite | SiO2 |
| Si | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Enstatite var. Bronzite | (Mg,Fe2+)2[SiO3]2 |
| Si | ⓘ Opal var. Common Opal | SiO2 · nH2O |
| Si | ⓘ Beryl var. Heliodor | Be3Al2(Si6O18) |
| Si | ⓘ Aluminoceladonite | K(MgAl◻)(Si4O10)(OH)2 |
| Si | ⓘ Kerolite | (Mg,Ni)3Si4O10(OH)2 · nH2O (n ~ 1) |
| Si | ⓘ Bloodstone | SiO2 |
| Si | ⓘ Fayalite-Forsterite Series | |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Quartz var. Carnelian | SiO2 |
| Si | ⓘ Pyroxene Group | ADSi2O6 |
| Si | ⓘ Kaolinite var. Chrome-Kaolinite | (Al,Cr)2(Si2O5)(OH)4 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| Si | ⓘ Reidite | Zr(SiO4) |
| Si | ⓘ Quartz var. Chrome-Chalcedony | SiO2 |
| Si | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| P | Phosphorus | |
| P | ⓘ Berlinite | AlPO4 |
| P | ⓘ Brushite | Ca(PO3OH) · 2H2O |
| P | ⓘ Churchite-(Y) | Y(PO4) · 2H2O |
| P | ⓘ Collinsite | Ca2Mg(PO4)2 · 2H2O |
| P | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Cyrilovite | NaFe33+(PO4)2(OH)4 · 2H2O |
| P | ⓘ Dufrénite | Ca0.5Fe2+Fe53+(PO4)4(OH)6 · 2H2O |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Foggite | CaAl(PO4)(OH)2 · H2O |
| P | ⓘ Gordonite | MgAl2(PO4)2(OH)2 · 8H2O |
| P | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| P | ⓘ Leucophosphite | KFe23+(PO4)2(OH) · 2H2O |
| P | ⓘ Metavariscite | AlPO4 · 2H2O |
| P | ⓘ Millisite | (Na,K)CaAl6(PO4)4(OH)9 · 3H2O |
| P | ⓘ Mitridatite | Ca2Fe33+(PO4)3O2 · 3H2O |
| P | ⓘ Monazite Group | REE(PO4) |
| P | ⓘ Montgomeryite | Ca4MgAl4(PO4)6(OH)4 · 12H2O |
| P | ⓘ Overite | CaMgAl(PO4)2(OH) · 4H2O |
| P | ⓘ Rockbridgeite | (Fe2+0.5Fe3+0.5)2Fe33+(PO4)3(OH)5 |
| P | ⓘ Schreibersite | (Fe,Ni)3P |
| P | ⓘ Segelerite | Ca2 Mg2 Fe23+(PO4)4(OH)2 · 8H2O |
| P | ⓘ Strengite | FePO4 · 2H2O |
| P | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| P | ⓘ Variscite | AlPO4 · 2H2O |
| P | ⓘ Wardite | NaAl3(PO4)2(OH)4 · 2H2O |
| P | ⓘ Merrillite | Ca9NaMg(PO4)7 |
| P | ⓘ Apatite | Ca5(PO4)3A |
| P | ⓘ Whiteite Subgroup | XM1M22M32(H2O)8(OH)2(PO4)4 |
| P | ⓘ Jahnsite Group | XM1M22M32(H2O)8(OH)2(PO4)4 |
| P | ⓘ Jahnsite Subgroup | XM1M22M32(H2O)8(OH)2(PO4)4 |
| S | Sulfur | |
| S | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| S | ⓘ Alunogen | Al2(SO4)3 · 17H2O |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Bournonite | PbCuSbS3 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| S | ⓘ Covellite | CuS |
| S | ⓘ Digenite | Cu9S5 |
| S | ⓘ Epsomite | MgSO4 · 7H2O |
| S | ⓘ Galena | PbS |
| S | ⓘ Gersdorffite | NiAsS |
| S | ⓘ Goslarite | ZnSO4 · 7H2O |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Natroalunite | NaAl3(SO4)2(OH)6 |
| S | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| S | ⓘ Osarizawaite | Pb(Al2Cu2+)(SO4)2(OH)6 |
| S | ⓘ Pentlandite | (NixFey)Σ9S8 |
| S | ⓘ Pickeringite | MgAl2(SO4)4 · 22H2O |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Troilite | FeS |
| S | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| Cl | Chlorine | |
| Cl | ⓘ Atacamite | Cu2(OH)3Cl |
| Cl | ⓘ Chlorargyrite | AgCl |
| Cl | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| Cl | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| K | Potassium | |
| K | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Carnotite | K2(UO2)2(VO4)2 · 3H2O |
| K | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| K | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| K | ⓘ Leucophosphite | KFe23+(PO4)2(OH) · 2H2O |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Millisite | (Na,K)CaAl6(PO4)4(OH)9 · 3H2O |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| K | ⓘ Aluminoceladonite | K(MgAl◻)(Si4O10)(OH)2 |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Anorthite | Ca(Al2Si2O8) |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Brushite | Ca(PO3OH) · 2H2O |
| Ca | ⓘ Anorthite var. Bytownite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Collinsite | Ca2Mg(PO4)2 · 2H2O |
| Ca | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| Ca | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Dufrénite | Ca0.5Fe2+Fe53+(PO4)4(OH)6 · 2H2O |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Foggite | CaAl(PO4)(OH)2 · H2O |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| Ca | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Ca | ⓘ Millisite | (Na,K)CaAl6(PO4)4(OH)9 · 3H2O |
| Ca | ⓘ Mitridatite | Ca2Fe33+(PO4)3O2 · 3H2O |
| Ca | ⓘ Montgomeryite | Ca4MgAl4(PO4)6(OH)4 · 12H2O |
| Ca | ⓘ Overite | CaMgAl(PO4)2(OH) · 4H2O |
| Ca | ⓘ Pigeonite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Segelerite | Ca2 Mg2 Fe23+(PO4)4(OH)2 · 8H2O |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| Ca | ⓘ Merrillite | Ca9NaMg(PO4)7 |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| Ti | ⓘ Magnetite var. Titanium-bearing Magnetite | Fe2+(Fe3+,Ti)2O4 |
| Ti | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| V | Vanadium | |
| V | ⓘ Carnotite | K2(UO2)2(VO4)2 · 3H2O |
| V | ⓘ Mottramite | PbCu(VO4)(OH) |
| V | ⓘ Magnetite var. Vanadium-bearing Magnetite | Fe2+(Fe3+,V3+ )2O4 |
| Cr | Chromium | |
| Cr | ⓘ Alexandrolite | Cr2Al4Si8O25 · 6H2O Or near |
| Cr | ⓘ Chromite | Fe2+Cr23+O4 |
| Cr | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Cr | ⓘ Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| Cr | ⓘ Chromite-Magnesiochromite Series | |
| Cr | ⓘ Kaolinite var. Chrome-Kaolinite | (Al,Cr)2(Si2O5)(OH)4 |
| Mn | Manganese | |
| Mn | ⓘ Manganite | Mn3+O(OH) |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chromite | Fe2+Cr23+O4 |
| Fe | ⓘ Cohenite | Fe3C |
| Fe | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| Fe | ⓘ Cyrilovite | NaFe33+(PO4)2(OH)4 · 2H2O |
| Fe | ⓘ Dufrénite | Ca0.5Fe2+Fe53+(PO4)4(OH)6 · 2H2O |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Grunerite | ◻Fe22+Fe52+(Si8O22)(OH)2 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Hypersthene | (Mg,Fe)SiO3 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Native Iron | Fe |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Native Iron var. Kamacite | (Fe,Ni) |
| Fe | ⓘ Leucophosphite | KFe23+(PO4)2(OH) · 2H2O |
| Fe | ⓘ Maghemite | (Fe3+0.67◻0.33)Fe23+O4 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Hematite var. Martite | Fe2O3 |
| Fe | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| Fe | ⓘ Mitridatite | Ca2Fe33+(PO4)3O2 · 3H2O |
| Fe | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| Fe | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Fe | ⓘ Pigeonite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Rockbridgeite | (Fe2+0.5Fe3+0.5)2Fe33+(PO4)3(OH)5 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Schreibersite | (Fe,Ni)3P |
| Fe | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Fe | ⓘ Segelerite | Ca2 Mg2 Fe23+(PO4)4(OH)2 · 8H2O |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Strengite | FePO4 · 2H2O |
| Fe | ⓘ Taenite | (Ni,Fe) |
| Fe | ⓘ Tetrataenite | FeNi |
| Fe | ⓘ Magnetite var. Titanium-bearing Magnetite | Fe2+(Fe3+,Ti)2O4 |
| Fe | ⓘ Troilite | FeS |
| Fe | ⓘ Enstatite var. Bronzite | (Mg,Fe2+)2[SiO3]2 |
| Fe | ⓘ Magnesite var. Breunnerite | (Mg,Fe)CO3 |
| Fe | ⓘ Fayalite-Forsterite Series | |
| Fe | ⓘ Chromite-Magnesiochromite Series | |
| Fe | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Fe | ⓘ Magnesite var. Mesitine Spar | (Mg,Fe)CO3 |
| Fe | ⓘ Magnetite var. Vanadium-bearing Magnetite | Fe2+(Fe3+,V3+ )2O4 |
| Ni | Nickel | |
| Ni | ⓘ Gersdorffite | NiAsS |
| Ni | ⓘ Native Iron var. Kamacite | (Fe,Ni) |
| Ni | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Ni | ⓘ Schreibersite | (Fe,Ni)3P |
| Ni | ⓘ Taenite | (Ni,Fe) |
| Ni | ⓘ Tetrataenite | FeNi |
| Ni | ⓘ Kerolite | (Mg,Ni)3Si4O10(OH)2 · nH2O (n ~ 1) |
| Cu | Copper | |
| Cu | ⓘ Atacamite | Cu2(OH)3Cl |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Bournonite | PbCuSbS3 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Digenite | Cu9S5 |
| Cu | ⓘ Georgeite | [Cu(OH)2-x(H2O)x][CO3]x/2 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Mcguinnessite | (Mg,Cu)2(CO3)(OH)2 |
| Cu | ⓘ Mottramite | PbCu(VO4)(OH) |
| Cu | ⓘ Osarizawaite | Pb(Al2Cu2+)(SO4)2(OH)6 |
| Cu | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| Cu | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Cu | ⓘ Tenorite | CuO |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Cuprite var. Tile ore | Cu2O |
| Cu | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| Zn | Zinc | |
| Zn | ⓘ Baileychlore | Zn5Al(AlSi3O10)(OH)8 |
| Zn | ⓘ Goslarite | ZnSO4 · 7H2O |
| Zn | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Zn | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Native Zinc | Zn |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| As | ⓘ Gersdorffite | NiAsS |
| As | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| As | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Se | Selenium | |
| Se | ⓘ Native Selenium | Se |
| Sr | Strontium | |
| Sr | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| Y | Yttrium | |
| Y | ⓘ Churchite-(Y) | Y(PO4) · 2H2O |
| Zr | Zirconium | |
| Zr | ⓘ Baddeleyite | ZrO2 |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Zr | ⓘ Reidite | Zr(SiO4) |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Ag | Silver | |
| Ag | ⓘ Chlorargyrite | AgCl |
| Ag | ⓘ Native Gold var. Electrum | (Au,Ag) |
| Ag | ⓘ Iodargyrite | AgI |
| Ag | ⓘ Native Silver | Ag |
| Sb | Antimony | |
| Sb | ⓘ Bournonite | PbCuSbS3 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Te | Tellurium | |
| Te | ⓘ Altaite | PbTe |
| I | Iodine | |
| I | ⓘ Iodargyrite | AgI |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
| Au | Gold | |
| Au | ⓘ Native Gold var. Electrum | (Au,Ag) |
| Au | ⓘ Native Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Altaite | PbTe |
| Pb | ⓘ Bournonite | PbCuSbS3 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Mottramite | PbCu(VO4)(OH) |
| Pb | ⓘ Osarizawaite | Pb(Al2Cu2+)(SO4)2(OH)6 |
| Bi | Bismuth | |
| Bi | ⓘ Native Bismuth | Bi |
| U | Uranium | |
| U | ⓘ Carnotite | K2(UO2)2(VO4)2 · 3H2O |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Meekatharra,_Western_Australia |
|---|
Localities in this Region
- Western Australia
- Meekatharra Shire
- ⭔Abbotts gold area
- Belele Station
- Bulloo Downs Station
- Burnakura Goldfield
- Butcherbird Manganese Mine
- Daisy Gold Mine
- Divide Creek Jasper 1
- Divide Creek Jasper 2
- Divide Creek Jasper 3
- Gabanintha
- Garden Gully Goldfield
- Booty 2 Mine
- Booty Mine
- Crown Gold Mine
- Crown North Gold Mine
- Crown South Gold Mine
- East Sabbath 1 Mine
- East Sabbath 2 Mine
- East Sabbath 3 Mine
- East Sabbath 4 Mine
- East Sabbath 5 Mine
- Eclipse Gold Mine
- Garden Gully Copper
- Garden Gully Group
- Garden Gully Talc
- Jasper Star East Mine
- Jasper Star Gold Mine
- Kyarra 3 Mine
- Kyarra Gold Mine
- Leanne prospect
- Lizzie Mine
- Lydia Gold Mine
- Lydia North Mine
- Lydia prospect
- Lydia South East Mine
- Nineteenth Hole prospect
- North Star Mine
- Once More Sabbath Mine
- Sabbath Gold Mine
- Sabbath North West Mine
- Sabbath South 2 Mine
- Sabbath South 3 Mine
- Sabbath West Mine
- Transylvannia prospect
- Glen Ross Creek Gorge
- Jillewarra
- ⭔Karalundi Community
- Kearry's Gold Mine
- Meekatharra
- Milgun Station
- Mount Gould Station
- Mount Olympus Gold Mine
- Mount Padbury Station
- Mount Vernon
- Mount Vernon Station
- Mulgul Station
- Murchison Downs meteorite
- ⭔Murramunda Community (Warrawanda Creek)
- Nannine Goldfield
- Aberfoyle Gold Mine
- ⭔Bailey's Island gold area
- Caledonian Gold Mine
- Champion Gold Mine
- Lake Annean
- Little Gap Well gold prospect (The Gap)
- Luggs Reward prospect
- Munarra Gully Gold Mine (Mistletoe)
- Nannine Gold Mine
- New Year Gold Mine
- Queen of the Lake Gold Mine (Aladdin; Fraser's Caledonian)
- Royalist Gold Mine
- Three Sisters Gold Mine
- Wanganui Gold Mine
- Neds Creek Station
- Meekatharra Shire
- Western Australia
- Meekatharra Shire
- Neds Creek Station
- Peak Hill Mining District
- Cashmans East prospect
- Cashmans Mine (Cashmans Bore)
- Cashmans North
- Curley's Gold P.A.
- Dead Horse Well 1
- Dead Horse Well 2
- Deep South Gold Mine (Yarlarweelor; D39; D43; South; South-Central)
- Doolgunna Station
- Durack Well 1
- Durack Well 2
- Durack Well 3
- Durack Well 4
- Fortnum Gold Mine
- Goodin Find Gold P.A.
- Heines Find Gold Mine
- Hit or Miss Gold Mine (Wilgeena; Wilson's Find)
- Horseshoe Lights Mine
- Horseshoe Range manganese ore deposits
- Judges Gold Patch
- Labouchere Gold Mine
- Mikhaburra Gold Mine (Holden's Find)
- Mount Pleasant Gold Mine
- Narracoota 1
- Narracoota 2
- Narracoota 3
- Nathan Gold Mine
- Peak Hill
- Quartz Well gold area P.A.
- Ricks Gold Mine
- Ruby Well group
- Saint Crispin Mine
- Starlight Gold Mine
- Tom's Gold Mine
- Wembley Gold
- Wilthorpe Gold
- Prairie Downs Station
- Snakeskin prospect
- Stakewell
- Sylvania Station
- Teano River
- Toedter Gold Mine
- Turee Creek Station
- Wonyulgunna Station
- Woodlands Station
- Yaloginda Goldfield (Bluebird; Eight Mile; Yallowgindat)
- Anarchist Mine
- Ascot Gold Mine
- Ascot West Gold Mine
- Bassetts West Gold Mine
- Batavia Bluebird Mine
- Batavia Gold Mine
- Batavia North Mine
- Black Jack East deposit
- Black Jack Mine
- Black Jack South mine
- Blackjack Gold Mine
- Blue Danube Mine
- Bluebird East Gold Mine
- Bluebird Gold Mine
- Bluebird South Mine
- Bluebird Underground Gold Mine
- Calliope Rajah
- Chunderloo Mine
- Chunderloo North deposit
- Chunderloo prospect
- Criterion Gold Mine
- Ecrin Mine
- Gibraltar Gold Mine
- Gibraltar Mystery Mine
- Golden Calf Mine
- Great Jack Mine
- Great Oversight Mine
- Hope for the Best Mine
- Hornsby Mine
- Karangahaki Gold Mine (Phantom Mine)
- Kelpy Gold Mine
- Kelpy South Mine
- Lady Mary Mine
- Lukes Junction pit
- Maranui Gold Mine
- Mystery Gold Mine (West Yaloginda)
- Navvies Secret Mine
- New Chum
- Nola Mine
- North Rocklee Mine
- Problem Mine
- Red Jack Mine
- Revenue East Mine
- Revenue Gold Mine
- Revenue North Extended Mine
- Revenue North Mine
- Revenue Proprietary Mine
- Revenue South Mine
- Revenue West Mine
- Rhens Mine
- Rocklee Gold Mine
- Rocklee Pariah Mine
- Rocklee South Mine
- Romsey Gold Mine
- Roseview Mine
- Saracen Mine
- Sirdar North 1
- Sirdar North 2
- Sirdar South Mine
- South Junction Gold Mine
- Surprise Gold Mine
- Surprise West pit
- Twelve Mile 1
- Twelve Mile 2
- Twelve Mile 3
- Two Bells Gold Mine
- Two Bells North Mine
- Whangamata Gold Mine
- Whangamata North Mine
- Yaloginda Jefferys Mine
- Yaloginda Scott Mine
- Yaloginda South 1
- Yaloginda South 2
- Yaloginda South 3
- ⭔Yanneri Pool area
- Yarrabubba Station
- Meekatharra Shire
Other Regions, Features and Areas that Intersect
Australia
- Northern Territory
- Kalkarindji Igneous ProvinceGeologic Province
- Western Australia
- Ashburton BasinBasin
- Bresnahan BasinBasin
- Bryah BasinBasin
- Collier BasinBasin
- Earaheedy BasinBasin
- Edmund BasinBasin
- Fortescue BasinBasin
- Gascoyne ProvinceGeologic Province
- Hamersley BasinBasin
- Padbury BasinBasin
- Western Australia
- Pilbara CratonCraton
- Sylvania DomeDome
- Warakurna Large Igneous ProvinceGeologic Province
- West Australian ElementCraton
- Yerrida BasinBasin
- Yilgarn CratonCraton
- Marymia DomeDome
- Pilbara CratonCraton
Australian PlateTectonic Plate
- West Australian Craton
- Capricorn OrogenOrogenic Belt
- Eastern Yilgarn CratonCraton
- Pilbara CratonCraton
- Western Yilgarn CratonCraton
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther RegionsReferences
Fenian Gold Mine, Meekatharra Goldfield, Meekatharra, Meekatharra Shire, Western Australia, Australia