Log In
This page is currently not sponsored. Click here to sponsor this page.
Get Involved with mindat.org
Mindat.org has grown through countless contributions from mineral enthusiasts, collectors, researchers and experts around the world — people just like you.
Want to take part?
1
2
3
4
Contribute
Add photos, locality information and knowledge
Every contribution helps make mindat.org better for everyone.
Area:
14,908 km2
Type:
County - last checked 2024
Museums in region:
Other Languages:
French:
Buskerud, Norvège
German:
Buskerud, Norwegen
Italian:
Buskerud, Norvegia
Norwegian:
Buskerud, Norge
Russian:
Бускеруд, Норвегия
Simplified Chinese:
布斯克吕郡, 挪威
Spanish:
Buskerud, Noruega
Afrikaans:
Buskerud, Noorweë
Albanian:
Buskerud, Norvegjia
Arabic:
بوسكرود, النرويج
Armenian:
Բուսկերուդ, Նորվեգիա
Asturian:
Buskerud, Noruega
Azeri:
Buskerud, Norveç
Basque:
Buskerud, Norvegia
Bavarian:
Buskerud, Norwegn
Belarusian:
Бускеруд, Нарвегія
Belarusian (Tarashkevitsa):
Бускеруд, Нарвэгія
Bengali:
বুস্কেরুদ, নরওয়ে
Bishnupriya Manipuri:
বাসকেরুড, নরৱে
Bosnian:
Buskerud, Norveška
Breton:
Buskerud, Norvegia
Bulgarian:
Бюскерю, Норвегия
Catalan:
Buskerud, Noruega
Cebuano:
Buskerud fylke, Norway
Cornish:
Buskerud, Norgagh
Croatian:
Buskerud, Norveška
Czech:
Buskerud, Norsko
Danish:
Buskerud, Norge
Dutch:
Buskerud, Noorwegen
Esperanto:
Buskerud, Norvegio
Estonian:
Buskerud, Norra
Farsi/Persian:
بوسکرود, نروژ
Finnish:
Buskerudin lääni, Norja
Georgian:
ბუსკერუდი, ნორვეგია
Greek:
Μπούσκερουντ, Νορβηγία
Gujarati:
બુસકેરુડ, નોર્વે
Hebrew:
בוסקרוד, נורבגיה
Hindi:
बस्केरूद, नॉर्वे
Hungarian:
Buskerud megye, Norvégia
Icelandic:
Buskerud, Noregur
Indonesian:
Buskerud, Norwegia
Japanese:
ブスケルー県, ノルウェー
Kannada:
ಬಸ್ಕ್ರೋಡ್, ಕಾಮೌ
Korean:
부스케루주, 노르웨이
Latin:
Buskerud, Norvegia
Latvian:
Buskeruda, Norvēģija
Limburgian:
Buskerud, Noorwege
Lithuanian:
Biuskeriudas, Norvegija
Low Saxon/Low German:
Amt Buskerud, Norwegen
Macedonian:
Бускеруд, Норвешка
Malay:
Buskerud, Norway
Marathi:
बस्केरुड, नॉर्वे
Minnan / Hokkien-Taiwanese:
Buskerud, Lo̍k-ui
Nauruan:
Buskerud, Norwei
Northern Sami:
Buskeruda fylka, Norga
Norwegian (Nynorsk):
Buskerud fylke, Noreg
Occitan:
Buskerud, Norvègia
Ossetian:
Бускеруд, Норвеги
Polish:
Buskerud, Norwegia
Portuguese:
Buskerud, Noruega
Romanian:
Buskerud, Norvegia
Samogitian:
Bioskeriuds, Nuorvegėjė
Scots:
Buskerud, Norawa
Serbian:
Бускеруд, Норвешка
Serbo-Croatian:
Buskerud, Norveška
Sinhalese:
බස්කෙරුඩ්, නෝර්වේ
Slovak:
Buskerud, Nórsko
Slovenian:
Buskerud, Norveška
South Azerbaijani:
بوسکرود, نوروژ
Swahili:
Buskerud, Norwei
Swedish:
Buskerud fylke, Norge
Tamil:
புஸ்கிருத், நோர்வே
Telugu:
బుస్కెరుడ్, నార్వే
Thai:
เทศมณฑลบุสเครุด, นอร์เวย์
Turkish:
Buskerud, Norveç
Ukrainian:
Бускерюд, Норвегія
Urdu:
بوسکرود, ناروے
Vietnamese:
Buskerud, Na Uy
Waray:
Buskerud, Noruega
West Frisian:
Buskerud, Noarwegen
Western Punjabi:
بسکرڈ, ناروے
Buskerud is a traditional region, a county, and a current electoral district in Norway, bordering Akershus, Oslo, Vestland, Innlandet, Telemark, and Vestfold. The region extends from the Oslofjord and Drammensfjorden in the southeast to the Hardangervidda mountain range in the northwest. The county administration is located in Drammen. Buskerud was merged with Akershus and Østfold into the newly created Viken County on 1 January 2020. On 1 January 2024, Viken was disestablished and the counties of Akershus, Buskerud and Østfold were re-established.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities332 valid minerals. 13 (TL) - type locality of valid minerals. 1 (FRL) - first recorded locality of unapproved mineral/variety/etc. 5 erroneous literature entries.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Acanthite Formula: Ag2S Localities: Reported from at least 15 localities in this region. |
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 Localities: Reported from at least 10 localities in this region. |
| ⓘ 'Actinolite-Tremolite Series' |
| ⓘ ' Locality: Gjellebekk marble quarry, Gjellebekk, Lier, Buskerud, Norway - erroneously reported |
| ⓘ Aegirine (TL) Formula: NaFe3+Si2O6 Localities: Reported from at least 8 localities in this region. Type Locality: Rundemyr, Øvre Eiker, Buskerud, Norway Habit: pinacoids {100} and {010}, prism {110} Description: Tapering brown prisms in pegmatite with a green centre |
| ⓘ Aenigmatite Formula: Na4[Fe2+10Ti2]O4[Si12O36] |
| ⓘ Aeschynite-(Y) ? Formula: Y(TiNb)O6 |
| ⓘ Aguilarite Formula: Ag4SeS |
| ⓘ Aikinite Formula: CuPbBiS3 Localities: |
| ⓘ Albite Formula: Na(AlSi3O8) Localities: Reported from at least 48 localities in this region. |
| ⓘ Albite var. Andesine Formula: (Na,Ca)[Al(Si,Al)Si2O8] Locality: Humledal, Hole, Buskerud, Norway |
| ⓘ Albite var. Oligoclase Formula: (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ Albite var. Oligoclase-Albite Formula: Na(AlSi3O8) |
| ⓘ 'Alkali Feldspar' |
| ⓘ Allanite-(Ce) Formula: (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ 'Allanite Group' Formula: (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) Localities: Reported from at least 11 localities in this region. |
| ⓘ Allanite-(Y) Formula: (CaY)(AlAlFe2+)O[Si2O7][SiO4](OH) References: |
| ⓘ Allargentum Formula: (Ag1-xSbx) |
| ⓘ Alloclasite ? Formula: Co1-xFexAsS |
| ⓘ Allophane Formula: (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 Localities: Reported from at least 7 localities in this region. |
| ⓘ 'Almandine-Spessartine Series' |
| ⓘ Altaite Formula: PbTe Locality: Kisgruva, Kongsberg, Buskerud, Norway References: |
| ⓘ Althausite (TL) Formula: Mg4(PO4)2(OH,O)(F,◻) Localities: Type Locality: Tingelstadtjern Quarry, Modum, Buskerud, Norway Colour: light grey Description: As cleavable masses in phospate nodules in serpentine |
| ⓘ Aluminocopiapite Formula: Al2/3Fe3+4(SO4)6(OH)2 · 20H2O References: |
| ⓘ 'Amphibole Supergroup' Formula: AB2C5(T8O22)W2 Localities: Reported from at least 46 localities in this region. |
| ⓘ 'Amphibole Supergroup var. Uralite' Formula: AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ Analcime Formula: Na(AlSi2O6) · H2O |
| ⓘ Anatase Formula: TiO2 Localities: Reported from at least 16 localities in this region. |
| ⓘ Andalusite Formula: Al2(SiO4)O |
| ⓘ 'Andesine-oligoclase' |
| ⓘ Andradite (TL) Formula: Ca3Fe3+2(SiO4)3 Localities: Reported from at least 22 localities in this region. Type Locality: Drammen, Buskerud, Norway Description: First described by d'Andrada as "Allochroite", with the locality given as Drammen, it might possibly be from Konnerudkollen mines where the mineral is common, and mining was at it's hights at that time.
Schumacher describe "allochroite" from an old iron mine; "Virum Eisengrube" near Drammen, in 1801. |
| ⓘ Andradite var. Hydroandradite Formula: Ca3Fe3+2(SiO4)3-x(OH)4x References: Zozulya, Dmitry R., Kullerud, Kåre, Ribacki, Enrico, Altenberger, Uwe, Sudo, Masafumi, Savchenko, Yevgeny E. (2020) The Newly Discovered Neoproterozoic Aillikite Occurrence in Vinoren (Southern Norway): Age, Geodynamic Position and Mineralogical Evidence of Diamond-Bearing Mantle Source. Minerals, 10 (11) 1029 doi:10.3390/min10111029 |
| ⓘ 'Andradite-Grossular Series' Localities: Reported from at least 6 localities in this region. |
| ⓘ Anglesite Formula: PbSO4 Localities: |
| ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 |
| ⓘ Annabergite Formula: Ni3(AsO4)2 · 8H2O |
| ⓘ Anorthite Formula: Ca(Al2Si2O8) |
| ⓘ Anthophyllite (TL) Formula: ◻Mg2Mg5(Si8O22)(OH)2 Localities: Reported from at least 10 localities in this region. Type Locality: Anthophyllite type locality, Kjennerudvann Silver Mine, Kjennerudvannet North, Øvre Eiker, Buskerud, Norway Description: Analysis of one sample of anthophyllite (the brownish orthoamphibole mineral) from Kjennerudvann has shown this not to be anthophyllite, but gedrite/sodic gedrite. Further investigations is in progress to establish if anthophyllite exist at the typelocality or not. (Kullerud et al. 2019). |
| ⓘ Antigorite Formula: Mg3(Si2O5)(OH)4 |
| ⓘ 'Apatite' Formula: Ca5(PO4)3A Localities: Reported from at least 21 localities in this region. |
| ⓘ Aphthitalite Formula: K3Na(SO4)2 Description: 2-30 my large grains in fluid inclusions in quartz |
| ⓘ 'Apophyllite Group' Formula: AB4[Si8O20]X · 8H2O |
| ⓘ Aragonite Formula: CaCO3 Localities: Reported from at least 7 localities in this region. |
| ⓘ Arfvedsonite Formula: NaNa2(Fe2+4Fe3+)Si8O22(OH)2 |
| ⓘ Argentopentlandite Formula: Ag(Fe,Ni)8S8 |
| ⓘ Argentopyrite Formula: AgFe2S3 References: |
| ⓘ Armenite (TL) Formula: Ba(H2O)2Ca2Al3[Al3Si9O30] Localities: |
| ⓘ Arsenopyrite Formula: FeAsS Localities: Reported from at least 23 localities in this region. |
| ⓘ Arsenopyrite var. Danaite Formula: (Fe0.90Co0.10)AsS - (Fe0.65Co0.35)AsS |
| ⓘ Astrophyllite Formula: K2NaFe2+7Ti2[Si4O12]2O2(OH)4F |
| ⓘ 'Astrophyllite Group' References: Knut Edvard Larsen collectionIdentified by Knut Edvard Larsen: Visual Identification |
| ⓘ Augite Formula: (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ Aurichalcite Formula: (Zn,Cu)5(CO3)2(OH)6 Localities: Reported from at least 7 localities in this region. |
| ⓘ Axinite-(Fe) Formula: Ca2Fe2+Al2BSi4O15OH Localities: Reported from at least 8 localities in this region. |
| ⓘ 'Axinite Group' |
| ⓘ Axinite-(Mn) Formula: Ca2Mn2+Al2BSi4O15(OH) |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 Localities: Reported from at least 13 localities in this region. |
| ⓘ Babingtonite Formula: Ca2Fe2+Fe3+Si5O14(OH) Colour: Black Description: Crystals 1-2mm |
| ⓘ Baryte Formula: BaSO4 Localities: Reported from at least 19 localities in this region. |
| ⓘ Baryte var. Hepatite Formula: BaSO4 |
| ⓘ Bavenite Formula: Ca4Be2Al2Si9O26(OH)2 Localities: Reported from at least 8 localities in this region. |
| ⓘ Bertrandite Formula: Be4(Si2O7)(OH)2 |
| ⓘ Beryl Formula: Be3Al2(Si6O18) Localities: Reported from at least 10 localities in this region. |
| ⓘ Beryl var. Aquamarine |
| ⓘ Beudantite Formula: PbFe3+3(AsO4)(SO4)(OH)6 |
| ⓘ Bianchite Formula: Zn(H2O)6(SO4) Habit: powder Colour: white Description: Bianchite was found in the dumps, when some of the material was removed and a deep profile of the dumps were revealed. It occured as a white to greyish powder, and are easily solved in water. The bianchite is almost without iron (Raade et al,1977). |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 Localities: Reported from at least 36 localities in this region. |
| ⓘ 'Biotite var. Anomite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 Description: as large crystals embedded in talc nodules in magnesite-dolomite |
| ⓘ Bismite Formula: Bi2O3 |
| ⓘ Bismuthinite Formula: Bi2S3 Localities: Reported from at least 7 localities in this region. |
| ⓘ Bismutite Formula: (BiO)2CO3 Localities: Reported from at least 6 localities in this region. |
| ⓘ 'Blaubleibender Covellite' |
| ⓘ Bornite Formula: Cu5FeS4 Localities: Reported from at least 11 localities in this region. |
| ⓘ Boulangerite Formula: Pb5Sb4S11 |
| ⓘ Böhmite ? Formula: AlO(OH) Description: According to Selbekk (2010) the mineral is reported in a list done by David Johansen, but this is not (yet, 2025) confirmed. |
| ⓘ Bournonite Formula: PbCuSbS3 |
| ⓘ Brannerite Formula: UTi2O6 Localities: Description: Occure in thin (< 0,5 cm) fractures in greenshist. |
| ⓘ Brewsterite-Ba Formula: Ba(Al2Si6)O16 · 5H2O Localities: Colour: colorless Description: crystals to 4mm long, consist mainly of brewsterite-Ba, with zones of brewsterite-Sr |
| ⓘ Brewsterite-Sr Formula: Sr(Al2Si6)O16 · 5H2O Localities: Description: As zones in up to 4 mm long clear crystals of brewsterite-Ba |
| ⓘ Brianyoungite Formula: Zn3(CO3,SO4)(OH)4 |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 Localities: Reported from at least 9 localities in this region. |
| ⓘ Brookite Formula: TiO2 |
| ⓘ Brucite Formula: Mg(OH)2 |
| ⓘ Bustamite Formula: CaMn2+(Si2O6) |
| ⓘ Calcite Formula: CaCO3 Localities: Reported from at least 116 localities in this region. |
| ⓘ 'Calcium Amphibole Subgroup' Formula: AnCa2(C2+5-mC3+m)(Si8-(n+m)Al(n+m))W2 Localities: Description: A ferrian-tschermakitic hornblende (Kullerud et al. 2019) |
| ⓘ ' Formula: AnCa2(Z2+5-mZ3+m)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 Locality: Oksøyekollen, Snarum, Modum, Buskerud, Norway - erroneously reported Description: The amphibole at the locality has been refered to as "hornblende"(sensu lato) in litterature of the late 19th century. At the time the usage of the term was more broad than it became later. Samples of amphiboles from this locality was and stillare labelled as "hornblende"(f.ex. Berg 1986)
An XRD of a typical sample showed it to be actinolite. |
| ⓘ Carrollite Formula: CuCo2S4 |
| ⓘ Cassiterite Formula: SnO2 Localities: Description: microscopic grain |
| ⓘ Catapleiite Formula: Na2Zr(Si3O9) · 2H2O |
| ⓘ Celestine Formula: SrSO4 |
| ⓘ Cerussite Formula: PbCO3 Localities: Reported from at least 8 localities in this region. |
| ⓘ 'Chabazite' |
| ⓘ Chabazite-Ca Formula: (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O Localities: Description: The "Chabazite" crystals from the Glomsrud Zinc Mines have for a long time been well known in the norwegian mineral collecting community. It has now been determined at NHM Økern, Oslo that the more specific species is Chabazite-(Ca)(EDS) |
| ⓘ Chalcanthite Formula: CuSO4 · 5H2O |
| ⓘ Chalcocite Formula: Cu2S Localities: Reported from at least 10 localities in this region. |
| ⓘ Chalcomenite Formula: CuSeO3 · 2H2O References: |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 109 localities in this region. |
| ⓘ Chamosite Formula: Fe2+5Al(AlSi3O10)(OH)8 |
| ⓘ Cheralite ? Formula: CaTh(PO4)2 Description: Described as "very tiny brownish crystals on hydroxylapatite" (Nordrum 2010). Most probably a misidentification = monazite-(Ce) ?? |
| ⓘ 'Chevkinite Group' |
| ⓘ Chlorapatite Formula: Ca5(PO4)3Cl |
| ⓘ Chlorargyrite Formula: AgCl |
| ⓘ 'Chlorite Group' Localities: Reported from at least 43 localities in this region. |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ Chrysotile Formula: Mg3(Si2O5)(OH)4 |
| ⓘ Cinnabar Formula: HgS |
| ✪ Clarkeite Formula: (Na,Ca,Pb)(UO2)O(OH) · 0-1H2O Description: Found in as the brownish inner layer closest to the uraninite in concentric alterations nodules after uraninite (cfr. Kristiansen 2007). According to Neumann (1985) the mineral was identified by Reidar Åmli (no further details are given on the method of identification in the present (2025) litterature).
Newer investigation by PXRD and SEM-XEDS confirms that clarkeite occurs at the Bjertnes pegmatite.
|
| ⓘ Clausthalite Formula: PbSe |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 Localities: Reported from at least 7 localities in this region. |
| ⓘ Clinochlore var. Leuchtenbergite Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ Clinochlore var. Pennine Formula: Mg5Al(AlSi3O10)(OH)8 Locality: Haugfoss, Modum, Buskerud, Norway |
| ⓘ 'Clinopyroxene Subgroup' Localities: Reported from at least 8 localities in this region. |
| ⓘ Clinozoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ 'Coal blend' Localities: Reported from at least 21 localities in this region. |
| ⓘ Cobaltite Formula: CoAsS Localities: Reported from at least 12 localities in this region. Habit: Combinations of (210), (111) and (100). Description: First cobaltite found in the Modum area was in 1772 by Ole Witloch. |
| ⓘ Collinsite Formula: Ca2Mg(PO4)2 · 2H2O Description: As replacement of reddish althausite. |
| ⓘ Columbite-(Fe) Formula: Fe2+Nb2O6 |
| ⓘ 'Columbite-(Fe)-Columbite-(Mn) Series' |
| ⓘ Copiapite Formula: Fe2+Fe3+4(SO4)6(OH)2 · 20H2O |
| ⓘ Cordierite Formula: Mg2Al4Si5O18 Locality: Øvre Dypingdal Mine, Dypingdal serpentine-magnesite deposit, Snarum, Modum, Buskerud, Norway References: Grew, Edward S.; Pertsev, Nikolai N.; Vrána, Stanislav; Yates, Martin G.; Shearer, Charles K.; Wiedenbeck, Michael (1998) Kornerupine parageneses in whiteschists and other magnesian rocks: is kornerupine + talc a high-pressure assemblage equivalent to tourmaline + orthoamphibole? Contributions to Mineralogy and Petrology, 131 (1). 22-38 doi:10.1007/s004100050376 |
| ⓘ Corundum Formula: Al2O3 |
| ⓘ Cosalite Formula: Pb2Bi2S5 |
| ⓘ Covellite Formula: CuS Localities: Reported from at least 8 localities in this region. |
| ⓘ 'Crichtonite Group' Formula: AD21O38 or A{DE2G6Ti12}O38 |
| ⓘ Cubanite Formula: CuFe2S3 References: |
| ⓘ Cuprite Formula: Cu2O |
| ⓘ Curite Formula: Pb3(H2O)2[(UO2)4O4(OH)3]2 References: Knut Eldjarn CollectionIdentification: XRD |
| ⓘ Danalite Formula: Be3Fe2+4(SiO4)3S |
| ⓘ 'Danalite-Genthelvite Series' |
| ⓘ Danburite Formula: CaB2Si2O8 References: Hurum, Jørn H., Jahren, J., Berg, Hans-Jørgen, Bjerkgaard, T. (1997) En eksotisk pegmatitt i kambrosiluren ved Eikeren, Buskerud [An unusual pegmatite from the Eikeren area, South-eastern Norway - a preliminary report], in Kongsberg Mineralsymposium 1997. STEIN. Nordisk magasin for populær geologi, 24 (3) 125-127 |
| ⓘ Datolite Formula: CaB(SiO4)(OH) |
| ⓘ 'Davidite' ? Description: Black, irregular masses with a vitreous to sub metallic lustre embedded in feldspar matrix have been labelled by collectors as "davidite". An analysis of some samples of these has shown these to be chrichtonite group minerals. |
| ⓘ Davidite-(La) ? Formula: La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 Description: According to Eldjarn & Viognola (2022) it is likely that davidite-(La) occurs at Åmot quarry, but this has not yet been confirmed. |
| ⓘ Devilline Formula: CaCu4(SO4)2(OH)6 · 3H2O Localities: Reported from at least 6 localities in this region. |
| ⓘ Diaspore Formula: AlO(OH) |
| ⓘ Dickite Formula: Al2(Si2O5)(OH)4 Habit: 0.1mm scales Colour: white Description: as white cover on quartz and feldspar |
| ⓘ Digenite Formula: Cu9S5 |
| ⓘ Diopside Formula: CaMgSi2O6 Localities: Reported from at least 12 localities in this region. |
| ⓘ Dolomite Formula: CaMg(CO3)2 Localities: Reported from at least 8 localities in this region. |
| ⓘ Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) Localities: Description: Dunn et al (1977) analyzes 4 crystals from 2 specimens of black tourmaline associated with calcite. |
| ⓘ Dypingite (TL) Formula: Mg5(CO3)4(OH)2 · 5H2O Localities: Habit: As small < 0,3 mm globular aggregates forming a thin cover on serpentine Colour: white Fluorescence: light blue |
| ⓘ Dyscrasite Formula: Ag3Sb |
| ⓘ Emplectite Formula: CuBiS2 |
| ⓘ Enargite Formula: Cu3AsS4 Description: Found as grains in microscopic lamellae within bornite |
| ⓘ Enstatite Formula: Mg2Si2O6 |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) Localities: Reported from at least 35 localities in this region. |
| ⓘ Epistilbite Formula: CaAl2Si6O16 · 5H2O References: |
| ⓘ Erythrite Formula: Co3(AsO4)2 · 8H2O Localities: Reported from at least 12 localities in this region. |
| ✪ Eucairite Formula: AgCuSe Description: 1-2 cm size masses composed by grains with perfect cleavage. Intimately associated with naumannite, clausthallite and Se-bearing chalcopyrite and covellite. Composition of the mineral is Cu.95Ag1.04Se1.01. References: |
| ⓘ Eugenite ? Formula: Ag11Hg2 |
| ⓘ Fayalite Formula: Fe2+2(SiO4) |
| ⓘ 'Feldspar Group' Localities: Reported from at least 34 localities in this region. |
| ⓘ 'Feldspar Group var. Mesoperthite' Locality: Lake Mykle, Kongsberg, Buskerud, Norway |
| ⓘ 'Feldspar Group var. Perthite' |
| ⓘ Fergusonite-(Y) Formula: YNbO4 |
| ⓘ Ferrimolybdite Formula: Fe2(MoO4)3 · nH2O |
| ⓘ Ferro-edenite Formula: NaCa2Fe2+5(Si7Al)O22(OH)2 Locality: Lake Mykle, Kongsberg, Buskerud, Norway |
| ⓘ Ferro-richterite Formula: Na(CaNa)Fe2+5(Si8O22)(OH)2 Locality: Lake Mykle, Kongsberg, Buskerud, Norway |
| ⓘ Fibroferrite Formula: Fe3+(SO4)(OH) · 5H2O Description: Sample collected by L.O. Kvamsdal. References: |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F Localities: Reported from at least 6 localities in this region. |
| ⓘ Fluorapophyllite-(K) Formula: KCa4(Si8O20)(F,OH) · 8H2O Localities: |
| ⓘ Fluorite Formula: CaF2 Localities: Reported from at least 67 localities in this region. |
| ⓘ 'Fluor-uvite-Uvite Series' Colour: black, white,blue |
| ⓘ Forsterite Formula: Mg2(SiO4) Localities: Description: Serpentine pseudomorphoses after olivine occure at the serpentinite-deposites, sometimes with remnants of forsterite (Fa2-3). |
| ⓘ Fourmarierite Formula: Pb(UO2)4O3(OH)4 · 4H2O Description: Identified at the x-ray laboratory of Natural History Museum, Oslo in 1965. |
| ⓘ 'Freibergite Subgroup' Formula: (Ag6,[Ag6]4+)(Cu4 C2+2)Sb4S12S0-1 |
| ⓘ 'Gadolinite' |
| ⓘ 'Gadolinite Group' ? Formula: A2MQ2Si2O8φ2 |
| ⓘ Gahnite Formula: ZnAl2O4 Localities: Description: One sample in the collection of Mineralogical Museum of Oslo. |
| ⓘ Galena Formula: PbS Localities: Reported from at least 61 localities in this region. |
| ⓘ Galenobismutite Formula: PbBi2S4 |
| ⓘ 'Ganomatite' ? Description: In the collection of Mineralogical Museum of Oslo, there is a sample labelled 'Gänseköthigerts, Gamle Segen Gottes'. There is no trace of the mineral on the sample, it might have been used for analyses, but it is unknown. |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 Localities: Reported from at least 37 localities in this region. |
| ⓘ Gedrite Formula: ◻Mg2(Mg3Al2)(Al2Si6O22)(OH)2 Localities: Colour: greyish brown |
| ⓘ Geikielite Formula: MgTiO3 Locality: Modum, Buskerud, Norway |
| ⓘ Genthelvite Formula: Be3Zn4(SiO4)3S |
| ⓘ 'Genthelvite-Helvine Series' Locality: Rundemyr, Øvre Eiker, Buskerud, Norway |
| ⓘ Gersdorffite Formula: NiAsS |
| ⓘ Gibbsite Formula: Al(OH)3 |
| ⓘ Glaucodot Formula: (Co0.50Fe0.50)AsS Description: Scheerer (1838, p. 424) describe a mineral and cal it "arsenopyrite intergrown with Glandskobolt(cobaltite)", this mineral is identical as glaucodote which was described 11 years later. References: |
| ⓘ 'Glockerite' Formula: Fe3+4(SO4)(OH)10 · 1-3H2O ? Locality: Modum, Buskerud, Norway |
| ⓘ Godlevskite ? Formula: (Ni,Fe)9S8 References: Zozulya, Dmitry R., Kullerud, Kåre, Ribacki, Enrico, Altenberger, Uwe, Sudo, Masafumi, Savchenko, Yevgeny E. (2020) The Newly Discovered Neoproterozoic Aillikite Occurrence in Vinoren (Southern Norway): Age, Geodynamic Position and Mineralogical Evidence of Diamond-Bearing Mantle Source. Minerals, 10 (11) 1029 doi:10.3390/min10111029 |
| ⓘ Goethite Formula: Fe3+O(OH) Localities: Reported from at least 28 localities in this region. |
| ⓘ Gonnardite Formula: (Na,Ca)2(Si,Al)5O10 · 3H2O |
| ⓘ Goslarite Formula: ZnSO4 · 7H2O |
| ⓘ Graphite Formula: C |
| ⓘ Greenockite Formula: CdS Localities: Baklia, Konnerudkollen Mines (Konnerud Mines), Konnerud, Drammen, Buskerud, Norway Glomsrudkollen Zinc Mines, Åmot, Modum, Buskerud, Norway ? (more information) Dalen Mine, Konnerud, Drammen, Buskerud, Norway ? (more information) Sata prospect, Konnerudkollen Mines (Konnerud Mines), Konnerud, Drammen, Buskerud, Norway ? (more information) |
| ⓘ Grossular Formula: Ca3Al2(SiO4)3 Localities: Reported from at least 22 localities in this region. |
| ⓘ Grossular var. Hibschite Formula: Ca3Al2(SiO4)3-x(OH)4x |
| ⓘ 'Gummite' References: Knut Eldjarn CollectionIdentified by Knut Eldjarn: Visual Identification |
| ⓘ Gunningite Formula: ZnSO4 · H2O Description: Sample found by S.A. Berge and identified at the x-ray laboratory of Mineralogical Museum of Oslo in 1978. |
| ⓘ Gypsum Formula: CaSO4 · 2H2O Localities: Reported from at least 16 localities in this region. |
| ⓘ Haitaite-(La) Formula: LaU4+Fe3+2(Ti13Fe2+4Fe3+)O38 Description: An U-rich chrichtonite group mineral from Åmot quarry is found to be similar in chemical composition to haitaite-(La). |
| ⓘ Halite Formula: NaCl |
| ⓘ Halloysite Formula: Al2Si2O5(OH)4 · n(H2O) |
| ⓘ Halotrichite ? Formula: Fe2+Al2(SO4)4 · 22H2O Description: Schumacher (1801) described a mineral he called "haarsalz". Neumann (1985) suuggest that it might be halotrichite. It could be mirabilite, which is positively identified from Kongsberg |
| ⓘ Harmotome Formula: Ba2(Si12Al4)O32 · 12H2O Localities: Reported from at least 19 localities in this region. |
| ⓘ Hawleyite Formula: CdS Description: First found by Dag Ottesen in 1989. |
| ⓘ Hedenbergite Formula: CaFe2+Si2O6 Localities: Ljøterud, Kongsberg, Buskerud, Norway Dessau Mine, Konnerudkollen Mines (Konnerud Mines), Konnerud, Drammen, Buskerud, Norway Kongsberg silver mining district, Buskerud, Norway Konnerudkollen Mines (Konnerud Mines), Konnerud, Drammen, Buskerud, Norway Baklia, Konnerudkollen Mines (Konnerud Mines), Konnerud, Drammen, Buskerud, Norway |
| ⓘ 'Hellandite' ? |
| ⓘ Helvine Formula: Be3Mn2+4(SiO4)3S Localities: Reported from at least 6 localities in this region. |
| ⓘ Hematite Formula: Fe2O3 Localities: Reported from at least 43 localities in this region. |
| ⓘ Formula: Fe2O3 Locality: Dypingdal serpentine-magnesite deposit, Snarum, Modum, Buskerud, Norway - erroneously reported Description: The large hematite crystals from Dypingdal has been erronously reported as being martite a pesudomorphose after magngatite (some crystals are weakly magnetitc, and some have a pseudocubic habitus). However Raade (1982) showed thes to be normal hematites with a content of Titanium. References: |
| ⓘ Hemimorphite Formula: Zn4Si2O7(OH)2 · H2O Localities: Reported from at least 9 localities in this region. |
| ✪ Heneuite (TL) Formula: CaMg5(CO3)(PO4)3(OH) Type Locality: Habit: nodular masses several cm across Colour: pale bluegreen Description: often surrounded by a rim of althausite which is surrounded by apatite References: |
| ⓘ Hessite Formula: Ag2Te |
| ⓘ Heulandite-Ba (TL) Formula: (Ba,Ca,K)5(Si27Al9)O72 · 22H2O Localities: |
| ⓘ Heulandite-Ca Formula: (Ca,Na)5(Si27Al9)O72 · 26H2O Localities: Reported from at least 9 localities in this region. Description: a potassian heulandite-Ca with a distinct strontium content (Nordrum et al 2003) |
| ⓘ 'Heulandite Subgroup' Formula: (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O Localities: Habit: tabular parallel to {100} Colour: colourless |
| ⓘ Hexahydrite Formula: Mg(H2O)6(SO4) |
| ⓘ Hingganite-(Y) ? Formula: (Y,REE,Ca)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
| ⓘ Hollandite Formula: Ba(Mn4+6Mn3+2)O16 Locality: Fossvann, Kongsberg, Buskerud, Norway |
| ⓘ Holtedahlite (TL) Formula: Mg2(PO4)(OH) Type Locality: Habit: irregular patches ; masses Colour: colourless Description: glassy. |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ Formula: MnWO4 Locality: Drammen, Buskerud, Norway - erroneously reported Description: Found in a hydrothermal quartz vein, locality only given as the "Drammen area", it refers to localities outside the municipality of Drammen eg. Hurum and Lier municipalities |
| ⓘ Hydrocerussite Formula: Pb3(CO3)2(OH)2 |
| ⓘ Hydrohalite Formula: NaCl · 2H2O Description: In liquid inclusions |
| ⓘ Hydromagnesite Formula: Mg5(CO3)4(OH)2 · 4H2O Localities: Description: Occure as white thin crusts on serpentine. |
| ⓘ Hydrotalcite (TL) Formula: Mg6Al2(CO3)(OH)16 · 4H2O Localities: Colour: white, blueish |
| ⓘ 'Hydrotalcite-2H' Formula: Mg6Al2(CO3)(OH)16 · 4H2O Localities: Description: The description give Snarum as locality, but it's presumably the Dypingdal locality - as for hydrotalcite. |
| ⓘ Hydroxylapatite Formula: Ca5(PO4)3(OH) |
| ⓘ Hydrozincite Formula: Zn5(CO3)2(OH)6 Localities: Reported from at least 6 localities in this region. Description: Mineral only labelled Kongsberg, was analysed and proved to be hydrozincite at Mineralogical Museum of Oslo. |
| ⓘ 'Hypersthene' Formula: (Mg,Fe)SiO3 |
| ⓘ Idaite Formula: Cu5FeS6 Localities: Description: Krause report idaite as thin lamellaes in bornite. |
| ⓘ Ilmenite Formula: Fe2+TiO3 Localities: Reported from at least 20 localities in this region. |
| ⓘ Ilvaite Formula: CaFe3+Fe2+2(Si2O7)O(OH) Locality: Rundemyr, Øvre Eiker, Buskerud, Norway Description: Not found at Rundemyr, but near the locality. (Neumann 1985 p 160) |
| ⓘ Imiterite Formula: Ag2HgS2 |
| ⓘ Jalpaite Formula: Ag3CuS2 |
| ⓘ Jarosite Formula: KFe3+3(SO4)2(OH)6 |
| ⓘ Joliotite Formula: (UO2)CO3 · nH2O Description: As a soft yellowish crust on partly altered uraninite. Easily soluble in diluted HCl acid. References: |
| ⓘ Kainosite-(Y) Formula: Ca2Y2(SiO3)4(CO3) · H2O Description: Mentioned as identified at the mineralogical laboratory at the Gological Museum in Oslo, without any further information about how it was identified (Bjørlykke 1959). |
| ✪ Kamotoite-(Y) Formula: Y2(UO2)4(CO3)3O4 · 14H2O Description: As yellowcolored, radiating crystals on the surface of uraninite or near uraninite. The radiating aggregates may be up to 3mm in diameter and are easily splintered into thin layers.It gives weak greenish fluorescens in UV light. References: |
| ⓘ Kamphaugite-(Y) (TL) Formula: Ca(Y,REE)(CO3)2(OH) · H2O Type Locality: |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Kasolite Formula: Pb(UO2)(SiO4) · H2O |
| ⓘ Katophorite Formula: Na(CaNa){Mg4Al)(AlSi7O22)(OH)2 Locality: Lake Mykle, Kongsberg, Buskerud, Norway |
| ⓘ 'K Feldspar' Localities: Reported from at least 16 localities in this region. |
| ⓘ 'K Feldspar var. Adularia' Formula: KAlSi3O8 |
| ⓘ Kornerupine Formula: Mg3Al6(Si,Al,B)5O21(OH) References: (n.d.) Knut Eldjarn collection.+ NHM, Oslo collection |
| ⓘ 'Kornerupine-Prismatine Series' Locality: Øvre Dypingdal Mine, Dypingdal serpentine-magnesite deposit, Snarum, Modum, Buskerud, Norway References: Grew, Edward S.; Pertsev, Nikolai N.; Vrána, Stanislav; Yates, Martin G.; Shearer, Charles K.; Wiedenbeck, Michael (1998) Kornerupine parageneses in whiteschists and other magnesian rocks: is kornerupine + talc a high-pressure assemblage equivalent to tourmaline + orthoamphibole? Contributions to Mineralogy and Petrology, 131 (1). 22-38 doi:10.1007/s004100050376 |
| ⓘ Ktenasite Formula: ZnCu4(SO4)2(OH)6 · 6H2O |
| ⓘ Kyanite Formula: Al2(SiO4)O Locality: Øvre Dypingdal Mine, Dypingdal serpentine-magnesite deposit, Snarum, Modum, Buskerud, Norway References: Grew, Edward S.; Pertsev, Nikolai N.; Vrána, Stanislav; Yates, Martin G.; Shearer, Charles K.; Wiedenbeck, Michael (1998) Kornerupine parageneses in whiteschists and other magnesian rocks: is kornerupine + talc a high-pressure assemblage equivalent to tourmaline + orthoamphibole? Contributions to Mineralogy and Petrology, 131 (1). 22-38 doi:10.1007/s004100050376 |
| ⓘ Langite Formula: Cu4(SO4)(OH)6 · 2H2O Localities: Reported from at least 9 localities in this region. Description: Langite was identified on a sample labelled "Kongsberg", at the x-ray laboratory at Natural History Museum of Oslo. |
| ⓘ Lansfordite Formula: MgCO3 · 5H2O |
| ⓘ Lanthanite-(La) Formula: La2(CO3)3 · 8H2O Locality: Liertoppen, Lier, Buskerud, Norway Habit: 0,5mm large aggregates of platy xls (1mm in width) Colour: vwaterclear |
| ⓘ Laumontite Formula: CaAl2Si4O12 · 4H2O Localities: Reported from at least 11 localities in this region. |
| ⓘ Lepidocrocite Formula: Fe3+O(OH) |
| ⓘ 'Leucoxene' Locality: Haugfoss, Modum, Buskerud, Norway |
| ⓘ Liebigite Formula: Ca2(UO2)(CO3)3 · 11H2O Description: Occurs as a yellowish to pale yellow-greenish secondary depostion layer on feldspar or muscovite. Forms irregularly or sphere-like aggreagates forming a crust.
First found in 1969 by Reidar Åmli. Later, identified in april 1972 by Gunnar Raade on a sample collected by Lars O. Kvamsdal occuring as a yellow crust on muscovite.
Visual similar material can still be found in the wall at the opening of the mine (Hamza Sito comment Sept. 2025). |
| ⓘ 'Limonite' |
| ⓘ Linarite Formula: PbCu(SO4)(OH)2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Linnaeite Formula: Co2+Co3+2S4 |
| ⓘ Lizardite Formula: Mg3(Si2O5)(OH)4 |
| ⓘ Löllingite Formula: FeAs2 Localities: Habit: small lenses (2,0 x 0,5 cm) Description: Two specimens in the Naturhistoriska Riksmuseet in Stockholm, Sweden (Nos.L.K. 6981 and L.K. 6982) |
| ⓘ Lucasite-(Ce) Formula: CeTi2(O,OH)6 References: Zozulya, Dmitry R., Kullerud, Kåre, Ribacki, Enrico, Altenberger, Uwe, Sudo, Masafumi, Savchenko, Yevgeny E. (2020) The Newly Discovered Neoproterozoic Aillikite Occurrence in Vinoren (Southern Norway): Age, Geodynamic Position and Mineralogical Evidence of Diamond-Bearing Mantle Source. Minerals, 10 (11) 1029 doi:10.3390/min10111029 |
| ⓘ Mackinawite Formula: FeS |
| ⓘ Maghemite Formula: (Fe3+0.67◻0.33)Fe3+2O4 |
| ⓘ Magnesioferrite Formula: MgFe3+2O4 |
| ⓘ Magnesite Formula: MgCO3 Localities: Reported from at least 13 localities in this region. |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 Localities: Reported from at least 48 localities in this region. |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 Localities: Reported from at least 26 localities in this region. |
| ⓘ Malachite var. Zinc-bearing Malachite Formula: (Cu,Zn)2(CO3)(OH)2 |
| ⓘ 'Manganese Oxides' |
| ✪ Manganilvaite Formula: CaFe2+Fe3+Mn2+(Si2O7)O(OH) |
| ⓘ Manganite Formula: Mn3+O(OH) Localities: Description: One sample in the collection of Mineralogical Museum of Oslo. |
| ⓘ Marcasite Formula: FeS2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Melanterite Formula: Fe2+(H2O)6(SO4) · H2O |
| ⓘ Mesolite Formula: Na2Ca2Si9Al6O30 · 8H2O |
| ⓘ Metazellerite Formula: Ca(UO2)(CO3)2 · 3H2O |
| ⓘ Metazeunerite Formula: Cu(UO2)2(AsO4)2 · 8H2O References: Knut Eldjarn CollectionIdentification: SEM-EDS |
| ⓘ Mianningite ? Formula: (◻,Pb,Ce,Na)(U4+,Mn,U6+)Fe3+2 (Ti,Fe3+)18O38 |
| ⓘ Miargyrite Formula: AgSbS2 |
| ⓘ 'Mica Group' Localities: Reported from at least 12 localities in this region. |
| ⓘ Microcline Formula: K(AlSi3O8) Localities: Reported from at least 12 localities in this region. |
| ⓘ Microcline var. Amazonite Formula: K(AlSi3O8) References: Hurum, Jørn H., Jahren, J., Berg, Hans-Jørgen, Bjerkgaard, T. (1997) En eksotisk pegmatitt i kambrosiluren ved Eikeren, Buskerud [An unusual pegmatite from the Eikeren area, South-eastern Norway - a preliminary report], in Kongsberg Mineralsymposium 1997. STEIN. Nordisk magasin for populær geologi, 24 (3) 125-127 |
| ⓘ Microcline var. Hyalophane Formula: (K,Ba)[Al(Si,Al)Si2O8] |
| ⓘ Miharaite Formula: Cu4FePbBiS6 |
| ⓘ Millerite Formula: NiS |
| ⓘ Mirabilite Formula: Na2SO4 · 10H2O Localities: Description: Mirabilite was found growing on the walls ca. 3600m inside the adit from Saggrenda. This part of the mine have a constant temperature of 6 degrees Celsius and are always moist. |
| ⓘ Molybdenite Formula: MoS2 Localities: Reported from at least 29 localities in this region. |
| ⓘ Monazite-(Ce) Formula: Ce(PO4) |
| ⓘ 'Monazite Group' Formula: REE(PO4) References: |
| ⓘ Monohydrocalcite Formula: CaCO3 · H2O |
| ⓘ Montmorillonite Formula: (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 37 localities in this region. Description: up to 40 cm in diameter |
| ⓘ Muscovite var. Illite Formula: K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ 'Muscovite-1M' Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Namuwite ? Formula: Zn4(SO4)(OH)6 · 4H2O |
| ⓘ Native Antimony Formula: Sb Description: As microscopic inclusions in arsenic. References: |
| ⓘ Native Arsenic Formula: As |
| ⓘ Native Bismuth Formula: Bi Localities: Skuterud Mines, Modum West, Modum, Buskerud, Norway Kjenner Bismuth Mine, Lierskogen, Lier, Buskerud, Norway Glomsrudkollen Zinc Mines, Åmot, Modum, Buskerud, Norway Wedelseie Adit, Konnerudkollen Mines (Konnerud Mines), Konnerud, Drammen, Buskerud, Norway |
| ⓘ Native Copper Formula: Cu Localities: Buttedal Mine, Tranby, Lier, Buskerud, Norway Kongsberg silver mining district, Buskerud, Norway Nordskjerpet, Konnerudkollen Mines (Konnerud Mines), Konnerud, Drammen, Buskerud, Norway Skuterud Mines, Modum West, Modum, Buskerud, Norway Konnerudkollen Mines (Konnerud Mines), Konnerud, Drammen, Buskerud, Norway ? (more information) |
| ⓘ Native Gold Formula: Au Localities: Reported from at least 6 localities in this region. Description: Microprobe analysis by V. Fjerdingstad gives 57,7% Au and 42,1% Ag. |
| ⓘ Native Gold var. Electrum Formula: (Au,Ag) Localities: Reported from at least 23 localities in this region. |
| ⓘ Native Silver Formula: Ag Localities: Reported from at least 67 localities in this region. Description: Plates 68/69 from Wilson, Wendell. E.; Bartsch, Joel A.; Mauthner, Mark (2004) Masterpieces of the Mineral World. Houston Museum of Natural Science. [https://www.mindat.org/reference.php?id=18945017] |
| ⓘ Native Silver var. Amalgam Formula: (Ag,Hg) |
| ⓘ Native Silver var. Kongsbergite (FRL) Formula: (Ag,Hg) Type Locality: Kongsberg silver mining district, Buskerud, Norway |
| ⓘ Native Sulphur Formula: S8 |
| ⓘ Natrojarosite Formula: NaFe3(SO4)2(OH)6 |
| ⓘ Natrolite Formula: Na2Al2Si3O10 · 2H2O |
| ⓘ Naumannite Formula: Ag2Se Localities: Kisgruva, Kongsberg, Buskerud, Norway Sankt Johannes Mine, Underberget Mining Field, Kongsberg, Buskerud, Norway Norske Løve, Vinoren Southern Mines, Vinoren Silver Mine Field, Flesberg, Buskerud, Norway Vinoren Silver Mine Field, Flesberg, Buskerud, Norway Hellig Trefoldighet Mine, Underberget Mining Field, Kongsberg, Buskerud, Norway |
| ⓘ Neotocite Formula: (Mn,Fe)SiO3 · H2O (?) |
| ⓘ Nepheline Formula: Na3K(Al4Si4O16) |
| ⓘ Nesquehonite Formula: MgCO3 · 3H2O |
| ⓘ Nickeline Formula: NiAs |
| ⓘ 'Nickelskutterudite-Skutterudite Series' Description: Neumann describe "smaltite-chloanthite" as common as 0,001-0,01 mm thick coatings on silver, together with safflorite-rammelsbergite. |
| ⓘ 'Nioboaeschynite' ? Description: Microprobe-data not conclusive. |
| ⓘ Nontronite Formula: Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| ⓘ Nordenskiöldine Formula: CaSn4+[BO3]2 |
| ⓘ Nukundamite Formula: Cu3.33Fe0.66S4 |
| ⓘ 'Olivine Group' Formula: M2SiO4 References: Mansur, E.; Orvik, A. A.; Henderson, I.; Miranda, A. C.; Slagstad, T.; Dare, S.; Bjerkgaard, T.; Sandstad, J. S. (2025) Formation of the Ertelien and Langedalen magmatic Ni–Cu sulfide deposits in Norway: investigating the evolution of platinum-group-element-depleted systems at convergent margins. European Journal of Mineralogy, 37 (6). 841-869 doi:10.5194/ejm-37-841-2025 |
| ⓘ Opal Formula: SiO2 · nH2O Localities: Reported from at least 8 localities in this region. |
| ⓘ Opal var. Opal-AN Formula: SiO2 · nH2O |
| ⓘ 'Orthochrysotile' Formula: Mg3(Si2O5)(OH)4 |
| ⓘ Orthoclase Formula: K(AlSi3O8) Localities: Reported from at least 30 localities in this region. |
| ⓘ 'Orthopyroxene Subgroup' |
| ⓘ Palygorskite Formula: ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| ⓘ Papikeite Formula: NaMg2(Mg3Al2}(Al3Si5O22)(OH)2 Description: Found in the rims of lathlike gedrite crystals. |
| ⓘ Parauranophane Formula: Ca(UO2)2(SiO3OH)2 · 5H2O References: Knut Eldjarn CollectionIdentification: XRD |
| ⓘ 'Parisite' Formula: Ca(Ce/La/Nd/REE)2(CO3)3F2 Locality: Kongsberg, Buskerud, Norway Description: A sample with Parisite labelled Kongsberg,in the collection of British Museum (Natural History), the mineral occur as a brown crystal on fluorite, and are confirmed by x-ray analysis. |
| ⓘ Parisite-(Ce) Formula: CaCe2(CO3)3F2 |
| ⓘ Pearceite ? Formula: [Ag6As2S7][Ag9CuS4] Description: Neumann (1944,1985) suspect that some of the Kongsberg polybasites might be wrongly identified, and be pearceite instead. |
| ⓘ Pentlandite Formula: (NixFey)Σ9S8 Localities: Reported from at least 12 localities in this region. |
| ⓘ Pentlandite var. Silver-bearing Pentlandite Formula: (Ni,Fe,Ag)9S8 |
| ⓘ 'Petroleum var. Bitumen' |
| ⓘ Phenakite Formula: Be2SiO4 |
| ⓘ Phlogopite Formula: KMg3(AlSi3O10)(OH)2 Localities: Reported from at least 8 localities in this region. |
| ⓘ Phosphoellenbergerite Formula: (Mg,◻)2Mg12(PO4,PO3OH)6(PO3OH,CO3)2(OH)6 |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 Localities: Reported from at least 11 localities in this region. |
| ⓘ Polybasite Formula: [Ag6Sb2S7][Ag9CuS4] Localities: Reported from at least 7 localities in this region. |
| ⓘ Portlandite Formula: Ca(OH)2 |
| ⓘ Posnjakite Formula: Cu4(SO4)(OH)6 · H2O Localities: |
| ⓘ Prehnite Formula: Ca2Al2Si3O10(OH)2 Localities: Reported from at least 12 localities in this region. |
| ⓘ Proustite ? Formula: Ag3AsS3 |
| ⓘ 'Proustite-Pyrargyrite Series' |
| ⓘ 'Psilomelane' |
| ⓘ 'Pumpellyite Subgroup' Formula: Ca2XAl2[Si2O6(OH)][SiO4](OH)2A Description: Sæbø (1966) mentions a find of a Fe-poor pumpellyite |
| ⓘ Pyrargyrite Formula: Ag3SbS3 Localities: Mildigkeit Gottes Mine (Mildigkeit Mine), Overberget Mining Field, Kongsberg, Buskerud, Norway Ringnesgangen Mine, Vinoren Southern Mines, Vinoren Silver Mine Field, Flesberg, Buskerud, Norway Norske Løve, Vinoren Southern Mines, Vinoren Silver Mine Field, Flesberg, Buskerud, Norway Kongens Mine, Overberget Mining Field, Kongsberg, Buskerud, Norway Kongsberg silver mining district, Buskerud, Norway |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 121 localities in this region. |
| ⓘ Pyroaurite ? Formula: Mg6Fe3+2(OH)16[CO3] · 4H2O Habit: hexagonal platy crystals Colour: white to pale brown Description: Described as a pyroaurite-like mineral. Identity uncertain |
| ⓘ 'Pyrochlore Group' Formula: A2Nb2(O,OH)6Z |
| ⓘ Pyrolusite Formula: Mn4+O2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Pyrolusite var. Polianite Formula: morphological variety |
| ⓘ Pyrope Formula: Mg3Al2(SiO4)3 |
| ⓘ Pyrophanite Formula: Mn2+TiO3 |
| ⓘ Pyrostilpnite Formula: Ag3SbS3 |
| ⓘ 'Pyroxene Group' Formula: ADSi2O6 Localities: Reported from at least 7 localities in this region. |
| ⓘ Pyrrhotite Formula: Fe1-xS Localities: Reported from at least 57 localities in this region. |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 203 localities in this region. |
| ⓘ Quartz var. Amethyst Formula: SiO2 Localities: Reported from at least 18 localities in this region. |
| ⓘ Quartz var. Chalcedony Formula: SiO2 |
| ⓘ Quartz var. Rock Crystal Formula: SiO2 |
| ⓘ Quartz var. Sceptre Quartz Formula: SiO2 |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 Localities: Reported from at least 32 localities in this region. |
| ⓘ Quintinite Formula: Mg4Al2(OH)12(CO3) · 3H2O |
| ⓘ Raadeite (TL) Formula: Mg7(PO4)2(OH)8 Type Locality: Habit: veinlets, a few tens of µm wide Colour: transparent and colourless Description: It occurs as veinlets, a few tens of µm wide, crosscutting althausite crystals; also as rare, up to 150 µm large anhedral inclusions in holtedahlite; and with apatite, althausite and magnesite in fibrous coronae replacing heneuite (Chopin et al. 2001)
The very low analytical total suggests H2O and/or CO2 are present. Valid unnamed minerasl list, update 2009-02 |
| ⓘ Rammelsbergite ? Formula: NiAs2 Description: Rammelsbergite dominated coating on silver have not been found (see safflorite), but Neumann hypotezied that it occured in the silver bearing veins in the Kongsberg field. It has not yet been proved. |
| ⓘ Rapidcreekite Formula: Ca2(SO4)(CO3) · 4H2O |
| ⓘ Rhodonite Formula: CaMn3Mn[Si5O15] Localities: |
| ⓘ Romanèchite Formula: (Ba,H2O)2(Mn4+,Mn3+)5O10 Locality: Kongsberg, Buskerud, Norway |
| ⓘ Rosasite ? Formula: (Cu,Zn)2(CO3)(OH)2 References: Raade, Gunnar, Sæbø, Per Chr. (1990) New Secondary Copper Minerals from Norway. Mineralogisk-Geologisk Museum - Universitetet i Oslo- Interne notater, Geologisk Museums venner. 145-148p.145 - XRD analysis of alleged rosasite has showed to be malachite |
| ⓘ Rozenite Formula: FeSO4 · 4H2O Locality: Vestfossen, Øvre Eiker, Buskerud, Norway Description: Rozenite was found by Raade at a locality south of Vestfossen with no further information on the locality. |
| ⓘ Rutherfordine Formula: (UO2)CO3 |
| ⓘ Rutile Formula: TiO2 Localities: Reported from at least 20 localities in this region. |
| ⓘ Rutile var. Ilmenorutile Formula: (Ti,Nb)O2 Locality: Lake Mykle, Kongsberg, Buskerud, Norway |
| ⓘ Safflorite Formula: (Co,Ni,Fe)As2 |
| ⓘ 'Scapolite' Localities: Reported from at least 6 localities in this region. |
| ⓘ Scheelite Formula: Ca(WO4) Localities: Reported from at least 8 localities in this region. |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Localities: Reported from at least 7 localities in this region. |
| ⓘ Schulenbergite Formula: (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| ⓘ Scolecite Formula: CaAl2Si3O10 · 3H2O |
| ⓘ Scorodite Formula: Fe3+AsO4 · 2H2O |
| ⓘ Sepiolite Formula: Mg4(Si6O15)(OH)2 · 6H2O |
| ⓘ 'Serpentine Subgroup' Formula: D3[Si2O5](OH)4 Localities: Reported from at least 9 localities in this region. |
| ⓘ Serpierite Formula: Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O Localities: Glomsrudkollen Zinc Mines, Åmot, Modum, Buskerud, Norway Nordskjerpet, Konnerudkollen Mines (Konnerud Mines), Konnerud, Drammen, Buskerud, Norway Ehrlich Mine, Konnerudkollen Mines (Konnerud Mines), Konnerud, Drammen, Buskerud, Norway Konnerudkollen Mines (Konnerud Mines), Konnerud, Drammen, Buskerud, Norway |
| ⓘ Siderite Formula: FeCO3 |
| ⓘ Siegenite Formula: CoNi2S4 |
| ⓘ Sillimanite Formula: Al2(SiO4)O |
| ⓘ Skutterudite (TL) Formula: CoAs3 Localities: Type Locality: Skuterud Mines, Modum West, Modum, Buskerud, Norway Habit: Typical: (111), (211), (110) and more rarely: (100), (310) and (332). Description: Breithaupt(1827)first named it as Tesseralkies but the properties was described under the heading Hartkobaltkies". Scheerer (1837) introduced the name Arsenik-Koboltkiis", Hausmann (1847)as "Hartkobalterze", Nicol (1849) it as "Modumite", and Haidinger described it as "skutterudite".
|
| ⓘ Smithsonite Formula: ZnCO3 Localities: Reported from at least 12 localities in this region. |
| ⓘ Spessartine ? Formula: Mn2+3Al2(SiO4)3 Description: Reported by Bjørlykke, H.; Burger, A.J in:
Bjørlykke, H.; Burger, A.J. (1962) The age of the Bjertnes uraninite, in Notiser. Norsk Geologisk Tidsskrift [Norwegian Journal of Geology], 42 (1-2). 187-190
No analysis is provided.
|
| ⓘ Sphalerite Formula: ZnS Localities: Reported from at least 69 localities in this region. |
| ⓘ Spinel Formula: MgAl2O4 |
| ⓘ Staurolite Formula: Fe2+2Al9Si4O23(OH) Locality: Kisgruva, Kongsberg, Buskerud, Norway |
| ⓘ Stellerite Formula: Ca4(Si28Al8)O72 · 28H2O Localities: Reported from at least 8 localities in this region. |
| ⓘ Stephanite Formula: Ag5SbS4 Localities: Ulrica Shaft (Ulrike Mine), Vinoren Southern Mines, Vinoren Silver Mine Field, Flesberg, Buskerud, Norway Gottes Hülfe in der Noth Mine, Overberget Mining Field, Kongsberg, Buskerud, Norway Kongsberg silver mining district, Buskerud, Norway Haus Sachsen Mine, Haus Sachsen, Overberget Mining Field, Kongsberg, Buskerud, Norway Mildigkeit Gottes Mine (Mildigkeit Mine), Overberget Mining Field, Kongsberg, Buskerud, Norway |
| ⓘ Sternbergite ? Formula: AgFe2S3 Localities: Gottes Hülfe in der Noth Mine, Overberget Mining Field, Kongsberg, Buskerud, Norway ? (more information) Kongsberg silver mining district, Buskerud, Norway ? (more information) Fräulein Christiane Mine, Underberget Mining Field, Kongsberg, Buskerud, Norway ? (more information) Kongens Mine, Overberget Mining Field, Kongsberg, Buskerud, Norway ? (more information) Description: Brünnich describe "sølv-holdig kis" (silver bearing sulphide) from this mine. Probably sternbergite. |
| ⓘ Stevensite Formula: (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| ⓘ Stibnite ? Formula: Sb2S3 |
| ⓘ 'Stilbite Subgroup' Formula: M6-7[Al8-9Si27-28O72] · nH2O Localities: Reported from at least 14 localities in this region. Description: Analyzed with XRD, can also theoretically be stellerite |
| ⓘ Stilpnomelane Formula: K4Fe2+48[Si64Al8]O164(OH)52 · nH2O |
| ⓘ Stishovite Formula: SiO2 |
| ⓘ Formula: Pb(WO4) Locality: Foss, Nedre Eggedal, Sigdal, Buskerud, Norway - erroneously reported Description: Later shown to be wulfenite (Neumann 1985). |
| ⓘ Strontianite Formula: SrCO3 References: Zozulya, Dmitry R., Kullerud, Kåre, Ribacki, Enrico, Altenberger, Uwe, Sudo, Masafumi, Savchenko, Yevgeny E. (2020) The Newly Discovered Neoproterozoic Aillikite Occurrence in Vinoren (Southern Norway): Age, Geodynamic Position and Mineralogical Evidence of Diamond-Bearing Mantle Source. Minerals, 10 (11) 1029 doi:10.3390/min10111029 |
| ⓘ Studtite Formula: [(UO2)(O2)(H2O)2] · H2O Description: Occurs as rare pale yellow to reddish yellow radial fans with a silky appearance. Found on uranophane on the surface of altered uraninite. |
| ⓘ Sylvite Formula: KCl |
| ⓘ Synchysite-(Ce) Formula: CaCe(CO3)2F Localities: Habit: hexagonal prisms Colour: white, red Description: Found in cavities in "drammens-granite", as small crystals to 1mm in or near titanite pseudomorphs. |
| ⓘ 'Synchysite Group' |
| ⓘ Szaibélyite Formula: MgBO2(OH) Localities: Tingelstadtjern Quarry, Modum, Buskerud, Norway Øvre Dypingdal Mine, Dypingdal serpentine-magnesite deposit, Snarum, Modum, Buskerud, Norway Nedre Dypingdal Mine, Dypingdal serpentine-magnesite deposit, Snarum, Modum, Buskerud, Norway Dypingdal serpentine-magnesite deposit, Snarum, Modum, Buskerud, Norway Description: At this locality szaibelyite occure in thin veins cutting althausite. |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 Localities: Reported from at least 12 localities in this region. |
| ⓘ Tellurobismuthite Formula: Bi2Te3 Locality: Kisgruva, Kongsberg, Buskerud, Norway References: |
| ⓘ Tengerite-(Y) Formula: Y2(CO3)3 · 2-3H2O |
| ⓘ 'Tennantite Subgroup' Formula: Cu6(Cu4C2+2)As4S12S |
| ⓘ Tetradymite Formula: Bi2Te2S |
| ⓘ 'Tetrahedrite Group' Formula: M2(A6)M1(B4 C2)X3(D4)S1(Y12)S2(Z) Localities: Mildigkeit Gottes Mine (Mildigkeit Mine), Overberget Mining Field, Kongsberg, Buskerud, Norway Gottes Hülfe in der Noth Mine, Overberget Mining Field, Kongsberg, Buskerud, Norway Kongens Mine, Overberget Mining Field, Kongsberg, Buskerud, Norway Konnerudkollen Mines (Konnerud Mines), Konnerud, Drammen, Buskerud, Norway |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S |
| ⓘ Thaumasite Formula: Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| ⓘ Thénardite Formula: Na2SO4 Description: possibly formed by dehydrated mirabilite |
| ⓘ 'Thomsonite Subgroup' |
| ⓘ Thorite Formula: Th(SiO4) Localities: Description: microscopic grain |
| ⓘ Tinnunculite Formula: C5H4N4O3 · 2H2O |
| ⓘ Titanite Formula: CaTiO(SiO4) Localities: Reported from at least 25 localities in this region. |
| ⓘ Titanite var. Yttrium-bearing Titanite Formula: (Ca,Y)TiSiO5 |
| ⓘ Topaz Formula: Al2(SiO4)(F,OH)2 |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z Localities: Reported from at least 15 localities in this region. |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ Urancalcarite Formula: Ca(UO2)3(CO3)(OH)6 · 3H2O Description: According to Kristiansen (1990) urancalcarite was found in only one sample as a yellowish crust on the surface of uraninite.
References: |
| ⓘ Uraninite Formula: UO2 |
| ⓘ Uranophane Formula: Ca(UO2)2(SiO3OH)2 · 5H2O Description: Analyzed by Chris Emproto at the Carnegie Museum of Natural History, with a Scanning Electron Microscope (SEM) and PXRD
Sample analyzed is catalogue number #0956N in the collection of Hamza. S, collected in the summer of 2025.
Uranophane at Bjertnes forms as a light yellow coating, mass and/or as rare small crystals.
Distinguished from Kasolite in the color / luster. References: |
| ⓘ Vanadinite Formula: Pb5(VO4)3Cl |
| ⓘ Vesuvianite Formula: Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 Localities: Reported from at least 20 localities in this region. |
| ⓘ 'Vesuvianite Group' Formula: [X42][X38][X28][X1][Y1][Y24][Y38][T14][T2](Si2O7)4(SiO4)10(O10)2(O11)8 Description: Reported in 1983 as "cyprine" (sensu lacto) in an article in DG-nytt [DG news], 2 (5) 14.
The identification was probably based on the bluishgreen color of a sample of vesuvianite group mineral found here. |
| ⓘ 'White mica' References: Mansur, E.; Orvik, A. A.; Henderson, I.; Miranda, A. C.; Slagstad, T.; Dare, S.; Bjerkgaard, T.; Sandstad, J. S. (2025) Formation of the Ertelien and Langedalen magmatic Ni–Cu sulfide deposits in Norway: investigating the evolution of platinum-group-element-depleted systems at convergent margins. European Journal of Mineralogy, 37 (6). 841-869 doi:10.5194/ejm-37-841-2025 |
| ⓘ Willemite Formula: Zn2SiO4 References: |
| ⓘ Wittichenite Formula: Cu3BiS3 References: |
| ⓘ Wollastonite Formula: Ca3(Si3O9) Localities: Reported from at least 11 localities in this region. |
| ⓘ Wölsendorfite Formula: Pb7(UO2)14O19(OH)4 · 12H2O References: Knut Eldjarn CollectionIdentification: XRD |
| ⓘ Wroewolfeite Formula: Cu4(SO4)(OH)6 · 2H2O |
| ⓘ Wulfenite Formula: Pb(MoO4) Localities: Reported from at least 13 localities in this region. |
| ⓘ Xenotime-(Y) Formula: Y(PO4) |
| ⓘ Yukonite Formula: Ca3Fe3+(AsO4)2(OH)3 · 5H2O |
| ⓘ Zellerite Formula: Ca(UO2)(CO3)2 · 5H2O Fluorescence: light yellowgreen in LW Description: Could also possibly be metazellerite. Found together with calcite and liebigite. |
| ⓘ Zeunerite Formula: Cu(UO2)2(AsO4)2 · 12H2O References: Knut Eldjarn CollectionIdentification: SEM-EDS |
| ⓘ Zincite ? Formula: ZnO Description: Only observed by Goldschmidt in thinsection-slice of marble once as unregular grains in mm size.
The identificatiion is unconfirmed. |
| ⓘ Zircon Formula: Zr(SiO4) Localities: Reported from at least 16 localities in this region. |
| ⓘ Zoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) Locality: Haugfoss, Modum, Buskerud, Norway |
| ⓘ Zussmanite ? Formula: K(Fe,Mg,Mn)13(Si,Al)18O42(OH)14 Locality: E 134 Road, Drammen, Buskerud, Norway Description: The specimen identified as zussmanite was found during construction of the E134 road, close to the Narverud mines, and only as a loose rock of Drammensgranite (a biotite granite). NOTE: The identification made at the Bulgarian Academy of Science in Sofia, is highly questionable, several analysis made there on norwegian materiaL has showed by newer analysis to be erronously. Thus the identification as zusmannite needs to be confirmed (K.E.Larsen commentary 2011) References: |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Silver var. Amalgam | 1.AA.05 | (Ag,Hg) |
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Native Gold var. Electrum | 1.AA.05 | (Au,Ag) |
| ⓘ | 1.AA.05 | Au | |
| ⓘ | Native Silver var. Kongsbergite (TL) | 1.AA.05 | (Ag,Hg) |
| ⓘ | 1.AA.05 | Ag | |
| ⓘ | Eugenite ? | 1.AD.15c | Ag11Hg2 |
| ⓘ | Native Antimony | 1.CA.05 | Sb |
| ⓘ | Native Arsenic | 1.CA.05 | As |
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| ⓘ | Graphite | 1.CB.05a | C |
| ⓘ | Native Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Allargentum | 2.AA.30 | (Ag1-xSbx) |
| ⓘ | Dyscrasite | 2.AA.35 | Ag3Sb |
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Digenite | 2.BA.10 | Cu9S5 |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Jalpaite | 2.BA.45 | Ag3CuS2 |
| ⓘ | Eucairite | 2.BA.50 | AgCuSe |
| ⓘ | Aguilarite | 2.BA.55 | Ag4SeS |
| ⓘ | Naumannite | 2.BA.55 | Ag2Se |
| ⓘ | Hessite | 2.BA.60 | Ag2Te |
| ⓘ | Argentopentlandite | 2.BB.15 | Ag(Fe,Ni)8S8 |
| ⓘ | Godlevskite ? | 2.BB.15 | (Ni,Fe)9S8 |
| ⓘ | Pentlandite | 2.BB.15 | (NixFey)Σ9S8 |
| ⓘ | var. Silver-bearing Pentlandite | 2.BB.15 | (Ni,Fe,Ag)9S8 |
| ⓘ | Imiterite | 2.BD.05 | Ag2HgS2 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Nukundamite | 2.CA.10 | Cu3.33Fe0.66S4 |
| ⓘ | Hawleyite | 2.CB.05a | CdS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Idaite | 2.CB.15a | Cu5FeS6 |
| ⓘ | Greenockite | 2.CB.45 | CdS |
| ⓘ | Cubanite | 2.CB.55a | CuFe2S3 |
| ⓘ | Argentopyrite | 2.CB.65 | AgFe2S3 |
| ⓘ | Sternbergite ? | 2.CB.65 | AgFe2S3 |
| ⓘ | Nickeline | 2.CC.05 | NiAs |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Millerite | 2.CC.20 | NiS |
| ⓘ | Mackinawite | 2.CC.25 | FeS |
| ⓘ | Altaite | 2.CD.10 | PbTe |
| ⓘ | Clausthalite | 2.CD.10 | PbSe |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Cinnabar | 2.CD.15a | HgS |
| ⓘ | Carrollite | 2.DA.05 | CuCo2S4 |
| ⓘ | Linnaeite | 2.DA.05 | Co2+Co3+2S4 |
| ⓘ | Siegenite | 2.DA.05 | CoNi2S4 |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Stibnite ? | 2.DB.05 | Sb2S3 |
| ⓘ | Tellurobismuthite | 2.DC.05 | Bi2Te3 |
| ⓘ | Tetradymite | 2.DC.05 | Bi2Te2S |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Alloclasite ? | 2.EB.10b | Co1-xFexAsS |
| ⓘ | Glaucodot | 2.EB.10c | (Co0.50Fe0.50)AsS |
| ⓘ | Löllingite | 2.EB.15a | FeAs2 |
| ⓘ | Rammelsbergite ? | 2.EB.15a | NiAs2 |
| ⓘ | Safflorite | 2.EB.15a | (Co,Ni,Fe)As2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | var. Danaite | 2.EB.20 | (Fe0.90Co0.10)AsS - (Fe0.65Co0.35)AsS |
| ⓘ | Cobaltite | 2.EB.25 | CoAsS |
| ⓘ | Gersdorffite | 2.EB.25 | NiAsS |
| ⓘ | Skutterudite (TL) | 2.EC.05 | CoAs3 |
| ⓘ | Proustite ? | 2.GA.05 | Ag3AsS3 |
| ⓘ | Pyrargyrite | 2.GA.05 | Ag3SbS3 |
| ⓘ | Pyrostilpnite | 2.GA.10 | Ag3SbS3 |
| ⓘ | Wittichenite | 2.GA.20 | Cu3BiS3 |
| ⓘ | Bournonite | 2.GA.50 | PbCuSbS3 |
| ⓘ | 'Freibergite Subgroup' | 2.GB.05 | (Ag6,[Ag6]4+)(Cu4 C2+2)Sb4S12S0-1 |
| ⓘ | 'Tennantite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)As4S12S |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | Stephanite | 2.GB.10 | Ag5SbS4 |
| ⓘ | Pearceite ? | 2.GB.15 | [Ag6As2S7][Ag9CuS4] |
| ⓘ | Polybasite | 2.GB.15 | [Ag6Sb2S7][Ag9CuS4] |
| ⓘ | Emplectite | 2.HA.05 | CuBiS2 |
| ⓘ | Miargyrite | 2.HA.10 | AgSbS2 |
| ⓘ | Aikinite | 2.HB.05a | CuPbBiS3 |
| ⓘ | Boulangerite | 2.HC.15 | Pb5Sb4S11 |
| ⓘ | Cosalite | 2.JB.10 | Pb2Bi2S5 |
| ⓘ | Galenobismutite | 2.JB.25e | PbBi2S4 |
| ⓘ | Enargite | 2.KA.05 | Cu3AsS4 |
| ⓘ | Miharaite | 2.LB.05 | Cu4FePbBiS6 |
| Group 3 - Halides | |||
| ⓘ | Chlorargyrite | 3.AA.15 | AgCl |
| ⓘ | Halite | 3.AA.20 | NaCl |
| ⓘ | Sylvite | 3.AA.20 | KCl |
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| ⓘ | Hydrohalite | 3.BA.05 | NaCl · 2H2O |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | 'Pyrochlore Group' | 4.00. | A2Nb2(O,OH)6Z |
| ⓘ | Cuprite | 4.AA.10 | Cu2O |
| ⓘ | Zincite ? | 4.AB.20 | ZnO |
| ⓘ | Gahnite | 4.BB.05 | ZnAl2O4 |
| ⓘ | Magnesioferrite | 4.BB.05 | MgFe3+2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
| ⓘ | Maghemite | 4.BB.15 | (Fe3+0.67◻0.33)Fe3+2O4 |
| ⓘ | Corundum | 4.CB.05 | Al2O3 |
| ⓘ | Geikielite | 4.CB.05 | MgTiO3 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Hematite var. Martite ? | 4.CB.05 | Fe2O3 |
| ⓘ | Pyrophanite | 4.CB.05 | Mn2+TiO3 |
| ⓘ | Bismite | 4.CB.60 | Bi2O3 |
| ⓘ | Haitaite-(La) | 4.CC. | LaU4+Fe3+2(Ti13Fe2+4Fe3+)O38 |
| ⓘ | Mianningite ? | 4.CC.20 | (◻,Pb,Ce,Na)(U4+,Mn,U6+)Fe3+2 (Ti,Fe3+)18O38 |
| ⓘ | Davidite-(La) ? | 4.CC.40 | La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| ⓘ | Quartz var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Rock Crystal | 4.DA.05 | SiO2 |
| ⓘ | var. Sceptre Quartz | 4.DA.05 | SiO2 |
| ⓘ | Opal var. Opal-AN | 4.DA.10 | SiO2 · nH2O |
| ⓘ | 4.DA.10 | SiO2 · nH2O | |
| ⓘ | Stishovite | 4.DA.40 | SiO2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Rutile var. Ilmenorutile | 4.DB.05 | (Ti,Nb)O2 |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Pyrolusite var. Polianite | 4.DB.05 | morphological variety |
| ⓘ | Hübnerite ? | 4.DB.30 | MnWO4 |
| ⓘ | Columbite-(Fe) | 4.DB.35 | Fe2+Nb2O6 |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Brookite | 4.DD.10 | TiO2 |
| ⓘ | Aeschynite-(Y) ? | 4.DF.05 | Y(TiNb)O6 |
| ⓘ | Brannerite | 4.DH.05 | UTi2O6 |
| ⓘ | Lucasite-(Ce) | 4.DH.10 | CeTi2(O,OH)6 |
| ⓘ | Hollandite | 4.DK.05a | Ba(Mn4+6Mn3+2)O16 |
| ⓘ | Romanèchite | 4.DK.10 | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| ⓘ | Uraninite | 4.DL.05 | UO2 |
| ⓘ | Diaspore | 4.FD.10 | AlO(OH) |
| ⓘ | Goethite | 4.FD.10 | Fe3+O(OH) |
| ⓘ | Manganite | 4.FD.15 | Mn3+O(OH) |
| ⓘ | Brucite | 4.FE.05 | Mg(OH)2 |
| ⓘ | Portlandite | 4.FE.05 | Ca(OH)2 |
| ⓘ | Gibbsite | 4.FE.10 | Al(OH)3 |
| ⓘ | Böhmite ? | 4.FE.15 | AlO(OH) |
| ⓘ | Lepidocrocite | 4.FE.15 | Fe3+O(OH) |
| ⓘ | Studtite | 4.GA.15 | [(UO2)(O2)(H2O)2] · H2O |
| ⓘ | Fourmarierite | 4.GB.25 | Pb(UO2)4O3(OH)4 · 4H2O |
| ⓘ | Wölsendorfite | 4.GB.30 | Pb7(UO2)14O19(OH)4 · 12H2O |
| ⓘ | Curite | 4.GB.55 | Pb3(H2O)2[(UO2)4O4(OH)3]2 |
| ⓘ | Clarkeite | 4.GC.05 | (Na,Ca,Pb)(UO2)O(OH) · 0-1H2O |
| ⓘ | Chalcomenite | 4.JH.05 | CuSeO3 · 2H2O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Magnesite | 5.AB.05 | MgCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Smithsonite | 5.AB.05 | ZnCO3 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Strontianite | 5.AB.15 | SrCO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Rosasite ? | 5.BA.10 | (Cu,Zn)2(CO3)(OH)2 |
| ⓘ | Malachite var. Zinc-bearing Malachite | 5.BA.10 | (Cu,Zn)2(CO3)(OH)2 |
| ⓘ | Aurichalcite | 5.BA.15 | (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ | Hydrozincite | 5.BA.15 | Zn5(CO3)2(OH)6 |
| ⓘ | Parisite-(Ce) | 5.BD.20b | CaCe2(CO3)3F2 |
| ⓘ | Synchysite-(Ce) | 5.BD.20c | CaCe(CO3)2F |
| ⓘ | Hydrocerussite | 5.BE.10 | Pb3(CO3)2(OH)2 |
| ⓘ | Bismutite | 5.BE.25 | (BiO)2CO3 |
| ⓘ | Brianyoungite | 5.BF.30 | Zn3(CO3,SO4)(OH)4 |
| ⓘ | Nesquehonite | 5.CA.05 | MgCO3 · 3H2O |
| ⓘ | Lansfordite | 5.CA.10 | MgCO3 · 5H2O |
| ⓘ | Monohydrocalcite | 5.CB.20 | CaCO3 · H2O |
| ⓘ | Tengerite-(Y) | 5.CC.10 | Y2(CO3)3 · 2-3H2O |
| ⓘ | Lanthanite-(La) | 5.CC.25 | La2(CO3)3 · 8H2O |
| ⓘ | Dypingite (TL) | 5.DA.05 | Mg5(CO3)4(OH)2 · 5H2O |
| ⓘ | Hydromagnesite | 5.DA.05 | Mg5(CO3)4(OH)2 · 4H2O |
| ⓘ | Quintinite | 5.DA.40 | Mg4Al2(OH)12(CO3) · 3H2O |
| ⓘ | 'Hydrotalcite-2H' | 5.DA.45 | Mg6Al2(CO3)(OH)16 · 4H2O |
| ⓘ | Hydrotalcite (TL) | 5.DA.50 | Mg6Al2(CO3)(OH)16 · 4H2O |
| ⓘ | Pyroaurite ? | 5.DA.50 | Mg6Fe3+2(OH)16[CO3] · 4H2O |
| ⓘ | Kamphaugite-(Y) (TL) | 5.DC.10 | Ca(Y,REE)(CO3)2(OH) · H2O |
| ⓘ | Urancalcarite | 5.EA.10 | Ca(UO2)3(CO3)(OH)6 · 3H2O |
| ⓘ | Kamotoite-(Y) | 5.EA.30 | Y2(UO2)4(CO3)3O4 · 14H2O |
| ⓘ | Rutherfordine | 5.EB.05 | (UO2)CO3 |
| ⓘ | Joliotite | 5.EB.15 | (UO2)CO3 · nH2O |
| ⓘ | Metazellerite | 5.EC.10 | Ca(UO2)(CO3)2 · 3H2O |
| ⓘ | Zellerite | 5.EC.10 | Ca(UO2)(CO3)2 · 5H2O |
| ⓘ | Liebigite | 5.ED.20 | Ca2(UO2)(CO3)3 · 11H2O |
| Group 6 - Borates | |||
| ⓘ | Nordenskiöldine | 6.AA.15 | CaSn4+[BO3]2 |
| ⓘ | Szaibélyite | 6.BA.15 | MgBO2(OH) |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Aphthitalite | 7.AC.35 | K3Na(SO4)2 |
| ⓘ | Thénardite | 7.AD.25 | Na2SO4 |
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Celestine | 7.AD.35 | SrSO4 |
| ⓘ | Baryte var. Hepatite | 7.AD.35 | BaSO4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Natrojarosite | 7.BC.10 | NaFe3(SO4)2(OH)6 |
| ⓘ | Linarite | 7.BC.65 | PbCu(SO4)(OH)2 |
| ⓘ | Gunningite | 7.CB.05 | ZnSO4 · H2O |
| ⓘ | Rozenite | 7.CB.15 | FeSO4 · 4H2O |
| ⓘ | Chalcanthite | 7.CB.20 | CuSO4 · 5H2O |
| ⓘ | Bianchite | 7.CB.25 | Zn(H2O)6(SO4) |
| ⓘ | Hexahydrite | 7.CB.25 | Mg(H2O)6(SO4) |
| ⓘ | Melanterite | 7.CB.35 | Fe2+(H2O)6(SO4) · H2O |
| ⓘ | Goslarite | 7.CB.40 | ZnSO4 · 7H2O |
| ⓘ | Halotrichite ? | 7.CB.85 | Fe2+Al2(SO4)4 · 22H2O |
| ⓘ | Mirabilite | 7.CD.10 | Na2SO4 · 10H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Aluminocopiapite | 7.DB.35 | Al2/3Fe3+4(SO4)6(OH)2 · 20H2O |
| ⓘ | Copiapite | 7.DB.35 | Fe2+Fe3+4(SO4)6(OH)2 · 20H2O |
| ⓘ | Fibroferrite | 7.DC.15 | Fe3+(SO4)(OH) · 5H2O |
| ⓘ | Langite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Posnjakite | 7.DD.10 | Cu4(SO4)(OH)6 · H2O |
| ⓘ | Wroewolfeite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Ktenasite | 7.DD.20 | ZnCu4(SO4)2(OH)6 · 6H2O |
| ⓘ | Devilline | 7.DD.30 | CaCu4(SO4)2(OH)6 · 3H2O |
| ⓘ | Serpierite | 7.DD.30 | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| ⓘ | Namuwite ? | 7.DD.50 | Zn4(SO4)(OH)6 · 4H2O |
| ⓘ | Schulenbergite | 7.DD.80 | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| ⓘ | Thaumasite | 7.DG.15 | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| ⓘ | Rapidcreekite | 7.DG.20 | Ca2(SO4)(CO3) · 4H2O |
| ⓘ | Fergusonite-(Y) | 7.GA.05 | YNbO4 |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| ⓘ | Stolzite ? | 7.GA.05 | Pb(WO4) |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| ⓘ | Ferrimolybdite | 7.GB.30 | Fe2(MoO4)3 · nH2O |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Xenotime-(Y) | 8.AD.35 | Y(PO4) |
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| ⓘ | Cheralite ? | 8.AD.50 | CaTh(PO4)2 |
| ⓘ | Holtedahlite (TL) | 8.BB.20 | Mg2(PO4)(OH) |
| ⓘ | Althausite (TL) | 8.BB.25 | Mg4(PO4)2(OH,O)(F,◻) |
| ⓘ | Phosphoellenbergerite | 8.BB.55 | (Mg,◻)2Mg12(PO4,PO3OH)6(PO3OH,CO3)2(OH)6 |
| ⓘ | Raadeite (TL) | 8.BE.30 | Mg7(PO4)2(OH)8 |
| ⓘ | Beudantite | 8.BL.05 | PbFe3+3(AsO4)(SO4)(OH)6 |
| ⓘ | Chlorapatite | 8.BN.05 | Ca5(PO4)3Cl |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Hydroxylapatite | 8.BN.05 | Ca5(PO4)3(OH) |
| ⓘ | Vanadinite | 8.BN.05 | Pb5(VO4)3Cl |
| ⓘ | Heneuite (TL) | 8.BO.25 | CaMg5(CO3)(PO4)3(OH) |
| ⓘ | Scorodite | 8.CD.10 | Fe3+AsO4 · 2H2O |
| ⓘ | Annabergite | 8.CE.40 | Ni3(AsO4)2 · 8H2O |
| ⓘ | Erythrite | 8.CE.40 | Co3(AsO4)2 · 8H2O |
| ⓘ | Collinsite | 8.CG.05 | Ca2Mg(PO4)2 · 2H2O |
| ⓘ | Yukonite | 8.DM.25 | Ca3Fe3+(AsO4)2(OH)3 · 5H2O |
| ⓘ | Zeunerite | 8.EB.05 | Cu(UO2)2(AsO4)2 · 12H2O |
| ⓘ | Metazeunerite | 8.EB.10 | Cu(UO2)2(AsO4)2 · 8H2O |
| Group 9 - Silicates | |||
| ⓘ | Chrysotile | 9.00. | Mg3(Si2O5)(OH)4 |
| ⓘ | Phenakite | 9.AA.05 | Be2SiO4 |
| ⓘ | Willemite | 9.AA.05 | Zn2SiO4 |
| ⓘ | Fayalite | 9.AC.05 | Fe2+2(SiO4) |
| ⓘ | Forsterite | 9.AC.05 | Mg2(SiO4) |
| ⓘ | Andradite (TL) | 9.AD.25 | Ca3Fe3+2(SiO4)3 |
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Grossular | 9.AD.25 | Ca3Al2(SiO4)3 |
| ⓘ | var. Hibschite | 9.AD.25 | Ca3Al2(SiO4)3-x(OH)4x |
| ⓘ | Andradite var. Hydroandradite | 9.AD.25 | Ca3Fe3+2(SiO4)3-x(OH)4x |
| ⓘ | Pyrope | 9.AD.25 | Mg3Al2(SiO4)3 |
| ⓘ | Spessartine ? | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Thorite | 9.AD.30 | Th(SiO4) |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Sillimanite | 9.AF.05 | Al2(SiO4)O |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Kyanite | 9.AF.15 | Al2(SiO4)O |
| ⓘ | Staurolite | 9.AF.30 | Fe2+2Al9Si4O23(OH) |
| ⓘ | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | var. Yttrium-bearing Titanite | 9.AG.15 | (Ca,Y)TiSiO5 |
| ⓘ | Datolite | 9.AJ.20 | CaB(SiO4)(OH) |
| ⓘ | Hingganite-(Y) ? | 9.AJ.20 | (Y,REE,Ca)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
| ⓘ | Kasolite | 9.AK.15 | Pb(UO2)(SiO4) · H2O |
| ⓘ | Parauranophane | 9.AK.15 | Ca(UO2)2(SiO3OH)2 · 5H2O |
| ⓘ | Uranophane | 9.AK.15 | Ca(UO2)2(SiO3OH)2 · 5H2O |
| ⓘ | Bertrandite | 9.BD.05 | Be4(Si2O7)(OH)2 |
| ⓘ | Hemimorphite | 9.BD.10 | Zn4Si2O7(OH)2 · H2O |
| ⓘ | Axinite-(Fe) | 9.BD.20 | Ca2Fe2+Al2BSi4O15OH |
| ⓘ | Axinite-(Mn) | 9.BD.20 | Ca2Mn2+Al2BSi4O15(OH) |
| ⓘ | Ilvaite | 9.BE.07 | CaFe3+Fe2+2(Si2O7)O(OH) |
| ⓘ | Manganilvaite | 9.BE.07 | CaFe2+Fe3+Mn2+(Si2O7)O(OH) |
| ⓘ | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Allanite-(Ce) | 9.BG.05b | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ | Allanite-(Y) | 9.BG.05b | (CaY)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ | Zoisite | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Vesuvianite | 9.BG.35 | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ | Kornerupine | 9.BJ.50 | Mg3Al6(Si,Al,B)5O21(OH) |
| ⓘ | Catapleiite | 9.CA.15 | Na2Zr(Si3O9) · 2H2O |
| ⓘ | Kainosite-(Y) | 9.CF.10 | Ca2Y2(SiO3)4(CO3) · H2O |
| ⓘ | Beryl var. Aquamarine | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | 9.CJ.05 | Be3Al2(Si6O18) | |
| ⓘ | Cordierite | 9.CJ.10 | Mg2Al4Si5O18 |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Armenite (TL) | 9.CM.05 | Ba(H2O)2Ca2Al3[Al3Si9O30] |
| ⓘ | Enstatite | 9.DA.05 | Mg2Si2O6 |
| ⓘ | Augite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Hedenbergite | 9.DA.15 | CaFe2+Si2O6 |
| ⓘ | Aegirine (TL) | 9.DA.25 | NaFe3+Si2O6 |
| ⓘ | Astrophyllite | 9.DC.05 | K2NaFe2+7Ti2[Si4O12]2O2(OH)4F |
| ⓘ | Anthophyllite (TL) | 9.DD.05 | ◻Mg2Mg5(Si8O22)(OH)2 |
| ⓘ | Gedrite | 9.DD.05 | ◻Mg2(Mg3Al2)(Al2Si6O22)(OH)2 |
| ⓘ | Papikeite | 9.DD.05 | NaMg2(Mg3Al2}(Al3Si5O22)(OH)2 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Ferro-edenite | 9.DE.15 | NaCa2Fe2+5(Si7Al)O22(OH)2 |
| ⓘ | Ferro-richterite | 9.DE.20 | Na(CaNa)Fe2+5(Si8O22)(OH)2 |
| ⓘ | Katophorite | 9.DE.20 | Na(CaNa){Mg4Al)(AlSi7O22)(OH)2 |
| ⓘ | Arfvedsonite | 9.DE.25 | NaNa2(Fe2+4Fe3+)Si8O22(OH)2 |
| ⓘ | Bavenite | 9.DF.25 | Ca4Be2Al2Si9O26(OH)2 |
| ⓘ | Bustamite | 9.DG.05 | CaMn2+(Si2O6) |
| ⓘ | Wollastonite | 9.DG.05 | Ca3(Si3O9) |
| ⓘ | Aenigmatite | 9.DH.40 | Na4[Fe2+10Ti2]O4[Si12O36] |
| ⓘ | Babingtonite | 9.DK.05 | Ca2Fe2+Fe3+Si5O14(OH) |
| ⓘ | Rhodonite | 9.DK.05 | CaMn3Mn[Si5O15] |
| ⓘ | Prehnite | 9.DP.20 | Ca2Al2Si3O10(OH)2 |
| ⓘ | Fluorapophyllite-(K) | 9.EA.15 | KCa4(Si8O20)(F,OH) · 8H2O |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Muscovite var. Illite | 9.EC.15 | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Montmorillonite | 9.EC.40 | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ | Nontronite | 9.EC.40 | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| ⓘ | Stevensite | 9.EC.45 | (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| ⓘ | Chamosite | 9.EC.55 | Fe2+5Al(AlSi3O10)(OH)8 |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | var. Pennine | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | var. Leuchtenbergite | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Dickite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Halloysite | 9.ED.10 | Al2Si2O5(OH)4 · n(H2O) |
| ⓘ | Antigorite | 9.ED.15 | Mg3(Si2O5)(OH)4 |
| ⓘ | Lizardite | 9.ED.15 | Mg3(Si2O5)(OH)4 |
| ⓘ | Allophane | 9.ED.20 | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Neotocite | 9.ED.20 | (Mn,Fe)SiO3 · H2O (?) |
| ⓘ | Palygorskite | 9.EE.20 | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| ⓘ | Sepiolite | 9.EE.25 | Mg4(Si6O15)(OH)2 · 6H2O |
| ⓘ | Zussmanite ? | 9.EG.35 | K(Fe,Mg,Mn)13(Si,Al)18O42(OH)14 |
| ⓘ | Stilpnomelane | 9.EG.40 | K4Fe2+48[Si64Al8]O164(OH)52 · nH2O |
| ⓘ | Nepheline | 9.FA.05 | Na3K(Al4Si4O16) |
| ⓘ | Microcline var. Amazonite | 9.FA.30 | K(AlSi3O8) |
| ⓘ | var. Hyalophane | 9.FA.30 | (K,Ba)[Al(Si,Al)Si2O8] |
| ⓘ | 9.FA.30 | K(AlSi3O8) | |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Andesine | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ | Anorthite | 9.FA.35 | Ca(Al2Si2O8) |
| ⓘ | Albite var. Oligoclase-Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Oligoclase | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ | Danburite | 9.FA.65 | CaB2Si2O8 |
| ⓘ | Danalite | 9.FB.10 | Be3Fe2+4(SiO4)3S |
| ⓘ | Genthelvite | 9.FB.10 | Be3Zn4(SiO4)3S |
| ⓘ | Helvine | 9.FB.10 | Be3Mn2+4(SiO4)3S |
| ⓘ | Gonnardite | 9.GA.05 | (Na,Ca)2(Si,Al)5O10 · 3H2O |
| ⓘ | Mesolite | 9.GA.05 | Na2Ca2Si9Al6O30 · 8H2O |
| ⓘ | Natrolite | 9.GA.05 | Na2Al2Si3O10 · 2H2O |
| ⓘ | Scolecite | 9.GA.05 | CaAl2Si3O10 · 3H2O |
| ⓘ | Analcime | 9.GB.05 | Na(AlSi2O6) · H2O |
| ⓘ | Laumontite | 9.GB.10 | CaAl2Si4O12 · 4H2O |
| ⓘ | Harmotome | 9.GC.10 | Ba2(Si12Al4)O32 · 12H2O |
| ⓘ | Chabazite-Ca | 9.GD.10 | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| ⓘ | Epistilbite | 9.GD.45 | CaAl2Si6O16 · 5H2O |
| ⓘ | Heulandite-Ca | 9.GE.05 | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| ⓘ | Heulandite-Ba (TL) | 9.GE.05 | (Ba,Ca,K)5(Si27Al9)O72 · 22H2O |
| ⓘ | Stellerite | 9.GE.15 | Ca4(Si28Al8)O72 · 28H2O |
| ⓘ | Brewsterite-Ba | 9.GE.20 | Ba(Al2Si6)O16 · 5H2O |
| ⓘ | Brewsterite-Sr | 9.GE.20 | Sr(Al2Si6)O16 · 5H2O |
| Group 10 - Organic Compounds | |||
| ⓘ | Tinnunculite | 10.CA.65 | C5H4N4O3 · 2H2O |
| Unclassified | |||
| ⓘ | 'K Feldspar var. Adularia' | - | KAlSi3O8 |
| ⓘ | 'Aedelforsite (of Retzius)' ? | - | |
| ⓘ | 'Alkali Feldspar' | - | |
| ⓘ | 'Amphibole Supergroup' | - | AB2C5(T8O22)W2 |
| ⓘ | 'Andesine-oligoclase' | - | |
| ⓘ | 'Biotite var. Anomite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Apophyllite Group' | - | AB4[Si8O20]X · 8H2O |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chabazite' | - | |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Davidite' ? | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Ganomatite' ? | - | |
| ⓘ | 'Gummite' | - | |
| ⓘ | 'Heulandite Subgroup' | - | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| ⓘ | 'Calcium Amphibole Subgroup var. Hornblende' ? | - | AnCa2(Z2+5-mZ3+m)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| ⓘ | 'Hypersthene' | - | (Mg,Fe)SiO3 |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Monazite Group' | - | REE(PO4) |
| ⓘ | 'Orthochrysotile' | - | Mg3(Si2O5)(OH)4 |
| ⓘ | 'Psilomelane' | - | |
| ⓘ | 'Pumpellyite Subgroup' | - | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| ⓘ | 'Stilbite Subgroup' | - | M6-7[Al8-9Si27-28O72] · nH2O |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Amphibole Supergroup var. Uralite' | - | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ | 'Fluor-uvite-Uvite Series' | - | |
| ⓘ | 'Leucoxene' | - | |
| ⓘ | 'Feldspar Group var. Perthite' | - | |
| ⓘ | 'Mica Group' | - | |
| ⓘ | 'Hellandite' ? | - | |
| ⓘ | 'Parisite' | - | Ca(Ce/La/Nd/REE)2(CO3)3F2 |
| ⓘ | 'Clinopyroxene Subgroup' | - | |
| ⓘ | 'Almandine-Spessartine Series' | - | |
| ⓘ | 'Andradite-Grossular Series' | - | |
| ⓘ | 'Actinolite-Tremolite Series' | - | |
| ⓘ | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
| ⓘ | 'Nickelskutterudite-Skutterudite Series' | - | |
| ⓘ | 'Scapolite' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ | 'Danalite-Genthelvite Series' | - | |
| ⓘ | 'Genthelvite-Helvine Series' | - | |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'Petroleum var. Bitumen' | - | |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
| ⓘ | 'Blaubleibender Covellite' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Gadolinite' | - | |
| ⓘ | 'Orthopyroxene Subgroup' | - | |
| ⓘ | 'Proustite-Pyrargyrite Series' | - | |
| ⓘ | 'Serpentine Subgroup' | - | D3[Si2O5](OH)4 |
| ⓘ | 'Glockerite' | - | Fe3+4(SO4)(OH)10 · 1-3H2O ? |
| ⓘ | 'Manganese Oxides' | - | |
| ⓘ | 'Thomsonite Subgroup' | - | |
| ⓘ | 'Crichtonite Group' | - | AD21O38 or A{DE2G6Ti12}O38 |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
| ⓘ | 'Axinite Group' | - | |
| ⓘ | 'Olivine Group' | - | M2SiO4 |
| ⓘ | 'Tetrahedrite Group' | - | M2(A6)M1(B4 C2)X3(D4)S1(Y12)S2(Z) |
| ⓘ | 'Calcium Amphibole Subgroup' | - | AnCa2(C2+5-mC3+m)(Si8-(n+m)Al(n+m))W2 |
| ⓘ | 'Vesuvianite Group' | - | [X42][X38][X28][X1][Y1][Y24][Y38][T14][T2](Si2O7)4(SiO4)10(O10)2(O11)8 |
| ⓘ | 'Gadolinite Group' ? | - | A2MQ2Si2O8φ2 |
| ⓘ | 'Synchysite Group' | - | |
| ⓘ | 'Muscovite-1M' | - | KAl2(AlSi3O10)(OH)2 |
| ⓘ | 'Kornerupine-Prismatine Series' | - | |
| ⓘ | 'Chevkinite Group' | - | |
| ⓘ | 'Nioboaeschynite' ? | - | |
| ⓘ | 'Coal blend' | - | |
| ⓘ | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| ⓘ | 'White mica' | - | |
| ⓘ | 'Astrophyllite Group' | - | |
| ⓘ | 'Feldspar Group var. Mesoperthite' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Aluminocopiapite | Al2/3Fe43+(SO4)6(OH)2 · 20H2O |
| H | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| H | ⓘ Allanite-(Y) | (CaY)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| H | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| H | ⓘ Althausite | Mg4(PO4)2(OH,O)(F,◻) |
| H | ⓘ Analcime | Na(AlSi2O6) · H2O |
| H | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| H | ⓘ Biotite var. Anomite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Anthophyllite | ◻Mg2Mg5(Si8O22)(OH)2 |
| H | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| H | ⓘ Apophyllite Group | AB4[Si8O20]X · 8H2O |
| H | ⓘ Arfvedsonite | NaNa2(Fe42+Fe3+)Si8O22(OH)2 |
| H | ⓘ Armenite | Ba(H2O)2Ca2Al3[Al3Si9O30] |
| H | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| H | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Babingtonite | Ca2Fe2+Fe3+Si5O14(OH) |
| H | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| H | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| H | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| H | ⓘ Bianchite | Zn(H2O)6(SO4) |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Böhmite | AlO(OH) |
| H | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Brucite | Mg(OH)2 |
| H | ⓘ Catapleiite | Na2Zr(Si3O9) · 2H2O |
| H | ⓘ Chalcomenite | CuSeO3 · 2H2O |
| H | ⓘ Chalcanthite | CuSO4 · 5H2O |
| H | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| H | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Clarkeite | (Na,Ca,Pb)(UO2)O(OH) · 0-1H2O |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Collinsite | Ca2Mg(PO4)2 · 2H2O |
| H | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| H | ⓘ Curite | Pb3(H2O)2[(UO2)4O4(OH)3]2 |
| H | ⓘ Davidite-(La) | La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| H | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| H | ⓘ Diaspore | AlO(OH) |
| H | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Dypingite | Mg5(CO3)4(OH)2 · 5H2O |
| H | ⓘ Datolite | CaB(SiO4)(OH) |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Epistilbite | CaAl2Si6O16 · 5H2O |
| H | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| H | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| H | ⓘ Ferro-edenite | NaCa2Fe52+(Si7Al)O22(OH)2 |
| H | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| H | ⓘ Ferro-richterite | Na(CaNa)Fe52+(Si8O22)(OH)2 |
| H | ⓘ Fibroferrite | Fe3+(SO4)(OH) · 5H2O |
| H | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| H | ⓘ Fourmarierite | Pb(UO2)4O3(OH)4 · 4H2O |
| H | ⓘ Gedrite | ◻Mg2(Mg3Al2)(Al2Si6O22)(OH)2 |
| H | ⓘ Gibbsite | Al(OH)3 |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gonnardite | (Na,Ca)2(Si,Al)5O10 · 3H2O |
| H | ⓘ Goslarite | ZnSO4 · 7H2O |
| H | ⓘ Gunningite | ZnSO4 · H2O |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Halloysite | Al2Si2O5(OH)4 · n(H2O) |
| H | ⓘ Halotrichite | Fe2+Al2(SO4)4 · 22H2O |
| H | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| H | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| H | ⓘ Heneuite | CaMg5(CO3)(PO4)3(OH) |
| H | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| H | ⓘ Hexahydrite | Mg(H2O)6(SO4) |
| H | ⓘ Grossular var. Hibschite | Ca3Al2(SiO4)3-x(OH)4x |
| H | ⓘ Hingganite-(Y) | (Y,REE,Ca)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
| H | ⓘ Holtedahlite | Mg2(PO4)(OH) |
| H | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| H | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
| H | ⓘ Andradite var. Hydroandradite | Ca3Fe23+(SiO4)3-x(OH)4x |
| H | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| H | ⓘ Hydrohalite | NaCl · 2H2O |
| H | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| H | ⓘ Hydrotalcite | Mg6Al2(CO3)(OH)16 · 4H2O |
| H | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| H | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| H | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| H | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Joliotite | (UO2)CO3 · nH2O |
| H | ⓘ Kainosite-(Y) | Ca2Y2(SiO3)4(CO3) · H2O |
| H | ⓘ Kamotoite-(Y) | Y2(UO2)4(CO3)3O4 · 14H2O |
| H | ⓘ Kamphaugite-(Y) | Ca(Y,REE)(CO3)2(OH) · H2O |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Kasolite | Pb(UO2)(SiO4) · H2O |
| H | ⓘ Kornerupine | Mg3Al6(Si,Al,B)5O21(OH) |
| H | ⓘ Ktenasite | ZnCu4(SO4)2(OH)6 · 6H2O |
| H | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Lansfordite | MgCO3 · 5H2O |
| H | ⓘ Lanthanite-(La) | La2(CO3)3 · 8H2O |
| H | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| H | ⓘ Lepidocrocite | Fe3+O(OH) |
| H | ⓘ Liebigite | Ca2(UO2)(CO3)3 · 11H2O |
| H | ⓘ Linarite | PbCu(SO4)(OH)2 |
| H | ⓘ Lizardite | Mg3(Si2O5)(OH)4 |
| H | ⓘ Lucasite-(Ce) | CeTi2(O,OH)6 |
| H | ⓘ Axinite-(Mn) | Ca2Mn2+Al2BSi4O15(OH) |
| H | ⓘ Manganite | Mn3+O(OH) |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Hydrotalcite-2H | Mg6Al2(CO3)(OH)16 · 4H2O |
| H | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| H | ⓘ Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| H | ⓘ Metazellerite | Ca(UO2)(CO3)2 · 3H2O |
| H | ⓘ Metazeunerite | Cu(UO2)2(AsO4)2 · 8H2O |
| H | ⓘ Mirabilite | Na2SO4 · 10H2O |
| H | ⓘ Monohydrocalcite | CaCO3 · H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| H | ⓘ Namuwite | Zn4(SO4)(OH)6 · 4H2O |
| H | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| H | ⓘ Neotocite | (Mn,Fe)SiO3 · H2O (?) |
| H | ⓘ Nesquehonite | MgCO3 · 3H2O |
| H | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| H | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Orthochrysotile | Mg3(Si2O5)(OH)4 |
| H | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Portlandite | Ca(OH)2 |
| H | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| H | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| H | ⓘ Pumpellyite Subgroup | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| H | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
| H | ⓘ Pyroaurite | Mg6Fe23+(OH)16[CO3] · 4H2O |
| H | ⓘ Rapidcreekite | Ca2(SO4)(CO3) · 4H2O |
| H | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| H | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| H | ⓘ Rozenite | FeSO4 · 4H2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| H | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| H | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| H | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| H | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| H | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| H | ⓘ Stellerite | Ca4(Si28Al8)O72 · 28H2O |
| H | ⓘ Stevensite | (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| H | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| H | ⓘ Stilpnomelane | K4Fe482+[Si64Al8]O164(OH)52 · nH2O |
| H | ⓘ Studtite | [(UO2)(O2)(H2O)2] · H2O |
| H | ⓘ Szaibélyite | MgBO2(OH) |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Tengerite-(Y) | Y2(CO3)3 · 2-3H2O |
| H | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| H | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| H | ⓘ Urancalcarite | Ca(UO2)3(CO3)(OH)6 · 3H2O |
| H | ⓘ Parauranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| H | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| H | ⓘ Fluor-uvite-Uvite Series | |
| H | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| H | ⓘ Wölsendorfite | Pb7(UO2)14O19(OH)4 · 12H2O |
| H | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Yukonite | Ca3Fe3+(AsO4)2(OH)3 · 5H2O |
| H | ⓘ Zellerite | Ca(UO2)(CO3)2 · 5H2O |
| H | ⓘ Zeunerite | Cu(UO2)2(AsO4)2 · 12H2O |
| H | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Zussmanite | K(Fe,Mg,Mn)13(Si,Al)18O42(OH)14 |
| H | ⓘ Brewsterite-Ba | Ba(Al2Si6)O16 · 5H2O |
| H | ⓘ Brewsterite-Sr | Sr(Al2Si6)O16 · 5H2O |
| H | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| H | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| H | ⓘ Raadeite | Mg7(PO4)2(OH)8 |
| H | ⓘ Katophorite | Na(CaNa){Mg4Al)(AlSi7O22)(OH)2 |
| H | ⓘ Phosphoellenbergerite | (Mg,◻)2Mg12(PO4,PO3OH)6(PO3OH,CO3)2(OH)6 |
| H | ⓘ Quintinite | Mg4Al2(OH)12(CO3) · 3H2O |
| H | ⓘ Actinolite-Tremolite Series | |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Clinochlore var. Leuchtenbergite | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| H | ⓘ Malachite var. Zinc-bearing Malachite | (Cu,Zn)2(CO3)(OH)2 |
| H | ⓘ Glockerite | Fe43+(SO4)(OH)10 · 1-3H2O ? |
| H | ⓘ Heulandite-Ba | (Ba,Ca,K)5(Si27Al9)O72 · 22H2O |
| H | ⓘ Manganilvaite | CaFe2+Fe3+Mn2+(Si2O7)O(OH) |
| H | ⓘ Muscovite-1M | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Kornerupine-Prismatine Series | |
| H | ⓘ Papikeite | NaMg2(Mg3Al2}(Al3Si5O22)(OH)2 |
| H | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| H | ⓘ Tinnunculite | C5H4N4O3 · 2H2O |
| Be | Beryllium | |
| Be | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| Be | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Danalite | Be3Fe42+(SiO4)3S |
| Be | ⓘ Genthelvite | Be3Zn4(SiO4)3S |
| Be | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| Be | ⓘ Hingganite-(Y) | (Y,REE,Ca)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
| Be | ⓘ Phenakite | Be2SiO4 |
| Be | ⓘ Danalite-Genthelvite Series | |
| Be | ⓘ Genthelvite-Helvine Series | |
| B | Boron | |
| B | ⓘ Danburite | CaB2Si2O8 |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Datolite | CaB(SiO4)(OH) |
| B | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| B | ⓘ Kornerupine | Mg3Al6(Si,Al,B)5O21(OH) |
| B | ⓘ Axinite-(Mn) | Ca2Mn2+Al2BSi4O15(OH) |
| B | ⓘ Nordenskiöldine | CaSn4+[BO3]2 |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Szaibélyite | MgBO2(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| B | ⓘ Fluor-uvite-Uvite Series | |
| B | ⓘ Kornerupine-Prismatine Series | |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Bismutite | (BiO)2CO3 |
| C | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Dypingite | Mg5(CO3)4(OH)2 · 5H2O |
| C | ⓘ Graphite | C |
| C | ⓘ Heneuite | CaMg5(CO3)(PO4)3(OH) |
| C | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| C | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| C | ⓘ Hydrotalcite | Mg6Al2(CO3)(OH)16 · 4H2O |
| C | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| C | ⓘ Joliotite | (UO2)CO3 · nH2O |
| C | ⓘ Kainosite-(Y) | Ca2Y2(SiO3)4(CO3) · H2O |
| C | ⓘ Kamotoite-(Y) | Y2(UO2)4(CO3)3O4 · 14H2O |
| C | ⓘ Kamphaugite-(Y) | Ca(Y,REE)(CO3)2(OH) · H2O |
| C | ⓘ Lansfordite | MgCO3 · 5H2O |
| C | ⓘ Lanthanite-(La) | La2(CO3)3 · 8H2O |
| C | ⓘ Liebigite | Ca2(UO2)(CO3)3 · 11H2O |
| C | ⓘ Magnesite | MgCO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Hydrotalcite-2H | Mg6Al2(CO3)(OH)16 · 4H2O |
| C | ⓘ Metazellerite | Ca(UO2)(CO3)2 · 3H2O |
| C | ⓘ Monohydrocalcite | CaCO3 · H2O |
| C | ⓘ Nesquehonite | MgCO3 · 3H2O |
| C | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| C | ⓘ Pyroaurite | Mg6Fe23+(OH)16[CO3] · 4H2O |
| C | ⓘ Rapidcreekite | Ca2(SO4)(CO3) · 4H2O |
| C | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| C | ⓘ Rutherfordine | (UO2)CO3 |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Smithsonite | ZnCO3 |
| C | ⓘ Strontianite | SrCO3 |
| C | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| C | ⓘ Tengerite-(Y) | Y2(CO3)3 · 2-3H2O |
| C | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| C | ⓘ Urancalcarite | Ca(UO2)3(CO3)(OH)6 · 3H2O |
| C | ⓘ Zellerite | Ca(UO2)(CO3)2 · 5H2O |
| C | ⓘ Phosphoellenbergerite | (Mg,◻)2Mg12(PO4,PO3OH)6(PO3OH,CO3)2(OH)6 |
| C | ⓘ Quintinite | Mg4Al2(OH)12(CO3) · 3H2O |
| C | ⓘ Parisite | Ca(Ce/La/Nd/REE)2(CO3)3F2 |
| C | ⓘ Malachite var. Zinc-bearing Malachite | (Cu,Zn)2(CO3)(OH)2 |
| C | ⓘ Tinnunculite | C5H4N4O3 · 2H2O |
| N | Nitrogen | |
| N | ⓘ Tinnunculite | C5H4N4O3 · 2H2O |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| O | ⓘ Aegirine | NaFe3+Si2O6 |
| O | ⓘ Aenigmatite | Na4[Fe102+Ti2]O4[Si12O36] |
| O | ⓘ Aeschynite-(Y) | Y(TiNb)O6 |
| O | ⓘ Aluminocopiapite | Al2/3Fe43+(SO4)6(OH)2 · 20H2O |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| O | ⓘ Allanite-(Y) | (CaY)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| O | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| O | ⓘ Althausite | Mg4(PO4)2(OH,O)(F,◻) |
| O | ⓘ Microcline var. Amazonite | K(AlSi3O8) |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Amphibole Supergroup | AB2C5(T8O22)W2 |
| O | ⓘ Analcime | Na(AlSi2O6) · H2O |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| O | ⓘ Biotite var. Anomite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Anorthite | Ca(Al2Si2O8) |
| O | ⓘ Anthophyllite | ◻Mg2Mg5(Si8O22)(OH)2 |
| O | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| O | ⓘ Aphthitalite | K3Na(SO4)2 |
| O | ⓘ Apophyllite Group | AB4[Si8O20]X · 8H2O |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Arfvedsonite | NaNa2(Fe42+Fe3+)Si8O22(OH)2 |
| O | ⓘ Armenite | Ba(H2O)2Ca2Al3[Al3Si9O30] |
| O | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| O | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Babingtonite | Ca2Fe2+Fe3+Si5O14(OH) |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| O | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| O | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| O | ⓘ Bianchite | Zn(H2O)6(SO4) |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Bismite | Bi2O3 |
| O | ⓘ Bismutite | (BiO)2CO3 |
| O | ⓘ Böhmite | AlO(OH) |
| O | ⓘ Brannerite | UTi2O6 |
| O | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Brookite | TiO2 |
| O | ⓘ Bustamite | CaMn2+(Si2O6) |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Brucite | Mg(OH)2 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Catapleiite | Na2Zr(Si3O9) · 2H2O |
| O | ⓘ Celestine | SrSO4 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Chalcomenite | CuSeO3 · 2H2O |
| O | ⓘ Chalcanthite | CuSO4 · 5H2O |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| O | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| O | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Clarkeite | (Na,Ca,Pb)(UO2)O(OH) · 0-1H2O |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Collinsite | Ca2Mg(PO4)2 · 2H2O |
| O | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| O | ⓘ Cordierite | Mg2Al4Si5O18 |
| O | ⓘ Corundum | Al2O3 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Curite | Pb3(H2O)2[(UO2)4O4(OH)3]2 |
| O | ⓘ Danburite | CaB2Si2O8 |
| O | ⓘ Davidite-(La) | La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| O | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| O | ⓘ Diaspore | AlO(OH) |
| O | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Dypingite | Mg5(CO3)4(OH)2 · 5H2O |
| O | ⓘ Datolite | CaB(SiO4)(OH) |
| O | ⓘ Danalite | Be3Fe42+(SiO4)3S |
| O | ⓘ Enstatite | Mg2Si2O6 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Epistilbite | CaAl2Si6O16 · 5H2O |
| O | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| O | ⓘ Fayalite | Fe22+(SiO4) |
| O | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| O | ⓘ Ferro-edenite | NaCa2Fe52+(Si7Al)O22(OH)2 |
| O | ⓘ Fergusonite-(Y) | YNbO4 |
| O | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| O | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| O | ⓘ Ferro-richterite | Na(CaNa)Fe52+(Si8O22)(OH)2 |
| O | ⓘ Fibroferrite | Fe3+(SO4)(OH) · 5H2O |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| O | ⓘ Forsterite | Mg2(SiO4) |
| O | ⓘ Fourmarierite | Pb(UO2)4O3(OH)4 · 4H2O |
| O | ⓘ Gahnite | ZnAl2O4 |
| O | ⓘ Gedrite | ◻Mg2(Mg3Al2)(Al2Si6O22)(OH)2 |
| O | ⓘ Geikielite | MgTiO3 |
| O | ⓘ Genthelvite | Be3Zn4(SiO4)3S |
| O | ⓘ Gibbsite | Al(OH)3 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Gonnardite | (Na,Ca)2(Si,Al)5O10 · 3H2O |
| O | ⓘ Goslarite | ZnSO4 · 7H2O |
| O | ⓘ Grossular | Ca3Al2(SiO4)3 |
| O | ⓘ Gunningite | ZnSO4 · H2O |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Halloysite | Al2Si2O5(OH)4 · n(H2O) |
| O | ⓘ Halotrichite | Fe2+Al2(SO4)4 · 22H2O |
| O | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| O | ⓘ Hedenbergite | CaFe2+Si2O6 |
| O | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| O | ⓘ Heneuite | CaMg5(CO3)(PO4)3(OH) |
| O | ⓘ Baryte var. Hepatite | BaSO4 |
| O | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| O | ⓘ Hexahydrite | Mg(H2O)6(SO4) |
| O | ⓘ Grossular var. Hibschite | Ca3Al2(SiO4)3-x(OH)4x |
| O | ⓘ Hingganite-(Y) | (Y,REE,Ca)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
| O | ⓘ Hollandite | Ba(Mn64+Mn23+)O16 |
| O | ⓘ Holtedahlite | Mg2(PO4)(OH) |
| O | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| O | ⓘ Hübnerite | MnWO4 |
| O | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
| O | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| O | ⓘ Andradite var. Hydroandradite | Ca3Fe23+(SiO4)3-x(OH)4x |
| O | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| O | ⓘ Hydrohalite | NaCl · 2H2O |
| O | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| O | ⓘ Hydrotalcite | Mg6Al2(CO3)(OH)16 · 4H2O |
| O | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| O | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| O | ⓘ Hypersthene | (Mg,Fe)SiO3 |
| O | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Rutile var. Ilmenorutile | (Ti,Nb)O2 |
| O | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Joliotite | (UO2)CO3 · nH2O |
| O | ⓘ Kainosite-(Y) | Ca2Y2(SiO3)4(CO3) · H2O |
| O | ⓘ Kamotoite-(Y) | Y2(UO2)4(CO3)3O4 · 14H2O |
| O | ⓘ Kamphaugite-(Y) | Ca(Y,REE)(CO3)2(OH) · H2O |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Kasolite | Pb(UO2)(SiO4) · H2O |
| O | ⓘ Kornerupine | Mg3Al6(Si,Al,B)5O21(OH) |
| O | ⓘ Ktenasite | ZnCu4(SO4)2(OH)6 · 6H2O |
| O | ⓘ Kyanite | Al2(SiO4)O |
| O | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Lansfordite | MgCO3 · 5H2O |
| O | ⓘ Lanthanite-(La) | La2(CO3)3 · 8H2O |
| O | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| O | ⓘ Lepidocrocite | Fe3+O(OH) |
| O | ⓘ Liebigite | Ca2(UO2)(CO3)3 · 11H2O |
| O | ⓘ Linarite | PbCu(SO4)(OH)2 |
| O | ⓘ Lizardite | Mg3(Si2O5)(OH)4 |
| O | ⓘ Lucasite-(Ce) | CeTi2(O,OH)6 |
| O | ⓘ Magnesite | MgCO3 |
| O | ⓘ Magnesioferrite | MgFe23+O4 |
| O | ⓘ Axinite-(Mn) | Ca2Mn2+Al2BSi4O15(OH) |
| O | ⓘ Manganite | Mn3+O(OH) |
| O | ⓘ Maghemite | (Fe3+0.67◻0.33)Fe23+O4 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Hydrotalcite-2H | Mg6Al2(CO3)(OH)16 · 4H2O |
| O | ⓘ Hematite var. Martite | Fe2O3 |
| O | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| O | ⓘ Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| O | ⓘ Metazellerite | Ca(UO2)(CO3)2 · 3H2O |
| O | ⓘ Metazeunerite | Cu(UO2)2(AsO4)2 · 8H2O |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Mirabilite | Na2SO4 · 10H2O |
| O | ⓘ Monazite Group | REE(PO4) |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Monohydrocalcite | CaCO3 · H2O |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| O | ⓘ Namuwite | Zn4(SO4)(OH)6 · 4H2O |
| O | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| O | ⓘ Neotocite | (Mn,Fe)SiO3 · H2O (?) |
| O | ⓘ Nepheline | Na3K(Al4Si4O16) |
| O | ⓘ Nesquehonite | MgCO3 · 3H2O |
| O | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| O | ⓘ Nordenskiöldine | CaSn4+[BO3]2 |
| O | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| O | ⓘ Albite var. Oligoclase-Albite | Na(AlSi3O8) |
| O | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Orthochrysotile | Mg3(Si2O5)(OH)4 |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| O | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| O | ⓘ Phenakite | Be2SiO4 |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Portlandite | Ca(OH)2 |
| O | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| O | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| O | ⓘ Pumpellyite Subgroup | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| O | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| O | ⓘ Pyrophanite | Mn2+TiO3 |
| O | ⓘ Pyroaurite | Mg6Fe23+(OH)16[CO3] · 4H2O |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rapidcreekite | Ca2(SO4)(CO3) · 4H2O |
| O | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| O | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| O | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| O | ⓘ Rozenite | FeSO4 · 4H2O |
| O | ⓘ Rutherfordine | (UO2)CO3 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| O | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| O | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| O | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| O | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Sillimanite | Al2(SiO4)O |
| O | ⓘ Smithsonite | ZnCO3 |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Spinel | MgAl2O4 |
| O | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| O | ⓘ Stellerite | Ca4(Si28Al8)O72 · 28H2O |
| O | ⓘ Stevensite | (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| O | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| O | ⓘ Stilpnomelane | K4Fe482+[Si64Al8]O164(OH)52 · nH2O |
| O | ⓘ Stishovite | SiO2 |
| O | ⓘ Stolzite | Pb(WO4) |
| O | ⓘ Strontianite | SrCO3 |
| O | ⓘ Studtite | [(UO2)(O2)(H2O)2] · H2O |
| O | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| O | ⓘ Szaibélyite | MgBO2(OH) |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Tengerite-(Y) | Y2(CO3)3 · 2-3H2O |
| O | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| O | ⓘ Thénardite | Na2SO4 |
| O | ⓘ Thorite | Th(SiO4) |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| O | ⓘ Urancalcarite | Ca(UO2)3(CO3)(OH)6 · 3H2O |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Parauranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| O | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| O | ⓘ Fluor-uvite-Uvite Series | |
| O | ⓘ Vanadinite | Pb5(VO4)3Cl |
| O | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| O | ⓘ Willemite | Zn2SiO4 |
| O | ⓘ Wölsendorfite | Pb7(UO2)14O19(OH)4 · 12H2O |
| O | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Wollastonite | Ca3(Si3O9) |
| O | ⓘ Xenotime-(Y) | Y(PO4) |
| O | ⓘ Yukonite | Ca3Fe3+(AsO4)2(OH)3 · 5H2O |
| O | ⓘ Zellerite | Ca(UO2)(CO3)2 · 5H2O |
| O | ⓘ Zeunerite | Cu(UO2)2(AsO4)2 · 12H2O |
| O | ⓘ Zincite | ZnO |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Zussmanite | K(Fe,Mg,Mn)13(Si,Al)18O42(OH)14 |
| O | ⓘ Quartz var. Rock Crystal | SiO2 |
| O | ⓘ Brewsterite-Ba | Ba(Al2Si6)O16 · 5H2O |
| O | ⓘ Brewsterite-Sr | Sr(Al2Si6)O16 · 5H2O |
| O | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| O | ⓘ Cheralite | CaTh(PO4)2 |
| O | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| O | ⓘ Raadeite | Mg7(PO4)2(OH)8 |
| O | ⓘ Katophorite | Na(CaNa){Mg4Al)(AlSi7O22)(OH)2 |
| O | ⓘ Phosphoellenbergerite | (Mg,◻)2Mg12(PO4,PO3OH)6(PO3OH,CO3)2(OH)6 |
| O | ⓘ Quintinite | Mg4Al2(OH)12(CO3) · 3H2O |
| O | ⓘ Parisite | Ca(Ce/La/Nd/REE)2(CO3)3F2 |
| O | ⓘ Quartz var. Sceptre Quartz | SiO2 |
| O | ⓘ Titanite var. Yttrium-bearing Titanite | (Ca,Y)TiSiO5 |
| O | ⓘ Almandine-Spessartine Series | |
| O | ⓘ Andradite-Grossular Series | |
| O | ⓘ Actinolite-Tremolite Series | |
| O | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| O | ⓘ Danalite-Genthelvite Series | |
| O | ⓘ Genthelvite-Helvine Series | |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Pyroxene Group | ADSi2O6 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Clinochlore var. Leuchtenbergite | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| O | ⓘ Malachite var. Zinc-bearing Malachite | (Cu,Zn)2(CO3)(OH)2 |
| O | ⓘ Glockerite | Fe43+(SO4)(OH)10 · 1-3H2O ? |
| O | ⓘ Heulandite-Ba | (Ba,Ca,K)5(Si27Al9)O72 · 22H2O |
| O | ⓘ Manganilvaite | CaFe2+Fe3+Mn2+(Si2O7)O(OH) |
| O | ⓘ Crichtonite Group | AD21O38 or A{DE2G6Ti12}O38 |
| O | ⓘ Apatite | Ca5(PO4)3A |
| O | ⓘ Olivine Group | M2SiO4 |
| O | ⓘ Vesuvianite Group | [X42][X38][X28][X1][Y1][Y24][Y38][T14][T2](Si2O7)4(SiO4)10(O10)2(O11)8 |
| O | ⓘ Gadolinite Group | A2MQ2Si2O8φ2 |
| O | ⓘ Muscovite-1M | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Kornerupine-Prismatine Series | |
| O | ⓘ Papikeite | NaMg2(Mg3Al2}(Al3Si5O22)(OH)2 |
| O | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| O | ⓘ Mianningite | (◻,Pb,Ce,Na)(U4+,Mn,U6+)Fe23+ (Ti,Fe3+)18O38 |
| O | ⓘ Tinnunculite | C5H4N4O3 · 2H2O |
| O | ⓘ Haitaite-(La) | LaU4+Fe23+(Ti13Fe42+Fe3+)O38 |
| F | Fluorine | |
| F | ⓘ Althausite | Mg4(PO4)2(OH,O)(F,◻) |
| F | ⓘ Biotite var. Anomite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Davidite-(La) | La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| F | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| F | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| F | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| F | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| F | ⓘ Fluor-uvite-Uvite Series | |
| F | ⓘ Parisite | Ca(Ce/La/Nd/REE)2(CO3)3F2 |
| F | ⓘ Kornerupine-Prismatine Series | |
| Na | Sodium | |
| Na | ⓘ Aegirine | NaFe3+Si2O6 |
| Na | ⓘ Aenigmatite | Na4[Fe102+Ti2]O4[Si12O36] |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Na | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Aphthitalite | K3Na(SO4)2 |
| Na | ⓘ Arfvedsonite | NaNa2(Fe42+Fe3+)Si8O22(OH)2 |
| Na | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| Na | ⓘ Catapleiite | Na2Zr(Si3O9) · 2H2O |
| Na | ⓘ Clarkeite | (Na,Ca,Pb)(UO2)O(OH) · 0-1H2O |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Ferro-edenite | NaCa2Fe52+(Si7Al)O22(OH)2 |
| Na | ⓘ Ferro-richterite | Na(CaNa)Fe52+(Si8O22)(OH)2 |
| Na | ⓘ Gonnardite | (Na,Ca)2(Si,Al)5O10 · 3H2O |
| Na | ⓘ Halite | NaCl |
| Na | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Na | ⓘ Hydrohalite | NaCl · 2H2O |
| Na | ⓘ Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| Na | ⓘ Mirabilite | Na2SO4 · 10H2O |
| Na | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Na | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| Na | ⓘ Nepheline | Na3K(Al4Si4O16) |
| Na | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Na | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Na | ⓘ Albite var. Oligoclase-Albite | Na(AlSi3O8) |
| Na | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Stevensite | (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| Na | ⓘ Thénardite | Na2SO4 |
| Na | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Na | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Na | ⓘ Katophorite | Na(CaNa){Mg4Al)(AlSi7O22)(OH)2 |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Na | ⓘ Papikeite | NaMg2(Mg3Al2}(Al3Si5O22)(OH)2 |
| Na | ⓘ Mianningite | (◻,Pb,Ce,Na)(U4+,Mn,U6+)Fe23+ (Ti,Fe3+)18O38 |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Althausite | Mg4(PO4)2(OH,O)(F,◻) |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Biotite var. Anomite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Anthophyllite | ◻Mg2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Brucite | Mg(OH)2 |
| Mg | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Collinsite | Ca2Mg(PO4)2 · 2H2O |
| Mg | ⓘ Cordierite | Mg2Al4Si5O18 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Dypingite | Mg5(CO3)4(OH)2 · 5H2O |
| Mg | ⓘ Enstatite | Mg2Si2O6 |
| Mg | ⓘ Forsterite | Mg2(SiO4) |
| Mg | ⓘ Gedrite | ◻Mg2(Mg3Al2)(Al2Si6O22)(OH)2 |
| Mg | ⓘ Geikielite | MgTiO3 |
| Mg | ⓘ Heneuite | CaMg5(CO3)(PO4)3(OH) |
| Mg | ⓘ Hexahydrite | Mg(H2O)6(SO4) |
| Mg | ⓘ Holtedahlite | Mg2(PO4)(OH) |
| Mg | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| Mg | ⓘ Hydrotalcite | Mg6Al2(CO3)(OH)16 · 4H2O |
| Mg | ⓘ Hypersthene | (Mg,Fe)SiO3 |
| Mg | ⓘ Kornerupine | Mg3Al6(Si,Al,B)5O21(OH) |
| Mg | ⓘ Lansfordite | MgCO3 · 5H2O |
| Mg | ⓘ Lizardite | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Magnesite | MgCO3 |
| Mg | ⓘ Magnesioferrite | MgFe23+O4 |
| Mg | ⓘ Hydrotalcite-2H | Mg6Al2(CO3)(OH)16 · 4H2O |
| Mg | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Mg | ⓘ Nesquehonite | MgCO3 · 3H2O |
| Mg | ⓘ Orthochrysotile | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| Mg | ⓘ Pyroaurite | Mg6Fe23+(OH)16[CO3] · 4H2O |
| Mg | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| Mg | ⓘ Spinel | MgAl2O4 |
| Mg | ⓘ Stevensite | (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| Mg | ⓘ Szaibélyite | MgBO2(OH) |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Fluor-uvite-Uvite Series | |
| Mg | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Mg | ⓘ Zussmanite | K(Fe,Mg,Mn)13(Si,Al)18O42(OH)14 |
| Mg | ⓘ Raadeite | Mg7(PO4)2(OH)8 |
| Mg | ⓘ Katophorite | Na(CaNa){Mg4Al)(AlSi7O22)(OH)2 |
| Mg | ⓘ Phosphoellenbergerite | (Mg,◻)2Mg12(PO4,PO3OH)6(PO3OH,CO3)2(OH)6 |
| Mg | ⓘ Quintinite | Mg4Al2(OH)12(CO3) · 3H2O |
| Mg | ⓘ Actinolite-Tremolite Series | |
| Mg | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Clinochlore var. Leuchtenbergite | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Kornerupine-Prismatine Series | |
| Mg | ⓘ Papikeite | NaMg2(Mg3Al2}(Al3Si5O22)(OH)2 |
| Al | Aluminium | |
| Al | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Al | ⓘ Aluminocopiapite | Al2/3Fe43+(SO4)6(OH)2 · 20H2O |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Allanite-(Y) | (CaY)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Al | ⓘ Microcline var. Amazonite | K(AlSi3O8) |
| Al | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Biotite var. Anomite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Anorthite | Ca(Al2Si2O8) |
| Al | ⓘ Armenite | Ba(H2O)2Ca2Al3[Al3Si9O30] |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Böhmite | AlO(OH) |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Cordierite | Mg2Al4Si5O18 |
| Al | ⓘ Corundum | Al2O3 |
| Al | ⓘ Diaspore | AlO(OH) |
| Al | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Epistilbite | CaAl2Si6O16 · 5H2O |
| Al | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Al | ⓘ Ferro-edenite | NaCa2Fe52+(Si7Al)O22(OH)2 |
| Al | ⓘ Gahnite | ZnAl2O4 |
| Al | ⓘ Gedrite | ◻Mg2(Mg3Al2)(Al2Si6O22)(OH)2 |
| Al | ⓘ Gibbsite | Al(OH)3 |
| Al | ⓘ Gonnardite | (Na,Ca)2(Si,Al)5O10 · 3H2O |
| Al | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Al | ⓘ Halloysite | Al2Si2O5(OH)4 · n(H2O) |
| Al | ⓘ Halotrichite | Fe2+Al2(SO4)4 · 22H2O |
| Al | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| Al | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Al | ⓘ Grossular var. Hibschite | Ca3Al2(SiO4)3-x(OH)4x |
| Al | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| Al | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| Al | ⓘ Hydrotalcite | Mg6Al2(CO3)(OH)16 · 4H2O |
| Al | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Kornerupine | Mg3Al6(Si,Al,B)5O21(OH) |
| Al | ⓘ Kyanite | Al2(SiO4)O |
| Al | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Al | ⓘ Axinite-(Mn) | Ca2Mn2+Al2BSi4O15(OH) |
| Al | ⓘ Hydrotalcite-2H | Mg6Al2(CO3)(OH)16 · 4H2O |
| Al | ⓘ Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Al | ⓘ Nepheline | Na3K(Al4Si4O16) |
| Al | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Al | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Al | ⓘ Albite var. Oligoclase-Albite | Na(AlSi3O8) |
| Al | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Al | ⓘ Pumpellyite Subgroup | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| Al | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| Al | ⓘ Sillimanite | Al2(SiO4)O |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Spinel | MgAl2O4 |
| Al | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Al | ⓘ Stellerite | Ca4(Si28Al8)O72 · 28H2O |
| Al | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Al | ⓘ Stilpnomelane | K4Fe482+[Si64Al8]O164(OH)52 · nH2O |
| Al | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Al | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Al | ⓘ Fluor-uvite-Uvite Series | |
| Al | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Zussmanite | K(Fe,Mg,Mn)13(Si,Al)18O42(OH)14 |
| Al | ⓘ Brewsterite-Ba | Ba(Al2Si6)O16 · 5H2O |
| Al | ⓘ Brewsterite-Sr | Sr(Al2Si6)O16 · 5H2O |
| Al | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Al | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Al | ⓘ Katophorite | Na(CaNa){Mg4Al)(AlSi7O22)(OH)2 |
| Al | ⓘ Quintinite | Mg4Al2(OH)12(CO3) · 3H2O |
| Al | ⓘ Almandine-Spessartine Series | |
| Al | ⓘ Andradite-Grossular Series | |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Al | ⓘ Clinochlore var. Leuchtenbergite | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Heulandite-Ba | (Ba,Ca,K)5(Si27Al9)O72 · 22H2O |
| Al | ⓘ Calcium Amphibole Subgroup | AnCa2(C2+5-mCm3+)(Si8-(n+m)Al(n+m))W2 |
| Al | ⓘ Muscovite-1M | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Kornerupine-Prismatine Series | |
| Al | ⓘ Papikeite | NaMg2(Mg3Al2}(Al3Si5O22)(OH)2 |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Si | ⓘ Aegirine | NaFe3+Si2O6 |
| Si | ⓘ Aenigmatite | Na4[Fe102+Ti2]O4[Si12O36] |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Allanite-(Y) | (CaY)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Si | ⓘ Microcline var. Amazonite | K(AlSi3O8) |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Si | ⓘ Biotite var. Anomite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Anorthite | Ca(Al2Si2O8) |
| Si | ⓘ Anthophyllite | ◻Mg2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Apophyllite Group | AB4[Si8O20]X · 8H2O |
| Si | ⓘ Arfvedsonite | NaNa2(Fe42+Fe3+)Si8O22(OH)2 |
| Si | ⓘ Armenite | Ba(H2O)2Ca2Al3[Al3Si9O30] |
| Si | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| Si | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Babingtonite | Ca2Fe2+Fe3+Si5O14(OH) |
| Si | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| Si | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Bustamite | CaMn2+(Si2O6) |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Catapleiite | Na2Zr(Si3O9) · 2H2O |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Si | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Cordierite | Mg2Al4Si5O18 |
| Si | ⓘ Danburite | CaB2Si2O8 |
| Si | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Datolite | CaB(SiO4)(OH) |
| Si | ⓘ Danalite | Be3Fe42+(SiO4)3S |
| Si | ⓘ Enstatite | Mg2Si2O6 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Epistilbite | CaAl2Si6O16 · 5H2O |
| Si | ⓘ Fayalite | Fe22+(SiO4) |
| Si | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Si | ⓘ Ferro-edenite | NaCa2Fe52+(Si7Al)O22(OH)2 |
| Si | ⓘ Ferro-richterite | Na(CaNa)Fe52+(Si8O22)(OH)2 |
| Si | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| Si | ⓘ Forsterite | Mg2(SiO4) |
| Si | ⓘ Gedrite | ◻Mg2(Mg3Al2)(Al2Si6O22)(OH)2 |
| Si | ⓘ Genthelvite | Be3Zn4(SiO4)3S |
| Si | ⓘ Gonnardite | (Na,Ca)2(Si,Al)5O10 · 3H2O |
| Si | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Si | ⓘ Halloysite | Al2Si2O5(OH)4 · n(H2O) |
| Si | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| Si | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Si | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| Si | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Si | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Si | ⓘ Grossular var. Hibschite | Ca3Al2(SiO4)3-x(OH)4x |
| Si | ⓘ Hingganite-(Y) | (Y,REE,Ca)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
| Si | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| Si | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
| Si | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| Si | ⓘ Andradite var. Hydroandradite | Ca3Fe23+(SiO4)3-x(OH)4x |
| Si | ⓘ Hypersthene | (Mg,Fe)SiO3 |
| Si | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Si | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| Si | ⓘ Kainosite-(Y) | Ca2Y2(SiO3)4(CO3) · H2O |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Kasolite | Pb(UO2)(SiO4) · H2O |
| Si | ⓘ Kornerupine | Mg3Al6(Si,Al,B)5O21(OH) |
| Si | ⓘ Kyanite | Al2(SiO4)O |
| Si | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Si | ⓘ Lizardite | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Axinite-(Mn) | Ca2Mn2+Al2BSi4O15(OH) |
| Si | ⓘ Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Si | ⓘ Neotocite | (Mn,Fe)SiO3 · H2O (?) |
| Si | ⓘ Nepheline | Na3K(Al4Si4O16) |
| Si | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Si | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Si | ⓘ Albite var. Oligoclase-Albite | Na(AlSi3O8) |
| Si | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Orthochrysotile | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| Si | ⓘ Phenakite | Be2SiO4 |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Si | ⓘ Pumpellyite Subgroup | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| Si | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| Si | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| Si | ⓘ Sillimanite | Al2(SiO4)O |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Si | ⓘ Stellerite | Ca4(Si28Al8)O72 · 28H2O |
| Si | ⓘ Stevensite | (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| Si | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Si | ⓘ Stilpnomelane | K4Fe482+[Si64Al8]O164(OH)52 · nH2O |
| Si | ⓘ Stishovite | SiO2 |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| Si | ⓘ Thorite | Th(SiO4) |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| Si | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | ⓘ Parauranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Si | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Si | ⓘ Fluor-uvite-Uvite Series | |
| Si | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Si | ⓘ Willemite | Zn2SiO4 |
| Si | ⓘ Wollastonite | Ca3(Si3O9) |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Zussmanite | K(Fe,Mg,Mn)13(Si,Al)18O42(OH)14 |
| Si | ⓘ Quartz var. Rock Crystal | SiO2 |
| Si | ⓘ Brewsterite-Ba | Ba(Al2Si6)O16 · 5H2O |
| Si | ⓘ Brewsterite-Sr | Sr(Al2Si6)O16 · 5H2O |
| Si | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Si | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Si | ⓘ Katophorite | Na(CaNa){Mg4Al)(AlSi7O22)(OH)2 |
| Si | ⓘ Quartz var. Sceptre Quartz | SiO2 |
| Si | ⓘ Titanite var. Yttrium-bearing Titanite | (Ca,Y)TiSiO5 |
| Si | ⓘ Almandine-Spessartine Series | |
| Si | ⓘ Andradite-Grossular Series | |
| Si | ⓘ Actinolite-Tremolite Series | |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Si | ⓘ Danalite-Genthelvite Series | |
| Si | ⓘ Genthelvite-Helvine Series | |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Pyroxene Group | ADSi2O6 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Clinochlore var. Leuchtenbergite | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| Si | ⓘ Heulandite-Ba | (Ba,Ca,K)5(Si27Al9)O72 · 22H2O |
| Si | ⓘ Manganilvaite | CaFe2+Fe3+Mn2+(Si2O7)O(OH) |
| Si | ⓘ Olivine Group | M2SiO4 |
| Si | ⓘ Calcium Amphibole Subgroup | AnCa2(C2+5-mCm3+)(Si8-(n+m)Al(n+m))W2 |
| Si | ⓘ Vesuvianite Group | [X42][X38][X28][X1][Y1][Y24][Y38][T14][T2](Si2O7)4(SiO4)10(O10)2(O11)8 |
| Si | ⓘ Gadolinite Group | A2MQ2Si2O8φ2 |
| Si | ⓘ Muscovite-1M | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Kornerupine-Prismatine Series | |
| Si | ⓘ Papikeite | NaMg2(Mg3Al2}(Al3Si5O22)(OH)2 |
| Si | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| P | Phosphorus | |
| P | ⓘ Althausite | Mg4(PO4)2(OH,O)(F,◻) |
| P | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| P | ⓘ Collinsite | Ca2Mg(PO4)2 · 2H2O |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Heneuite | CaMg5(CO3)(PO4)3(OH) |
| P | ⓘ Holtedahlite | Mg2(PO4)(OH) |
| P | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| P | ⓘ Monazite Group | REE(PO4) |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| P | ⓘ Xenotime-(Y) | Y(PO4) |
| P | ⓘ Cheralite | CaTh(PO4)2 |
| P | ⓘ Raadeite | Mg7(PO4)2(OH)8 |
| P | ⓘ Phosphoellenbergerite | (Mg,◻)2Mg12(PO4,PO3OH)6(PO3OH,CO3)2(OH)6 |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Aguilarite | Ag4SeS |
| S | ⓘ Aikinite | CuPbBiS3 |
| S | ⓘ Aluminocopiapite | Al2/3Fe43+(SO4)6(OH)2 · 20H2O |
| S | ⓘ Alloclasite | Co1-xFexAsS |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Aphthitalite | K3Na(SO4)2 |
| S | ⓘ Argentopentlandite | Ag(Fe,Ni)8S8 |
| S | ⓘ Argentopyrite | AgFe2S3 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| S | ⓘ Bianchite | Zn(H2O)6(SO4) |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Boulangerite | Pb5Sb4S11 |
| S | ⓘ Bournonite | PbCuSbS3 |
| S | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Carrollite | CuCo2S4 |
| S | ⓘ Celestine | SrSO4 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcanthite | CuSO4 · 5H2O |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Cinnabar | HgS |
| S | ⓘ Cobaltite | CoAsS |
| S | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| S | ⓘ Cosalite | Pb2Bi2S5 |
| S | ⓘ Covellite | CuS |
| S | ⓘ Cubanite | CuFe2S3 |
| S | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| S | ⓘ Digenite | Cu9S5 |
| S | ⓘ Danalite | Be3Fe42+(SiO4)3S |
| S | ⓘ Emplectite | CuBiS2 |
| S | ⓘ Enargite | Cu3AsS4 |
| S | ⓘ Fibroferrite | Fe3+(SO4)(OH) · 5H2O |
| S | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| S | ⓘ Galena | PbS |
| S | ⓘ Galenobismutite | PbBi2S4 |
| S | ⓘ Genthelvite | Be3Zn4(SiO4)3S |
| S | ⓘ Gersdorffite | NiAsS |
| S | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| S | ⓘ Godlevskite | (Ni,Fe)9S8 |
| S | ⓘ Goslarite | ZnSO4 · 7H2O |
| S | ⓘ Greenockite | CdS |
| S | ⓘ Gunningite | ZnSO4 · H2O |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Halotrichite | Fe2+Al2(SO4)4 · 22H2O |
| S | ⓘ Hawleyite | CdS |
| S | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| S | ⓘ Baryte var. Hepatite | BaSO4 |
| S | ⓘ Hexahydrite | Mg(H2O)6(SO4) |
| S | ⓘ Idaite | Cu5FeS6 |
| S | ⓘ Imiterite | Ag2HgS2 |
| S | ⓘ Jalpaite | Ag3CuS2 |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Ktenasite | ZnCu4(SO4)2(OH)6 · 6H2O |
| S | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Linarite | PbCu(SO4)(OH)2 |
| S | ⓘ Linnaeite | Co2+Co23+S4 |
| S | ⓘ Mackinawite | FeS |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| S | ⓘ Miargyrite | AgSbS2 |
| S | ⓘ Miharaite | Cu4FePbBiS6 |
| S | ⓘ Millerite | NiS |
| S | ⓘ Mirabilite | Na2SO4 · 10H2O |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Namuwite | Zn4(SO4)(OH)6 · 4H2O |
| S | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| S | ⓘ Nukundamite | Cu3.33Fe0.66S4 |
| S | ⓘ Pearceite | [Ag6As2S7][Ag9CuS4] |
| S | ⓘ Pentlandite | (NixFey)Σ9S8 |
| S | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| S | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| S | ⓘ Proustite | Ag3AsS3 |
| S | ⓘ Pyrargyrite | Ag3SbS3 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrostilpnite | Ag3SbS3 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Rapidcreekite | Ca2(SO4)(CO3) · 4H2O |
| S | ⓘ Rozenite | FeSO4 · 4H2O |
| S | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| S | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| S | ⓘ Siegenite | CoNi2S4 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stephanite | Ag5SbS4 |
| S | ⓘ Sternbergite | AgFe2S3 |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Native Sulphur | S8 |
| S | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| S | ⓘ Tetradymite | Bi2Te2S |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| S | ⓘ Thénardite | Na2SO4 |
| S | ⓘ Wittichenite | Cu3BiS3 |
| S | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Danalite-Genthelvite Series | |
| S | ⓘ Genthelvite-Helvine Series | |
| S | ⓘ Pentlandite var. Silver-bearing Pentlandite | (Ni,Fe,Ag)9S8 |
| S | ⓘ Proustite-Pyrargyrite Series | |
| S | ⓘ Arsenopyrite var. Danaite | (Fe0.90Co0.10)AsS - (Fe0.65Co0.35)AsS |
| S | ⓘ Glockerite | Fe43+(SO4)(OH)10 · 1-3H2O ? |
| S | ⓘ Tetrahedrite Group | M2(A6)M1(B4 C2)X3(D4)S1(Y12)S2(Z) |
| Cl | Chlorine | |
| Cl | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| Cl | ⓘ Chlorargyrite | AgCl |
| Cl | ⓘ Halite | NaCl |
| Cl | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| Cl | ⓘ Hydrohalite | NaCl · 2H2O |
| Cl | ⓘ Sylvite | KCl |
| Cl | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Cl | ⓘ Vanadinite | Pb5(VO4)3Cl |
| K | Potassium | |
| K | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| K | ⓘ Microcline var. Amazonite | K(AlSi3O8) |
| K | ⓘ Biotite var. Anomite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Aphthitalite | K3Na(SO4)2 |
| K | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| K | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| K | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| K | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Nepheline | Na3K(Al4Si4O16) |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| K | ⓘ Stilpnomelane | K4Fe482+[Si64Al8]O164(OH)52 · nH2O |
| K | ⓘ Sylvite | KCl |
| K | ⓘ Zussmanite | K(Fe,Mg,Mn)13(Si,Al)18O42(OH)14 |
| K | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Heulandite-Ba | (Ba,Ca,K)5(Si27Al9)O72 · 22H2O |
| K | ⓘ Muscovite-1M | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Allanite-(Y) | (CaY)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Anorthite | Ca(Al2Si2O8) |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Armenite | Ba(H2O)2Ca2Al3[Al3Si9O30] |
| Ca | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Babingtonite | Ca2Fe2+Fe3+Si5O14(OH) |
| Ca | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| Ca | ⓘ Bustamite | CaMn2+(Si2O6) |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| Ca | ⓘ Clarkeite | (Na,Ca,Pb)(UO2)O(OH) · 0-1H2O |
| Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Collinsite | Ca2Mg(PO4)2 · 2H2O |
| Ca | ⓘ Danburite | CaB2Si2O8 |
| Ca | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Datolite | CaB(SiO4)(OH) |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Epistilbite | CaAl2Si6O16 · 5H2O |
| Ca | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Ca | ⓘ Ferro-edenite | NaCa2Fe52+(Si7Al)O22(OH)2 |
| Ca | ⓘ Ferro-richterite | Na(CaNa)Fe52+(Si8O22)(OH)2 |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Gonnardite | (Na,Ca)2(Si,Al)5O10 · 3H2O |
| Ca | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Ca | ⓘ Heneuite | CaMg5(CO3)(PO4)3(OH) |
| Ca | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Ca | ⓘ Grossular var. Hibschite | Ca3Al2(SiO4)3-x(OH)4x |
| Ca | ⓘ Hingganite-(Y) | (Y,REE,Ca)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
| Ca | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| Ca | ⓘ Andradite var. Hydroandradite | Ca3Fe23+(SiO4)3-x(OH)4x |
| Ca | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| Ca | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| Ca | ⓘ Kainosite-(Y) | Ca2Y2(SiO3)4(CO3) · H2O |
| Ca | ⓘ Kamphaugite-(Y) | Ca(Y,REE)(CO3)2(OH) · H2O |
| Ca | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Ca | ⓘ Liebigite | Ca2(UO2)(CO3)3 · 11H2O |
| Ca | ⓘ Axinite-(Mn) | Ca2Mn2+Al2BSi4O15(OH) |
| Ca | ⓘ Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| Ca | ⓘ Metazellerite | Ca(UO2)(CO3)2 · 3H2O |
| Ca | ⓘ Monohydrocalcite | CaCO3 · H2O |
| Ca | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Ca | ⓘ Nordenskiöldine | CaSn4+[BO3]2 |
| Ca | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| Ca | ⓘ Portlandite | Ca(OH)2 |
| Ca | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Ca | ⓘ Pumpellyite Subgroup | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| Ca | ⓘ Rapidcreekite | Ca2(SO4)(CO3) · 4H2O |
| Ca | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| Ca | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| Ca | ⓘ Stellerite | Ca4(Si28Al8)O72 · 28H2O |
| Ca | ⓘ Stevensite | (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| Ca | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| Ca | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Urancalcarite | Ca(UO2)3(CO3)(OH)6 · 3H2O |
| Ca | ⓘ Parauranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Ca | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Ca | ⓘ Fluor-uvite-Uvite Series | |
| Ca | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Ca | ⓘ Wollastonite | Ca3(Si3O9) |
| Ca | ⓘ Yukonite | Ca3Fe3+(AsO4)2(OH)3 · 5H2O |
| Ca | ⓘ Zellerite | Ca(UO2)(CO3)2 · 5H2O |
| Ca | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Ca | ⓘ Cheralite | CaTh(PO4)2 |
| Ca | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Ca | ⓘ Katophorite | Na(CaNa){Mg4Al)(AlSi7O22)(OH)2 |
| Ca | ⓘ Parisite | Ca(Ce/La/Nd/REE)2(CO3)3F2 |
| Ca | ⓘ Titanite var. Yttrium-bearing Titanite | (Ca,Y)TiSiO5 |
| Ca | ⓘ Andradite-Grossular Series | |
| Ca | ⓘ Actinolite-Tremolite Series | |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Heulandite-Ba | (Ba,Ca,K)5(Si27Al9)O72 · 22H2O |
| Ca | ⓘ Manganilvaite | CaFe2+Fe3+Mn2+(Si2O7)O(OH) |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ca | ⓘ Calcium Amphibole Subgroup | AnCa2(C2+5-mCm3+)(Si8-(n+m)Al(n+m))W2 |
| Ti | Titanium | |
| Ti | ⓘ Aenigmatite | Na4[Fe102+Ti2]O4[Si12O36] |
| Ti | ⓘ Aeschynite-(Y) | Y(TiNb)O6 |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Biotite var. Anomite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Brannerite | UTi2O6 |
| Ti | ⓘ Brookite | TiO2 |
| Ti | ⓘ Davidite-(La) | La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| Ti | ⓘ Geikielite | MgTiO3 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile var. Ilmenorutile | (Ti,Nb)O2 |
| Ti | ⓘ Lucasite-(Ce) | CeTi2(O,OH)6 |
| Ti | ⓘ Pyrophanite | Mn2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| Ti | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Ti | ⓘ Titanite var. Yttrium-bearing Titanite | (Ca,Y)TiSiO5 |
| Ti | ⓘ Crichtonite Group | AD21O38 or A{DE2G6Ti12}O38 |
| Ti | ⓘ Mianningite | (◻,Pb,Ce,Na)(U4+,Mn,U6+)Fe23+ (Ti,Fe3+)18O38 |
| Ti | ⓘ Haitaite-(La) | LaU4+Fe23+(Ti13Fe42+Fe3+)O38 |
| V | Vanadium | |
| V | ⓘ Davidite-(La) | La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| V | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Cr | Chromium | |
| Cr | ⓘ Davidite-(La) | La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| Mn | Manganese | |
| Mn | ⓘ Bustamite | CaMn2+(Si2O6) |
| Mn | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| Mn | ⓘ Hollandite | Ba(Mn64+Mn23+)O16 |
| Mn | ⓘ Hübnerite | MnWO4 |
| Mn | ⓘ Axinite-(Mn) | Ca2Mn2+Al2BSi4O15(OH) |
| Mn | ⓘ Manganite | Mn3+O(OH) |
| Mn | ⓘ Neotocite | (Mn,Fe)SiO3 · H2O (?) |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Pyrophanite | Mn2+TiO3 |
| Mn | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Mn | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Mn | ⓘ Zussmanite | K(Fe,Mg,Mn)13(Si,Al)18O42(OH)14 |
| Mn | ⓘ Almandine-Spessartine Series | |
| Mn | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Mn | ⓘ Genthelvite-Helvine Series | |
| Mn | ⓘ Manganilvaite | CaFe2+Fe3+Mn2+(Si2O7)O(OH) |
| Mn | ⓘ Mianningite | (◻,Pb,Ce,Na)(U4+,Mn,U6+)Fe23+ (Ti,Fe3+)18O38 |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Aegirine | NaFe3+Si2O6 |
| Fe | ⓘ Aenigmatite | Na4[Fe102+Ti2]O4[Si12O36] |
| Fe | ⓘ Aluminocopiapite | Al2/3Fe43+(SO4)6(OH)2 · 20H2O |
| Fe | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Allanite-(Y) | (CaY)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Alloclasite | Co1-xFexAsS |
| Fe | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Biotite var. Anomite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Argentopentlandite | Ag(Fe,Ni)8S8 |
| Fe | ⓘ Argentopyrite | AgFe2S3 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Arfvedsonite | NaNa2(Fe42+Fe3+)Si8O22(OH)2 |
| Fe | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| Fe | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Babingtonite | Ca2Fe2+Fe3+Si5O14(OH) |
| Fe | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Fe | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| Fe | ⓘ Cubanite | CuFe2S3 |
| Fe | ⓘ Davidite-(La) | La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| Fe | ⓘ Danalite | Be3Fe42+(SiO4)3S |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Fayalite | Fe22+(SiO4) |
| Fe | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Fe | ⓘ Ferro-edenite | NaCa2Fe52+(Si7Al)O22(OH)2 |
| Fe | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| Fe | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| Fe | ⓘ Ferro-richterite | Na(CaNa)Fe52+(Si8O22)(OH)2 |
| Fe | ⓘ Fibroferrite | Fe3+(SO4)(OH) · 5H2O |
| Fe | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| Fe | ⓘ Godlevskite | (Ni,Fe)9S8 |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Halotrichite | Fe2+Al2(SO4)4 · 22H2O |
| Fe | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Hingganite-(Y) | (Y,REE,Ca)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
| Fe | ⓘ Andradite var. Hydroandradite | Ca3Fe23+(SiO4)3-x(OH)4x |
| Fe | ⓘ Hypersthene | (Mg,Fe)SiO3 |
| Fe | ⓘ Idaite | Cu5FeS6 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Lepidocrocite | Fe3+O(OH) |
| Fe | ⓘ Löllingite | FeAs2 |
| Fe | ⓘ Magnesioferrite | MgFe23+O4 |
| Fe | ⓘ Mackinawite | FeS |
| Fe | ⓘ Maghemite | (Fe3+0.67◻0.33)Fe23+O4 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Hematite var. Martite | Fe2O3 |
| Fe | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| Fe | ⓘ Miharaite | Cu4FePbBiS6 |
| Fe | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| Fe | ⓘ Neotocite | (Mn,Fe)SiO3 · H2O (?) |
| Fe | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Fe | ⓘ Nukundamite | Cu3.33Fe0.66S4 |
| Fe | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Pyroaurite | Mg6Fe23+(OH)16[CO3] · 4H2O |
| Fe | ⓘ Rozenite | FeSO4 · 4H2O |
| Fe | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Fe | ⓘ Sternbergite | AgFe2S3 |
| Fe | ⓘ Stilpnomelane | K4Fe482+[Si64Al8]O164(OH)52 · nH2O |
| Fe | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Fe | ⓘ Yukonite | Ca3Fe3+(AsO4)2(OH)3 · 5H2O |
| Fe | ⓘ Zussmanite | K(Fe,Mg,Mn)13(Si,Al)18O42(OH)14 |
| Fe | ⓘ Almandine-Spessartine Series | |
| Fe | ⓘ Andradite-Grossular Series | |
| Fe | ⓘ Actinolite-Tremolite Series | |
| Fe | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Fe | ⓘ Danalite-Genthelvite Series | |
| Fe | ⓘ Pentlandite var. Silver-bearing Pentlandite | (Ni,Fe,Ag)9S8 |
| Fe | ⓘ Arsenopyrite var. Danaite | (Fe0.90Co0.10)AsS - (Fe0.65Co0.35)AsS |
| Fe | ⓘ Glockerite | Fe43+(SO4)(OH)10 · 1-3H2O ? |
| Fe | ⓘ Manganilvaite | CaFe2+Fe3+Mn2+(Si2O7)O(OH) |
| Fe | ⓘ Kornerupine-Prismatine Series | |
| Fe | ⓘ Mianningite | (◻,Pb,Ce,Na)(U4+,Mn,U6+)Fe23+ (Ti,Fe3+)18O38 |
| Fe | ⓘ Haitaite-(La) | LaU4+Fe23+(Ti13Fe42+Fe3+)O38 |
| Co | Cobalt | |
| Co | ⓘ Alloclasite | Co1-xFexAsS |
| Co | ⓘ Carrollite | CuCo2S4 |
| Co | ⓘ Cobaltite | CoAsS |
| Co | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| Co | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| Co | ⓘ Linnaeite | Co2+Co23+S4 |
| Co | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Co | ⓘ Siegenite | CoNi2S4 |
| Co | ⓘ Skutterudite | CoAs3 |
| Co | ⓘ Nickelskutterudite-Skutterudite Series | |
| Co | ⓘ Arsenopyrite var. Danaite | (Fe0.90Co0.10)AsS - (Fe0.65Co0.35)AsS |
| Ni | Nickel | |
| Ni | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| Ni | ⓘ Argentopentlandite | Ag(Fe,Ni)8S8 |
| Ni | ⓘ Gersdorffite | NiAsS |
| Ni | ⓘ Godlevskite | (Ni,Fe)9S8 |
| Ni | ⓘ Millerite | NiS |
| Ni | ⓘ Nickeline | NiAs |
| Ni | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Ni | ⓘ Rammelsbergite | NiAs2 |
| Ni | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Ni | ⓘ Siegenite | CoNi2S4 |
| Ni | ⓘ Nickelskutterudite-Skutterudite Series | |
| Ni | ⓘ Pentlandite var. Silver-bearing Pentlandite | (Ni,Fe,Ag)9S8 |
| Cu | Copper | |
| Cu | ⓘ Aikinite | CuPbBiS3 |
| Cu | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Bournonite | PbCuSbS3 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Carrollite | CuCo2S4 |
| Cu | ⓘ Chalcomenite | CuSeO3 · 2H2O |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcanthite | CuSO4 · 5H2O |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cubanite | CuFe2S3 |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Cu | ⓘ Digenite | Cu9S5 |
| Cu | ⓘ Emplectite | CuBiS2 |
| Cu | ⓘ Enargite | Cu3AsS4 |
| Cu | ⓘ Eucairite | AgCuSe |
| Cu | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Cu | ⓘ Idaite | Cu5FeS6 |
| Cu | ⓘ Jalpaite | Ag3CuS2 |
| Cu | ⓘ Ktenasite | ZnCu4(SO4)2(OH)6 · 6H2O |
| Cu | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Metazeunerite | Cu(UO2)2(AsO4)2 · 8H2O |
| Cu | ⓘ Miharaite | Cu4FePbBiS6 |
| Cu | ⓘ Nukundamite | Cu3.33Fe0.66S4 |
| Cu | ⓘ Pearceite | [Ag6As2S7][Ag9CuS4] |
| Cu | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| Cu | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| Cu | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Cu | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| Cu | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| Cu | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Wittichenite | Cu3BiS3 |
| Cu | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Zeunerite | Cu(UO2)2(AsO4)2 · 12H2O |
| Cu | ⓘ Malachite var. Zinc-bearing Malachite | (Cu,Zn)2(CO3)(OH)2 |
| Zn | Zinc | |
| Zn | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Zn | ⓘ Bianchite | Zn(H2O)6(SO4) |
| Zn | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| Zn | ⓘ Gahnite | ZnAl2O4 |
| Zn | ⓘ Genthelvite | Be3Zn4(SiO4)3S |
| Zn | ⓘ Goslarite | ZnSO4 · 7H2O |
| Zn | ⓘ Gunningite | ZnSO4 · H2O |
| Zn | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Zn | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| Zn | ⓘ Ktenasite | ZnCu4(SO4)2(OH)6 · 6H2O |
| Zn | ⓘ Namuwite | Zn4(SO4)(OH)6 · 4H2O |
| Zn | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Zn | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| Zn | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| Zn | ⓘ Smithsonite | ZnCO3 |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Willemite | Zn2SiO4 |
| Zn | ⓘ Zincite | ZnO |
| Zn | ⓘ Danalite-Genthelvite Series | |
| Zn | ⓘ Genthelvite-Helvine Series | |
| Zn | ⓘ Malachite var. Zinc-bearing Malachite | (Cu,Zn)2(CO3)(OH)2 |
| As | Arsenic | |
| As | ⓘ Alloclasite | Co1-xFexAsS |
| As | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Native Arsenic | As |
| As | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| As | ⓘ Cobaltite | CoAsS |
| As | ⓘ Enargite | Cu3AsS4 |
| As | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| As | ⓘ Gersdorffite | NiAsS |
| As | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| As | ⓘ Löllingite | FeAs2 |
| As | ⓘ Metazeunerite | Cu(UO2)2(AsO4)2 · 8H2O |
| As | ⓘ Nickeline | NiAs |
| As | ⓘ Pearceite | [Ag6As2S7][Ag9CuS4] |
| As | ⓘ Proustite | Ag3AsS3 |
| As | ⓘ Rammelsbergite | NiAs2 |
| As | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| As | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| As | ⓘ Skutterudite | CoAs3 |
| As | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| As | ⓘ Yukonite | Ca3Fe3+(AsO4)2(OH)3 · 5H2O |
| As | ⓘ Zeunerite | Cu(UO2)2(AsO4)2 · 12H2O |
| As | ⓘ Nickelskutterudite-Skutterudite Series | |
| As | ⓘ Proustite-Pyrargyrite Series | |
| As | ⓘ Arsenopyrite var. Danaite | (Fe0.90Co0.10)AsS - (Fe0.65Co0.35)AsS |
| Se | Selenium | |
| Se | ⓘ Aguilarite | Ag4SeS |
| Se | ⓘ Chalcomenite | CuSeO3 · 2H2O |
| Se | ⓘ Clausthalite | PbSe |
| Se | ⓘ Eucairite | AgCuSe |
| Se | ⓘ Naumannite | Ag2Se |
| Sr | Strontium | |
| Sr | ⓘ Celestine | SrSO4 |
| Sr | ⓘ Strontianite | SrCO3 |
| Sr | ⓘ Brewsterite-Sr | Sr(Al2Si6)O16 · 5H2O |
| Y | Yttrium | |
| Y | ⓘ Aeschynite-(Y) | Y(TiNb)O6 |
| Y | ⓘ Allanite-(Y) | (CaY)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Y | ⓘ Davidite-(La) | La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| Y | ⓘ Fergusonite-(Y) | YNbO4 |
| Y | ⓘ Hingganite-(Y) | (Y,REE,Ca)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
| Y | ⓘ Kainosite-(Y) | Ca2Y2(SiO3)4(CO3) · H2O |
| Y | ⓘ Kamotoite-(Y) | Y2(UO2)4(CO3)3O4 · 14H2O |
| Y | ⓘ Kamphaugite-(Y) | Ca(Y,REE)(CO3)2(OH) · H2O |
| Y | ⓘ Tengerite-(Y) | Y2(CO3)3 · 2-3H2O |
| Y | ⓘ Xenotime-(Y) | Y(PO4) |
| Y | ⓘ Titanite var. Yttrium-bearing Titanite | (Ca,Y)TiSiO5 |
| Zr | Zirconium | |
| Zr | ⓘ Catapleiite | Na2Zr(Si3O9) · 2H2O |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | ⓘ Aeschynite-(Y) | Y(TiNb)O6 |
| Nb | ⓘ Fergusonite-(Y) | YNbO4 |
| Nb | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| Nb | ⓘ Rutile var. Ilmenorutile | (Ti,Nb)O2 |
| Nb | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
| Nb | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Mo | Molybdenum | |
| Mo | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| Mo | ⓘ Molybdenite | MoS2 |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Aguilarite | Ag4SeS |
| Ag | ⓘ Allargentum | (Ag1-xSbx) |
| Ag | ⓘ Native Silver var. Amalgam | (Ag,Hg) |
| Ag | ⓘ Argentopentlandite | Ag(Fe,Ni)8S8 |
| Ag | ⓘ Argentopyrite | AgFe2S3 |
| Ag | ⓘ Chlorargyrite | AgCl |
| Ag | ⓘ Dyscrasite | Ag3Sb |
| Ag | ⓘ Native Gold var. Electrum | (Au,Ag) |
| Ag | ⓘ Eucairite | AgCuSe |
| Ag | ⓘ Eugenite | Ag11Hg2 |
| Ag | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Ag | ⓘ Hessite | Ag2Te |
| Ag | ⓘ Imiterite | Ag2HgS2 |
| Ag | ⓘ Jalpaite | Ag3CuS2 |
| Ag | ⓘ Native Silver var. Kongsbergite | (Ag,Hg) |
| Ag | ⓘ Miargyrite | AgSbS2 |
| Ag | ⓘ Naumannite | Ag2Se |
| Ag | ⓘ Pearceite | [Ag6As2S7][Ag9CuS4] |
| Ag | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| Ag | ⓘ Proustite | Ag3AsS3 |
| Ag | ⓘ Pyrargyrite | Ag3SbS3 |
| Ag | ⓘ Pyrostilpnite | Ag3SbS3 |
| Ag | ⓘ Native Silver | Ag |
| Ag | ⓘ Stephanite | Ag5SbS4 |
| Ag | ⓘ Sternbergite | AgFe2S3 |
| Ag | ⓘ Pentlandite var. Silver-bearing Pentlandite | (Ni,Fe,Ag)9S8 |
| Ag | ⓘ Proustite-Pyrargyrite Series | |
| Cd | Cadmium | |
| Cd | ⓘ Greenockite | CdS |
| Cd | ⓘ Hawleyite | CdS |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sn | ⓘ Nordenskiöldine | CaSn4+[BO3]2 |
| Sb | Antimony | |
| Sb | ⓘ Allargentum | (Ag1-xSbx) |
| Sb | ⓘ Native Antimony | Sb |
| Sb | ⓘ Boulangerite | Pb5Sb4S11 |
| Sb | ⓘ Bournonite | PbCuSbS3 |
| Sb | ⓘ Dyscrasite | Ag3Sb |
| Sb | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Sb | ⓘ Miargyrite | AgSbS2 |
| Sb | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| Sb | ⓘ Pyrargyrite | Ag3SbS3 |
| Sb | ⓘ Pyrostilpnite | Ag3SbS3 |
| Sb | ⓘ Stephanite | Ag5SbS4 |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Sb | ⓘ Proustite-Pyrargyrite Series | |
| Te | Tellurium | |
| Te | ⓘ Altaite | PbTe |
| Te | ⓘ Hessite | Ag2Te |
| Te | ⓘ Tellurobismuthite | Bi2Te3 |
| Te | ⓘ Tetradymite | Bi2Te2S |
| Ba | Barium | |
| Ba | ⓘ Armenite | Ba(H2O)2Ca2Al3[Al3Si9O30] |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| Ba | ⓘ Baryte var. Hepatite | BaSO4 |
| Ba | ⓘ Hollandite | Ba(Mn64+Mn23+)O16 |
| Ba | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| Ba | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| Ba | ⓘ Brewsterite-Ba | Ba(Al2Si6)O16 · 5H2O |
| Ba | ⓘ Heulandite-Ba | (Ba,Ca,K)5(Si27Al9)O72 · 22H2O |
| La | Lanthanum | |
| La | ⓘ Davidite-(La) | La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| La | ⓘ Lanthanite-(La) | La2(CO3)3 · 8H2O |
| La | ⓘ Parisite | Ca(Ce/La/Nd/REE)2(CO3)3F2 |
| La | ⓘ Haitaite-(La) | LaU4+Fe23+(Ti13Fe42+Fe3+)O38 |
| Ce | Cerium | |
| Ce | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ce | ⓘ Lucasite-(Ce) | CeTi2(O,OH)6 |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| Ce | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| Ce | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| Ce | ⓘ Parisite | Ca(Ce/La/Nd/REE)2(CO3)3F2 |
| Ce | ⓘ Mianningite | (◻,Pb,Ce,Na)(U4+,Mn,U6+)Fe23+ (Ti,Fe3+)18O38 |
| Nd | Neodymium | |
| Nd | ⓘ Parisite | Ca(Ce/La/Nd/REE)2(CO3)3F2 |
| W | Tungsten | |
| W | ⓘ Hübnerite | MnWO4 |
| W | ⓘ Scheelite | Ca(WO4) |
| W | ⓘ Stolzite | Pb(WO4) |
| Au | Gold | |
| Au | ⓘ Native Gold var. Electrum | (Au,Ag) |
| Au | ⓘ Native Gold | Au |
| Hg | Mercury | |
| Hg | ⓘ Native Silver var. Amalgam | (Ag,Hg) |
| Hg | ⓘ Cinnabar | HgS |
| Hg | ⓘ Eugenite | Ag11Hg2 |
| Hg | ⓘ Imiterite | Ag2HgS2 |
| Hg | ⓘ Native Silver var. Kongsbergite | (Ag,Hg) |
| Pb | Lead | |
| Pb | ⓘ Aikinite | CuPbBiS3 |
| Pb | ⓘ Altaite | PbTe |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| Pb | ⓘ Boulangerite | Pb5Sb4S11 |
| Pb | ⓘ Bournonite | PbCuSbS3 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Clarkeite | (Na,Ca,Pb)(UO2)O(OH) · 0-1H2O |
| Pb | ⓘ Clausthalite | PbSe |
| Pb | ⓘ Cosalite | Pb2Bi2S5 |
| Pb | ⓘ Curite | Pb3(H2O)2[(UO2)4O4(OH)3]2 |
| Pb | ⓘ Fourmarierite | Pb(UO2)4O3(OH)4 · 4H2O |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Galenobismutite | PbBi2S4 |
| Pb | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| Pb | ⓘ Kasolite | Pb(UO2)(SiO4) · H2O |
| Pb | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Pb | ⓘ Miharaite | Cu4FePbBiS6 |
| Pb | ⓘ Stolzite | Pb(WO4) |
| Pb | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Pb | ⓘ Wölsendorfite | Pb7(UO2)14O19(OH)4 · 12H2O |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| Pb | ⓘ Mianningite | (◻,Pb,Ce,Na)(U4+,Mn,U6+)Fe23+ (Ti,Fe3+)18O38 |
| Bi | Bismuth | |
| Bi | ⓘ Aikinite | CuPbBiS3 |
| Bi | ⓘ Bismite | Bi2O3 |
| Bi | ⓘ Native Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Bismutite | (BiO)2CO3 |
| Bi | ⓘ Cosalite | Pb2Bi2S5 |
| Bi | ⓘ Emplectite | CuBiS2 |
| Bi | ⓘ Galenobismutite | PbBi2S4 |
| Bi | ⓘ Miharaite | Cu4FePbBiS6 |
| Bi | ⓘ Tellurobismuthite | Bi2Te3 |
| Bi | ⓘ Tetradymite | Bi2Te2S |
| Bi | ⓘ Wittichenite | Cu3BiS3 |
| Th | Thorium | |
| Th | ⓘ Thorite | Th(SiO4) |
| Th | ⓘ Cheralite | CaTh(PO4)2 |
| U | Uranium | |
| U | ⓘ Brannerite | UTi2O6 |
| U | ⓘ Clarkeite | (Na,Ca,Pb)(UO2)O(OH) · 0-1H2O |
| U | ⓘ Curite | Pb3(H2O)2[(UO2)4O4(OH)3]2 |
| U | ⓘ Davidite-(La) | La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| U | ⓘ Fourmarierite | Pb(UO2)4O3(OH)4 · 4H2O |
| U | ⓘ Joliotite | (UO2)CO3 · nH2O |
| U | ⓘ Kamotoite-(Y) | Y2(UO2)4(CO3)3O4 · 14H2O |
| U | ⓘ Kasolite | Pb(UO2)(SiO4) · H2O |
| U | ⓘ Liebigite | Ca2(UO2)(CO3)3 · 11H2O |
| U | ⓘ Metazellerite | Ca(UO2)(CO3)2 · 3H2O |
| U | ⓘ Metazeunerite | Cu(UO2)2(AsO4)2 · 8H2O |
| U | ⓘ Rutherfordine | (UO2)CO3 |
| U | ⓘ Studtite | [(UO2)(O2)(H2O)2] · H2O |
| U | ⓘ Urancalcarite | Ca(UO2)3(CO3)(OH)6 · 3H2O |
| U | ⓘ Uraninite | UO2 |
| U | ⓘ Parauranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| U | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| U | ⓘ Wölsendorfite | Pb7(UO2)14O19(OH)4 · 12H2O |
| U | ⓘ Zellerite | Ca(UO2)(CO3)2 · 5H2O |
| U | ⓘ Zeunerite | Cu(UO2)2(AsO4)2 · 12H2O |
| U | ⓘ Mianningite | (◻,Pb,Ce,Na)(U4+,Mn,U6+)Fe23+ (Ti,Fe3+)18O38 |
| U | ⓘ Haitaite-(La) | LaU4+Fe23+(Ti13Fe42+Fe3+)O38 |
Geochronology
Mineralization age: Mesoproterozoic to Permian : 1463 Ma to 279.8 ± 0.7 MaImportant note: This table is based only on rock and mineral ages recorded on mindat.org for this locality and is not necessarily a complete representation of the geochronology, but does give an indication of possible mineralization events relevant to this locality. As more age information is added this table may expand in the future. A break in the table simply indicates a lack of data entered here, not necessarily a break in the geologic sequence. Grey background entries are from different, related, localities.
| Geologic Time | Rocks, Minerals and Events | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Phanerozoic | |||||||||||||
| Paleozoic | |||||||||||||
| Permian | |||||||||||||
| Cisuralian |
| ||||||||||||
| Precambrian | |||||||||||||
| Proterozoic | |||||||||||||
| Mesoproterozoic | |||||||||||||
| Stenian |
| ||||||||||||
| Calymmian |
| ||||||||||||
Fossils
There are 721 fossil localities from the PaleoBioDB database within this region.These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 721 |
|---|---|
| Youngest Fossil Listed | 423 Ma (Silurian) |
| Oldest Fossil Listed | 541 Ma (Cambrian) |
| Stratigraphic Units | Click here to view 46 stratigraphic units. |
| Fossils from Region | Click here to show the list. |
| Fossil Localities | Click to show 67 fossil localities |
- Buskerud
- Drammen
- Flesberg
- Hol
- Hole
- Ordovician🐚 Bratterud beach
- Paleozoic🐚 Bønsnes
- Late/Upper Ordovician🐚 Frognøya
- Ordovician🐚 Gomnes - Rud
- Ordovician🐚 Gomnes-Rud
- Late/Upper Ordovician🐚 Hole
- Paleozoic🐚 Nøstret
- Silurian🐚 Ringerike
- Late/Upper Ordovician🐚 Røyse
- Ordovician🐚 Røysetangen
- Late/Upper Ordovician🐚 Stamnestangen
- Paleozoic🐚 Store Svartøya
- Silurian🐚 Sønsterud farm
- Paleozoic🐚 Ullerntangen
- Late/Upper Ordovician🐚 Vestbråtan
- Late/Upper Ordovician🐚 Vestre Svartøy
- Paleozoic🐚 Vestre Svartøya
- Late/Upper Ordovician🐚 Western side of Frognöy
- Late/Upper Ordovician🐚 Western side of Frognøy
- Kongsberg
- Buskerud
- Lier
- Modum
- Øvre Eiker
- Ringerike
- Silurian🐚 Atrypa 'reticularis'-Dicoelosia alticavata Community at Ringerike
- Late/Upper Ordovician🐚 Bjørkeåsen
- Ordovician🐚 Brattstad locality
- Late/Upper Ordovician🐚 Frok
- Paleozoic🐚 Grunntjern in Vakerdalen
- Ordovician🐚 Gullerud
- Cambrian🐚 Hval
- Cambrian🐚 N. Gausdal
- Ordovician🐚 Norderhov
- Late/Upper Ordovician🐚 Rud
- Paleozoic🐚 Stavnestangen
- Cambrian🐚 Steinsvika
- Late/Upper Ordovician🐚 Vaker
- Ordovician🐚 Vesleseter
- Cambrian🐚 Viul
- Rollag
Localities in this Region
- Buskerud
- ⭔Ål
- ⭔Drammen
- ⭔Flå
- ⭔Flesberg
- ⭔Gol
- ⭔Hemsedal
- ⭔Hol
- ⭔Hole
- ⭔Kongsberg
- Barlinddalen Mines
- Blårud Mine
- Bratteskjerpet Mine
- Dildok Prospect
- Diseplass (Aas Kafeteria)
- E134 Damåsen–Saggrenda
- Eikeren-Skrim granite complex
- Eknesvarden
- Elgtjernhaug Prospect
- Ertstjern
- Fossvann
- Frederik IV Mine
- Fulsebakkåsen
- Funkelia
- Gamlegrendåsen
- Gott Vermags Mine
- Granatdammen
- Helgevannet Mining Field
- Himmelfart Mine
- Hinteløkken
- Hovdebøfjell
- Jerngruva
- Jerngruvevannet
- Jonsknuten
- Kisgruva
- Kjennerud Pegmatite
- Kjennerudvannet South
- Knutehovet Mining Field
- Kopparvollane Mine
- Kvartsdal Mine
- Labrofoss
- Lake Mykle
- Lassedalen Fluorspar Mine
- Lassedalen Fluorspar Project
- Ljøterud
- Ollebak Prospect
- Overberget Mining Field
- Rosengangen Mine
- Sankt Andreasfjell
- Smedsrud prospect
- Stalsbergtjern
- Stavsmyr
- Sulusåsen North
- Sulusåsen South
- Underberget Mining Field
- Verlorne Sohn Mine
- ⭔Krødsherad
- ⭔Lier
- Buskerud
- Lier
- ⭔Modum
- Åmot
- Amundrud Magnesite Quarry
- Aslaksby
- Berganlia
- Bergantjern
- Delesteinåsen
- Embretsfoss
- Granodiorite outrop
- Grautåsen
- Hassel iron mines
- Haugfoss
- Hvalsknatten
- Kastbråten
- Kløftefoss
- Langsrud
- Langsrudåsen Quarry
- Lysevatnet
- Mælum
- Modum West
- Overntjern
- Rødkollåsen
- Sæterås
- Sætersbergåsen
- Sibelco Nordic Spone Sand Pit
- Simostranda
- Snarum
- Sønsteby
- Stulldammen
- Svarthull
- Tarmen
- Tingelstadtjern Quarry
- ⭔Nesbyen
- ⭔Nore og Uvdal
- ⭔Øvre Eiker
- Bakke prospects
- Basserudåsen roadcut
- Bergsgruva
- Besseberg
- Darbu
- Fiskeløs prospect
- Gislerud
- Gulliksrud feldspar quarry
- Gulliksrud prospect
- Gunhildrud
- Hakavika
- Hamre
- Hellemyr
- Himsjø
- Hokksund
- Jøranrud Mines
- Kjennerudvannet North
- Knive
- Krambudalen
- Krekling
- Liverud Mine
- Minde roadcut (E 134)
- Myrhagen
- Nordre Svartskurden Mine
- Roadcut Eikernveien 444
- Roadcut RV 35 Eikerenveien
- Rundemyr
- Rv 35
- Skara Mines
- Skard Quarry
- Skarra Farm
- Skjelbreddalen
- Spissholt Mine
- Toppenhaug
- Tørrbekk
- ⭔Tryterud-Storekleiv
- Vestfossen
- ⭔Ringerike
- ⭔Rollag
- ⭔Sigdal
Other Regions, Features and Areas that Intersect
Eurasian PlateTectonic Plate
- Baltic Shield
- Sveconorwegian BeltShield
- CaledonidesOrogenic Belt
EuropeContinent
Norway
- Buskerud
- DrammensmarkaForest
- Buskerud
- Flesberg pegmatite fieldPegmatite Field
- HallingdalValley
- Kongsberg silver mining districtMining District
- TyrifjordenLake
- Oslo Volcanic ProvinceVolcanic Province
- Western Gneiss RegionGeologic Region
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Skuterud Mines, Modum West, Modum, Buskerud, Norway