Log In
This page is currently not sponsored. Click here to sponsor this page.
Get Involved with mindat.org
Mindat.org has grown through countless contributions from mineral enthusiasts, collectors, researchers and experts around the world — people just like you.
Want to take part?
1
2
3
4
Contribute
Add photos, locality information and knowledge
Every contribution helps make mindat.org better for everyone.
Area:
515 km2
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Vikersund | 2,448 (2016) |
Museums in region:
Other Languages:
French:
Modum, Buskerud, Norvège
German:
Modum, Buskerud, Norwegen
Italian:
Modum, Buskerud, Norvegia
Norwegian:
Modum, Buskerud, Norge
Russian:
Мудум, Бускеруд, Норвегия
Simplified Chinese:
莫迪姆, 布斯克吕郡, 挪威
Spanish:
Modum, Buskerud, Noruega
Albanian:
Modum, Buskerud, Norvegjia
Arabic:
مودوم , بوسكرود, النرويج
Armenian:
Մուդում, Բուսկերուդ, Նորվեգիա
Asturian:
Modum, Buskerud, Noruega
Basque:
Modum, Buskerud, Norvegia
Bavarian:
Modum, Buskerud, Norwegn
Bishnupriya Manipuri:
মোডুম, বাসকেরুড, নরৱে
Catalan:
Modum, Buskerud, Noruega
Cebuano:
Modum , Buskerud fylke, Norway
Danish:
Modum, Buskerud, Norge
Dutch:
Modum, Buskerud, Noorwegen
Esperanto:
Modum, Buskerud, Norvegio
Estonian:
Modumi vald, Buskerud, Norra
Farsi/Persian:
مودوم, بوسکرود, نروژ
Finnish:
Modum, Buskerudin lääni, Norja
Icelandic:
Modum, Buskerud, Noregur
Japanese:
ブスケルー県, ブスケルー県, ノルウェー
Javanese:
Modum, Norwégia
Korean:
모둠, 부스케루주, 노르웨이
Latin:
Modum, Buskerud, Norvegia
Limburgian:
Modum, Buskerud, Noorwege
Lithuanian:
Modumas, Biuskeriudas, Norvegija
Low Saxon/Low German:
Kommun Modum, Amt Buskerud, Norwegen
Malay:
Modum, Buskerud, Norway
Minnan / Hokkien-Taiwanese:
Modum, Buskerud, Lo̍k-ui
Northern Sami:
Modum, Buskeruda fylka, Norga
Norwegian (Nynorsk):
Modum, Buskerud fylke, Noreg
Polish:
Modum, Buskerud, Norwegia
Portuguese:
Modum, Buskerud, Noruega
Romanian:
Modum, Buskerud, Norvegia
Slovenian:
Modum, Buskerud, Norveška
Swahili:
Modum, Buskerud, Norwei
Swedish:
Modum, Buskerud fylke, Norge
Traditional Chinese:
莫迪姆, 挪威
Turkish:
Modum, Buskerud, Norveç
Ukrainian:
Модум, Бускерюд, Норвегія
Vietnamese:
Modum, Buskerud, Na Uy
Waray:
Modum, Buskerud, Noruega
Modum is a municipality in Buskerud County, Norway. The administrative centre of the municipality is the town of Vikersund. The municipality of Modum was established on 1 January 1838.
The Modum municipality is known for the cobalt mines of the Blaafarveværket, now a large museum complex with guided tours through the Skuterud cobalt mines.
Among mineral collectors, this area is known for numerous occurrences of beautiful green serpentine and magnesite. The magnesite was actively mined by, e.g., Norsk Magnesit Industri, a company producing fireproof tiles from the magnesite. This is a rather neglected part of the geological history in Modum. The quality of the tiles was very good, and they were exported to many important smelters abroad.
The Glomsrudkollen zinc mine is popular among collectors. Nice epidote, fluorite and other minerals have been found here.
During WW2 muscovite was mined in several pegmatites.
The Modum municipality is known for the cobalt mines of the Blaafarveværket, now a large museum complex with guided tours through the Skuterud cobalt mines.
Among mineral collectors, this area is known for numerous occurrences of beautiful green serpentine and magnesite. The magnesite was actively mined by, e.g., Norsk Magnesit Industri, a company producing fireproof tiles from the magnesite. This is a rather neglected part of the geological history in Modum. The quality of the tiles was very good, and they were exported to many important smelters abroad.
The Glomsrudkollen zinc mine is popular among collectors. Nice epidote, fluorite and other minerals have been found here.
During WW2 muscovite was mined in several pegmatites.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities135 valid minerals. 7 (TL) - type locality of valid minerals. 2 erroneous literature entries.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ Albite Formula: Na(AlSi3O8) Localities: Reported from at least 15 localities in this region. |
| ⓘ Albite var. Oligoclase Formula: (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ Albite var. Oligoclase-Albite Formula: Na(AlSi3O8) |
| ⓘ 'Allanite Group' Formula: (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| ⓘ Allanite-(Y) Formula: (CaY)(AlAlFe2+)O[Si2O7][SiO4](OH) References: |
| ⓘ Althausite (TL) Formula: Mg4(PO4)2(OH,O)(F,◻) Localities: Type Locality: Tingelstadtjern Quarry, Modum, Buskerud, Norway Colour: light grey Description: As cleavable masses in phospate nodules in serpentine |
| ⓘ 'Amphibole Supergroup' Formula: AB2C5(T8O22)W2 Localities: Reported from at least 10 localities in this region. |
| ⓘ Anatase Formula: TiO2 |
| ⓘ 'Andradite-Grossular Series' Locality: Hvalsknatten, Modum, Buskerud, Norway |
| ⓘ Anthophyllite Formula: ◻Mg2Mg5(Si8O22)(OH)2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Antigorite Formula: Mg3(Si2O5)(OH)4 Description: also as pseudomorphs after forsterite crystals |
| ⓘ 'Apatite' Formula: Ca5(PO4)3A Localities: Reported from at least 7 localities in this region. |
| ⓘ Aragonite Formula: CaCO3 |
| ⓘ Arsenopyrite Formula: FeAsS |
| ⓘ Arsenopyrite var. Danaite Formula: (Fe0.90Co0.10)AsS - (Fe0.65Co0.35)AsS References: Scheerer, Th. (1837) Ueber zwei norwegische Kobalterze von den Skutteruder Gruben. Annalen der Physik und Chemie, 118. 546-555 doi:10.1002/andp.18371181205as kobalthaltiger Arsenikkies Wöhler, (1838) Ueber zwei neue Kobalt-Mineralien von Skutterud in Norwegen. Annalen der Physik und Chemie, 119. 591-592 doi:10.1002/andp.18381190317as Kobaltarsenikkies Rosenquist, Ivan Th. (1949) Noen observasjoner og refleksjoner omkring Modum koboltgruver (Nedl.) I. Fahlbåndene [Some observations and reflections on Modum cobalt mines (closed) I. The fahlbands]. Norsk Geologisk Tidsskrift [Norwegian Journal of Geology], 27 (3-4) 187-216 Larsen, Knut Edvard (2022) Klassiske mineraler fra Snarum, Modum – et bidrag til norsk mineralogihistorie i første del av 1800-tallet [Classical minerals from Snarum, Modum. a contribution to the Norwegian mineralogical history of the first half of the 18th century.]. Norsk Mineralsymposium 2022, 29-45 |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 |
| ⓘ Beryl Formula: Be3Al2(Si6O18) Locality: Sætersbergåsen, Modum, Buskerud, Norway References: Scheerer, Th. (1840) Ueber eine neues Vorkommen verschiedener Fossilien, welches mit dem zu Finbo in Schweden grosse Aehnlichkeit hat. Annalen der Physik und Chemie, 125. 533-538 doi:10.1002/andp.18401250312 |
| ⓘ Bianchite Formula: Zn(H2O)6(SO4) Habit: powder Colour: white Description: Bianchite was found in the dumps, when some of the material was removed and a deep profile of the dumps were revealed. It occured as a white to greyish powder, and are easily solved in water. The bianchite is almost without iron (Raade et al,1977). |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ 'Biotite var. Anomite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 Description: as large crystals embedded in talc nodules in magnesite-dolomite |
| ⓘ Bismuthinite Formula: Bi2S3 References: |
| ⓘ Bismutite Formula: (BiO)2CO3 |
| ⓘ Bornite Formula: Cu5FeS4 References: |
| ⓘ Brannerite Formula: UTi2O6 Locality: Haugfoss, Modum, Buskerud, Norway Description: Occure in thin (< 0,5 cm) fractures in greenshist. |
| ⓘ Brianyoungite Formula: Zn3(CO3,SO4)(OH)4 |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 |
| ⓘ Brucite Formula: Mg(OH)2 |
| ⓘ Calcite Formula: CaCO3 Localities: Reported from at least 9 localities in this region. |
| ⓘ 'Calcium Amphibole Subgroup' Formula: AnCa2(C2+5-mC3+m)(Si8-(n+m)Al(n+m))W2 |
| ⓘ ' Formula: AnCa2(Z2+5-mZ3+m)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 Locality: Oksøyekollen, Snarum, Modum, Buskerud, Norway - erroneously reported Description: The amphibole at the locality has been refered to as "hornblende"(sensu lato) in litterature of the late 19th century. At the time the usage of the term was more broad than it became later. Samples of amphiboles from this locality was and stillare labelled as "hornblende"(f.ex. Berg 1986)
An XRD of a typical sample showed it to be actinolite. |
| ⓘ Cassiterite ? Formula: SnO2 |
| ⓘ 'Chabazite' References: |
| ✪ Chabazite-Ca Formula: (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O Description: The "Chabazite" crystals from the Glomsrud Zinc Mines have for a long time been well known in the norwegian mineral collecting community. It has now been determined at NHM Økern, Oslo that the more specific species is Chabazite-(Ca)(EDS) References: [4](2025) STEIN. Magasin for populærgeologi Vol. 52 (4). Norske Amatørgeologers SammenslutningBack cover photo by Harald K Andersen |
| ⓘ Chalcanthite Formula: CuSO4 · 5H2O |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 9 localities in this region. |
| ⓘ Cheralite ? Formula: CaTh(PO4)2 Description: Described as "very tiny brownish crystals on hydroxylapatite" (Nordrum 2010). Most probably a misidentification = monazite-(Ce) ?? |
| ⓘ Chlorapatite Formula: Ca5(PO4)3Cl Description: Described by Raade & Mladeck (1979) as a apatite dominated by Cl; later by Raade, Mladeck & Din as Cl- bearing apatite |
| ⓘ 'Chlorite Group' |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 References: |
| ⓘ Chrysotile Formula: Mg3(Si2O5)(OH)4 |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 Localities: Reported from at least 6 localities in this region. |
| ⓘ Clinochlore var. Leuchtenbergite Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ Clinochlore var. Pennine Formula: Mg5Al(AlSi3O10)(OH)8 Locality: Haugfoss, Modum, Buskerud, Norway |
| ⓘ 'Clinopyroxene Subgroup' |
| ⓘ 'Coal blend' |
| ⓘ Cobaltite Formula: CoAsS Localities: Skuterud Mines, Modum West, Modum, Buskerud, Norway Døvikkollen, Modum West, Modum, Buskerud, Norway Clara adit, Mellomgruvene, Skuterud Mines, Modum West, Modum, Buskerud, Norway Midtgruven, Mellomgruvene, Skuterud Mines, Modum West, Modum, Buskerud, Norway Svartfjell Mines, Modum West, Modum, Buskerud, Norway Habit: Combinations of (210), (111) and (100). Description: First cobaltite found in the Modum area was in 1772 by Ole Witloch. |
| ⓘ Collinsite Formula: Ca2Mg(PO4)2 · 2H2O Description: As replacement of reddish althausite. |
| ⓘ 'Columbite-(Fe)-Columbite-(Mn) Series' Locality: Sætersbergåsen, Modum, Buskerud, Norway References: Knut Eldjarn CollectionIdentified by Knut Eldjarn: Visual Identification |
| ⓘ Cordierite Formula: Mg2Al4Si5O18 Locality: Øvre Dypingdal Mine, Dypingdal serpentine-magnesite deposit, Snarum, Modum, Buskerud, Norway References: Grew, Edward S.; Pertsev, Nikolai N.; Vrána, Stanislav; Yates, Martin G.; Shearer, Charles K.; Wiedenbeck, Michael (1998) Kornerupine parageneses in whiteschists and other magnesian rocks: is kornerupine + talc a high-pressure assemblage equivalent to tourmaline + orthoamphibole? Contributions to Mineralogy and Petrology, 131 (1). 22-38 doi:10.1007/s004100050376 |
| ⓘ Corundum Formula: Al2O3 Locality: Øvre Dypingdal Mine, Dypingdal serpentine-magnesite deposit, Snarum, Modum, Buskerud, Norway References: Grew, Edward S.; Pertsev, Nikolai N.; Vrána, Stanislav; Yates, Martin G.; Shearer, Charles K.; Wiedenbeck, Michael (1998) Kornerupine parageneses in whiteschists and other magnesian rocks: is kornerupine + talc a high-pressure assemblage equivalent to tourmaline + orthoamphibole? Contributions to Mineralogy and Petrology, 131 (1). 22-38 doi:10.1007/s004100050376 |
| ⓘ Cosalite Formula: Pb2Bi2S5 |
| ⓘ Covellite Formula: CuS |
| ⓘ 'Crichtonite Group' Formula: AD21O38 or A{DE2G6Ti12}O38 |
| ⓘ 'Davidite' ? Description: Black, irregular masses with a vitreous to sub metallic lustre embedded in feldspar matrix have been labelled by collectors as "davidite". An analysis of some samples of these has shown these to be chrichtonite group minerals. |
| ⓘ Davidite-(La) ? Formula: La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 Description: According to Eldjarn & Viognola (2022) it is likely that davidite-(La) occurs at Åmot quarry, but this has not yet been confirmed. |
| ⓘ Devilline Formula: CaCu4(SO4)2(OH)6 · 3H2O References: |
| ⓘ Diaspore Formula: AlO(OH) |
| ⓘ Diopside Formula: CaMgSi2O6 |
| ⓘ Dolomite Formula: CaMg(CO3)2 Localities: Øvre Dypingdal Mine, Dypingdal serpentine-magnesite deposit, Snarum, Modum, Buskerud, Norway Dypingdal serpentine-magnesite deposit, Snarum, Modum, Buskerud, Norway Overntjern Quarry, Overntjern, Modum, Buskerud, Norway Nesbruddet, Snarum, Modum, Buskerud, Norway Tingelstadtjern Quarry, Modum, Buskerud, Norway |
| ⓘ Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) Description: Dunn et al (1977) analyzes 4 crystals from 2 specimens of black tourmaline associated with calcite. |
| ⓘ Dypingite (TL) Formula: Mg5(CO3)4(OH)2 · 5H2O Localities: Habit: As small < 0,3 mm globular aggregates forming a thin cover on serpentine Colour: white Fluorescence: light blue |
| ⓘ Enstatite Formula: Mg2Si2O6 |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ Erythrite Formula: Co3(AsO4)2 · 8H2O |
| ⓘ 'Feldspar Group' Localities: Reported from at least 10 localities in this region. |
| ⓘ Fluorite Formula: CaF2 |
| ⓘ Forsterite Formula: Mg2(SiO4) Localities: Description: Serpentine pseudomorphoses after olivine occure at the serpentinite-deposites, sometimes with remnants of forsterite (Fa2-3). |
| ⓘ Galena Formula: PbS |
| ⓘ Galenobismutite Formula: PbBi2S4 |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 |
| ⓘ Gedrite Formula: ◻Mg2(Mg3Al2)(Al2Si6O22)(OH)2 Localities: Colour: greyish brown |
| ⓘ Geikielite Formula: MgTiO3 |
| ⓘ Gibbsite Formula: Al(OH)3 |
| ⓘ Glaucodot Formula: (Co0.50Fe0.50)AsS Description: Scheerer (1838, p. 424) describe a mineral and cal it "arsenopyrite intergrown with Glandskobolt(cobaltite)", this mineral is identical as glaucodote which was described 11 years later. References: |
| ⓘ 'Glockerite' Formula: Fe3+4(SO4)(OH)10 · 1-3H2O ? |
| ⓘ Graphite Formula: C |
| ⓘ Greenockite ? Formula: CdS |
| ⓘ Grossular Formula: Ca3Al2(SiO4)3 Locality: Hvalsknatten, Modum, Buskerud, Norway |
| ⓘ Gunningite Formula: ZnSO4 · H2O Description: Sample found by S.A. Berge and identified at the x-ray laboratory of Mineralogical Museum of Oslo in 1978. |
| ⓘ Gypsum Formula: CaSO4 · 2H2O |
| ⓘ Haitaite-(La) Formula: LaU4+Fe3+2(Ti13Fe2+4Fe3+)O38 Description: An U-rich chrichtonite group mineral from Åmot quarry is found to be similar in chemical composition to haitaite-(La). |
| ⓘ Helvine Formula: Be3Mn2+4(SiO4)3S Habit: tetrahedra up to 1 mm Colour: yellow; red |
| ⓘ Hematite Formula: Fe2O3 Localities: Reported from at least 12 localities in this region. |
| ⓘ Formula: Fe2O3 Locality: Dypingdal serpentine-magnesite deposit, Snarum, Modum, Buskerud, Norway - erroneously reported Description: The large hematite crystals from Dypingdal has been erronously reported as being martite a pesudomorphose after magngatite (some crystals are weakly magnetitc, and some have a pseudocubic habitus). However Raade (1982) showed thes to be normal hematites with a content of Titanium. References: |
| ⓘ Hemimorphite Formula: Zn4Si2O7(OH)2 · H2O |
| ✪ Heneuite (TL) Formula: CaMg5(CO3)(PO4)3(OH) Type Locality: Habit: nodular masses several cm across Colour: pale bluegreen Description: often surrounded by a rim of althausite which is surrounded by apatite References: |
| ⓘ Hexahydrite Formula: Mg(H2O)6(SO4) |
| ⓘ Holtedahlite (TL) Formula: Mg2(PO4)(OH) Type Locality: Habit: irregular patches ; masses Colour: colourless Description: glassy. |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ Hydromagnesite Formula: Mg5(CO3)4(OH)2 · 4H2O Localities: Description: Occure as white thin crusts on serpentine. |
| ⓘ Hydrotalcite (TL) Formula: Mg6Al2(CO3)(OH)16 · 4H2O Localities: Colour: white, blueish |
| ⓘ 'Hydrotalcite-2H' Formula: Mg6Al2(CO3)(OH)16 · 4H2O Localities: Description: The description give Snarum as locality, but it's presumably the Dypingdal locality - as for hydrotalcite. |
| ⓘ Hydroxylapatite Formula: Ca5(PO4)3(OH) |
| ⓘ Hydrozincite Formula: Zn5(CO3)2(OH)6 |
| ⓘ Ilmenite Formula: Fe2+TiO3 Localities: Description: as microscopic inclusions in hematite |
| ⓘ 'K Feldspar' |
| ⓘ Kornerupine Formula: Mg3Al6(Si,Al,B)5O21(OH) References: (n.d.) Knut Eldjarn collection.+ NHM, Oslo collection |
| ⓘ 'Kornerupine-Prismatine Series' Locality: Øvre Dypingdal Mine, Dypingdal serpentine-magnesite deposit, Snarum, Modum, Buskerud, Norway References: Grew, Edward S.; Pertsev, Nikolai N.; Vrána, Stanislav; Yates, Martin G.; Shearer, Charles K.; Wiedenbeck, Michael (1998) Kornerupine parageneses in whiteschists and other magnesian rocks: is kornerupine + talc a high-pressure assemblage equivalent to tourmaline + orthoamphibole? Contributions to Mineralogy and Petrology, 131 (1). 22-38 doi:10.1007/s004100050376 |
| ⓘ Ktenasite Formula: ZnCu4(SO4)2(OH)6 · 6H2O Habit: thin platy or laths up to 1 mm Colour: green Description: Nice micro crystals was discovered in 1972.
Often growing on clear gypsum crystals |
| ⓘ Kyanite Formula: Al2(SiO4)O Locality: Øvre Dypingdal Mine, Dypingdal serpentine-magnesite deposit, Snarum, Modum, Buskerud, Norway References: Grew, Edward S.; Pertsev, Nikolai N.; Vrána, Stanislav; Yates, Martin G.; Shearer, Charles K.; Wiedenbeck, Michael (1998) Kornerupine parageneses in whiteschists and other magnesian rocks: is kornerupine + talc a high-pressure assemblage equivalent to tourmaline + orthoamphibole? Contributions to Mineralogy and Petrology, 131 (1). 22-38 doi:10.1007/s004100050376 |
| ⓘ Lansfordite Formula: MgCO3 · 5H2O |
| ⓘ 'Leucoxene' Locality: Haugfoss, Modum, Buskerud, Norway |
| ⓘ 'Limonite' |
| ⓘ Linnaeite Formula: Co2+Co3+2S4 |
| ⓘ Lizardite Formula: Mg3(Si2O5)(OH)4 |
| ⓘ Löllingite Formula: FeAs2 Locality: Sætersbergåsen, Modum, Buskerud, Norway Habit: small lenses (2,0 x 0,5 cm) Description: Two specimens in the Naturhistoriska Riksmuseet in Stockholm, Sweden (Nos.L.K. 6981 and L.K. 6982) |
| ⓘ Mackinawite Formula: FeS |
| ⓘ Maghemite Formula: (Fe3+0.67◻0.33)Fe3+2O4 |
| ⓘ Magnesioferrite Formula: MgFe3+2O4 |
| ⓘ Magnesite Formula: MgCO3 Localities: Reported from at least 13 localities in this region. |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 Localities: Reported from at least 7 localities in this region. |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 |
| ⓘ Marcasite Formula: FeS2 |
| ⓘ Melanterite Formula: Fe2+(H2O)6(SO4) · H2O References: |
| ⓘ Mianningite ? Formula: (◻,Pb,Ce,Na)(U4+,Mn,U6+)Fe3+2 (Ti,Fe3+)18O38 |
| ⓘ 'Mica Group' |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ Millerite Formula: NiS |
| ⓘ Molybdenite Formula: MoS2 |
| ⓘ Monazite-(Ce) Formula: Ce(PO4) Localities: Description: Sverdrup et al. report monazite-(Ce) as accessory mineral in the ore-bands. Monazite-(Ce) have been found in a small pegmatite close to Skutterud mines, together with schörl in muscovite (P. Andresen, self collected). |
| ⓘ Monohydrocalcite Formula: CaCO3 · H2O |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 11 localities in this region. |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Namuwite ? Formula: Zn4(SO4)(OH)6 · 4H2O References: |
| ⓘ Native Bismuth Formula: Bi |
| ⓘ Native Copper Formula: Cu |
| ⓘ Native Gold Formula: Au References: |
| ⓘ Native Silver Formula: Ag References: |
| ⓘ Natrojarosite Formula: NaFe3(SO4)2(OH)6 Locality: Mælum, Modum, Buskerud, Norway Description: Scheerer (1838) describes a mineral as "Gelbeisenerz" occuring on schist, and determines a formula very close to the one of natrojarosite. Van der Wel made a new analysis of a yellow mineral labled Mælum, Modum - that might be the same as Scheerer described, and it turned out to be natrojarosite (Neumann (1985) References: |
| ⓘ Nesquehonite Formula: MgCO3 · 3H2O |
| ⓘ Pentlandite Formula: (NixFey)Σ9S8 |
| ⓘ Pentlandite var. Silver-bearing Pentlandite Formula: (Ni,Fe,Ag)9S8 |
| ⓘ Phlogopite Formula: KMg3(AlSi3O10)(OH)2 Localities: Såstad Mines, Modum West, Modum, Buskerud, Norway Ludvig Eugen adit, Mellomgruvene, Skuterud Mines, Modum West, Modum, Buskerud, Norway Skuterud Mines, Modum West, Modum, Buskerud, Norway Midtgruven, Mellomgruvene, Skuterud Mines, Modum West, Modum, Buskerud, Norway Øvre Dypingdal Mine, Dypingdal serpentine-magnesite deposit, Snarum, Modum, Buskerud, Norway |
| ⓘ Phosphoellenbergerite Formula: (Mg,◻)2Mg12(PO4,PO3OH)6(PO3OH,CO3)2(OH)6 |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ Posnjakite Formula: Cu4(SO4)(OH)6 · H2O |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 10 localities in this region. |
| ⓘ Pyroaurite ? Formula: Mg6Fe3+2(OH)16[CO3] · 4H2O Habit: hexagonal platy crystals Colour: white to pale brown Description: Described as a pyroaurite-like mineral. Identity uncertain |
| ⓘ Pyrope Formula: Mg3Al2(SiO4)3 |
| ⓘ 'Pyroxene Group' Formula: ADSi2O6 |
| ⓘ Pyrrhotite Formula: Fe1-xS Localities: Reported from at least 7 localities in this region. |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 18 localities in this region. |
| ⓘ Quintinite Formula: Mg4Al2(OH)12(CO3) · 3H2O |
| ⓘ Raadeite (TL) Formula: Mg7(PO4)2(OH)8 Type Locality: Habit: veinlets, a few tens of µm wide Colour: transparent and colourless Description: It occurs as veinlets, a few tens of µm wide, crosscutting althausite crystals; also as rare, up to 150 µm large anhedral inclusions in holtedahlite; and with apatite, althausite and magnesite in fibrous coronae replacing heneuite (Chopin et al. 2001)
The very low analytical total suggests H2O and/or CO2 are present. Valid unnamed minerasl list, update 2009-02 |
| ⓘ Rutile Formula: TiO2 Localities: Reported from at least 8 localities in this region. |
| ⓘ Safflorite Formula: (Co,Ni,Fe)As2 |
| ⓘ 'Scapolite' |
| ⓘ Scheelite Formula: Ca(WO4) |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Description: Analysis of a sample of black tourmaline by Kolitsch et al (2011) showed it to be a Mg-rich, Ca-bearing schorl |
| ⓘ Schulenbergite Formula: (Cu,Zn)7(SO4)2(OH)10 · 3H2O References: |
| ⓘ 'Serpentine Subgroup' Formula: D3[Si2O5](OH)4 Localities: Reported from at least 8 localities in this region. |
| ⓘ Serpierite Formula: Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| ⓘ Siegenite Formula: CoNi2S4 |
| ⓘ Sillimanite Formula: Al2(SiO4)O |
| ⓘ Skutterudite (TL) Formula: CoAs3 Type Locality: Habit: Typical: (111), (211), (110) and more rarely: (100), (310) and (332). Description: Breithaupt(1827)first named it as Tesseralkies but the properties was described under the heading Hartkobaltkies". Scheerer (1837) introduced the name Arsenik-Koboltkiis", Hausmann (1847)as "Hartkobalterze", Nicol (1849) it as "Modumite", and Haidinger described it as "skutterudite".
References: Breithaupt, Aug. (1827) Ueber eine neue Kies-Spezies von Skutterud. Annalen der Physik und Chemie, 85. 115-116 doi:10.1002/andp.18270850110as Tesseralkies and also Hartkobaltkies Scheerer, Th. (1837) Ueber zwei norwegische Kobalterze von den Skutteruder Gruben. Annalen der Physik und Chemie, 118. 546-555 doi:10.1002/andp.18371181205as Arsenikkobaltkies Wöhler, (1838) Ueber zwei neue Kobalt-Mineralien von Skutterud in Norwegen. Annalen der Physik und Chemie, 119. 591-592 doi:10.1002/andp.18381190317 Böbert, Karl F. (1848) Forsög til en geognostisk - mineralogisk Beskrivelse over Modums Koboltgruber, samt nogle almindelige Betraktninger over Fahlbaand [Attempt to a geognostic-mineralogical description of the Modum cobalt mines, and some common considerations on Fahlband]. Nyt magazin for naturvidenskaberne [New magazine for the natural sciences], 5. 1-32 p.8 Beutell, A. (1916) Mikroskopische Untersuchung des Speiskobalts und Chloanthits. Mit 20 Textfiguren . Centralblatt für Mineralogie, Geologie und Paläontologie, E. Schweizerbart. 180-185 Samdahl, Bjarne (1925) Analyse des Skutterudits [Analysis of Skutterudites]. Norsk Geologisk Tidsskrift [Norwegian Journal of Geology], 8 (1-2) 68-73 Rosenquist, Ivan Th. (1949) Noen observasjoner og refleksjoner omkring Modum koboltgruver (Nedl.) I. Fahlbåndene [Some observations and reflections on Modum cobalt mines (closed) I. The fahlbands]. Norsk Geologisk Tidsskrift [Norwegian Journal of Geology], 27 (3-4) 187-216 p.209 Roseboom, Eugene H. (1962) Skutterudites (Co, Ni, Fe)As3-x; composition and cell dimensions. American Mineralogist, 47 (3-4) 310-327 Neumann, Henrich (1985) Norges Mineraler [The Minerals of Norway]. Norges geologiske Undersøkelse Skrifter Vol. 68. Universitetsforlaget pp.43-44 Larsen, Knut Edvard (2022) Klassiske mineraler fra Snarum, Modum – et bidrag til norsk mineralogihistorie i første del av 1800-tallet [Classical minerals from Snarum, Modum. a contribution to the Norwegian mineralogical history of the first half of the 18th century.]. Norsk Mineralsymposium 2022, 29-45 |
| ⓘ Smithsonite Formula: ZnCO3 |
| ⓘ Sphalerite Formula: ZnS |
| ⓘ Spinel Formula: MgAl2O4 |
| ⓘ 'Stilbite Subgroup' Formula: M6-7[Al8-9Si27-28O72] · nH2O |
| ⓘ Szaibélyite Formula: MgBO2(OH) Localities: Tingelstadtjern Quarry, Modum, Buskerud, Norway Øvre Dypingdal Mine, Dypingdal serpentine-magnesite deposit, Snarum, Modum, Buskerud, Norway Nedre Dypingdal Mine, Dypingdal serpentine-magnesite deposit, Snarum, Modum, Buskerud, Norway Dypingdal serpentine-magnesite deposit, Snarum, Modum, Buskerud, Norway Description: At this locality szaibelyite occure in thin veins cutting althausite. |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 Localities: Reported from at least 9 localities in this region. |
| ⓘ 'Tennantite Subgroup' Formula: Cu6(Cu4C2+2)As4S12S |
| ⓘ Tinnunculite Formula: C5H4N4O3 · 2H2O |
| ⓘ Titanite Formula: CaTiO(SiO4) Localities: Reported from at least 6 localities in this region. |
| ⓘ Titanite var. Yttrium-bearing Titanite Formula: (Ca,Y)TiSiO5 |
| ⓘ Topaz Formula: Al2(SiO4)(F,OH)2 Locality: Sætersbergåsen, Modum, Buskerud, Norway References: Scheerer, Th. (1840) Ueber eine neues Vorkommen verschiedener Fossilien, welches mit dem zu Finbo in Schweden grosse Aehnlichkeit hat. Annalen der Physik und Chemie, 125. 533-538 doi:10.1002/andp.18401250312 |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z |
| ⓘ Uraninite Formula: UO2 |
| ⓘ Vesuvianite Formula: Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ Wollastonite Formula: Ca3(Si3O9) Locality: Hvalsknatten, Modum, Buskerud, Norway |
| ⓘ Wulfenite Formula: Pb(MoO4) Description: Microcrystals References: |
| ⓘ Xenotime-(Y) Formula: Y(PO4) Habit: euhedral crystals up to 1 mm Colour: brownish Description: embedded in althausite |
| ⓘ Zincite ? Formula: ZnO Description: Only observed by Goldschmidt in thinsection-slice of marble once as unregular grains in mm size.
The identificatiion is unconfirmed. |
| ⓘ Zircon Formula: Zr(SiO4) |
| ⓘ Zoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) Locality: Haugfoss, Modum, Buskerud, Norway |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Native Gold | 1.AA.05 | Au |
| ⓘ | Native Silver | 1.AA.05 | Ag |
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| ⓘ | Graphite | 1.CB.05a | C |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Pentlandite | 2.BB.15 | (NixFey)Σ9S8 |
| ⓘ | var. Silver-bearing Pentlandite | 2.BB.15 | (Ni,Fe,Ag)9S8 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Greenockite ? | 2.CB.45 | CdS |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Millerite | 2.CC.20 | NiS |
| ⓘ | Mackinawite | 2.CC.25 | FeS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Linnaeite | 2.DA.05 | Co2+Co3+2S4 |
| ⓘ | Siegenite | 2.DA.05 | CoNi2S4 |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Glaucodot | 2.EB.10c | (Co0.50Fe0.50)AsS |
| ⓘ | Löllingite | 2.EB.15a | FeAs2 |
| ⓘ | Safflorite | 2.EB.15a | (Co,Ni,Fe)As2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | var. Danaite | 2.EB.20 | (Fe0.90Co0.10)AsS - (Fe0.65Co0.35)AsS |
| ⓘ | Cobaltite | 2.EB.25 | CoAsS |
| ⓘ | Skutterudite (TL) | 2.EC.05 | CoAs3 |
| ⓘ | 'Tennantite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)As4S12S |
| ⓘ | Cosalite | 2.JB.10 | Pb2Bi2S5 |
| ⓘ | Galenobismutite | 2.JB.25e | PbBi2S4 |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Zincite ? | 4.AB.20 | ZnO |
| ⓘ | Magnesioferrite | 4.BB.05 | MgFe3+2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
| ⓘ | Maghemite | 4.BB.15 | (Fe3+0.67◻0.33)Fe3+2O4 |
| ⓘ | Corundum | 4.CB.05 | Al2O3 |
| ⓘ | Geikielite | 4.CB.05 | MgTiO3 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Hematite var. Martite ? | 4.CB.05 | Fe2O3 |
| ⓘ | Haitaite-(La) | 4.CC. | LaU4+Fe3+2(Ti13Fe2+4Fe3+)O38 |
| ⓘ | Mianningite ? | 4.CC.20 | (◻,Pb,Ce,Na)(U4+,Mn,U6+)Fe3+2 (Ti,Fe3+)18O38 |
| ⓘ | Davidite-(La) ? | 4.CC.40 | La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Cassiterite ? | 4.DB.05 | SnO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Brannerite | 4.DH.05 | UTi2O6 |
| ⓘ | Uraninite | 4.DL.05 | UO2 |
| ⓘ | Diaspore | 4.FD.10 | AlO(OH) |
| ⓘ | Brucite | 4.FE.05 | Mg(OH)2 |
| ⓘ | Gibbsite | 4.FE.10 | Al(OH)3 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Magnesite | 5.AB.05 | MgCO3 |
| ⓘ | Smithsonite | 5.AB.05 | ZnCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Hydrozincite | 5.BA.15 | Zn5(CO3)2(OH)6 |
| ⓘ | Bismutite | 5.BE.25 | (BiO)2CO3 |
| ⓘ | Brianyoungite | 5.BF.30 | Zn3(CO3,SO4)(OH)4 |
| ⓘ | Nesquehonite | 5.CA.05 | MgCO3 · 3H2O |
| ⓘ | Lansfordite | 5.CA.10 | MgCO3 · 5H2O |
| ⓘ | Monohydrocalcite | 5.CB.20 | CaCO3 · H2O |
| ⓘ | Dypingite (TL) | 5.DA.05 | Mg5(CO3)4(OH)2 · 5H2O |
| ⓘ | Hydromagnesite | 5.DA.05 | Mg5(CO3)4(OH)2 · 4H2O |
| ⓘ | Quintinite | 5.DA.40 | Mg4Al2(OH)12(CO3) · 3H2O |
| ⓘ | 'Hydrotalcite-2H' | 5.DA.45 | Mg6Al2(CO3)(OH)16 · 4H2O |
| ⓘ | Hydrotalcite (TL) | 5.DA.50 | Mg6Al2(CO3)(OH)16 · 4H2O |
| ⓘ | Pyroaurite ? | 5.DA.50 | Mg6Fe3+2(OH)16[CO3] · 4H2O |
| Group 6 - Borates | |||
| ⓘ | Szaibélyite | 6.BA.15 | MgBO2(OH) |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Natrojarosite | 7.BC.10 | NaFe3(SO4)2(OH)6 |
| ⓘ | Gunningite | 7.CB.05 | ZnSO4 · H2O |
| ⓘ | Chalcanthite | 7.CB.20 | CuSO4 · 5H2O |
| ⓘ | Bianchite | 7.CB.25 | Zn(H2O)6(SO4) |
| ⓘ | Hexahydrite | 7.CB.25 | Mg(H2O)6(SO4) |
| ⓘ | Melanterite | 7.CB.35 | Fe2+(H2O)6(SO4) · H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Posnjakite | 7.DD.10 | Cu4(SO4)(OH)6 · H2O |
| ⓘ | Ktenasite | 7.DD.20 | ZnCu4(SO4)2(OH)6 · 6H2O |
| ⓘ | Devilline | 7.DD.30 | CaCu4(SO4)2(OH)6 · 3H2O |
| ⓘ | Serpierite | 7.DD.30 | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| ⓘ | Namuwite ? | 7.DD.50 | Zn4(SO4)(OH)6 · 4H2O |
| ⓘ | Schulenbergite | 7.DD.80 | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Xenotime-(Y) | 8.AD.35 | Y(PO4) |
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| ⓘ | Cheralite ? | 8.AD.50 | CaTh(PO4)2 |
| ⓘ | Holtedahlite (TL) | 8.BB.20 | Mg2(PO4)(OH) |
| ⓘ | Althausite (TL) | 8.BB.25 | Mg4(PO4)2(OH,O)(F,◻) |
| ⓘ | Phosphoellenbergerite | 8.BB.55 | (Mg,◻)2Mg12(PO4,PO3OH)6(PO3OH,CO3)2(OH)6 |
| ⓘ | Raadeite (TL) | 8.BE.30 | Mg7(PO4)2(OH)8 |
| ⓘ | Chlorapatite | 8.BN.05 | Ca5(PO4)3Cl |
| ⓘ | Hydroxylapatite | 8.BN.05 | Ca5(PO4)3(OH) |
| ⓘ | Heneuite (TL) | 8.BO.25 | CaMg5(CO3)(PO4)3(OH) |
| ⓘ | Erythrite | 8.CE.40 | Co3(AsO4)2 · 8H2O |
| ⓘ | Collinsite | 8.CG.05 | Ca2Mg(PO4)2 · 2H2O |
| Group 9 - Silicates | |||
| ⓘ | Chrysotile | 9.00. | Mg3(Si2O5)(OH)4 |
| ⓘ | Forsterite | 9.AC.05 | Mg2(SiO4) |
| ⓘ | Grossular | 9.AD.25 | Ca3Al2(SiO4)3 |
| ⓘ | Pyrope | 9.AD.25 | Mg3Al2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Sillimanite | 9.AF.05 | Al2(SiO4)O |
| ⓘ | Kyanite | 9.AF.15 | Al2(SiO4)O |
| ⓘ | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | var. Yttrium-bearing Titanite | 9.AG.15 | (Ca,Y)TiSiO5 |
| ⓘ | Hemimorphite | 9.BD.10 | Zn4Si2O7(OH)2 · H2O |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Allanite-(Y) | 9.BG.05b | (CaY)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ | Zoisite | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Vesuvianite | 9.BG.35 | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ | Kornerupine | 9.BJ.50 | Mg3Al6(Si,Al,B)5O21(OH) |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Cordierite | 9.CJ.10 | Mg2Al4Si5O18 |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Enstatite | 9.DA.05 | Mg2Si2O6 |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Anthophyllite | 9.DD.05 | ◻Mg2Mg5(Si8O22)(OH)2 |
| ⓘ | Gedrite | 9.DD.05 | ◻Mg2(Mg3Al2)(Al2Si6O22)(OH)2 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Wollastonite | 9.DG.05 | Ca3(Si3O9) |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | var. Pennine | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | var. Leuchtenbergite | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Antigorite | 9.ED.15 | Mg3(Si2O5)(OH)4 |
| ⓘ | Lizardite | 9.ED.15 | Mg3(Si2O5)(OH)4 |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Oligoclase-Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Oligoclase | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ | Helvine | 9.FB.10 | Be3Mn2+4(SiO4)3S |
| ⓘ | Chabazite-Ca | 9.GD.10 | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Group 10 - Organic Compounds | |||
| ⓘ | Tinnunculite | 10.CA.65 | C5H4N4O3 · 2H2O |
| Unclassified | |||
| ⓘ | 'Amphibole Supergroup' | - | AB2C5(T8O22)W2 |
| ⓘ | 'Biotite var. Anomite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | '' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chabazite' | - | |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Davidite' ? | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Calcium Amphibole Subgroup var. Hornblende' ? | - | AnCa2(Z2+5-mZ3+m)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Stilbite Subgroup' | - | M6-7[Al8-9Si27-28O72] · nH2O |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Leucoxene' | - | |
| ⓘ | 'Mica Group' | - | |
| ⓘ | 'Clinopyroxene Subgroup' | - | |
| ⓘ | 'Andradite-Grossular Series' | - | |
| ⓘ | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
| ⓘ | 'Scapolite' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Serpentine Subgroup' | - | D3[Si2O5](OH)4 |
| ⓘ | 'Glockerite' | - | Fe3+4(SO4)(OH)10 · 1-3H2O ? |
| ⓘ | 'Crichtonite Group' | - | AD21O38 or A{DE2G6Ti12}O38 |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
| ⓘ | 'Calcium Amphibole Subgroup' | - | AnCa2(C2+5-mC3+m)(Si8-(n+m)Al(n+m))W2 |
| ⓘ | 'Kornerupine-Prismatine Series' | - | |
| ⓘ | 'Coal blend' | - | |
| ⓘ | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Allanite-(Y) | (CaY)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| H | ⓘ Althausite | Mg4(PO4)2(OH,O)(F,◻) |
| H | ⓘ Biotite var. Anomite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Anthophyllite | ◻Mg2Mg5(Si8O22)(OH)2 |
| H | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Bianchite | Zn(H2O)6(SO4) |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Brucite | Mg(OH)2 |
| H | ⓘ Chalcanthite | CuSO4 · 5H2O |
| H | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Collinsite | Ca2Mg(PO4)2 · 2H2O |
| H | ⓘ Davidite-(La) | La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| H | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| H | ⓘ Diaspore | AlO(OH) |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Dypingite | Mg5(CO3)4(OH)2 · 5H2O |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| H | ⓘ Gedrite | ◻Mg2(Mg3Al2)(Al2Si6O22)(OH)2 |
| H | ⓘ Gibbsite | Al(OH)3 |
| H | ⓘ Gunningite | ZnSO4 · H2O |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| H | ⓘ Heneuite | CaMg5(CO3)(PO4)3(OH) |
| H | ⓘ Hexahydrite | Mg(H2O)6(SO4) |
| H | ⓘ Holtedahlite | Mg2(PO4)(OH) |
| H | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| H | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| H | ⓘ Hydrotalcite | Mg6Al2(CO3)(OH)16 · 4H2O |
| H | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| H | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| H | ⓘ Kornerupine | Mg3Al6(Si,Al,B)5O21(OH) |
| H | ⓘ Ktenasite | ZnCu4(SO4)2(OH)6 · 6H2O |
| H | ⓘ Lansfordite | MgCO3 · 5H2O |
| H | ⓘ Lizardite | Mg3(Si2O5)(OH)4 |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Hydrotalcite-2H | Mg6Al2(CO3)(OH)16 · 4H2O |
| H | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| H | ⓘ Monohydrocalcite | CaCO3 · H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Namuwite | Zn4(SO4)(OH)6 · 4H2O |
| H | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| H | ⓘ Nesquehonite | MgCO3 · 3H2O |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| H | ⓘ Pyroaurite | Mg6Fe23+(OH)16[CO3] · 4H2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| H | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| H | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| H | ⓘ Szaibélyite | MgBO2(OH) |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| H | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| H | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| H | ⓘ Raadeite | Mg7(PO4)2(OH)8 |
| H | ⓘ Phosphoellenbergerite | (Mg,◻)2Mg12(PO4,PO3OH)6(PO3OH,CO3)2(OH)6 |
| H | ⓘ Quintinite | Mg4Al2(OH)12(CO3) · 3H2O |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Clinochlore var. Leuchtenbergite | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| H | ⓘ Glockerite | Fe43+(SO4)(OH)10 · 1-3H2O ? |
| H | ⓘ Kornerupine-Prismatine Series | |
| H | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| H | ⓘ Tinnunculite | C5H4N4O3 · 2H2O |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| B | Boron | |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Kornerupine | Mg3Al6(Si,Al,B)5O21(OH) |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Szaibélyite | MgBO2(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| B | ⓘ Kornerupine-Prismatine Series | |
| C | Carbon | |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Bismutite | (BiO)2CO3 |
| C | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Dypingite | Mg5(CO3)4(OH)2 · 5H2O |
| C | ⓘ Graphite | C |
| C | ⓘ Heneuite | CaMg5(CO3)(PO4)3(OH) |
| C | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| C | ⓘ Hydrotalcite | Mg6Al2(CO3)(OH)16 · 4H2O |
| C | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| C | ⓘ Lansfordite | MgCO3 · 5H2O |
| C | ⓘ Magnesite | MgCO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Hydrotalcite-2H | Mg6Al2(CO3)(OH)16 · 4H2O |
| C | ⓘ Monohydrocalcite | CaCO3 · H2O |
| C | ⓘ Nesquehonite | MgCO3 · 3H2O |
| C | ⓘ Pyroaurite | Mg6Fe23+(OH)16[CO3] · 4H2O |
| C | ⓘ Smithsonite | ZnCO3 |
| C | ⓘ Phosphoellenbergerite | (Mg,◻)2Mg12(PO4,PO3OH)6(PO3OH,CO3)2(OH)6 |
| C | ⓘ Quintinite | Mg4Al2(OH)12(CO3) · 3H2O |
| C | ⓘ Tinnunculite | C5H4N4O3 · 2H2O |
| N | Nitrogen | |
| N | ⓘ Tinnunculite | C5H4N4O3 · 2H2O |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Allanite-(Y) | (CaY)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| O | ⓘ Althausite | Mg4(PO4)2(OH,O)(F,◻) |
| O | ⓘ Amphibole Supergroup | AB2C5(T8O22)W2 |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Biotite var. Anomite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Anthophyllite | ◻Mg2Mg5(Si8O22)(OH)2 |
| O | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Bianchite | Zn(H2O)6(SO4) |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Bismutite | (BiO)2CO3 |
| O | ⓘ Brannerite | UTi2O6 |
| O | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Brucite | Mg(OH)2 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Chalcanthite | CuSO4 · 5H2O |
| O | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| O | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Collinsite | Ca2Mg(PO4)2 · 2H2O |
| O | ⓘ Cordierite | Mg2Al4Si5O18 |
| O | ⓘ Corundum | Al2O3 |
| O | ⓘ Davidite-(La) | La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| O | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| O | ⓘ Diaspore | AlO(OH) |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Dypingite | Mg5(CO3)4(OH)2 · 5H2O |
| O | ⓘ Enstatite | Mg2Si2O6 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| O | ⓘ Forsterite | Mg2(SiO4) |
| O | ⓘ Gedrite | ◻Mg2(Mg3Al2)(Al2Si6O22)(OH)2 |
| O | ⓘ Geikielite | MgTiO3 |
| O | ⓘ Gibbsite | Al(OH)3 |
| O | ⓘ Grossular | Ca3Al2(SiO4)3 |
| O | ⓘ Gunningite | ZnSO4 · H2O |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| O | ⓘ Heneuite | CaMg5(CO3)(PO4)3(OH) |
| O | ⓘ Hexahydrite | Mg(H2O)6(SO4) |
| O | ⓘ Holtedahlite | Mg2(PO4)(OH) |
| O | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| O | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| O | ⓘ Hydrotalcite | Mg6Al2(CO3)(OH)16 · 4H2O |
| O | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| O | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Kornerupine | Mg3Al6(Si,Al,B)5O21(OH) |
| O | ⓘ Ktenasite | ZnCu4(SO4)2(OH)6 · 6H2O |
| O | ⓘ Kyanite | Al2(SiO4)O |
| O | ⓘ Lansfordite | MgCO3 · 5H2O |
| O | ⓘ Lizardite | Mg3(Si2O5)(OH)4 |
| O | ⓘ Magnesite | MgCO3 |
| O | ⓘ Magnesioferrite | MgFe23+O4 |
| O | ⓘ Maghemite | (Fe3+0.67◻0.33)Fe23+O4 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Hydrotalcite-2H | Mg6Al2(CO3)(OH)16 · 4H2O |
| O | ⓘ Hematite var. Martite | Fe2O3 |
| O | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Monohydrocalcite | CaCO3 · H2O |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Namuwite | Zn4(SO4)(OH)6 · 4H2O |
| O | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| O | ⓘ Nesquehonite | MgCO3 · 3H2O |
| O | ⓘ Albite var. Oligoclase-Albite | Na(AlSi3O8) |
| O | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| O | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| O | ⓘ Pyroaurite | Mg6Fe23+(OH)16[CO3] · 4H2O |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| O | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| O | ⓘ Sillimanite | Al2(SiO4)O |
| O | ⓘ Smithsonite | ZnCO3 |
| O | ⓘ Spinel | MgAl2O4 |
| O | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| O | ⓘ Szaibélyite | MgBO2(OH) |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Wollastonite | Ca3(Si3O9) |
| O | ⓘ Xenotime-(Y) | Y(PO4) |
| O | ⓘ Zincite | ZnO |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| O | ⓘ Cheralite | CaTh(PO4)2 |
| O | ⓘ Raadeite | Mg7(PO4)2(OH)8 |
| O | ⓘ Phosphoellenbergerite | (Mg,◻)2Mg12(PO4,PO3OH)6(PO3OH,CO3)2(OH)6 |
| O | ⓘ Quintinite | Mg4Al2(OH)12(CO3) · 3H2O |
| O | ⓘ Titanite var. Yttrium-bearing Titanite | (Ca,Y)TiSiO5 |
| O | ⓘ Andradite-Grossular Series | |
| O | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Pyroxene Group | ADSi2O6 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Clinochlore var. Leuchtenbergite | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| O | ⓘ Glockerite | Fe43+(SO4)(OH)10 · 1-3H2O ? |
| O | ⓘ Crichtonite Group | AD21O38 or A{DE2G6Ti12}O38 |
| O | ⓘ Apatite | Ca5(PO4)3A |
| O | ⓘ Kornerupine-Prismatine Series | |
| O | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| O | ⓘ Mianningite | (◻,Pb,Ce,Na)(U4+,Mn,U6+)Fe23+ (Ti,Fe3+)18O38 |
| O | ⓘ Tinnunculite | C5H4N4O3 · 2H2O |
| O | ⓘ Haitaite-(La) | LaU4+Fe23+(Ti13Fe42+Fe3+)O38 |
| F | Fluorine | |
| F | ⓘ Althausite | Mg4(PO4)2(OH,O)(F,◻) |
| F | ⓘ Biotite var. Anomite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Davidite-(La) | La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| F | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| F | ⓘ Kornerupine-Prismatine Series | |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| Na | ⓘ Albite var. Oligoclase-Albite | Na(AlSi3O8) |
| Na | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Na | ⓘ Mianningite | (◻,Pb,Ce,Na)(U4+,Mn,U6+)Fe23+ (Ti,Fe3+)18O38 |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Althausite | Mg4(PO4)2(OH,O)(F,◻) |
| Mg | ⓘ Biotite var. Anomite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Anthophyllite | ◻Mg2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Brucite | Mg(OH)2 |
| Mg | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Collinsite | Ca2Mg(PO4)2 · 2H2O |
| Mg | ⓘ Cordierite | Mg2Al4Si5O18 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Dypingite | Mg5(CO3)4(OH)2 · 5H2O |
| Mg | ⓘ Enstatite | Mg2Si2O6 |
| Mg | ⓘ Forsterite | Mg2(SiO4) |
| Mg | ⓘ Gedrite | ◻Mg2(Mg3Al2)(Al2Si6O22)(OH)2 |
| Mg | ⓘ Geikielite | MgTiO3 |
| Mg | ⓘ Heneuite | CaMg5(CO3)(PO4)3(OH) |
| Mg | ⓘ Hexahydrite | Mg(H2O)6(SO4) |
| Mg | ⓘ Holtedahlite | Mg2(PO4)(OH) |
| Mg | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| Mg | ⓘ Hydrotalcite | Mg6Al2(CO3)(OH)16 · 4H2O |
| Mg | ⓘ Kornerupine | Mg3Al6(Si,Al,B)5O21(OH) |
| Mg | ⓘ Lansfordite | MgCO3 · 5H2O |
| Mg | ⓘ Lizardite | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Magnesite | MgCO3 |
| Mg | ⓘ Magnesioferrite | MgFe23+O4 |
| Mg | ⓘ Hydrotalcite-2H | Mg6Al2(CO3)(OH)16 · 4H2O |
| Mg | ⓘ Nesquehonite | MgCO3 · 3H2O |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| Mg | ⓘ Pyroaurite | Mg6Fe23+(OH)16[CO3] · 4H2O |
| Mg | ⓘ Spinel | MgAl2O4 |
| Mg | ⓘ Szaibélyite | MgBO2(OH) |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Mg | ⓘ Raadeite | Mg7(PO4)2(OH)8 |
| Mg | ⓘ Phosphoellenbergerite | (Mg,◻)2Mg12(PO4,PO3OH)6(PO3OH,CO3)2(OH)6 |
| Mg | ⓘ Quintinite | Mg4Al2(OH)12(CO3) · 3H2O |
| Mg | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Clinochlore var. Leuchtenbergite | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Kornerupine-Prismatine Series | |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Allanite-(Y) | (CaY)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Biotite var. Anomite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Cordierite | Mg2Al4Si5O18 |
| Al | ⓘ Corundum | Al2O3 |
| Al | ⓘ Diaspore | AlO(OH) |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Gedrite | ◻Mg2(Mg3Al2)(Al2Si6O22)(OH)2 |
| Al | ⓘ Gibbsite | Al(OH)3 |
| Al | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Al | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| Al | ⓘ Hydrotalcite | Mg6Al2(CO3)(OH)16 · 4H2O |
| Al | ⓘ Kornerupine | Mg3Al6(Si,Al,B)5O21(OH) |
| Al | ⓘ Kyanite | Al2(SiO4)O |
| Al | ⓘ Hydrotalcite-2H | Mg6Al2(CO3)(OH)16 · 4H2O |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Albite var. Oligoclase-Albite | Na(AlSi3O8) |
| Al | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Sillimanite | Al2(SiO4)O |
| Al | ⓘ Spinel | MgAl2O4 |
| Al | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Al | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Al | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Al | ⓘ Quintinite | Mg4Al2(OH)12(CO3) · 3H2O |
| Al | ⓘ Andradite-Grossular Series | |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Al | ⓘ Clinochlore var. Leuchtenbergite | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Calcium Amphibole Subgroup | AnCa2(C2+5-mCm3+)(Si8-(n+m)Al(n+m))W2 |
| Al | ⓘ Kornerupine-Prismatine Series | |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Allanite-(Y) | (CaY)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Biotite var. Anomite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Anthophyllite | ◻Mg2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Cordierite | Mg2Al4Si5O18 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Enstatite | Mg2Si2O6 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Forsterite | Mg2(SiO4) |
| Si | ⓘ Gedrite | ◻Mg2(Mg3Al2)(Al2Si6O22)(OH)2 |
| Si | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Si | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| Si | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Si | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| Si | ⓘ Kornerupine | Mg3Al6(Si,Al,B)5O21(OH) |
| Si | ⓘ Kyanite | Al2(SiO4)O |
| Si | ⓘ Lizardite | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Albite var. Oligoclase-Albite | Na(AlSi3O8) |
| Si | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Sillimanite | Al2(SiO4)O |
| Si | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| Si | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Si | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Si | ⓘ Wollastonite | Ca3(Si3O9) |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Si | ⓘ Titanite var. Yttrium-bearing Titanite | (Ca,Y)TiSiO5 |
| Si | ⓘ Andradite-Grossular Series | |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Pyroxene Group | ADSi2O6 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Clinochlore var. Leuchtenbergite | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| Si | ⓘ Calcium Amphibole Subgroup | AnCa2(C2+5-mCm3+)(Si8-(n+m)Al(n+m))W2 |
| Si | ⓘ Kornerupine-Prismatine Series | |
| Si | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| P | Phosphorus | |
| P | ⓘ Althausite | Mg4(PO4)2(OH,O)(F,◻) |
| P | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| P | ⓘ Collinsite | Ca2Mg(PO4)2 · 2H2O |
| P | ⓘ Heneuite | CaMg5(CO3)(PO4)3(OH) |
| P | ⓘ Holtedahlite | Mg2(PO4)(OH) |
| P | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| P | ⓘ Xenotime-(Y) | Y(PO4) |
| P | ⓘ Cheralite | CaTh(PO4)2 |
| P | ⓘ Raadeite | Mg7(PO4)2(OH)8 |
| P | ⓘ Phosphoellenbergerite | (Mg,◻)2Mg12(PO4,PO3OH)6(PO3OH,CO3)2(OH)6 |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Bianchite | Zn(H2O)6(SO4) |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcanthite | CuSO4 · 5H2O |
| S | ⓘ Cobaltite | CoAsS |
| S | ⓘ Cosalite | Pb2Bi2S5 |
| S | ⓘ Covellite | CuS |
| S | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| S | ⓘ Galena | PbS |
| S | ⓘ Galenobismutite | PbBi2S4 |
| S | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| S | ⓘ Greenockite | CdS |
| S | ⓘ Gunningite | ZnSO4 · H2O |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| S | ⓘ Hexahydrite | Mg(H2O)6(SO4) |
| S | ⓘ Ktenasite | ZnCu4(SO4)2(OH)6 · 6H2O |
| S | ⓘ Linnaeite | Co2+Co23+S4 |
| S | ⓘ Mackinawite | FeS |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| S | ⓘ Millerite | NiS |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Namuwite | Zn4(SO4)(OH)6 · 4H2O |
| S | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| S | ⓘ Pentlandite | (NixFey)Σ9S8 |
| S | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| S | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| S | ⓘ Siegenite | CoNi2S4 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| S | ⓘ Pentlandite var. Silver-bearing Pentlandite | (Ni,Fe,Ag)9S8 |
| S | ⓘ Arsenopyrite var. Danaite | (Fe0.90Co0.10)AsS - (Fe0.65Co0.35)AsS |
| S | ⓘ Glockerite | Fe43+(SO4)(OH)10 · 1-3H2O ? |
| Cl | Chlorine | |
| Cl | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| Cl | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| K | Potassium | |
| K | ⓘ Biotite var. Anomite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| K | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Allanite-(Y) | (CaY)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| Ca | ⓘ Collinsite | Ca2Mg(PO4)2 · 2H2O |
| Ca | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Heneuite | CaMg5(CO3)(PO4)3(OH) |
| Ca | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| Ca | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| Ca | ⓘ Monohydrocalcite | CaCO3 · H2O |
| Ca | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ca | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Ca | ⓘ Wollastonite | Ca3(Si3O9) |
| Ca | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Ca | ⓘ Cheralite | CaTh(PO4)2 |
| Ca | ⓘ Titanite var. Yttrium-bearing Titanite | (Ca,Y)TiSiO5 |
| Ca | ⓘ Andradite-Grossular Series | |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ca | ⓘ Calcium Amphibole Subgroup | AnCa2(C2+5-mCm3+)(Si8-(n+m)Al(n+m))W2 |
| Ti | Titanium | |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Biotite var. Anomite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Brannerite | UTi2O6 |
| Ti | ⓘ Davidite-(La) | La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| Ti | ⓘ Geikielite | MgTiO3 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| Ti | ⓘ Titanite var. Yttrium-bearing Titanite | (Ca,Y)TiSiO5 |
| Ti | ⓘ Crichtonite Group | AD21O38 or A{DE2G6Ti12}O38 |
| Ti | ⓘ Mianningite | (◻,Pb,Ce,Na)(U4+,Mn,U6+)Fe23+ (Ti,Fe3+)18O38 |
| Ti | ⓘ Haitaite-(La) | LaU4+Fe23+(Ti13Fe42+Fe3+)O38 |
| V | Vanadium | |
| V | ⓘ Davidite-(La) | La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| Cr | Chromium | |
| Cr | ⓘ Davidite-(La) | La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| Mn | Manganese | |
| Mn | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| Mn | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Mn | ⓘ Mianningite | (◻,Pb,Ce,Na)(U4+,Mn,U6+)Fe23+ (Ti,Fe3+)18O38 |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Allanite-(Y) | (CaY)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Biotite var. Anomite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Davidite-(La) | La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Löllingite | FeAs2 |
| Fe | ⓘ Magnesioferrite | MgFe23+O4 |
| Fe | ⓘ Mackinawite | FeS |
| Fe | ⓘ Maghemite | (Fe3+0.67◻0.33)Fe23+O4 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Hematite var. Martite | Fe2O3 |
| Fe | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| Fe | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| Fe | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Pyroaurite | Mg6Fe23+(OH)16[CO3] · 4H2O |
| Fe | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Fe | ⓘ Andradite-Grossular Series | |
| Fe | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Fe | ⓘ Pentlandite var. Silver-bearing Pentlandite | (Ni,Fe,Ag)9S8 |
| Fe | ⓘ Arsenopyrite var. Danaite | (Fe0.90Co0.10)AsS - (Fe0.65Co0.35)AsS |
| Fe | ⓘ Glockerite | Fe43+(SO4)(OH)10 · 1-3H2O ? |
| Fe | ⓘ Kornerupine-Prismatine Series | |
| Fe | ⓘ Mianningite | (◻,Pb,Ce,Na)(U4+,Mn,U6+)Fe23+ (Ti,Fe3+)18O38 |
| Fe | ⓘ Haitaite-(La) | LaU4+Fe23+(Ti13Fe42+Fe3+)O38 |
| Co | Cobalt | |
| Co | ⓘ Cobaltite | CoAsS |
| Co | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| Co | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| Co | ⓘ Linnaeite | Co2+Co23+S4 |
| Co | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Co | ⓘ Siegenite | CoNi2S4 |
| Co | ⓘ Skutterudite | CoAs3 |
| Co | ⓘ Arsenopyrite var. Danaite | (Fe0.90Co0.10)AsS - (Fe0.65Co0.35)AsS |
| Ni | Nickel | |
| Ni | ⓘ Millerite | NiS |
| Ni | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Ni | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Ni | ⓘ Siegenite | CoNi2S4 |
| Ni | ⓘ Pentlandite var. Silver-bearing Pentlandite | (Ni,Fe,Ag)9S8 |
| Cu | Copper | |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcanthite | CuSO4 · 5H2O |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Cu | ⓘ Ktenasite | ZnCu4(SO4)2(OH)6 · 6H2O |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| Cu | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| Cu | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| Cu | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Zn | Zinc | |
| Zn | ⓘ Bianchite | Zn(H2O)6(SO4) |
| Zn | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| Zn | ⓘ Gunningite | ZnSO4 · H2O |
| Zn | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Zn | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| Zn | ⓘ Ktenasite | ZnCu4(SO4)2(OH)6 · 6H2O |
| Zn | ⓘ Namuwite | Zn4(SO4)(OH)6 · 4H2O |
| Zn | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| Zn | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| Zn | ⓘ Smithsonite | ZnCO3 |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Zincite | ZnO |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Cobaltite | CoAsS |
| As | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| As | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| As | ⓘ Löllingite | FeAs2 |
| As | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| As | ⓘ Skutterudite | CoAs3 |
| As | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| As | ⓘ Arsenopyrite var. Danaite | (Fe0.90Co0.10)AsS - (Fe0.65Co0.35)AsS |
| Y | Yttrium | |
| Y | ⓘ Allanite-(Y) | (CaY)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Y | ⓘ Davidite-(La) | La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| Y | ⓘ Xenotime-(Y) | Y(PO4) |
| Y | ⓘ Titanite var. Yttrium-bearing Titanite | (Ca,Y)TiSiO5 |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Ag | Silver | |
| Ag | ⓘ Native Silver | Ag |
| Ag | ⓘ Pentlandite var. Silver-bearing Pentlandite | (Ni,Fe,Ag)9S8 |
| Cd | Cadmium | |
| Cd | ⓘ Greenockite | CdS |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| La | Lanthanum | |
| La | ⓘ Davidite-(La) | La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| La | ⓘ Haitaite-(La) | LaU4+Fe23+(Ti13Fe42+Fe3+)O38 |
| Ce | Cerium | |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| Ce | ⓘ Mianningite | (◻,Pb,Ce,Na)(U4+,Mn,U6+)Fe23+ (Ti,Fe3+)18O38 |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Cosalite | Pb2Bi2S5 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Galenobismutite | PbBi2S4 |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| Pb | ⓘ Mianningite | (◻,Pb,Ce,Na)(U4+,Mn,U6+)Fe23+ (Ti,Fe3+)18O38 |
| Bi | Bismuth | |
| Bi | ⓘ Native Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Bismutite | (BiO)2CO3 |
| Bi | ⓘ Cosalite | Pb2Bi2S5 |
| Bi | ⓘ Galenobismutite | PbBi2S4 |
| Th | Thorium | |
| Th | ⓘ Cheralite | CaTh(PO4)2 |
| U | Uranium | |
| U | ⓘ Brannerite | UTi2O6 |
| U | ⓘ Davidite-(La) | La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| U | ⓘ Uraninite | UO2 |
| U | ⓘ Mianningite | (◻,Pb,Ce,Na)(U4+,Mn,U6+)Fe23+ (Ti,Fe3+)18O38 |
| U | ⓘ Haitaite-(La) | LaU4+Fe23+(Ti13Fe42+Fe3+)O38 |
Geochronology
Mineralization age: Mesoproterozoic : 1463 Ma to 1080 MaImportant note: This table is based only on rock and mineral ages recorded on mindat.org for this locality and is not necessarily a complete representation of the geochronology, but does give an indication of possible mineralization events relevant to this locality. As more age information is added this table may expand in the future. A break in the table simply indicates a lack of data entered here, not necessarily a break in the geologic sequence. Grey background entries are from different, related, localities.
| Geologic Time | Rocks, Minerals and Events | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Precambrian | |||||||||||||
| Proterozoic | |||||||||||||
| Mesoproterozoic | |||||||||||||
| Stenian |
| ||||||||||||
| Calymmian |
| ||||||||||||
Fossils
There are 66 fossil localities from the PaleoBioDB database within this region.These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 66 |
|---|---|
| Youngest Fossil Listed | 443 Ma (Silurian) |
| Oldest Fossil Listed | 541 Ma (Cambrian) |
| Stratigraphic Units | Click here to view 6 stratigraphic units. |
| Fossils from Region | Click here to show the list. |
| Fossil Localities | Click to show 8 fossil localities |
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Modum |
|---|---|
| Wikidata ID: | Q484001 |
| GeoNames ID: | 3145690 |
Localities in this Region
- Buskerud
- Modum
- Modum West
- Skuterud Mines
- Svartfjell Mines
- ⭔Overntjern
- Rødkollåsen
- Sæterås
- Sætersbergåsen
- Sibelco Nordic Spone Sand Pit
- Simostranda
- ⭔Snarum
- Sønsteby
- Stulldammen
- Svarthull
- Tarmen
- Tingelstadtjern Quarry
- Modum West
- Modum
Other Regions, Features and Areas that Intersect
Eurasian PlateTectonic Plate
- Baltic Shield
- Sveconorwegian BeltShield
EuropeContinent
Norway
- Oslo Volcanic ProvinceVolcanic Province
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Quick NavTopCommoditiesMineral ListRock TypesGeochronologyFossilsOther DatabasesLocalities in RegionOther RegionsReferences
Modum, Buskerud, Norway