Log In
This page is currently not sponsored. Click here to sponsor this page.
Get Involved with mindat.org
Mindat.org has grown through countless contributions from mineral enthusiasts, collectors, researchers and experts around the world — people just like you.
Want to take part?
1
2
3
4
Contribute
Add photos, locality information and knowledge
Every contribution helps make mindat.org better for everyone.
Area:
70,273 km2
Neighbouring regions:
Type:
Museums in region:
Other Languages:
French:
Irlande
German:
Irland
Irish Gaelic:
Éire
Italian:
Irlanda
Russian:
Ирландия
Simplified Chinese:
爱尔兰岛
Spanish:
Irlanda
Abkhaz:
Ирландиа
Achinese:
Irlandia
Adyghe:
Ирландие
Afrikaans:
Ierland
Akan:
Aereland
Albanian:
Irlanda
Alemannic:
Irland
Amharic:
አየርላንድ
Anglo-Saxon:
Īrland
Arabic:
جزيرة أيرلندا
Aragonese:
Isla d'Irlanda
Aramaic:
ܩܘܛܢܝܘܬܐ ܕܐܝܪܠܢܕ
Armenian:
Իռլանդիա
Aromanian:
Irlanda
Asturian:
Islla d'Irlanda
Avaric:
Ирландия
Aymara:
Irlandiya
Azeri:
İrlandiya
Bambara:
Irilandi
Bashkir:
Ирландия
Basque:
Irlanda
Bavarian:
Irland
Belarusian:
Ірландыя
Belarusian (Tarashkevitsa):
Ірляндыя
Bengali:
আয়ারল্যান্ড
Bishnupriya Manipuri:
আয়ারল্যান্ড
Bislama:
Ireland
Bosnian:
Irska
Breton:
Iwerzhon
Buginese:
Irlandia
Bulgarian:
Ирландия
Burmese:
အိုင်ယာလန်
Catalan:
Illa d'Irlanda
Cebuano:
Ireland
Central Bikol:
Irlandya
Central Kurdish/Sorani:
ئیرلەند
Chamorro:
Irlanda
Chavacano:
Irlanda
Chechen:
Ирланди
Cherokee:
ᎠᏲᎳᏂ
Cheyenne:
Ireland
Church Slavic:
Єирь
Chuvash:
Ирланди Республики
Classical Chinese:
愛爾蘭共和國
Cornish:
Wordhen
Corsican:
Irlanda
Crimean Tatar (Latin):
İrlandiya
Croatian:
Irska
Czech:
Irsko
Danish:
Irland
Doteli:
गणतन्त्र आयरल्यान्ड
Dutch:
Ierland
Dutch Low Saxon:
Ierlaand
Dzongkha:
ཨའིརི་ལེནཌ་
Egyptian Arabic:
ايرلاندا
Emilian-Romagnol:
Irlànda
Erzya:
Ирландия Мастор
Esperanto:
Irlando
Estonian:
Iirimaa saar
Ewe:
Ireland
Extremaduran:
Irlanda
Faroese:
Írland
Farsi/Persian:
ایرلند
Fiji Hindi:
Ireland
Finnish:
Irlanti
Franco-Provençal:
Irlande
Friulian:
Irlande
Fula:
Irlannda
Gagauz:
İrlandiya
Galician:
Illa de Irlanda
Gan:
愛爾蘭
Georgian:
ირლანდია
Greek:
Ιρλανδία
Greenlandic:
Irlandi
Guarani:
Ilánda
Gujarati:
આયરલેંડનું ગણતંત્ર
Haitian:
Ilann
Hakka:
Ireland Tó
Hausa:
Ayalan
Hawaiian:
ʻIlelani
Hebrew:
אירלנד
Hill Mari:
Ирланди
Hindi:
आयरलैण्ड
Hungarian:
Ír-sziget
Icelandic:
Írland
Ido:
Irlando
Igbo:
Ireland
Iloko:
Irlanda
Indonesian:
Pulau Irlandia
Interlingua:
Irlanda
Interlingue:
Irland
Jamaican Patois:
Airilan
Japanese:
アイルランド島
Javanese:
Pulo Irlandia
Judaeo-Spanish:
Irlanda
Kabardian:
Ирлэнд
Kabiye:
Irɩlandɩ
Kabyle:
Irland
Kalmyk:
Ирландин Орн
Kannada:
ಐರ್ಲೆಂಡ್
Kapampangan:
Irlanda
Karachay-Balkar:
Ирландия
Karakalpak:
İrlandiya
Kashmiri:
اَیَرلینٛڑ
Kashubian:
Irlandiô
Kazakh (Cyrillic Script):
Ирландия
Khmer:
អៀរឡង់
Kikuyu:
Ayalandi
Kinyarwanda:
Irilande
Komi:
Ирландия
Komi-Permyak:
Ирму
Kongo:
Irlande
Konkani:
आयर्लंड
Korean:
아일랜드섬
Kurdish (Latin Script):
Îrlenda
Kyrgyz:
Ирландия
Lao:
ໄອແລນ
Latgalian:
Eireja
Latin:
Hibernia
Latvian:
Īrija
Lezghian:
Ирландия
Ligurian:
Irlanda
Limburgian:
Ierland
Lingala:
Irlandí
Lingua Franca Nova:
Er
Lithuanian:
Airijos sala
Livvi-Karelian:
Irlandii
Lojban:
airland
Lombard:
Irlanda
Low Saxon/Low German:
Irland
Lower Sorbian:
Irska
Luganda:
Ayalandi
Luri:
ایرلند
Luxembourgish:
Irland
Macedonian:
Ирска
Malagasy:
Irlanda
Malay:
Ireland
Malayalam:
അയർലന്റ്
Maltese:
Irlanda
Manx:
Nerin
Maori:
Airangi
Marathi:
आयर्लंड
Mazanderani:
ایرلند
Meadow Mari:
Ирландий
Min Dong Chinese:
Ireland
Mingrelian:
ირლანდია
Minnan / Hokkien-Taiwanese:
Éire
Mirandese:
Irlanda
Mongolian:
Ирланд
Nahuatl:
Irtlālpan
Narom:
Républyique d'Irlande
Nauruan:
Ripubrikit Airerand
Navajo:
Bitsiighaʼ Łichííʼí Bikéyah
Neapolitan:
Irlanna
Nepali:
आइरल्याण्ड
Newar / Nepal Bhasa:
गणतन्त्र आयरल्यान्द
Norfolk:
Airiland
Northern Frisian:
Irlun
Northern Sami:
Eire
Northern Sotho:
Ireland
Norwegian:
Irland
Norwegian (Nynorsk):
Irland
Novial:
Republike de Irlande
Occitan:
Irlanda
Odia:
ଆୟରଲ୍ୟାଣ୍ଡ
Oromo:
Aayerlaandi
Ossetian:
Ирланди
Pali:
आयर्लैंड
Pangasinan:
Irlande
Papiamento:
Irlandia
Pashto:
آیرلنډ
Pfaelzisch:
Irland
Picard:
Irlinde
Piedmontese:
Irlanda
Polish:
Irlandia
Pontic Greek:
Ιρλανδία
Portuguese:
Irlanda
Punjabi:
ਆਇਰਲੈਂਡ
Quechua:
Ilanda wat'a
Ripuarian:
Irland
Romanian:
Irlanda
Romansh:
Irlanda
Rundi:
Irlanda
Russia Buriat:
Ирланд
Rusyn:
Ірьско
Samoan:
Aialani
Samogitian:
Airėjė
Sango:
Irlânde
Sanskrit:
आयर्लैंड
Sardinian:
Irlanda
Saterland Frisian:
Irlound
Scots:
Ireland
Scottish Gaelic:
Èirinn
Serbian:
Ирска
Serbo-Croatian:
Irska
Shona:
Ireland
Sicilian:
Irlanna
Silesian:
Irlandyjo
Sindhi:
آئرلينڊ
Sinhalese:
අයර්ලන්තය
Slovak:
Írsko
Slovenian:
Irska
Somali:
Ireland
South Azerbaijani:
ایرلند
Sranan Tongo:
Irikondre
Swahili:
Eire
Swati:
IYalendi
Swedish:
Irland
Tagalog:
Irlanda
Tajik (Cyrillic Script):
Ҷумҳурии Ирландия
Tamil:
அயர்லாந்து
Tarantino:
Irlanne
Tatar:
Ирландия
Telugu:
ఐర్లాండ్
Tetum:
Irlanda
Thai:
เกาะไอร์แลนด์
Tibetan (Standard):
ཨར་ལེན་ཌ།
Tigrinya:
አየርላንድ
Tok Pisin:
Aialan
Tongan:
ʻAealani
Traditional Chinese:
愛爾蘭島
Tsonga:
Ireland
Tumbuka:
Ireland
Turkish:
İrlanda
Turkmen:
Irlandiýa
Udmurt:
Ирландия шормуӵ
Ukrainian:
Ірландія
Upper Sorbian:
Irska
Urdu:
جزیرہ آئرلینڈ
Uyghur:
ئىرلاندىيە
Uzbek (Latin Script):
Irlandiya oroli
Venetian:
Irlanda
Veps:
Irlandii
Vietnamese:
Đảo Ireland
Vlax Romani:
Irland
Volapük:
Lireyän
Võro:
Iirimaa
Walloon:
Irlande
Waray:
Irlanda
Welsh:
Iwerddon
West Flemish:
Ierland
West Frisian:
Ierlân
Western Punjabi:
آئرلینڈ
Wolof:
Irlaand
Wu Chinese:
爱尔兰岛
Yakut:
Ирландия Республиката
Yiddish:
אירלאנד
Yoruba:
Írẹ́lándì
Zazaki:
İrlanda
Zeelandic:
Ierland
Zhuang:
Aiwjlanz Gunghozgoz
Zulu:
i-Ireland
In the old Gaelic political system, Ireland was divided into four provinces: Connacht, Leinster, Munster, Ulster. At present, the Republic of Ireland consists of 26 counties.
Many localities are accompanied by an ITM GPS grid reference. More details on this can be found in the link below.
Many localities are accompanied by an ITM GPS grid reference. More details on this can be found in the link below.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities318 valid minerals. 3 (TL) - type locality of valid minerals. 2 erroneous literature entries.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Acanthite Formula: Ag2S Localities: B-Zone 4611 Silver-Rich Pod, Mogul Mine (Garryard Mine; International Mogul Mines), Silvermines District, Tipperary County, Munster, Ireland Mogul Mine (Garryard Mine; International Mogul Mines), Silvermines District, Tipperary County, Munster, Ireland Tynagh Mine, Killimor, Galway County, Connacht, Ireland |
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ Adamite Formula: Zn2(AsO4)(OH) Description: Is cuprian. References: |
| ⓘ Aegirine-augite Formula: (NaaCabFe2+cMgd)(Fe3+eAlfFe2+gMgh)Si2O6 |
| ⓘ Afwillite Formula: Ca3[SiO4][SiO2(OH)2] · 2H2O References: |
| ⓘ Aikinite Formula: CuPbBiS3 |
| ⓘ Albite Formula: Na(AlSi3O8) Localities: Reported from at least 19 localities in this region. |
| ⓘ Albite var. Andesine Formula: (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ Albite var. Oligoclase Formula: (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ Allanite-(Ce) Formula: (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ 'Allanite Group' Formula: (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| ⓘ Alloclasite Formula: Co1-xFexAsS |
| ⓘ Allophane Formula: (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 Locality: Aclare, Carlow County, Leinster, Ireland |
| ⓘ Alum-(K) Formula: KAl(SO4)2 · 12H2O References: Alfredo Petrov specimen (obtained from Dr Marco Marcchesini)Identification: Visual Identification, Dealer/Collection Label, Wet Chemical |
| ⓘ Amesite Formula: Mg2Al(AlSiO5)(OH)4 Description: Matrix mineral in an altered composite quartz-feldspar porphyry in a zone of Cu-Pb-Zn-Ag mineralisation [A.
Poustie, in Brown, A. G. and Pyne, J., eds. (1982) Mineral exploration in Ireland: progress and developments 1971-1981, Irish Association for Economic Geology, Wexford Conference, 1981.97-107.] |
| ⓘ 'Amphibole Supergroup' Formula: AB2C5(T8O22)W2 References: |
| ⓘ Anatase Formula: TiO2 Localities: Knockmahon Mine, Knockmahon, Bonmahon (Bunmahon), Waterford County, Munster, Ireland Larkin's Quarry, Shannapheasteen, Costelloe, Connemara, Galway County, Connacht, Ireland Ardragh Quarry, Maam Cross, Connemara, Galway County, Connacht, Ireland Ross Island, Lough Leane, Killarney, Kerry County, Munster, Ireland |
| ⓘ Andalusite Formula: Al2(SiO4)O Localities: Reported from at least 6 localities in this region. |
| ⓘ Andalusite var. Chiastolite Formula: Al2(SiO4)O |
| ⓘ 'Andrewsite' References: |
| ⓘ Anglesite Formula: PbSO4 Localities: Reported from at least 13 localities in this region. |
| ⓘ Anhydrite Formula: CaSO4 |
| ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 Localities: Reported from at least 9 localities in this region. |
| ⓘ Annabergite Formula: Ni3(AsO4)2 · 8H2O |
| ⓘ Anorthite Formula: Ca(Al2Si2O8) |
| ⓘ Anorthite var. Labradorite Formula: (Ca,Na)[Al(Al,Si)Si2O8] |
| ⓘ 'Apatite' Formula: Ca5(PO4)3A Localities: Reported from at least 9 localities in this region. |
| ⓘ 'Apatite var. Collophane' Formula: Ca5(PO4)3(Cl/F/OH) |
| ⓘ Aragonite Formula: CaCO3 |
| ⓘ Argentotennantite-(Zn) Formula: Ag6(Cu4Zn2)As4S12S Description: Argentotennantite came from about a two metre section of the 4611 Room in an unusual buff crystalline opaque barite vein about 30cms wide and near vertical trending SSW cutting massive pyrite of the B Zone. |
| ⓘ Argyrodite Formula: Ag8GeS6 Localities: B-Zone 4611 Silver-Rich Pod, Mogul Mine (Garryard Mine; International Mogul Mines), Silvermines District, Tipperary County, Munster, Ireland Navan Mine (Tara Mine), Navan (An Uaimh), Meath County, Leinster, Ireland Mogul Mine (Garryard Mine; International Mogul Mines), Silvermines District, Tipperary County, Munster, Ireland |
| ⓘ Arsenolite Formula: As2O3 References: |
| ⓘ Arsenopyrite Formula: FeAsS Localities: Reported from at least 21 localities in this region. Colour: Steel-Grey Description: Crystals similar to Dhurode Mine material. |
| ⓘ 'Asbestos' References: |
| ⓘ Asbolane Formula: (Ni,Co)2-xMn4+(O,OH)4 · nH2O Locality: Howth, Dublin County, Leinster, Ireland References: |
| ⓘ Atacamite Formula: Cu2(OH)3Cl Localities: Knockmahon Mine, Knockmahon, Bonmahon (Bunmahon), Waterford County, Munster, Ireland Dooneen Mine, Allihies, Castletown-Bearhaven Copper Mines, Cork County, Munster, Ireland Tankardstown mine (Knockmahon Mine), Knockmahon, Bonmahon (Bunmahon), Waterford County, Munster, Ireland Stage mine, Knockmahon, Bonmahon (Bunmahon), Waterford County, Munster, Ireland |
| ⓘ Augite Formula: (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ Augite var. Ferroaugite Formula: (CaxMgyFez)(Mgy1Fez1)Si2O6 Description: S. R. Nockolds (1935) Geol. Mag. 72, 289-315. [Approximate analysis of and optical data for 'hypersthene-augite', p. 309, indicate a ferroaugite.] |
| ⓘ Augite var. Titanium-bearing Augite Formula: (Ca,Na)(Mg,Ti, Fe,Al,)(Si,Al)2O6 |
| ⓘ Aurichalcite Formula: (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ Axinite-(Mn) Formula: Ca2Mn2+Al2BSi4O15(OH) Locality: Logwood Hill, Calliagh, Ballybay-Clones Municipal District, Monaghan County, Ulster, Ireland Description: Ryback et al. (1988): "Veinlets up to 2 cm across of yellowish-brown fan-shaped masses in quartz, from an Fe-Mn deposit at Calliagh, 8 km SW of Monaghan, Co. Monaghan." |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 Localities: Reported from at least 19 localities in this region. |
| ⓘ Baryte Formula: BaSO4 Localities: Reported from at least 46 localities in this region. Habit: Chisel Shaped Colour: Translucent, White Description: Barite in massive form is particularly abundant-it being the primary ore mined although well formed crystals are incredibly rare and exceptionnally difficult to find making the single known specimen quite important. A cabinet specimen showing well formed chisel-shaped crystals and minor pyrite cubes (well oxidised, leaving little more than limonite and iron staining). Cockcomb barite has also been reported from the site. |
| ⓘ Bayldonite Formula: PbCu3(AsO4)2(OH)2 References: |
| ⓘ Beraunite Formula: Fe3+6(PO4)4O(OH)4 · 6H2O |
| ⓘ Bertrandite Formula: Be4(Si2O7)(OH)2 References: |
| ⓘ Beryl Formula: Be3Al2(Si6O18) Localities: Reported from at least 7 localities in this region. Habit: prismatic Colour: green, blue-green Description: Finger-size xls in tough matrix. Terminations very rare. Clarity - opaque to translucent. Is the largest known beryl deposit in the British Isles. |
| ⓘ Beudantite Formula: PbFe3+3(AsO4)(SO4)(OH)6 References: |
| ⓘ Bindheimite Formula: Pb2Sb2O6O |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 Localities: Reported from at least 7 localities in this region. |
| ⓘ 'Biotite var. Chromium-bearing Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 Description: contains up to 0.94% Cr203 at this locality. References: |
| ⓘ Bismuthinite Formula: Bi2S3 Locality: Ballycummisk Mine, Audley Mines, Ballydehob, Mizen Peninsula, Cork County, Munster, Ireland Description: Identified by thin-section ore microscopy. |
| ⓘ Bornite Formula: Cu5FeS4 Localities: Reported from at least 21 localities in this region. |
| ⓘ Botallackite Formula: Cu2(OH)3Cl |
| ⓘ Boulangerite Formula: Pb5Sb4S11 Localities: Reported from at least 8 localities in this region. |
| ⓘ Bournonite Formula: PbCuSbS3 Localities: Reported from at least 12 localities in this region. Habit: Tabular or Prismatic Colour: Dull black (suffering from slight dissolution). Description: Very infrequently found but some samples showed large (up to 2cm) well formed euhedral crystals. More often the crystal faces have been partially dissolved leaving them dull and pitted.
|
| ⓘ Boyleite Formula: ZnSO4 · 4H2O |
| ⓘ Brannerite Formula: UTi2O6 Localities: Description: In dolomitized greywackes at Gortdrum mine, near Tipperary, Co. Tipperary; a grain (90µm) was analysed by electron microprobe. M. J. Duane (1981) unpubl. Ph.D. thesis, University of Dublin; M. J. Duane, H. J. Welke and H. L. Allsopp (1986) Geology 14, 477-80. |
| ⓘ Braunite Formula: Mn2+Mn3+6(SiO4)O8 References: |
| ⓘ Breithauptite Formula: NiSb |
| ⓘ Brewsterite-Ba Formula: Ba(Al2Si6)O16 · 5H2O |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 Localities: Reported from at least 15 localities in this region. |
| ⓘ Brucite Formula: Mg(OH)2 |
| ⓘ Brushite Formula: Ca(PO3OH) · 2H2O Description: Thin crusts of minute colourless platy crystals from the interior of a human skull found in a cave near Kilkenny, Co. Kilkenny. BM(NH) specimen BM 1966, 512. |
| ⓘ Cacoxenite Formula: Fe3+24AlO6(PO4)17(OH)12 · 75H2O Localities: Habit: Fibrous spheres Colour: Yellow Description: Excellent specimens of cacoxenite in the form of golden yellow fibrous radiating 1mm and bunches of needles form on quartz pebble conglomerates. |
| ⓘ Calcite Formula: CaCO3 Localities: Reported from at least 94 localities in this region. Description: Probably Ireland's premier calcite location. Varied habits, crystals up to 18 cm, often pale yellowish. |
| ⓘ Calcite var. Manganese-bearing Calcite Formula: (Ca,Mn)CO3 Locality: Tara Deep deposit, Navan Mine (Tara Mine), Navan (An Uaimh), Meath County, Leinster, Ireland References: Yesares, Lola; Menuge, Julian F.; Blakeman, Robert J.; Ashton, John H.; Boyce, Adrian J.; Coller, David; Drummond, Drew A.; Farrelly, Ian (2022) Pyritic mineralization halo above the Tara Deep Zn-Pb deposit, Navan, Ireland: Evidence for sub-seafloor exhalative hydrothermal processes? Ore Geology Reviews, 140. doi:10.1016/j.oregeorev.2021.104415 |
| ⓘ Caledonite Formula: Pb5Cu2(SO4)3(CO3)(OH)6 |
| ⓘ Cassiterite Formula: SnO2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Cassiterite var. Wood Tin Formula: SnO2 |
| ⓘ Celestine Formula: SrSO4 Habit: thin platy; wedge or lozenge shaped Colour: white to pale lilac |
| ⓘ Cerussite Formula: PbCO3 Localities: Reported from at least 23 localities in this region. Description: Predominantly "jackstraw" habit. |
| ⓘ Chabazite-Ca Formula: (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| ⓘ Chalcanthite Formula: CuSO4 · 5H2O Localities: Reported from at least 6 localities in this region. |
| ⓘ Chalcocite Formula: Cu2S Localities: Reported from at least 21 localities in this region. |
| ⓘ Chalcomenite Formula: CuSeO3 · 2H2O Localities: Description: quoting from: Francis, J.G. & Ryback, G. (1987) Mineralogical Magazine, vol. 51, 751. |
| ⓘ Chalcophyllite Formula: Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O Locality: Sheeffry Mine (Tawnycrower Mine; Sheefry Mine; Sheffry Mine), Mayo County, Connacht, Ireland Description: Associated with lavendulan. References: |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 93 localities in this region. Colour: Golden metallic Description: Found in dolomite vugs in association with cinnabar or as massive lumps. |
| ⓘ Chalcosiderite Formula: CuFe3+6(PO4)4(OH)8 · 4H2O |
| ⓘ Chamosite Formula: Fe2+5Al(AlSi3O10)(OH)8 |
| ⓘ 'Chlorite Group' Localities: Reported from at least 34 localities in this region. |
| ⓘ 'Chrome-Spinel (of Dana)' |
| ⓘ Chromite Formula: Fe2+Cr3+2O4 Localities: Mooresfort meteorite (Tipperary meteorite), Tipperary County, Munster, Ireland Ballycoog, Gold Mines River, Croghan Kinshela Mountain, Wicklow County, Leinster, Ireland Limerick meteorite, Limerick County, Munster, Ireland Ross Island, Lough Leane, Killarney, Kerry County, Munster, Ireland Dooros serpentinite, Connemara, Galway County, Connacht, Ireland |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 Localities: Reported from at least 8 localities in this region. |
| ⓘ Churchite-(Y) Formula: Y(PO4) · 2H2O |
| ⓘ Cinnabar Formula: HgS Description: A vein of massive cadmian cinnabar (ca. 1.5% Cd), with inclusions of cadmian metacinnabarite (11.1% Cd) and mercurian sphalerite (12.9% Hg), occurred in the topmost part of the ore deposit. References: Embrey, Peter G. (1978) Fourth supplementary list of British minerals. Mineralogical Magazine, 42 (322) 169-177 doi:10.1180/minmag.1978.042.322.01 |
| ⓘ Clausthalite Formula: PbSe |
| ⓘ 'Clay minerals' |
| ⓘ Clinoatacamite Formula: Cu2(OH)3Cl |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ Clinochlore var. Pennine Formula: Mg5Al(AlSi3O10)(OH)8 Locality: Aclare, Carlow County, Leinster, Ireland |
| ⓘ Clinoclase Formula: Cu3(AsO4)(OH)3 |
| ⓘ 'Clinopyroxene Subgroup' Description: Many of the pyroxene grains are polysynthetically twinned 'clinobronzite' in Mason & Wiik's 1966 terminology. |
| ⓘ Clinozoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ Cobaltite Formula: CoAsS |
| ⓘ Cobaltpentlandite Formula: Co9S8 Locality: Tara Deep deposit, Navan Mine (Tara Mine), Navan (An Uaimh), Meath County, Leinster, Ireland References: Yesares, Lola; Menuge, Julian F.; Blakeman, Robert J.; Ashton, John H.; Boyce, Adrian J.; Coller, David; Drummond, Drew A.; Farrelly, Ian (2022) Pyritic mineralization halo above the Tara Deep Zn-Pb deposit, Navan, Ireland: Evidence for sub-seafloor exhalative hydrothermal processes? Ore Geology Reviews, 140. doi:10.1016/j.oregeorev.2021.104415 |
| ⓘ 'Columbite-(Fe)-Columbite-(Mn) Series' |
| ⓘ 'Columbite Group' References: |
| ⓘ Conichalcite Formula: CaCu(AsO4)(OH) |
| ⓘ Connellite Formula: Cu19(SO4)(OH)32Cl4 · 3H2O Localities: Reported from at least 9 localities in this region. Description: Small area of rich connellite underground, now mostly removed. Identified by XRD & IR. |
| ⓘ Copiapite Formula: Fe2+Fe3+4(SO4)6(OH)2 · 20H2O |
| ⓘ Cordierite Formula: Mg2Al4Si5O18 |
| ✪ Corkite (TL) Formula: PbFe3+3(PO4)(SO4)(OH)6 Type Locality: Description: Hard to find nowadays, but when specimens are found they can be quite rich. References: |
| ⓘ Cornwallite Formula: Cu5(AsO4)2(OH)4 |
| ⓘ Coronadite Formula: Pb(Mn4+6Mn3+2)O16 |
| ⓘ Corundum Formula: Al2O3 |
| ⓘ Corundum var. Sapphire Formula: Al2O3 |
| ⓘ Cosalite ? Formula: Pb2Bi2S5 |
| ⓘ Covellite Formula: CuS Localities: Reported from at least 10 localities in this region. |
| ⓘ Crandallite Formula: CaAl3(PO4)(PO3OH)(OH)6 |
| ⓘ Cryptomelane Formula: K(Mn4+7Mn3+)O16 |
| ⓘ Cubanite Formula: CuFe2S3 |
| ⓘ Cuprite Formula: Cu2O Localities: Reported from at least 10 localities in this region. |
| ⓘ Cuprite var. Tile ore Formula: Cu2O References: Russell, Arthur (1927) Notice of an occurrence of niccolite and ullmannite at the Settlingstones Mine, Fourstones, Northumberland; and of serpierite at Ross Island Mine, Killarney, Co. Kerry, Ireland. Mineralogical Magazine and Journal of the Mineralogical Society, 21 (119) 383-387 doi:10.1180/minmag.1927.021.119.03 |
| ⓘ Cuspidine Formula: Ca8(Si2O7)2F4 |
| ⓘ Cylindrite Formula: Pb3Sn4FeSb2S14 Description: Intergrown with colloform galena in the Navan Zn-Pb deposit, Co. Meath; several grains with typical concentric texture identified optically and confirmed by XRD. |
| ⓘ Delafossite Formula: Cu+Fe3+O2 |
| ⓘ Devilline Formula: CaCu4(SO4)2(OH)6 · 3H2O Localities: Mountain Mine, Allihies, Castletown-Bearhaven Copper Mines, Cork County, Munster, Ireland Tynagh Mine, Killimor, Galway County, Connacht, Ireland Muckross Mine, Killarney, Kerry County, Munster, Ireland Tankardstown mine (Knockmahon Mine), Knockmahon, Bonmahon (Bunmahon), Waterford County, Munster, Ireland |
| ⓘ Diaphorite Formula: Ag3Pb2Sb3S8 |
| ⓘ Digenite Formula: Cu9S5 Localities: Gortdrum Mine, Monard, Tipperary County, Munster, Ireland Tynagh Mine, Killimor, Galway County, Connacht, Ireland Dhurode Mine (Carrigacat Mine), Mizen Peninsula, Cork County, Munster, Ireland Tullacondra Cu-Ag Deposit, Mallow, Cork County, Munster, Ireland Ross Island, Lough Leane, Killarney, Kerry County, Munster, Ireland |
| ⓘ Diopside Formula: CaMgSi2O6 |
| ⓘ Djurleite Formula: Cu31S16 |
| ⓘ Dolomite Formula: CaMg(CO3)2 Localities: Reported from at least 40 localities in this region. Description: Fine saddle shaped crystals on calcite. |
| ⓘ Dolomite var. Iron-bearing Dolomite Formula: Ca(Mg,Fe)(CO3)2 |
| ⓘ Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Dufrénoysite Formula: Pb2As2S5 |
| ⓘ Dundasite Formula: PbAl2(CO3)2(OH)4 · H2O Localities: Habit: Fibrous sprays Colour: White Description: Rare white fibrous sprays found in/on gossan. |
| ⓘ Enargite Formula: Cu3AsS4 Localities: Description: as symplectic intergrowths with tennantite, or with bournonite which apparently replaces tennantite; as fine to medium grained anhedral aggregates with tennantite; and as inclusions in galena. |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) Localities: Reported from at least 7 localities in this region. |
| ⓘ Erythrite Formula: Co3(AsO4)2 · 8H2O Localities: Reported from at least 8 localities in this region. |
| ⓘ Eskolaite Formula: Cr2O3 Description: Very thin green coatings round quartz grains in greywacke pebbles in boulder clay. References: |
| ⓘ Eudialyte Formula: Na15Ca6Fe3Zr3Si(Si25O73)(O,OH,H2O)3(Cl,OH)2 |
| ⓘ Famatinite Formula: Cu3SbS4 Description: optical identification in R. W. Schultz (1968) Unpub. Ph.D. thesis, University of Dublin. |
| ⓘ Fayalite Formula: Fe2+2(SiO4) Description: Found in slag material. |
| ⓘ 'Fayalite-Forsterite Series' |
| ⓘ 'Feldspar Group' Localities: Reported from at least 10 localities in this region. |
| ⓘ 'Feldspar Group var. Perthite' References: |
| ⓘ Felsőbányaite Formula: Al4(SO4)(OH)10 · 4H2O Colour: White Description: First Irish occurrence. |
| ⓘ Ferrimolybdite Formula: Fe2(MoO4)3 · nH2O |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F |
| ⓘ Fluorite Formula: CaF2 Localities: Reported from at least 32 localities in this region. Habit: Cubic Colour: Colourless, orange, lilac, to deep purple Description: Extremely common throughout the spoil as it accounted for a large portion of the lode. The majority of smithsonite is found cementing heavily fractured fluorite together. Purple cubic crystals are often coated with mammilated smithsonite. Very rarely purple cubes can be found associated with limestone matrices.
|
| ⓘ Foitite ? Formula: ◻(Fe2+2Al)Al6(Si6O18)(BO3)3(OH)3(OH) Description: XRD and XRF are insufficient for correct ID. References: |
| ⓘ Forsterite Formula: Mg2(SiO4) |
| ⓘ Franckeite Formula: Fe2+(Pb,Sn2+)6Sn4+2Sb2S14 Description: As a fine exsolution(?) intergrowth in coarse-grained galena; a single specimen, identified optically. C.J. Andrew and J. H. Ashton (1985) Trans. Inst. Mining Metall., sect. B, 94, 66--93; C. J. Andrew, pers. comm., 1987. |
| ⓘ Franklinite Formula: Zn2+Fe3+2O4 Description: Found only in slag material associated with magnetite. |
| ⓘ 'Freibergite Subgroup' Formula: (Ag6,[Ag6]4+)(Cu4 C2+2)Sb4S12S0-1 Localities: Mogul Mine (Garryard Mine; International Mogul Mines), Silvermines District, Tipperary County, Munster, Ireland Galmoy Mine, Johnstown, Kilkenny County, Leinster, Ireland B-Zone 4611 Silver-Rich Pod, Mogul Mine (Garryard Mine; International Mogul Mines), Silvermines District, Tipperary County, Munster, Ireland Garrycam deposit (Keel Mine), Keel, Ballymahon, Longford County, Leinster, Ireland |
| ⓘ Galena Formula: PbS Localities: Reported from at least 95 localities in this region. Habit: Cubo-Octahedral Colour: Metallic Grey Description: World-class galena crystals with a brilliant mirror-bright lustre were found here. |
| ⓘ Galena var. Silver-bearing Galena Formula: PbS with Ag |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 Localities: Reported from at least 9 localities in this region. |
| ⓘ Geocronite Formula: Pb14Sb6S23 Localities: Mogul Mine (Garryard Mine; International Mogul Mines), Silvermines District, Tipperary County, Munster, Ireland B-Zone 4611 Silver-Rich Pod, Mogul Mine (Garryard Mine; International Mogul Mines), Silvermines District, Tipperary County, Munster, Ireland Tynagh Mine, Killimor, Galway County, Connacht, Ireland Kilbricken Mine (Kilbreckan Mine), Quin, Ennis, Clare County, Munster, Ireland |
| ⓘ Gersdorffite Formula: NiAsS Localities: Mogul Mine (Garryard Mine; International Mogul Mines), Silvermines District, Tipperary County, Munster, Ireland B-Zone 4611 Silver-Rich Pod, Mogul Mine (Garryard Mine; International Mogul Mines), Silvermines District, Tipperary County, Munster, Ireland Tynagh Mine, Killimor, Galway County, Connacht, Ireland Lisheen mine, Moyne, Tipperary County, Munster, Ireland |
| ⓘ Gibbsite Formula: Al(OH)3 |
| ⓘ 'Glass' Locality: Avoca, Wicklow County, Leinster, Ireland |
| ⓘ Goethite Formula: Fe3+O(OH) Localities: Reported from at least 12 localities in this region. Habit: Mammillated/Botryoidal Colour: Black Description: Very rarely found |
| ✪ Gortdrumite (TL) Formula: Cu24Fe2Hg9S23 Type Locality: Habit: Lath like crystals, similar to stibnite Colour: Grey Description: Extremely rare, found in association/similar conditions (dolomite vugs) with cinnabar. |
| ⓘ Graphite Formula: C Localities: Description: Flecks in limestone up to 200 microns. |
| ⓘ Gratonite Formula: Pb9As4S15 |
| ⓘ Greenockite Formula: CdS Localities: Description: powdery impregnations and deposits |
| ⓘ Grossular Formula: Ca3Al2(SiO4)3 Localities: Reported from at least 6 localities in this region. |
| ⓘ Gudmundite Formula: FeSbS |
| ⓘ 'Guitermanite' Formula: Pb10As6S19 (?) Description: Pbl0As6S19(?) Listed without details from Silvermines, Co. Tipperary, by C. J. Morrissey et al. (1971) Trans. Inst. Mining Metall., sect. B, 80, 174-85, and, with the formula Pb3As2S6, by C.J. Andrew, in
Andrew, C.J., Crowe, R.W.A., Finlay, S., Pennell, W.M. and Pyne, J.F., eds. (1986) Geology and genesis
of mineral deposits in Ireland, Irish Association for Economic Geology, Dublin Conference, 1984. [The true nature of guitermanite is obscure. M.H. Hey (1962) An Index of Mineral Species and Varieties, 2nd edn. London, BM(NH).] |
| ⓘ Gypsum Formula: CaSO4 · 2H2O Localities: Reported from at least 11 localities in this region. |
| ⓘ Gypsum var. Selenite Formula: CaSO4 · 2H2O References: |
| ⓘ Halloysite Formula: Al2Si2O5(OH)4 · n(H2O) References: |
| ⓘ Halotrichite Formula: Fe2+Al2(SO4)4 · 22H2O Description: Band of fibrous halotrichite with alum-K and jarosite was exposed under an overhang at base of cliff in Doon east for several years until buried by a cliff fall in around 2023-2024. References: Stephen Moreton CollectionIdentified by Stephen Moreton: Wet Chemical, XRD, XRF |
| ⓘ Hammarite Formula: Cu2Pb2Bi4S9 |
| ⓘ Harmotome Formula: Ba2(Si12Al4)O32 · 12H2O |
| ⓘ Hawleyite Formula: CdS Description: powdery impregnations and deposits |
| ⓘ Hedyphane Formula: Ca2Pb3(AsO4)3Cl |
| ⓘ Hematite Formula: Fe2O3 Localities: Reported from at least 26 localities in this region. |
| ⓘ Hematite var. Crucilite Formula: Fe2O3 |
| ⓘ Hematite var. Specularite Formula: Fe2O3 Localities: Habit: Bladed crystals in ball form Colour: Black Description: Usually found as micro rosettes on quartz crystals, often times in the presence of tetrahedrite.
Larger masses of bladed/rosette crystals are nearly always very badly oxidised. |
| ⓘ Hemimorphite Formula: Zn4Si2O7(OH)2 · H2O Localities: Reported from at least 10 localities in this region. Habit: Prismatic Colour: White, transparent Description: Well formed albeit small crystals can occasionally be found associated with goethite. |
| ⓘ Hercynite Formula: Fe2+Al2O4 |
| ⓘ Hessite Formula: Ag2Te |
| ⓘ Hetaerolite Formula: ZnMn2O4 |
| ⓘ Hetaerolite var. Hydrohetaerolite Formula: Zn(Mn,◻)2(O,OH)4 |
| ⓘ Heulandite-Ca Formula: (Ca,Na)5(Si27Al9)O72 · 26H2O |
| ⓘ Hidalgoite Formula: PbAl3(AsO4)(SO4)(OH)6 Description: Ryback et al. (1988): "May occur with beudantite as a secondary mineral at Tynagh mine, near Killimor, Co. Galway, forming a pale green powder; tentative identification based on XRD pattern and mean refractive index similar to those of hidalgoite. C. J. Morrissey (1970) Unpub. Ph.D. thesis, University of London." References: |
| ⓘ Hollandite Formula: Ba(Mn4+6Mn3+2)O16 Localities: Habit: Botryoidal Colour: Black Description: Mixed with cryptomelane. First suggested by David Jordan, Trinity College, Dublin. Quantitative electron-probe analysis by Dr Andy Tindle, Open University. Contains some potassium. |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ 'Högbomite Group' Description: Brown grains with green spinel intergrown with magnetite in corundum in a complex xenolith in gabbro. |
| ⓘ Hydroniumjarosite Formula: (H3O)Fe3+3(SO4)2(OH)6 |
| ⓘ Hydrozincite Formula: Zn5(CO3)2(OH)6 Localities: Reported from at least 8 localities in this region. Description: Abundant in some of the old workings. Is entirely post-mining in origin. |
| ⓘ 'Hypersthene' Formula: (Mg,Fe)SiO3 Locality: Aclare, Carlow County, Leinster, Ireland |
| ⓘ Ilmenite Formula: Fe2+TiO3 Localities: Reported from at least 8 localities in this region. Description: Detrital grains in limestone. |
| ⓘ Jalpaite Formula: Ag3CuS2 |
| ⓘ Jarosite Formula: KFe3+3(SO4)2(OH)6 |
| ⓘ Jordanite Formula: Pb14As6S23 Localities: Reported from at least 6 localities in this region. |
| ⓘ Kaersutite Formula: NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 References: |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 Localities: Reported from at least 7 localities in this region. |
| ⓘ Kawazulite Formula: Bi2Te2Se |
| ⓘ 'K Feldspar' Localities: Reported from at least 6 localities in this region. |
| ⓘ 'K Feldspar var. Adularia' Formula: KAlSi3O8 |
| ⓘ Kidwellite Formula: NaFe3+9+x(PO4)6(OH)11 · 3H2O, x = 0.33 |
| ⓘ Killalaite (TL) Formula: Ca6.4(H0.6Si2O7)2(OH)2 Type Locality: Description: Colourless crystals (< 2 mm) in veins and cavities with calcite or afwillite in thermally altered limestone. References: |
| ⓘ Kintoreite Formula: PbFe3(PO4)(PO3OH)(OH)6 |
| ⓘ Koninckite Formula: Fe3+PO4 · 3H2O |
| ⓘ Köttigite Formula: Zn3(AsO4)2 · 8H2O |
| ⓘ Krupkaite Formula: CuPbBi3S6 |
| ⓘ Kurilite Formula: Ag8Te3Se |
| ⓘ Kyanite Formula: Al2(SiO4)O |
| ⓘ Langite Formula: Cu4(SO4)(OH)6 · 2H2O Localities: Reported from at least 13 localities in this region. Description: Post-mining coatings on mine walls. |
| ⓘ Lavendulan Formula: NaCaCu5(AsO4)4Cl · 5H2O |
| ⓘ Lazulite Formula: MgAl2(PO4)2(OH)2 Description: Aggregates of blue anhedral grains (<0.5 mm) forming rare small patches in white Dalradian quartzite. Qualitative EDS analysis shows P, A1, Mg and Fe. |
| ⓘ Leadhillite Formula: Pb4(CO3)2(SO4)(OH)2 |
| ⓘ Lepidocrocite Formula: Fe3+O(OH) |
| ⓘ 'Leucoxene' Localities: Description: Detrital grains in limestone. |
| ⓘ 'Limonite' Localities: Reported from at least 21 localities in this region. |
| ⓘ Linarite Formula: PbCu(SO4)(OH)2 Localities: Reported from at least 18 localities in this region. |
| ⓘ Lindströmite Formula: Cu3Pb3Bi7S15 |
| ⓘ Formula: Cu2Al(AsO4)(OH)4 · 4H2O Locality: Connary mine (Connorree mine), Avoca, Wicklow County, Leinster, Ireland - erroneously reported References: Flannery, Barry (n.d.) Personal communication.personal observations of University College Dublin historical collections. Specimen now resides at National Museum of Ireland. NOTE THAT THERE IS A DEBATE ABOUT THE ORIGIN OF THIS REFERENCE SPECIMEN |
| ⓘ Lithiophilite Formula: LiMn2+PO4 |
| ⓘ Löllingite Formula: FeAs2 Localities: Description: 10-20 micron inclusions in olivenite. |
| ⓘ Mackinawite Formula: FeS |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 Localities: Reported from at least 13 localities in this region. |
| ⓘ Magnetite var. Titanium-bearing Magnetite Formula: Fe2+(Fe3+,Ti)2O4 References: |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 Localities: Reported from at least 48 localities in this region. |
| ⓘ 'Manganese Oxides' |
| ⓘ Manganite Formula: Mn3+O(OH) |
| ⓘ 'Manganomelane' |
| ⓘ Marcasite Formula: FeS2 Localities: Reported from at least 20 localities in this region. |
| ⓘ Matildite ? Formula: AgBiS2 Description: Tentatively identified in mineralized microgranite and vein quartz. References: |
| ⓘ Melanterite Formula: Fe2+(H2O)6(SO4) · H2O |
| ⓘ 'Melilite Group' Formula: A2M(XSiO7) |
| ⓘ 'Melnikovite' Localities: |
| ⓘ Meneghinite Formula: Pb13CuSb7S24 |
| ⓘ Merrillite Formula: Ca9NaMg(PO4)7 |
| ⓘ Metacinnabar Formula: HgS Description: A vein of massive cadmian cinnabar (ca. 1.5% Cd), with inclusions of cadmian metacinnabarite (11.1% Cd) and mercurian sphalerite (12.9% Hg), occurred in the topmost part of the ore deposit. References: |
| ⓘ Metasideronatrite Formula: Na2Fe(SO4)2(OH) · H2O |
| ⓘ 'Meteoritic Iron' |
| ⓘ Miargyrite Formula: AgSbS2 Localities: Mogul Mine (Garryard Mine; International Mogul Mines), Silvermines District, Tipperary County, Munster, Ireland B-Zone 4611 Silver-Rich Pod, Mogul Mine (Garryard Mine; International Mogul Mines), Silvermines District, Tipperary County, Munster, Ireland Tynagh Mine, Killimor, Galway County, Connacht, Ireland Description: Arsenian miargyrite, as exsolutions in and intergrowths with unspecified Bi-As-Sb sulphosalts, is recorded from a silver-rich pod cutting massive pyrite. |
| ⓘ 'Mica Group' |
| ⓘ 'Micrite' Localities: Ballinalack deposit (Ballinalack Zinc Project), Westmeath County, Leinster, Ireland Island Pod Zn-Pb Orebody, Lisheen mine, Moyne, Tipperary County, Munster, Ireland B-Zone 4611 Silver-Rich Pod, Mogul Mine (Garryard Mine; International Mogul Mines), Silvermines District, Tipperary County, Munster, Ireland Pallas Green Zn-Pb deposit, Limerick County, Munster, Ireland |
| ⓘ Microcline Formula: K(AlSi3O8) Localities: Reported from at least 8 localities in this region. |
| ⓘ Microcline var. Hyalophane Formula: (K,Ba)[Al(Si,Al)Si2O8] |
| ⓘ 'Microlite Group' Formula: A2-mTa2X6-wZ1-n Localities: Description: grey, yellowish or brown irregular grains or, occasionally, small octahedral crystal; the microlite is
uraniferous. |
| ⓘ Millerite Formula: NiS |
| ⓘ Mimetite Formula: Pb5(AsO4)3Cl |
| ⓘ Minnesotaite Formula: Fe2+3Si4O10(OH)2 Description: Minor constituent of Lower Carboniferous cherty ironstones as aggregates of fibres up to 0.15 mm long, associated with stilpnomelane and hematite. |
| ⓘ Minrecordite Formula: CaZn(CO3)2 Description: As minute (1 µm) intergrowths in calcite occurring in close association with sphalerite in dolomitized
limestone. |
| ⓘ Molybdenite Formula: MoS2 Localities: Reported from at least 10 localities in this region. |
| ⓘ Monazite-(Ce) Formula: Ce(PO4) References: |
| ⓘ 'Monazite Group' Formula: REE(PO4) References: |
| ⓘ Monohydrocalcite Formula: CaCO3 · H2O |
| ⓘ Monticellite Formula: CaMg(SiO4) |
| ⓘ Montmorillonite Formula: (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O References: |
| ⓘ Morenosite Formula: NiSO4 · 7H2O |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 24 localities in this region. |
| ⓘ Muscovite var. Fuchsite Formula: K(Al,Cr)3Si3O10(OH)2 |
| ⓘ Muscovite var. Illite Formula: K0.65Al2.0[Al0.65Si3.35O10](OH)2 Localities: Reported from at least 8 localities in this region. |
| ⓘ Muscovite var. Mariposite Formula: K(Al,Cr)2(Al,Si)4O10(OH)2 References: |
| ⓘ Muscovite var. Phengite Formula: KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 References: |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 10 localities in this region. |
| ⓘ 'Myrmekite' |
| ⓘ Native Antimony Formula: Sb |
| ⓘ Native Arsenic Formula: As References: |
| ⓘ Native Bismuth Formula: Bi Localities: Ballycoog, Gold Mines River, Croghan Kinshela Mountain, Wicklow County, Leinster, Ireland Ballymaquiff Quarry, Ballymaquiff, Ardrahan, Galway County, Connacht, Ireland Ballinglen, Aughrim, Wicklow County, Leinster, Ireland Castletown-Bearhaven Copper Mines, Cork County, Munster, Ireland Ballycummisk Mine, Audley Mines, Ballydehob, Mizen Peninsula, Cork County, Munster, Ireland |
| ⓘ Native Copper Formula: Cu Localities: Reported from at least 15 localities in this region. Habit: Arborescent, branching, sheets. Description: Formerly common and of good quality. Unobtainable nowadays. |
| ⓘ Native Gold Formula: Au Localities: Reported from at least 15 localities in this region. |
| ⓘ Native Gold var. Electrum Formula: (Au,Ag) Localities: Castletown-Bearhaven Copper Mines, Cork County, Munster, Ireland Gold Mines River, Croghan Kinshela Mountain, Wicklow County, Leinster, Ireland Ballycoog, Gold Mines River, Croghan Kinshela Mountain, Wicklow County, Leinster, Ireland Dooneen Mine, Allihies, Castletown-Bearhaven Copper Mines, Cork County, Munster, Ireland |
| ⓘ Native Iron Formula: Fe |
| ⓘ Native Iron var. Kamacite Formula: (Fe,Ni) |
| ⓘ Native Platinum Formula: Pt Description: Electron microprobe analysis of a grain of alluvial platinum from auriferous sand, Croghan Kinshela Mtn., Co. Wicklow, showed 10.86% Ir. References: |
| ⓘ Native Selenium Formula: Se |
| ⓘ Native Silver Formula: Ag Localities: Reported from at least 15 localities in this region. |
| ⓘ Native Silver var. Amalgam Formula: (Ag,Hg) Colour: Grey Description: Rare grey metallic crystals associated with ferroan dolomite.
Thin dull brassy sheets on grey baryte with tennantite in limestone (British Museum of Natural History specimens collected by A.J. Criddle & G.S. Byrne in 1974) |
| ⓘ Native Silver var. Kongsbergite Formula: (Ag,Hg) |
| ⓘ Native Silver var. Küstelite Formula: Ag |
| ⓘ Native Sulphur Formula: S8 Localities: Tynagh Mine, Killimor, Galway County, Connacht, Ireland Old Luganure mine, Glendasan, Wicklow County, Leinster, Ireland Oughterard, Connemara, Galway County, Connacht, Ireland Tigroney Mine (East Avoca Open Pit; St. Patrick's Mine), Avoca, Wicklow County, Leinster, Ireland Glandore Mines (Aghatubrid Mine; Glendore Mine), Glandore, Cork County, Munster, Ireland ? (more information) |
| ⓘ Native Tellurium Formula: Te |
| ⓘ Neptunite Formula: KNa2Li(Fe2+)2Ti2[Si4O12]2 |
| ⓘ Nickeline Formula: NiAs References: Yesares, Lola, Drummond, Drew A., Hollis, Steven P., Doran, Aileen L., Menuge, Julian F., Boyce, Adrian J., Blakeman, Robert J., Ashton, John H. (2019) Coupling Mineralogy, Textures, Stable and Radiogenic Isotopes in Identifying Ore-Forming Processes in Irish-Type Carbonate-Hosted Zn–Pb Deposits. Minerals, 9 (6) 335 doi:10.3390/min9060335 Doran, Aileen L.; Hollis, Steven P.; Menuge, Julian F.; Lyons, Connor; Piercey, Stephen J.; Boyce, Adrian J.; Slezak, Paul; Torremans, Koen; Güven, John (2025) Evidence for metal sources, fluid-mixing processes, and S isotope recycling within the feeder zone of an Irish type Zn-Pb deposit. Ore Geology Reviews, 182. 106660 doi:10.1016/j.oregeorev.2025.106660 |
| ⓘ Nontronite Formula: Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| ⓘ Olivenite Formula: Cu2(AsO4)(OH) |
| ⓘ 'Olivine Group' Formula: M2SiO4 |
| ⓘ Orpiment Formula: As2S3 References: |
| ⓘ Orthoclase Formula: K(AlSi3O8) |
| ⓘ 'Orthopyroxene Subgroup' |
| ⓘ Orthoserpierite Formula: Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| ⓘ Otavite Formula: CdCO3 Habit: Skeletal crystals Colour: White Fluorescence: Pink Description: Microscopic white otavite crystals are found on smithsonite containing high amounts of cadmium. References: |
| ⓘ Paragonite Formula: NaAl2(AlSi3O10)(OH)2 References: |
| ⓘ Pararammelsbergite Formula: NiAs2 References: Yesares, Lola, Drummond, Drew A., Hollis, Steven P., Doran, Aileen L., Menuge, Julian F., Boyce, Adrian J., Blakeman, Robert J., Ashton, John H. (2019) Coupling Mineralogy, Textures, Stable and Radiogenic Isotopes in Identifying Ore-Forming Processes in Irish-Type Carbonate-Hosted Zn–Pb Deposits. Minerals, 9 (6) 335 doi:10.3390/min9060335 |
| ⓘ Parasymplesite Formula: Fe2+3(AsO4)2 · 8H2O |
| ⓘ Parnauite Formula: Cu9(AsO4)2(SO4)(OH)10 · 7H2O |
| ⓘ Formula: [Ag6As2S7][Ag9CuS4] Locality: Tynagh Mine, Killimor, Galway County, Connacht, Ireland - erroneously reported Description: Ryback et al. (1988): "Pearceite has not been recorded from the British Isles." References: |
| ⓘ Pectolite Formula: NaCa2Si3O8(OH) |
| ⓘ Pentlandite Formula: (NixFey)Σ9S8 |
| ⓘ 'Petroleum var. Bitumen' Localities: Moneen Quarry, Castlebar, Mayo County, Connacht, Ireland Abbeytown Mine & Quarry, Ballysadare, Sligo County, Connacht, Ireland Brownstown Mine, Navan (An Uaimh), Meath County, Leinster, Ireland Tynagh Mine, Killimor, Galway County, Connacht, Ireland Aughamore Quarry (Maye Quarry; "Achenmore Quarry"), Aughamore, Sligo County, Connacht, Ireland Habit: spots, ca. 1 mm across, on dolomite. Colour: black |
| ⓘ Pharmacolite Formula: Ca(HAsO4) · 2H2O References: |
| ✪ Pharmacosiderite Formula: KFe3+4(AsO4)3(OH)4 · 6-7H2O References: |
| ⓘ Phaunouxite Formula: Ca3(AsO4)2 · 11H2O |
| ⓘ Phlogopite Formula: KMg3(AlSi3O10)(OH)2 |
| ⓘ Phosgenite Formula: Pb2CO3Cl2 |
| ⓘ Phosphosiderite Formula: FePO4 · 2H2O |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 Localities: Reported from at least 6 localities in this region. |
| ⓘ Planerite Formula: Al6(PO4)2(PO3OH)2(OH)8 · 4H2O |
| ⓘ Polybasite Formula: [Ag6Sb2S7][Ag9CuS4] References: |
| ⓘ Polylithionite Formula: KLi2Al(Si4O10)(F,OH)2 |
| ⓘ Posnjakite Formula: Cu4(SO4)(OH)6 · H2O |
| ⓘ Prehnite Formula: Ca2Al2Si3O10(OH)2 |
| ⓘ Proustite Formula: Ag3AsS3 Localities: Mogul Mine (Garryard Mine; International Mogul Mines), Silvermines District, Tipperary County, Munster, Ireland B-Zone 4611 Silver-Rich Pod, Mogul Mine (Garryard Mine; International Mogul Mines), Silvermines District, Tipperary County, Munster, Ireland Galmoy Mine, Johnstown, Kilkenny County, Leinster, Ireland |
| ⓘ Pseudomalachite Formula: Cu5(PO4)2(OH)4 |
| ⓘ 'Psilomelane' References: |
| ⓘ Pyrargyrite Formula: Ag3SbS3 Localities: Mogul Mine (Garryard Mine; International Mogul Mines), Silvermines District, Tipperary County, Munster, Ireland B-Zone 4611 Silver-Rich Pod, Mogul Mine (Garryard Mine; International Mogul Mines), Silvermines District, Tipperary County, Munster, Ireland Garrycam deposit (Keel Mine), Keel, Ballymahon, Longford County, Leinster, Ireland |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 92 localities in this region. Habit: Cubic Colour: Golden metallic Description: Magnificent pyrite cubes up to 4cm on translucent brown barite crystals were known from the mine during it's late stages of development. In association with a fossil hydrothermal vent the pyrites were obviously quite fantastic as even a miner took a specimen but sadly the rest were left where they lay-now under 80m of water! The current whereabouts of the miner's specimen is unknown. |
| ⓘ Pyrite var. Arsenic-bearing Pyrite Formula: Fe(S,As)2 References: Doran, Aileen L., Hollis, Steven P., Menuge, Julian F., Piercey, Stephen J., Boyce, Adrian J., Johnson, Sean, Güven, John, Turner, Oakley (2022) A Distal, High-grade Irish-type Orebody: Petrographic, Sulfur Isotope, and Sulfide Chemistry of the Island Pod Zn-Pb Orebody, Lisheen, Ireland. Economic Geology, 117 (2) 305-326 doi:10.5382/econgeo.4882 |
| ⓘ Pyrite var. Bravoite Formula: (Fe,Ni)S2 References: Yesares, Lola, Drummond, Drew A., Hollis, Steven P., Doran, Aileen L., Menuge, Julian F., Boyce, Adrian J., Blakeman, Robert J., Ashton, John H. (2019) Coupling Mineralogy, Textures, Stable and Radiogenic Isotopes in Identifying Ore-Forming Processes in Irish-Type Carbonate-Hosted Zn–Pb Deposits. Minerals, 9 (6) 335 doi:10.3390/min9060335 Doran, Aileen L.; Hollis, Steven P.; Menuge, Julian F.; Lyons, Connor; Piercey, Stephen J.; Boyce, Adrian J.; Slezak, Paul; Torremans, Koen; Güven, John (2025) Evidence for metal sources, fluid-mixing processes, and S isotope recycling within the feeder zone of an Irish type Zn-Pb deposit. Ore Geology Reviews, 182. 106660 doi:10.1016/j.oregeorev.2025.106660 |
| ⓘ 'Pyrobitumen' References: Flannery, Barry (n.d.) Personal communication.Personal Observation 25-7-2010 |
| ⓘ 'Pyrochlore Group' Formula: A2Nb2(O,OH)6Z |
| ⓘ Pyrolusite Formula: Mn4+O2 Localities: Ross Island, Lough Leane, Killarney, Kerry County, Munster, Ireland Glandore Mines (Aghatubrid Mine; Glendore Mine), Glandore, Cork County, Munster, Ireland Fort Lismeenagh (Ballycormick), Shanagolden, Limerick County, Munster, Ireland Logwood Hill, Calliagh, Ballybay-Clones Municipal District, Monaghan County, Ulster, Ireland Ballygown South Mine, Silvermines District, Tipperary County, Munster, Ireland |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl Localities: Reported from at least 11 localities in this region. Description: SEM-WDS analysis by Dr Green, Manchester Museum, indicates end-member pyromorphite with little or no arsenic. Currently Ireland's best pyromorphite location. |
| ⓘ Pyrrhotite Formula: Fe1-xS Localities: Reported from at least 12 localities in this region. |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 151 localities in this region. Description: "Herkimer diamond" double terminated crystals up to 9 cm, often with bubbles inside. Rare, but can be of excellent quality. |
| ⓘ Quartz var. Amethyst Formula: SiO2 Localities: Description: Probably Ireland's best amethyst location. |
| ⓘ Quartz var. Chalcedony Formula: SiO2 Localities: Ross Island, Lough Leane, Killarney, Kerry County, Munster, Ireland Navan Mine (Tara Mine), Navan (An Uaimh), Meath County, Leinster, Ireland Copper mine, Loughshinny, Dublin County, Leinster, Ireland Gurtnadyne Mine (Gorteenahida), Silvermines District, Tipperary County, Munster, Ireland Abbeytown Mine & Quarry, Ballysadare, Sligo County, Connacht, Ireland |
| ⓘ Quartz var. Cotterite Formula: SiO2 References: |
| ⓘ Quartz var. Ferruginous Quartz Formula: SiO2 References: |
| ⓘ Quartz var. Milky Quartz Formula: SiO2 |
| ⓘ Quartz var. Prase Formula: SiO2 |
| ⓘ Quartz var. Rock Crystal Formula: SiO2 |
| ⓘ Quartz var. Rose Quartz Formula: SiO2 Localities: Description: Doubtful |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 Localities: Blue Stack Mountains, Donegal County, Ulster, Ireland Keem, Achill Island, Mayo County, Connacht, Ireland Moylisha, Shillelagh, Wicklow County, Leinster, Ireland Ballycummisk Mine, Audley Mines, Ballydehob, Mizen Peninsula, Cork County, Munster, Ireland Fort Lismeenagh (Ballycormick), Shanagolden, Limerick County, Munster, Ireland |
| ⓘ Rammelsbergite ? Formula: NiAs2 References: |
| ⓘ Rauenthalite Formula: Ca3(AsO4)2 · 10H2O |
| ⓘ Realgar Formula: As4S4 References: |
| ⓘ Redgillite Formula: Cu6(SO4)(OH)10 · H2O Localities: Habit: Rounded crystallites Colour: Light Green |
| ⓘ Renierite Formula: (Cu+,Zn)11Fe4(Ge4+,As5+)2S16 |
| ⓘ Rhodochrosite Formula: MnCO3 |
| ⓘ Romanèchite Formula: (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| ⓘ Rosasite Formula: (Cu,Zn)2(CO3)(OH)2 |
| ⓘ Rozenite Formula: FeSO4 · 4H2O |
| ⓘ Rustumite Formula: Ca10(Si2O7)2(SiO4)(OH)2Cl2 |
| ⓘ Rutile Formula: TiO2 Localities: Reported from at least 7 localities in this region. Description: contains ca. 1% Cr203 at this locality. |
| ⓘ Sauconite Formula: Na0.3Zn3((Si,Al)4O10)(OH)2 · 4H2O |
| ⓘ Scawtite Formula: Ca7(Si3O9)2CO3 · 2H2O |
| ⓘ Scheelite Formula: Ca(WO4) |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Scorodite Formula: Fe3+AsO4 · 2H2O |
| ⓘ Seligmannite Formula: PbCuAsS3 |
| ⓘ Semseyite Formula: Pb9Sb8S21 |
| ⓘ 'Serpentine Subgroup' Formula: D3[Si2O5](OH)4 |
| ⓘ Serpierite Formula: Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| ⓘ Siderite Formula: FeCO3 Localities: Reported from at least 15 localities in this region. Habit: Rhombohedral Colour: Brown-White-Clear Description: Generally found as earthy-brown oxidised material in quartz. Occasionally well formed saddle-shaped crystals and rhombs are found albeit oxidised to a brown colour. |
| ⓘ Sideronatrite Formula: Na2Fe(SO4)2(OH) · 3H2O |
| ⓘ Siderophyllite Formula: KFe2+2Al(Al2Si2O10)(OH)2 |
| ⓘ Siegenite Formula: CoNi2S4 |
| ⓘ Sillimanite Formula: Al2(SiO4)O |
| ⓘ Sillimanite var. Fibrolite Formula: Al2(SiO4)O |
| ⓘ Skutterudite Formula: CoAs3 |
| ⓘ Smithite Formula: AgAsS2 Localities: Description: Fine-grained intergrowths with proustite, gersdorffite, and arsenian miargyrite, from a silver-rich pod cutting massive pyrite in the B zone at Silvermines, Co. Tipperary; optical and XRD identification. |
| ⓘ Smithsonite Formula: ZnCO3 Localities: Reported from at least 11 localities in this region. Habit: Botryoidal, Tetrahedral. Colour: Yellow,Orange to Green Description: Very difficult to find nowadays, several specimens in the Barry Flannery Collection show distinct tetrahedra albeit slightly rounded. Mammilations and botryoids are by far the most common although some botryoids/mammilations show tetrahedra under magnification and even microscopic spheres... |
| ⓘ Smolyaninovite Formula: Co3Fe3+2(AsO4)4 · 11H2O |
| ⓘ 'Sparite' References: Doran, Aileen L.; Hollis, Steven P.; Menuge, Julian F.; Lyons, Connor; Piercey, Stephen J.; Boyce, Adrian J.; Slezak, Paul; Torremans, Koen; Güven, John (2025) Evidence for metal sources, fluid-mixing processes, and S isotope recycling within the feeder zone of an Irish type Zn-Pb deposit. Ore Geology Reviews, 182. 106660 doi:10.1016/j.oregeorev.2025.106660 |
| ⓘ Spessartine Formula: Mn2+3Al2(SiO4)3 |
| ⓘ Sphalerite Formula: ZnS Localities: Reported from at least 78 localities in this region. Colour: Varied, yellow, red, brown Description: Very fine crystallised honey blende sphalerite in a wide variety of shades from almost yellow through to deep treacle brown. |
| ⓘ Sphalerite var. Mercury-bearing Sphalerite Formula: (Zn,Hg)S Description: A vein of massive cadmian cinnabar (ca. 1.5% Cd), with inclusions of cadmian metacinnabarite (11.1% Cd) and mercurian sphalerite (12.9% Hg), occurred in the topmost part of the ore deposit. References: |
| ⓘ Sphalerite var. Schalenblende |
| ⓘ Spinel Formula: MgAl2O4 Localities: |
| ⓘ Spinel var. Pleonaste Formula: (Mg,Fe)Al2O4 |
| ⓘ Spionkopite Formula: Cu39S28 |
| ⓘ Spodumene Formula: LiAlSi2O6 Localities: Reported from at least 12 localities in this region. |
| ⓘ Spurrite Formula: Ca5(SiO4)2(CO3) |
| ⓘ Stannite Formula: Cu2FeSnS4 |
| ⓘ Staurolite Formula: Fe2+2Al9Si4O23(OH) |
| ⓘ Stephanite Formula: Ag5SbS4 |
| ⓘ Stibiopalladinite Formula: Pd5Sb2 |
| ⓘ Stibnite Formula: Sb2S3 Localities: Connary mine (Connorree mine), Avoca, Wicklow County, Leinster, Ireland Kilmacoo Mine (East Cronebane Mine), Avoca, Wicklow County, Leinster, Ireland Tara Deep deposit, Navan Mine (Tara Mine), Navan (An Uaimh), Meath County, Leinster, Ireland B-Zone 4611 Silver-Rich Pod, Mogul Mine (Garryard Mine; International Mogul Mines), Silvermines District, Tipperary County, Munster, Ireland Clontibret Mine, Clontibret, Clontibret mining district, Monaghan Municipal District, Monaghan County, Ulster, Ireland |
| ⓘ Stilbite-Ca Formula: NaCa4(Si27Al9)O72 · 28H2O |
| ⓘ Stilpnomelane Formula: K4Fe2+48[Si64Al8]O164(OH)52 · nH2O Description: Associated with minnesotaite and hematite. |
| ⓘ Strashimirite Formula: Cu8(AsO4)4(OH)4 · 5H2O |
| ⓘ Strengite Formula: FePO4 · 2H2O |
| ⓘ Stromeyerite Formula: AgCuS |
| ⓘ Strontianite Formula: SrCO3 Localities: Habit: tufts and druses of acicular crystals up to 4 mm in length. Colour: snow-white to translucent |
| ⓘ Struvite Formula: (NH4)Mg(PO4) · 6H2O Locality: Dublin, Dublin County, Leinster, Ireland Description: Fragmented crystals (6-20 mm), amber yellow to smoky brown, translucent to opaque, mostly tabular, from a soil horizon dated pre-1060 AD in an archaeological excavation in High Street, Dublin (1967-72). Also from an excavation in Fishamble Street, Dublin (1978-81), associated with a layer of mussels dated ca. 980 AD. |
| ⓘ Susannite Formula: Pb4(CO3)2(SO4)(OH)2 |
| ⓘ Taenite Formula: (Ni,Fe) |
| ⓘ 'Tantalite' Formula: (Mn,Fe)(Ta,Nb)2O6 Locality: Leinster Batholith, Leinster, Ireland References: Barros, Renata, Kaeter, David, Menuge, Julian F., Fegan, Thomas, Harrop, John (2022) Rare Element Enrichment in Lithium Pegmatite Exomorphic Halos and Implications for Exploration: Evidence from the Leinster Albite-Spodumene Pegmatite Belt, Southeast Ireland. Minerals, 12 (8) 981 doi:10.3390/min12080981 |
| ⓘ Tantalite-(Mn) Formula: Mn2+Ta2O6 Description: Irregular to platy crystals, dark-red, brown, or black, as an accessory mineral in lithium pegmatites associated with the Leinster Granite at Stranakelly, near Shillelagh, Co. Wicklow; no compositional data given. |
| ⓘ 'Tennantite Subgroup' Formula: Cu6(Cu4C2+2)As4S12S Localities: Reported from at least 17 localities in this region. |
| ⓘ 'Tennantite Subgroup var. Mercury-bearing Tennantite' Formula: Cu6[Cu4(Zn,Fe,Hg)2]As4S13 Description: A major ore mineral at this locality. Hg up to nearly 12% at the top of the deposit, decreasing to <1% with depth. |
| ⓘ Tennantite-(Zn) Formula: Cu6(Cu4Zn2)As4S12S |
| ⓘ Tenorite Formula: CuO Localities: Reported from at least 10 localities in this region. |
| ⓘ 'Tetrahedrite Group' Formula: M2(A6)M1(B4 C2)X3(D4)S1(Y12)S2(Z) |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S Localities: Reported from at least 26 localities in this region. Habit: Tetrahedrons |
| ⓘ 'Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite' Formula: (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| ⓘ Tetrataenite Formula: FeNi |
| ⓘ Theisite Formula: Cu5Zn5(AsO4,SbO4)2(OH)14 |
| ⓘ Tilleyite Formula: Ca5(Si2O7)(CO3)2 |
| ⓘ Titanite Formula: CaTiO(SiO4) Localities: Reported from at least 7 localities in this region. |
| ⓘ Topaz Formula: Al2(SiO4)(F,OH)2 |
| ⓘ Torbernite Formula: Cu(UO2)2(PO4)2 · 12H2O References: |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z Localities: Reported from at least 6 localities in this region. |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ Troilite Formula: FeS |
| ⓘ Turquoise Formula: CuAl6(PO4)4(OH)8 · 4H2O |
| ⓘ Tyrolite Formula: Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O Localities: Gortdrum Mine, Monard, Tipperary County, Munster, Ireland Hollyford Mine, Tipperary County, Munster, Ireland Ross Island, Lough Leane, Killarney, Kerry County, Munster, Ireland Tynagh Mine, Killimor, Galway County, Connacht, Ireland Leaghillaun (Leaghuillean), Tuosist, Beara, Kerry County, Munster, Ireland Colour: Light lustrous green/blue Description: Quite likely the finest example of tyrolite in the British Isle |
| ⓘ Ullmannite Formula: NiSbS |
| ⓘ 'Unnamed (Pb Thiosulphate)' Formula: PbS2O3 |
| ⓘ Uraninite Formula: UO2 References: Paasche, Hendrik; Dumais, Marie-Andrée; Haase, Claudia; Harrop, John; Larsen, Björn Eskil; Menuge, Julian; Nasuti, Aziz; Pohl, Claudia; Saalmann, Kerstin; Tassis, Georgios; et al. (2026) Unsupervised clustering for prospectivity mapping of lithium pegmatites in Leinster, Ireland: A transferable workflow. Ore Geology Reviews, 195. p.107380. doi:10.1016/j.oregeorev.2026.107380 |
| ⓘ Vaesite Formula: NiS2 |
| ⓘ Variscite ? Formula: AlPO4 · 2H2O |
| ⓘ Vermiculite Formula: Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| ⓘ Vesuvianite Formula: Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 Localities: Reported from at least 10 localities in this region. Description: Vesuvianite is found abundant in a calc-silicate rock, forming masses of interlocking brown crystals to 3 cm x 1 cm in anorthite and actinolite. |
| ⓘ 'Wad' |
| ⓘ Wavellite Formula: Al3(PO4)2(OH)3 · 5H2O Localities: Reported from at least 12 localities in this region. Habit: Radiating crystals and perfect spheres up to 1.6cm Colour: White, blue/green, pink Description: Spheres of wavellite are extremely rare but can be very fine when they do occur. Rosettes on fracture surfaces are common, but confined to one narrow horizon. |
| ⓘ Willemite ? Formula: Zn2SiO4 |
| ⓘ Wittichenite Formula: Cu3BiS3 |
| ⓘ 'Wolframite Group' |
| ⓘ Wollastonite Formula: Ca3(Si3O9) |
| ⓘ Woodwardite Formula: Cu1-xAlx(OH)2(SO4)x/2 · nH2O References: |
| ⓘ Wroewolfeite Formula: Cu4(SO4)(OH)6 · 2H2O |
| ⓘ Wulfenite Formula: Pb(MoO4) Localities: Reported from at least 9 localities in this region. Description: SEM-WDS analysis by Dr Green, Manchester Museum, indicates end-member lead molybdate with little or no W. |
| ⓘ Wurtzite Formula: (Zn,Fe)S References: |
| ⓘ Xanthoconite Formula: Ag3AsS3 Localities: Description: Abundant fine intergrowths with proustite, baryte and galena, from a silver-rich pod cutting massive pyrite. Optical and XRD identification. |
| ⓘ 'Xenotime' |
| ⓘ Xonotlite Formula: Ca6(Si6O17)(OH)2 |
| ⓘ Yarrowite Formula: Cu9S8 |
| ⓘ Zálesíite Formula: CaCu6(AsO4)2(AsO3OH)(OH)6 · 3H2O |
| ⓘ Zircon Formula: Zr(SiO4) Localities: Reported from at least 8 localities in this region. |
| ⓘ Zoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Silver var. Amalgam | 1.AA.05 | (Ag,Hg) |
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Native Gold var. Electrum | 1.AA.05 | (Au,Ag) |
| ⓘ | 1.AA.05 | Au | |
| ⓘ | Native Silver var. Kongsbergite | 1.AA.05 | (Ag,Hg) |
| ⓘ | 1.AA.05 | Ag | |
| ⓘ | var. Küstelite | 1.AA.05 | Ag |
| ⓘ | Native Iron | 1.AE.05 | Fe |
| ⓘ | var. Kamacite | 1.AE.05 | (Fe,Ni) |
| ⓘ | Taenite | 1.AE.10 | (Ni,Fe) |
| ⓘ | Tetrataenite | 1.AE.10 | FeNi |
| ⓘ | Native Platinum | 1.AF.10 | Pt |
| ⓘ | Native Antimony | 1.CA.05 | Sb |
| ⓘ | Native Arsenic | 1.CA.05 | As |
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| ⓘ | Graphite | 1.CB.05a | C |
| ⓘ | Native Sulphur | 1.CC.05 | S8 |
| ⓘ | Native Selenium | 1.CC.10 | Se |
| ⓘ | Native Tellurium | 1.CC.10 | Te |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Stibiopalladinite | 2.AC.20a | Pd5Sb2 |
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Djurleite | 2.BA.05 | Cu31S16 |
| ⓘ | Digenite | 2.BA.10 | Cu9S5 |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Stromeyerite | 2.BA.40 | AgCuS |
| ⓘ | Jalpaite | 2.BA.45 | Ag3CuS2 |
| ⓘ | Kurilite | 2.BA.45 | Ag8Te3Se |
| ⓘ | Hessite | 2.BA.60 | Ag2Te |
| ⓘ | Argyrodite | 2.BA.70 | Ag8GeS6 |
| ⓘ | Cobaltpentlandite | 2.BB.15 | Co9S8 |
| ⓘ | Pentlandite | 2.BB.15 | (NixFey)Σ9S8 |
| ⓘ | Gortdrumite (TL) | 2.BD.10 | Cu24Fe2Hg9S23 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Spionkopite | 2.CA.05c | Cu39S28 |
| ⓘ | Yarrowite | 2.CA.05d | Cu9S8 |
| ⓘ | Hawleyite | 2.CB.05a | CdS |
| ⓘ | Metacinnabar | 2.CB.05a | HgS |
| ⓘ | Sphalerite var. Schalenblende | 2.CB.05a | ZnS |
| ⓘ | 2.CB.05a | ZnS | |
| ⓘ | var. Mercury-bearing Sphalerite | 2.CB.05a | (Zn,Hg)S |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Stannite | 2.CB.15a | Cu2FeSnS4 |
| ⓘ | Renierite | 2.CB.35a | (Cu+,Zn)11Fe4(Ge4+,As5+)2S16 |
| ⓘ | Greenockite | 2.CB.45 | CdS |
| ⓘ | Wurtzite | 2.CB.45 | (Zn,Fe)S |
| ⓘ | Cubanite | 2.CB.55a | CuFe2S3 |
| ⓘ | Breithauptite | 2.CC.05 | NiSb |
| ⓘ | Nickeline | 2.CC.05 | NiAs |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Troilite | 2.CC.10 | FeS |
| ⓘ | Millerite | 2.CC.20 | NiS |
| ⓘ | Mackinawite | 2.CC.25 | FeS |
| ⓘ | Clausthalite | 2.CD.10 | PbSe |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | var. Silver-bearing Galena | 2.CD.10 | PbS with Ag |
| ⓘ | Cinnabar | 2.CD.15a | HgS |
| ⓘ | Siegenite | 2.DA.05 | CoNi2S4 |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Kawazulite | 2.DC.05 | Bi2Te2Se |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite var. Bravoite | 2.EB.05a | (Fe,Ni)S2 |
| ⓘ | 2.EB.05a | FeS2 | |
| ⓘ | Vaesite | 2.EB.05a | NiS2 |
| ⓘ | Pyrite var. Arsenic-bearing Pyrite | 2.EB.05a | Fe(S,As)2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Alloclasite | 2.EB.10b | Co1-xFexAsS |
| ⓘ | Pararammelsbergite | 2.EB.10e | NiAs2 |
| ⓘ | Löllingite | 2.EB.15a | FeAs2 |
| ⓘ | Rammelsbergite ? | 2.EB.15a | NiAs2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Gudmundite | 2.EB.20 | FeSbS |
| ⓘ | Cobaltite | 2.EB.25 | CoAsS |
| ⓘ | Gersdorffite | 2.EB.25 | NiAsS |
| ⓘ | Ullmannite | 2.EB.25 | NiSbS |
| ⓘ | Skutterudite | 2.EC.05 | CoAs3 |
| ⓘ | Realgar | 2.FA.15a | As4S4 |
| ⓘ | Orpiment | 2.FA.30 | As2S3 |
| ⓘ | Proustite | 2.GA.05 | Ag3AsS3 |
| ⓘ | Pyrargyrite | 2.GA.05 | Ag3SbS3 |
| ⓘ | Xanthoconite | 2.GA.10 | Ag3AsS3 |
| ⓘ | Wittichenite | 2.GA.20 | Cu3BiS3 |
| ⓘ | Bournonite | 2.GA.50 | PbCuSbS3 |
| ⓘ | Seligmannite | 2.GA.50 | PbCuAsS3 |
| ⓘ | Argentotennantite-(Zn) | 2.GB.05 | Ag6(Cu4Zn2)As4S12S |
| ⓘ | 'Freibergite Subgroup' | 2.GB.05 | (Ag6,[Ag6]4+)(Cu4 C2+2)Sb4S12S0-1 |
| ⓘ | 'Tennantite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)As4S12S |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | 'var. Silver-bearing Tetrahedrite' | 2.GB.05 | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| ⓘ | 'Tennantite Subgroup var. Mercury-bearing Tennantite' | 2.GB.05 | Cu6[Cu4(Zn,Fe,Hg)2]As4S13 |
| ⓘ | Tennantite-(Zn) | 2.GB.05 | Cu6(Cu4Zn2)As4S12S |
| ⓘ | Stephanite | 2.GB.10 | Ag5SbS4 |
| ⓘ | Pearceite ? | 2.GB.15 | [Ag6As2S7][Ag9CuS4] |
| ⓘ | Polybasite | 2.GB.15 | [Ag6Sb2S7][Ag9CuS4] |
| ⓘ | Smithite | 2.GC.30 | AgAsS2 |
| ⓘ | Miargyrite | 2.HA.10 | AgSbS2 |
| ⓘ | Aikinite | 2.HB.05a | CuPbBiS3 |
| ⓘ | Hammarite | 2.HB.05a | Cu2Pb2Bi4S9 |
| ⓘ | Krupkaite | 2.HB.05a | CuPbBi3S6 |
| ⓘ | Lindströmite | 2.HB.05a | Cu3Pb3Bi7S15 |
| ⓘ | Meneghinite | 2.HB.05b | Pb13CuSb7S24 |
| ⓘ | Dufrénoysite | 2.HC.05d | Pb2As2S5 |
| ⓘ | Semseyite | 2.HC.10d | Pb9Sb8S21 |
| ⓘ | Boulangerite | 2.HC.15 | Pb5Sb4S11 |
| ⓘ | Cylindrite | 2.HF.25a | Pb3Sn4FeSb2S14 |
| ⓘ | Franckeite | 2.HF.25b | Fe2+(Pb,Sn2+)6Sn4+2Sb2S14 |
| ⓘ | Matildite ? | 2.JA.20 | AgBiS2 |
| ⓘ | Diaphorite | 2.JB.05 | Ag3Pb2Sb3S8 |
| ⓘ | Cosalite ? | 2.JB.10 | Pb2Bi2S5 |
| ⓘ | Geocronite | 2.JB.30a | Pb14Sb6S23 |
| ⓘ | Jordanite | 2.JB.30a | Pb14As6S23 |
| ⓘ | Gratonite | 2.JB.55 | Pb9As4S15 |
| ⓘ | Enargite | 2.KA.05 | Cu3AsS4 |
| ⓘ | Famatinite | 2.KA.10 | Cu3SbS4 |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| ⓘ | Atacamite | 3.DA.10a | Cu2(OH)3Cl |
| ⓘ | Botallackite | 3.DA.10b | Cu2(OH)3Cl |
| ⓘ | Clinoatacamite | 3.DA.10b | Cu2(OH)3Cl |
| ⓘ | Connellite | 3.DA.25 | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | 'Microlite Group' | 4.00. | A2-mTa2X6-wZ1-n |
| ⓘ | 'Pyrochlore Group' | 4.00. | A2Nb2(O,OH)6Z |
| ⓘ | Cuprite | 4.AA.10 | Cu2O |
| ⓘ | var. Tile ore | 4.AA.10 | Cu2O |
| ⓘ | Tenorite | 4.AB.10 | CuO |
| ⓘ | Delafossite | 4.AB.15 | Cu+Fe3+O2 |
| ⓘ | Chromite | 4.BB.05 | Fe2+Cr3+2O4 |
| ⓘ | Franklinite | 4.BB.05 | Zn2+Fe3+2O4 |
| ⓘ | Hercynite | 4.BB.05 | Fe2+Al2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
| ⓘ | Magnetite var. Titanium-bearing Magnetite | 4.BB.05 | Fe2+(Fe3+,Ti)2O4 |
| ⓘ | Spinel var. Pleonaste | 4.BB.05 | (Mg,Fe)Al2O4 |
| ⓘ | Hetaerolite | 4.BB.10 | ZnMn2O4 |
| ⓘ | var. Hydrohetaerolite | 4.BB.10 | Zn(Mn,◻)2(O,OH)4 |
| ⓘ | Corundum | 4.CB.05 | Al2O3 |
| ⓘ | Eskolaite | 4.CB.05 | Cr2O3 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Corundum var. Sapphire | 4.CB.05 | Al2O3 |
| ⓘ | Hematite var. Specularite | 4.CB.05 | Fe2O3 |
| ⓘ | var. Crucilite | 4.CB.05 | Fe2O3 |
| ⓘ | Arsenolite | 4.CB.50 | As2O3 |
| ⓘ | Quartz var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Rose Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Rock Crystal | 4.DA.05 | SiO2 |
| ⓘ | var. Milky Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Prase | 4.DA.05 | SiO2 |
| ⓘ | var. Cotterite | 4.DA.05 | SiO2 |
| ⓘ | var. Ferruginous Quartz | 4.DA.05 | SiO2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Cassiterite var. Wood Tin | 4.DB.05 | SnO2 |
| ⓘ | 'Wolframite Group' | 4.DB.30 va | |
| ⓘ | Tantalite-(Mn) | 4.DB.35 | Mn2+Ta2O6 |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Brannerite | 4.DH.05 | UTi2O6 |
| ⓘ | Bindheimite | 4.DH.20 | Pb2Sb2O6O |
| ⓘ | Coronadite | 4.DK.05a | Pb(Mn4+6Mn3+2)O16 |
| ⓘ | Cryptomelane | 4.DK.05a | K(Mn4+7Mn3+)O16 |
| ⓘ | Hollandite | 4.DK.05a | Ba(Mn4+6Mn3+2)O16 |
| ⓘ | Romanèchite | 4.DK.10 | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| ⓘ | Uraninite | 4.DL.05 | UO2 |
| ⓘ | Goethite | 4.FD.10 | Fe3+O(OH) |
| ⓘ | Manganite | 4.FD.15 | Mn3+O(OH) |
| ⓘ | Brucite | 4.FE.05 | Mg(OH)2 |
| ⓘ | Gibbsite | 4.FE.10 | Al(OH)3 |
| ⓘ | Lepidocrocite | 4.FE.15 | Fe3+O(OH) |
| ⓘ | Asbolane | 4.FL.30 | (Ni,Co)2-xMn4+(O,OH)4 · nH2O |
| ⓘ | Chalcomenite | 4.JH.05 | CuSeO3 · 2H2O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | var. Manganese-bearing Calcite | 5.AB.05 | (Ca,Mn)CO3 |
| ⓘ | Otavite | 5.AB.05 | CdCO3 |
| ⓘ | Rhodochrosite | 5.AB.05 | MnCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Smithsonite | 5.AB.05 | ZnCO3 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Minrecordite | 5.AB.10 | CaZn(CO3)2 |
| ⓘ | Dolomite var. Iron-bearing Dolomite | 5.AB.10 | Ca(Mg,Fe)(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Strontianite | 5.AB.15 | SrCO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Rosasite | 5.BA.10 | (Cu,Zn)2(CO3)(OH)2 |
| ⓘ | Aurichalcite | 5.BA.15 | (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ | Hydrozincite | 5.BA.15 | Zn5(CO3)2(OH)6 |
| ⓘ | Phosgenite | 5.BE.20 | Pb2CO3Cl2 |
| ⓘ | Leadhillite | 5.BF.40 | Pb4(CO3)2(SO4)(OH)2 |
| ⓘ | Susannite | 5.BF.40 | Pb4(CO3)2(SO4)(OH)2 |
| ⓘ | Monohydrocalcite | 5.CB.20 | CaCO3 · H2O |
| ⓘ | Dundasite | 5.DB.10 | PbAl2(CO3)2(OH)4 · H2O |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anhydrite | 7.AD.30 | CaSO4 |
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Celestine | 7.AD.35 | SrSO4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Hydroniumjarosite | 7.BC.10 | (H3O)Fe3+3(SO4)2(OH)6 |
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Caledonite | 7.BC.50 | Pb5Cu2(SO4)3(CO3)(OH)6 |
| ⓘ | Linarite | 7.BC.65 | PbCu(SO4)(OH)2 |
| ⓘ | Boyleite | 7.CB.15 | ZnSO4 · 4H2O |
| ⓘ | Rozenite | 7.CB.15 | FeSO4 · 4H2O |
| ⓘ | Chalcanthite | 7.CB.20 | CuSO4 · 5H2O |
| ⓘ | Melanterite | 7.CB.35 | Fe2+(H2O)6(SO4) · H2O |
| ⓘ | Morenosite | 7.CB.40 | NiSO4 · 7H2O |
| ⓘ | Halotrichite | 7.CB.85 | Fe2+Al2(SO4)4 · 22H2O |
| ⓘ | Alum-(K) | 7.CC.20 | KAl(SO4)2 · 12H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | var. Selenite | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Copiapite | 7.DB.35 | Fe2+Fe3+4(SO4)6(OH)2 · 20H2O |
| ⓘ | Felsőbányaite | 7.DD.05 | Al4(SO4)(OH)10 · 4H2O |
| ⓘ | Langite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Posnjakite | 7.DD.10 | Cu4(SO4)(OH)6 · H2O |
| ⓘ | Wroewolfeite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Devilline | 7.DD.30 | CaCu4(SO4)2(OH)6 · 3H2O |
| ⓘ | Orthoserpierite | 7.DD.30 | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| ⓘ | Serpierite | 7.DD.30 | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| ⓘ | Woodwardite | 7.DD.35 | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| ⓘ | Redgillite | 7.DD.70 | Cu6(SO4)(OH)10 · H2O |
| ⓘ | Metasideronatrite | 7.DF.20 | Na2Fe(SO4)2(OH) · H2O |
| ⓘ | Sideronatrite | 7.DF.20 | Na2Fe(SO4)2(OH) · 3H2O |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| ⓘ | Ferrimolybdite | 7.GB.30 | Fe2(MoO4)3 · nH2O |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Lithiophilite | 8.AB.10 | LiMn2+PO4 |
| ⓘ | Merrillite | 8.AC.45 | Ca9NaMg(PO4)7 |
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| ⓘ | Adamite | 8.BB.30 | Zn2(AsO4)(OH) |
| ⓘ | Olivenite | 8.BB.30 | Cu2(AsO4)(OH) |
| ⓘ | Lazulite | 8.BB.40 | MgAl2(PO4)2(OH)2 |
| ⓘ | Cornwallite | 8.BD.05 | Cu5(AsO4)2(OH)4 |
| ⓘ | Pseudomalachite | 8.BD.05 | Cu5(PO4)2(OH)4 |
| ⓘ | Clinoclase | 8.BE.20 | Cu3(AsO4)(OH)3 |
| ⓘ | Theisite | 8.BE.75 | Cu5Zn5(AsO4,SbO4)2(OH)14 |
| ⓘ | Conichalcite | 8.BH.35 | CaCu(AsO4)(OH) |
| ⓘ | Bayldonite | 8.BH.45 | PbCu3(AsO4)2(OH)2 |
| ⓘ | Beudantite | 8.BL.05 | PbFe3+3(AsO4)(SO4)(OH)6 |
| ⓘ | Corkite (TL) | 8.BL.05 | PbFe3+3(PO4)(SO4)(OH)6 |
| ⓘ | Hidalgoite | 8.BL.05 | PbAl3(AsO4)(SO4)(OH)6 |
| ⓘ | Crandallite | 8.BL.10 | CaAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Kintoreite | 8.BL.10 | PbFe3(PO4)(PO3OH)(OH)6 |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Hedyphane | 8.BN.05 | Ca2Pb3(AsO4)3Cl |
| ⓘ | Mimetite | 8.BN.05 | Pb5(AsO4)3Cl |
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Phosphosiderite | 8.CD.05 | FePO4 · 2H2O |
| ⓘ | Scorodite | 8.CD.10 | Fe3+AsO4 · 2H2O |
| ⓘ | Strengite | 8.CD.10 | FePO4 · 2H2O |
| ⓘ | Variscite ? | 8.CD.10 | AlPO4 · 2H2O |
| ⓘ | Annabergite | 8.CE.40 | Ni3(AsO4)2 · 8H2O |
| ⓘ | Erythrite | 8.CE.40 | Co3(AsO4)2 · 8H2O |
| ⓘ | Köttigite | 8.CE.40 | Zn3(AsO4)2 · 8H2O |
| ⓘ | Parasymplesite | 8.CE.40 | Fe2+3(AsO4)2 · 8H2O |
| ⓘ | Koninckite | 8.CE.55 | Fe3+PO4 · 3H2O |
| ⓘ | Struvite | 8.CH.40 | (NH4)Mg(PO4) · 6H2O |
| ⓘ | Smolyaninovite | 8.CH.55 | Co3Fe3+2(AsO4)4 · 11H2O |
| ⓘ | Phaunouxite | 8.CJ.40 | Ca3(AsO4)2 · 11H2O |
| ⓘ | Rauenthalite | 8.CJ.40 | Ca3(AsO4)2 · 10H2O |
| ⓘ | Brushite | 8.CJ.50 | Ca(PO3OH) · 2H2O |
| ⓘ | Churchite-(Y) | 8.CJ.50 | Y(PO4) · 2H2O |
| ⓘ | Pharmacolite | 8.CJ.50 | Ca(HAsO4) · 2H2O |
| ⓘ | Strashimirite | 8.DC.12 | Cu8(AsO4)4(OH)4 · 5H2O |
| ⓘ | Beraunite | 8.DC.27 | Fe3+6(PO4)4O(OH)4 · 6H2O |
| ⓘ | Cacoxenite | 8.DC.40 | Fe3+24AlO6(PO4)17(OH)12 · 75H2O |
| ⓘ | Wavellite | 8.DC.50 | Al3(PO4)2(OH)3 · 5H2O |
| ⓘ | Chalcosiderite | 8.DD.15 | CuFe3+6(PO4)4(OH)8 · 4H2O |
| ⓘ | Planerite | 8.DD.15 | Al6(PO4)2(PO3OH)2(OH)8 · 4H2O |
| ⓘ | Turquoise | 8.DD.15 | CuAl6(PO4)4(OH)8 · 4H2O |
| ⓘ | Liroconite ? | 8.DF.20 | Cu2Al(AsO4)(OH)4 · 4H2O |
| ⓘ | Chalcophyllite | 8.DF.30 | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| ⓘ | Parnauite | 8.DF.35 | Cu9(AsO4)2(SO4)(OH)10 · 7H2O |
| ⓘ | Lavendulan | 8.DG.05 | NaCaCu5(AsO4)4Cl · 5H2O |
| ⓘ | Pharmacosiderite | 8.DK.10 | KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| ⓘ | Kidwellite | 8.DK.20 | NaFe3+9+x(PO4)6(OH)11 · 3H2O, x = 0.33 |
| ⓘ | Zálesíite | 8.DL.15 | CaCu6(AsO4)2(AsO3OH)(OH)6 · 3H2O |
| ⓘ | Tyrolite | 8.DM.10 | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| ⓘ | Torbernite | 8.EB.05 | Cu(UO2)2(PO4)2 · 12H2O |
| Group 9 - Silicates | |||
| ⓘ | Willemite ? | 9.AA.05 | Zn2SiO4 |
| ⓘ | Fayalite | 9.AC.05 | Fe2+2(SiO4) |
| ⓘ | Forsterite | 9.AC.05 | Mg2(SiO4) |
| ⓘ | Monticellite | 9.AC.10 | CaMg(SiO4) |
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Grossular | 9.AD.25 | Ca3Al2(SiO4)3 |
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Sillimanite | 9.AF.05 | Al2(SiO4)O |
| ⓘ | var. Fibrolite | 9.AF.05 | Al2(SiO4)O |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | var. Chiastolite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Kyanite | 9.AF.15 | Al2(SiO4)O |
| ⓘ | Staurolite | 9.AF.30 | Fe2+2Al9Si4O23(OH) |
| ⓘ | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| ⓘ | Braunite | 9.AG.05 | Mn2+Mn3+6(SiO4)O8 |
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | Afwillite | 9.AG.75 | Ca3[SiO4][SiO2(OH)2] · 2H2O |
| ⓘ | Spurrite | 9.AH.15 | Ca5(SiO4)2(CO3) |
| ⓘ | Bertrandite | 9.BD.05 | Be4(Si2O7)(OH)2 |
| ⓘ | Hemimorphite | 9.BD.10 | Zn4Si2O7(OH)2 · H2O |
| ⓘ | Axinite-(Mn) | 9.BD.20 | Ca2Mn2+Al2BSi4O15(OH) |
| ⓘ | Cuspidine | 9.BE.17 | Ca8(Si2O7)2F4 |
| ⓘ | Tilleyite | 9.BE.82 | Ca5(Si2O7)(CO3)2 |
| ⓘ | Killalaite (TL) | 9.BE.85 | Ca6.4(H0.6Si2O7)2(OH)2 |
| ⓘ | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Allanite-(Ce) | 9.BG.05b | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ | Zoisite | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Rustumite | 9.BG.30 | Ca10(Si2O7)2(SiO4)(OH)2Cl2 |
| ⓘ | Vesuvianite | 9.BG.35 | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Cordierite | 9.CJ.10 | Mg2Al4Si5O18 |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Foitite ? | 9.CK.05 | ◻(Fe2+2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Scawtite | 9.CK.15 | Ca7(Si3O9)2CO3 · 2H2O |
| ⓘ | Eudialyte | 9.CO.10 | Na15Ca6Fe3Zr3Si(Si25O73)(O,OH,H2O)3(Cl,OH)2 |
| ⓘ | Augite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Augite var. Titanium-bearing Augite | 9.DA.15 | (Ca,Na)(Mg,Ti, Fe,Al,)(Si,Al)2O6 |
| ⓘ | var. Ferroaugite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Aegirine-augite | 9.DA.20 | (NaaCabFe2+cMgd)(Fe3+eAlfFe2+gMgh)Si2O6 |
| ⓘ | Spodumene | 9.DA.30 | LiAlSi2O6 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Kaersutite | 9.DE.15 | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| ⓘ | Pectolite | 9.DG.05 | NaCa2Si3O8(OH) |
| ⓘ | Wollastonite | 9.DG.05 | Ca3(Si3O9) |
| ⓘ | Xonotlite | 9.DG.35 | Ca6(Si6O17)(OH)2 |
| ⓘ | Prehnite | 9.DP.20 | Ca2Al2Si3O10(OH)2 |
| ⓘ | Minnesotaite | 9.EC.05 | Fe2+3Si4O10(OH)2 |
| ⓘ | Muscovite var. Fuchsite | 9.EC.15 | K(Al,Cr)3Si3O10(OH)2 |
| ⓘ | var. Illite | 9.EC.15 | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | Paragonite | 9.EC.15 | NaAl2(AlSi3O10)(OH)2 |
| ⓘ | Muscovite var. Phengite | 9.EC.15 | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| ⓘ | var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | var. Mariposite | 9.EC.15 | K(Al,Cr)2(Al,Si)4O10(OH)2 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Polylithionite | 9.EC.20 | KLi2Al(Si4O10)(F,OH)2 |
| ⓘ | Siderophyllite | 9.EC.20 | KFe2+2Al(Al2Si2O10)(OH)2 |
| ⓘ | Montmorillonite | 9.EC.40 | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ | Nontronite | 9.EC.40 | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| ⓘ | Sauconite | 9.EC.45 | Na0.3Zn3((Si,Al)4O10)(OH)2 · 4H2O |
| ⓘ | Vermiculite | 9.EC.50 | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| ⓘ | Chamosite | 9.EC.55 | Fe2+5Al(AlSi3O10)(OH)8 |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | var. Pennine | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Halloysite | 9.ED.10 | Al2Si2O5(OH)4 · n(H2O) |
| ⓘ | Amesite | 9.ED.15 | Mg2Al(AlSiO5)(OH)4 |
| ⓘ | Allophane | 9.ED.20 | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Stilpnomelane | 9.EG.40 | K4Fe2+48[Si64Al8]O164(OH)52 · nH2O |
| ⓘ | Neptunite | 9.EH.05 | KNa2Li(Fe2+)2Ti2[Si4O12]2 |
| ⓘ | Microcline var. Hyalophane | 9.FA.30 | (K,Ba)[Al(Si,Al)Si2O8] |
| ⓘ | 9.FA.30 | K(AlSi3O8) | |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Andesine | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ | Anorthite | 9.FA.35 | Ca(Al2Si2O8) |
| ⓘ | var. Labradorite | 9.FA.35 | (Ca,Na)[Al(Al,Si)Si2O8] |
| ⓘ | Albite var. Oligoclase | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ | Harmotome | 9.GC.10 | Ba2(Si12Al4)O32 · 12H2O |
| ⓘ | Chabazite-Ca | 9.GD.10 | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| ⓘ | Heulandite-Ca | 9.GE.05 | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| ⓘ | Stilbite-Ca | 9.GE.10 | NaCa4(Si27Al9)O72 · 28H2O |
| ⓘ | Brewsterite-Ba | 9.GE.20 | Ba(Al2Si6)O16 · 5H2O |
| Unclassified | |||
| ⓘ | 'K Feldspar var. Adularia' | - | KAlSi3O8 |
| ⓘ | 'Amphibole Supergroup' | - | AB2C5(T8O22)W2 |
| ⓘ | 'Andrewsite' | - | |
| ⓘ | 'Asbestos' | - | |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Clay minerals' | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Guitermanite' | - | Pb10As6S19 (?) |
| ⓘ | 'Hypersthene' | - | (Mg,Fe)SiO3 |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Monazite Group' | - | REE(PO4) |
| ⓘ | 'Psilomelane' | - | |
| ⓘ | 'Tantalite' | - | (Mn,Fe)(Ta,Nb)2O6 |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Wad' | - | |
| ⓘ | 'Melnikovite' | - | |
| ⓘ | 'Leucoxene' | - | |
| ⓘ | 'Manganomelane' | - | |
| ⓘ | 'Xenotime' | - | |
| ⓘ | 'Feldspar Group var. Perthite' | - | |
| ⓘ | 'Mica Group' | - | |
| ⓘ | 'Clinopyroxene Subgroup' | - | |
| ⓘ | 'Fayalite-Forsterite Series' | - | |
| ⓘ | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'Petroleum var. Bitumen' | - | |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Chrome-Spinel (of Dana)' | - | |
| ⓘ | 'Biotite var. Chromium-bearing Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Apatite var. Collophane' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Meteoritic Iron' | - | |
| ⓘ | 'Orthopyroxene Subgroup' | - | |
| ⓘ | 'Serpentine Subgroup' | - | D3[Si2O5](OH)4 |
| ⓘ | 'Glass' | - | |
| ⓘ | 'Manganese Oxides' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
| ⓘ | 'Olivine Group' | - | M2SiO4 |
| ⓘ | 'Melilite Group' | - | A2M(XSiO7) |
| ⓘ | 'Tetrahedrite Group' | - | M2(A6)M1(B4 C2)X3(D4)S1(Y12)S2(Z) |
| ⓘ | 'Pyrobitumen' | - | |
| ⓘ | 'Högbomite Group' | - | |
| ⓘ | 'Columbite Group' | - | |
| ⓘ | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| ⓘ | 'Unnamed (Pb Thiosulphate)' | - | PbS2O3 |
| ⓘ | 'Micrite' | - | |
| ⓘ | 'Myrmekite' | - | |
| ⓘ | 'Sparite' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Adamite | Zn2(AsO4)(OH) |
| H | ⓘ Afwillite | Ca3[SiO4][SiO2(OH)2] · 2H2O |
| H | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| H | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| H | ⓘ Amesite | Mg2Al(AlSiO5)(OH)4 |
| H | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| H | ⓘ Asbolane | (Ni,Co)2-xMn4+(O,OH)4 · nH2O |
| H | ⓘ Atacamite | Cu2(OH)3Cl |
| H | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| H | ⓘ Beraunite | Fe63+(PO4)4O(OH)4 · 6H2O |
| H | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| H | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Botallackite | Cu2(OH)3Cl |
| H | ⓘ Boyleite | ZnSO4 · 4H2O |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Brushite | Ca(PO3OH) · 2H2O |
| H | ⓘ Brucite | Mg(OH)2 |
| H | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| H | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| H | ⓘ Chalcosiderite | CuFe63+(PO4)4(OH)8 · 4H2O |
| H | ⓘ Chalcomenite | CuSeO3 · 2H2O |
| H | ⓘ Chalcanthite | CuSO4 · 5H2O |
| H | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| H | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Churchite-(Y) | Y(PO4) · 2H2O |
| H | ⓘ Clinoclase | Cu3(AsO4)(OH)3 |
| H | ⓘ Clinoatacamite | Cu2(OH)3Cl |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| H | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| H | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| H | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| H | ⓘ Cornwallite | Cu5(AsO4)2(OH)4 |
| H | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Dundasite | PbAl2(CO3)2(OH)4 · H2O |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| H | ⓘ Eudialyte | Na15Ca6Fe3Zr3Si(Si25O73)(O,OH,H2O)3(Cl,OH)2 |
| H | ⓘ Felsőbányaite | Al4(SO4)(OH)10 · 4H2O |
| H | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| H | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| H | ⓘ Gibbsite | Al(OH)3 |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Halloysite | Al2Si2O5(OH)4 · n(H2O) |
| H | ⓘ Halotrichite | Fe2+Al2(SO4)4 · 22H2O |
| H | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| H | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| H | ⓘ Hidalgoite | PbAl3(AsO4)(SO4)(OH)6 |
| H | ⓘ Hetaerolite var. Hydrohetaerolite | Zn(Mn,◻)2(O,OH)4 |
| H | ⓘ Hydroniumjarosite | (H3O)Fe33+(SO4)2(OH)6 |
| H | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| H | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Kidwellite | NaFe3+9+x(PO4)6(OH)11 · 3H2O, x = 0.33 |
| H | ⓘ Killalaite | Ca6.4(H0.6Si2O7)2(OH)2 |
| H | ⓘ Kintoreite | PbFe3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Koninckite | Fe3+PO4 · 3H2O |
| H | ⓘ Köttigite | Zn3(AsO4)2 · 8H2O |
| H | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| H | ⓘ Lazulite | MgAl2(PO4)2(OH)2 |
| H | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| H | ⓘ Lepidocrocite | Fe3+O(OH) |
| H | ⓘ Linarite | PbCu(SO4)(OH)2 |
| H | ⓘ Liroconite | Cu2Al(AsO4)(OH)4 · 4H2O |
| H | ⓘ Axinite-(Mn) | Ca2Mn2+Al2BSi4O15(OH) |
| H | ⓘ Manganite | Mn3+O(OH) |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| H | ⓘ Metasideronatrite | Na2Fe(SO4)2(OH) · H2O |
| H | ⓘ Minnesotaite | Fe32+Si4O10(OH)2 |
| H | ⓘ Monohydrocalcite | CaCO3 · H2O |
| H | ⓘ Morenosite | NiSO4 · 7H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| H | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| H | ⓘ Olivenite | Cu2(AsO4)(OH) |
| H | ⓘ Orthoserpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| H | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| H | ⓘ Parasymplesite | Fe32+(AsO4)2 · 8H2O |
| H | ⓘ Parnauite | Cu9(AsO4)2(SO4)(OH)10 · 7H2O |
| H | ⓘ Pectolite | NaCa2Si3O8(OH) |
| H | ⓘ Pharmacolite | Ca(HAsO4) · 2H2O |
| H | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| H | ⓘ Phaunouxite | Ca3(AsO4)2 · 11H2O |
| H | ⓘ Phosphosiderite | FePO4 · 2H2O |
| H | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Planerite | Al6(PO4)2(PO3OH)2(OH)8 · 4H2O |
| H | ⓘ Polylithionite | KLi2Al(Si4O10)(F,OH)2 |
| H | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| H | ⓘ Alum-(K) | KAl(SO4)2 · 12H2O |
| H | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| H | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| H | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
| H | ⓘ Rauenthalite | Ca3(AsO4)2 · 10H2O |
| H | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| H | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| H | ⓘ Rozenite | FeSO4 · 4H2O |
| H | ⓘ Rustumite | Ca10(Si2O7)2(SiO4)(OH)2Cl2 |
| H | ⓘ Sauconite | Na0.3Zn3((Si,Al)4O10)(OH)2 · 4H2O |
| H | ⓘ Scawtite | Ca7(Si3O9)2CO3 · 2H2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| H | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| H | ⓘ Sideronatrite | Na2Fe(SO4)2(OH) · 3H2O |
| H | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| H | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| H | ⓘ Stilpnomelane | K4Fe482+[Si64Al8]O164(OH)52 · nH2O |
| H | ⓘ Strashimirite | Cu8(AsO4)4(OH)4 · 5H2O |
| H | ⓘ Strengite | FePO4 · 2H2O |
| H | ⓘ Struvite | (NH4)Mg(PO4) · 6H2O |
| H | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| H | ⓘ Theisite | Cu5Zn5(AsO4,SbO4)2(OH)14 |
| H | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| H | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| H | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| H | ⓘ Variscite | AlPO4 · 2H2O |
| H | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| H | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| H | ⓘ Wavellite | Al3(PO4)2(OH)3 · 5H2O |
| H | ⓘ Woodwardite | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| H | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Xonotlite | Ca6(Si6O17)(OH)2 |
| H | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| H | ⓘ Brewsterite-Ba | Ba(Al2Si6)O16 · 5H2O |
| H | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| H | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| H | ⓘ Zálesíite | CaCu6(AsO4)2(AsO3OH)(OH)6 · 3H2O |
| H | ⓘ Smolyaninovite | Co3Fe23+(AsO4)4 · 11H2O |
| H | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Biotite var. Chromium-bearing Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Muscovite var. Mariposite | K(Al,Cr)2(Al,Si)4O10(OH)2 |
| H | ⓘ Apatite var. Collophane | Ca5(PO4)3(Cl/F/OH) |
| H | ⓘ Redgillite | Cu6(SO4)(OH)10 · H2O |
| H | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| H | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| Li | Lithium | |
| Li | ⓘ Lithiophilite | LiMn2+PO4 |
| Li | ⓘ Neptunite | KNa2Li(Fe2+)2Ti2[Si4O12]2 |
| Li | ⓘ Polylithionite | KLi2Al(Si4O10)(F,OH)2 |
| Li | ⓘ Spodumene | LiAlSi2O6 |
| Be | Beryllium | |
| Be | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Axinite-(Mn) | Ca2Mn2+Al2BSi4O15(OH) |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Dundasite | PbAl2(CO3)2(OH)4 · H2O |
| C | ⓘ Graphite | C |
| C | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| C | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| C | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Minrecordite | CaZn(CO3)2 |
| C | ⓘ Monohydrocalcite | CaCO3 · H2O |
| C | ⓘ Otavite | CdCO3 |
| C | ⓘ Phosgenite | Pb2CO3Cl2 |
| C | ⓘ Rhodochrosite | MnCO3 |
| C | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| C | ⓘ Scawtite | Ca7(Si3O9)2CO3 · 2H2O |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Smithsonite | ZnCO3 |
| C | ⓘ Spurrite | Ca5(SiO4)2(CO3) |
| C | ⓘ Strontianite | SrCO3 |
| C | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| C | ⓘ Tilleyite | Ca5(Si2O7)(CO3)2 |
| C | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| C | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| N | Nitrogen | |
| N | ⓘ Struvite | (NH4)Mg(PO4) · 6H2O |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Adamite | Zn2(AsO4)(OH) |
| O | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| O | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| O | ⓘ Afwillite | Ca3[SiO4][SiO2(OH)2] · 2H2O |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| O | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| O | ⓘ Amesite | Mg2Al(AlSiO5)(OH)4 |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Amphibole Supergroup | AB2C5(T8O22)W2 |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Anhydrite | CaSO4 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| O | ⓘ Anorthite | Ca(Al2Si2O8) |
| O | ⓘ Arsenolite | As2O3 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Asbolane | (Ni,Co)2-xMn4+(O,OH)4 · nH2O |
| O | ⓘ Atacamite | Cu2(OH)3Cl |
| O | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| O | ⓘ Beraunite | Fe63+(PO4)4O(OH)4 · 6H2O |
| O | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| O | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| O | ⓘ Bindheimite | Pb2Sb2O6O |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Botallackite | Cu2(OH)3Cl |
| O | ⓘ Boyleite | ZnSO4 · 4H2O |
| O | ⓘ Brannerite | UTi2O6 |
| O | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Brushite | Ca(PO3OH) · 2H2O |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Brucite | Mg(OH)2 |
| O | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Celestine | SrSO4 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Chalcosiderite | CuFe63+(PO4)4(OH)8 · 4H2O |
| O | ⓘ Chalcomenite | CuSeO3 · 2H2O |
| O | ⓘ Chalcanthite | CuSO4 · 5H2O |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| O | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| O | ⓘ Andalusite var. Chiastolite | Al2(SiO4)O |
| O | ⓘ Chromite | Fe2+Cr23+O4 |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Churchite-(Y) | Y(PO4) · 2H2O |
| O | ⓘ Clinoclase | Cu3(AsO4)(OH)3 |
| O | ⓘ Clinoatacamite | Cu2(OH)3Cl |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| O | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| O | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| O | ⓘ Cordierite | Mg2Al4Si5O18 |
| O | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| O | ⓘ Cornwallite | Cu5(AsO4)2(OH)4 |
| O | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| O | ⓘ Corundum | Al2O3 |
| O | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Cuspidine | Ca8(Si2O7)2F4 |
| O | ⓘ Delafossite | Cu+Fe3+O2 |
| O | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Dundasite | PbAl2(CO3)2(OH)4 · H2O |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| O | ⓘ Eskolaite | Cr2O3 |
| O | ⓘ Eudialyte | Na15Ca6Fe3Zr3Si(Si25O73)(O,OH,H2O)3(Cl,OH)2 |
| O | ⓘ Fayalite | Fe22+(SiO4) |
| O | ⓘ Felsőbányaite | Al4(SO4)(OH)10 · 4H2O |
| O | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Forsterite | Mg2(SiO4) |
| O | ⓘ Franklinite | Zn2+Fe23+O4 |
| O | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| O | ⓘ Gibbsite | Al(OH)3 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Grossular | Ca3Al2(SiO4)3 |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Halloysite | Al2Si2O5(OH)4 · n(H2O) |
| O | ⓘ Halotrichite | Fe2+Al2(SO4)4 · 22H2O |
| O | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| O | ⓘ Hedyphane | Ca2Pb3(AsO4)3Cl |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| O | ⓘ Hercynite | Fe2+Al2O4 |
| O | ⓘ Hetaerolite | ZnMn2O4 |
| O | ⓘ Hidalgoite | PbAl3(AsO4)(SO4)(OH)6 |
| O | ⓘ Hollandite | Ba(Mn64+Mn23+)O16 |
| O | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| O | ⓘ Hetaerolite var. Hydrohetaerolite | Zn(Mn,◻)2(O,OH)4 |
| O | ⓘ Hydroniumjarosite | (H3O)Fe33+(SO4)2(OH)6 |
| O | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| O | ⓘ Hypersthene | (Mg,Fe)SiO3 |
| O | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Kidwellite | NaFe3+9+x(PO4)6(OH)11 · 3H2O, x = 0.33 |
| O | ⓘ Killalaite | Ca6.4(H0.6Si2O7)2(OH)2 |
| O | ⓘ Kintoreite | PbFe3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Koninckite | Fe3+PO4 · 3H2O |
| O | ⓘ Köttigite | Zn3(AsO4)2 · 8H2O |
| O | ⓘ Kyanite | Al2(SiO4)O |
| O | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| O | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| O | ⓘ Lazulite | MgAl2(PO4)2(OH)2 |
| O | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| O | ⓘ Lepidocrocite | Fe3+O(OH) |
| O | ⓘ Linarite | PbCu(SO4)(OH)2 |
| O | ⓘ Liroconite | Cu2Al(AsO4)(OH)4 · 4H2O |
| O | ⓘ Lithiophilite | LiMn2+PO4 |
| O | ⓘ Axinite-(Mn) | Ca2Mn2+Al2BSi4O15(OH) |
| O | ⓘ Manganite | Mn3+O(OH) |
| O | ⓘ Tantalite-(Mn) | Mn2+Ta2O6 |
| O | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| O | ⓘ Metasideronatrite | Na2Fe(SO4)2(OH) · H2O |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Mimetite | Pb5(AsO4)3Cl |
| O | ⓘ Minnesotaite | Fe32+Si4O10(OH)2 |
| O | ⓘ Minrecordite | CaZn(CO3)2 |
| O | ⓘ Monazite Group | REE(PO4) |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Monohydrocalcite | CaCO3 · H2O |
| O | ⓘ Monticellite | CaMg(SiO4) |
| O | ⓘ Morenosite | NiSO4 · 7H2O |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| O | ⓘ Neptunite | KNa2Li(Fe2+)2Ti2[Si4O12]2 |
| O | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| O | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Olivenite | Cu2(AsO4)(OH) |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Orthoserpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| O | ⓘ Otavite | CdCO3 |
| O | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| O | ⓘ Parasymplesite | Fe32+(AsO4)2 · 8H2O |
| O | ⓘ Parnauite | Cu9(AsO4)2(SO4)(OH)10 · 7H2O |
| O | ⓘ Pectolite | NaCa2Si3O8(OH) |
| O | ⓘ Pharmacolite | Ca(HAsO4) · 2H2O |
| O | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| O | ⓘ Phaunouxite | Ca3(AsO4)2 · 11H2O |
| O | ⓘ Phosphosiderite | FePO4 · 2H2O |
| O | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Phosgenite | Pb2CO3Cl2 |
| O | ⓘ Planerite | Al6(PO4)2(PO3OH)2(OH)8 · 4H2O |
| O | ⓘ Polylithionite | KLi2Al(Si4O10)(F,OH)2 |
| O | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| O | ⓘ Alum-(K) | KAl(SO4)2 · 12H2O |
| O | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| O | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| O | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rauenthalite | Ca3(AsO4)2 · 10H2O |
| O | ⓘ Rhodochrosite | MnCO3 |
| O | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| O | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| O | ⓘ Quartz var. Rose Quartz | SiO2 |
| O | ⓘ Rozenite | FeSO4 · 4H2O |
| O | ⓘ Rustumite | Ca10(Si2O7)2(SiO4)(OH)2Cl2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Corundum var. Sapphire | Al2O3 |
| O | ⓘ Sauconite | Na0.3Zn3((Si,Al)4O10)(OH)2 · 4H2O |
| O | ⓘ Scawtite | Ca7(Si3O9)2CO3 · 2H2O |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| O | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Sideronatrite | Na2Fe(SO4)2(OH) · 3H2O |
| O | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| O | ⓘ Sillimanite | Al2(SiO4)O |
| O | ⓘ Smithsonite | ZnCO3 |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Spinel | MgAl2O4 |
| O | ⓘ Spodumene | LiAlSi2O6 |
| O | ⓘ Spurrite | Ca5(SiO4)2(CO3) |
| O | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| O | ⓘ Stilpnomelane | K4Fe482+[Si64Al8]O164(OH)52 · nH2O |
| O | ⓘ Strashimirite | Cu8(AsO4)4(OH)4 · 5H2O |
| O | ⓘ Strengite | FePO4 · 2H2O |
| O | ⓘ Strontianite | SrCO3 |
| O | ⓘ Struvite | (NH4)Mg(PO4) · 6H2O |
| O | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| O | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| O | ⓘ Tenorite | CuO |
| O | ⓘ Theisite | Cu5Zn5(AsO4,SbO4)2(OH)14 |
| O | ⓘ Cuprite var. Tile ore | Cu2O |
| O | ⓘ Tilleyite | Ca5(Si2O7)(CO3)2 |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Magnetite var. Titanium-bearing Magnetite | Fe2+(Fe3+,Ti)2O4 |
| O | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| O | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| O | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Variscite | AlPO4 · 2H2O |
| O | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| O | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| O | ⓘ Wavellite | Al3(PO4)2(OH)3 · 5H2O |
| O | ⓘ Willemite | Zn2SiO4 |
| O | ⓘ Cassiterite var. Wood Tin | SnO2 |
| O | ⓘ Woodwardite | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| O | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Wollastonite | Ca3(Si3O9) |
| O | ⓘ Xonotlite | Ca6(Si6O17)(OH)2 |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| O | ⓘ Hematite var. Specularite | Fe2O3 |
| O | ⓘ Quartz var. Rock Crystal | SiO2 |
| O | ⓘ Quartz var. Milky Quartz | SiO2 |
| O | ⓘ Sillimanite var. Fibrolite | Al2(SiO4)O |
| O | ⓘ Merrillite | Ca9NaMg(PO4)7 |
| O | ⓘ Spinel var. Pleonaste | (Mg,Fe)Al2O4 |
| O | ⓘ Quartz var. Prase | SiO2 |
| O | ⓘ Brewsterite-Ba | Ba(Al2Si6)O16 · 5H2O |
| O | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| O | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| O | ⓘ Zálesíite | CaCu6(AsO4)2(AsO3OH)(OH)6 · 3H2O |
| O | ⓘ Smolyaninovite | Co3Fe23+(AsO4)4 · 11H2O |
| O | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| O | ⓘ Fayalite-Forsterite Series | |
| O | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Biotite var. Chromium-bearing Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Quartz var. Cotterite | SiO2 |
| O | ⓘ Muscovite var. Mariposite | K(Al,Cr)2(Al,Si)4O10(OH)2 |
| O | ⓘ Apatite var. Collophane | Ca5(PO4)3(Cl/F/OH) |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Redgillite | Cu6(SO4)(OH)10 · H2O |
| O | ⓘ Augite var. Titanium-bearing Augite | (Ca,Na)(Mg,Ti, Fe,Al,)(Si,Al)2O6 |
| O | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| O | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| O | ⓘ Hematite var. Crucilite | Fe2O3 |
| O | ⓘ Quartz var. Ferruginous Quartz | SiO2 |
| O | ⓘ Apatite | Ca5(PO4)3A |
| O | ⓘ Olivine Group | M2SiO4 |
| O | ⓘ Melilite Group | A2M(XSiO7) |
| O | ⓘ Augite var. Ferroaugite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| O | ⓘ Unnamed (Pb Thiosulphate) | PbS2O3 |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Cuspidine | Ca8(Si2O7)2F4 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Polylithionite | KLi2Al(Si4O10)(F,OH)2 |
| F | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| F | ⓘ Biotite var. Chromium-bearing Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Apatite var. Collophane | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Eudialyte | Na15Ca6Fe3Zr3Si(Si25O73)(O,OH,H2O)3(Cl,OH)2 |
| Na | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Na | ⓘ Kidwellite | NaFe3+9+x(PO4)6(OH)11 · 3H2O, x = 0.33 |
| Na | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Na | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| Na | ⓘ Metasideronatrite | Na2Fe(SO4)2(OH) · H2O |
| Na | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Na | ⓘ Neptunite | KNa2Li(Fe2+)2Ti2[Si4O12]2 |
| Na | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Na | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| Na | ⓘ Pectolite | NaCa2Si3O8(OH) |
| Na | ⓘ Sauconite | Na0.3Zn3((Si,Al)4O10)(OH)2 · 4H2O |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Sideronatrite | Na2Fe(SO4)2(OH) · 3H2O |
| Na | ⓘ Merrillite | Ca9NaMg(PO4)7 |
| Na | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Na | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Na | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Na | ⓘ Augite var. Titanium-bearing Augite | (Ca,Na)(Mg,Ti, Fe,Al,)(Si,Al)2O6 |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Mg | ⓘ Amesite | Mg2Al(AlSiO5)(OH)4 |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Brucite | Mg(OH)2 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Cordierite | Mg2Al4Si5O18 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Forsterite | Mg2(SiO4) |
| Mg | ⓘ Hypersthene | (Mg,Fe)SiO3 |
| Mg | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Mg | ⓘ Lazulite | MgAl2(PO4)2(OH)2 |
| Mg | ⓘ Monticellite | CaMg(SiO4) |
| Mg | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Mg | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Spinel | MgAl2O4 |
| Mg | ⓘ Struvite | (NH4)Mg(PO4) · 6H2O |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Mg | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Mg | ⓘ Merrillite | Ca9NaMg(PO4)7 |
| Mg | ⓘ Spinel var. Pleonaste | (Mg,Fe)Al2O4 |
| Mg | ⓘ Fayalite-Forsterite Series | |
| Mg | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Biotite var. Chromium-bearing Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Augite var. Titanium-bearing Augite | (Ca,Na)(Mg,Ti, Fe,Al,)(Si,Al)2O6 |
| Mg | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Mg | ⓘ Augite var. Ferroaugite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Al | Aluminium | |
| Al | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Al | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Al | ⓘ Amesite | Mg2Al(AlSiO5)(OH)4 |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Anorthite | Ca(Al2Si2O8) |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| Al | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Al | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| Al | ⓘ Andalusite var. Chiastolite | Al2(SiO4)O |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Cordierite | Mg2Al4Si5O18 |
| Al | ⓘ Corundum | Al2O3 |
| Al | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Dundasite | PbAl2(CO3)2(OH)4 · H2O |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Felsőbányaite | Al4(SO4)(OH)10 · 4H2O |
| Al | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Al | ⓘ Gibbsite | Al(OH)3 |
| Al | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Al | ⓘ Halloysite | Al2Si2O5(OH)4 · n(H2O) |
| Al | ⓘ Halotrichite | Fe2+Al2(SO4)4 · 22H2O |
| Al | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| Al | ⓘ Hercynite | Fe2+Al2O4 |
| Al | ⓘ Hidalgoite | PbAl3(AsO4)(SO4)(OH)6 |
| Al | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| Al | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Al | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Kyanite | Al2(SiO4)O |
| Al | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Al | ⓘ Lazulite | MgAl2(PO4)2(OH)2 |
| Al | ⓘ Liroconite | Cu2Al(AsO4)(OH)4 · 4H2O |
| Al | ⓘ Axinite-(Mn) | Ca2Mn2+Al2BSi4O15(OH) |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Al | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Al | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Planerite | Al6(PO4)2(PO3OH)2(OH)8 · 4H2O |
| Al | ⓘ Polylithionite | KLi2Al(Si4O10)(F,OH)2 |
| Al | ⓘ Alum-(K) | KAl(SO4)2 · 12H2O |
| Al | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Al | ⓘ Corundum var. Sapphire | Al2O3 |
| Al | ⓘ Sauconite | Na0.3Zn3((Si,Al)4O10)(OH)2 · 4H2O |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| Al | ⓘ Sillimanite | Al2(SiO4)O |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Spinel | MgAl2O4 |
| Al | ⓘ Spodumene | LiAlSi2O6 |
| Al | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Al | ⓘ Stilpnomelane | K4Fe482+[Si64Al8]O164(OH)52 · nH2O |
| Al | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Al | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| Al | ⓘ Variscite | AlPO4 · 2H2O |
| Al | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Al | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | ⓘ Wavellite | Al3(PO4)2(OH)3 · 5H2O |
| Al | ⓘ Woodwardite | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| Al | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Sillimanite var. Fibrolite | Al2(SiO4)O |
| Al | ⓘ Spinel var. Pleonaste | (Mg,Fe)Al2O4 |
| Al | ⓘ Brewsterite-Ba | Ba(Al2Si6)O16 · 5H2O |
| Al | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Al | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Al | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Al | ⓘ Biotite var. Chromium-bearing Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Muscovite var. Mariposite | K(Al,Cr)2(Al,Si)4O10(OH)2 |
| Al | ⓘ Augite var. Titanium-bearing Augite | (Ca,Na)(Mg,Ti, Fe,Al,)(Si,Al)2O6 |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Si | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Si | ⓘ Afwillite | Ca3[SiO4][SiO2(OH)2] · 2H2O |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Si | ⓘ Amesite | Mg2Al(AlSiO5)(OH)4 |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Anorthite | Ca(Al2Si2O8) |
| Si | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Si | ⓘ Andalusite var. Chiastolite | Al2(SiO4)O |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Cordierite | Mg2Al4Si5O18 |
| Si | ⓘ Cuspidine | Ca8(Si2O7)2F4 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Eudialyte | Na15Ca6Fe3Zr3Si(Si25O73)(O,OH,H2O)3(Cl,OH)2 |
| Si | ⓘ Fayalite | Fe22+(SiO4) |
| Si | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Forsterite | Mg2(SiO4) |
| Si | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Si | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Si | ⓘ Halloysite | Al2Si2O5(OH)4 · n(H2O) |
| Si | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| Si | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Si | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| Si | ⓘ Hypersthene | (Mg,Fe)SiO3 |
| Si | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Si | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Killalaite | Ca6.4(H0.6Si2O7)2(OH)2 |
| Si | ⓘ Kyanite | Al2(SiO4)O |
| Si | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Si | ⓘ Axinite-(Mn) | Ca2Mn2+Al2BSi4O15(OH) |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Minnesotaite | Fe32+Si4O10(OH)2 |
| Si | ⓘ Monticellite | CaMg(SiO4) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Si | ⓘ Neptunite | KNa2Li(Fe2+)2Ti2[Si4O12]2 |
| Si | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Si | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Pectolite | NaCa2Si3O8(OH) |
| Si | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Polylithionite | KLi2Al(Si4O10)(F,OH)2 |
| Si | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Quartz var. Rose Quartz | SiO2 |
| Si | ⓘ Rustumite | Ca10(Si2O7)2(SiO4)(OH)2Cl2 |
| Si | ⓘ Sauconite | Na0.3Zn3((Si,Al)4O10)(OH)2 · 4H2O |
| Si | ⓘ Scawtite | Ca7(Si3O9)2CO3 · 2H2O |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| Si | ⓘ Sillimanite | Al2(SiO4)O |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Spodumene | LiAlSi2O6 |
| Si | ⓘ Spurrite | Ca5(SiO4)2(CO3) |
| Si | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Si | ⓘ Stilpnomelane | K4Fe482+[Si64Al8]O164(OH)52 · nH2O |
| Si | ⓘ Tilleyite | Ca5(Si2O7)(CO3)2 |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| Si | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Si | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Si | ⓘ Willemite | Zn2SiO4 |
| Si | ⓘ Wollastonite | Ca3(Si3O9) |
| Si | ⓘ Xonotlite | Ca6(Si6O17)(OH)2 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Quartz var. Rock Crystal | SiO2 |
| Si | ⓘ Quartz var. Milky Quartz | SiO2 |
| Si | ⓘ Sillimanite var. Fibrolite | Al2(SiO4)O |
| Si | ⓘ Quartz var. Prase | SiO2 |
| Si | ⓘ Brewsterite-Ba | Ba(Al2Si6)O16 · 5H2O |
| Si | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Si | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Si | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| Si | ⓘ Fayalite-Forsterite Series | |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Biotite var. Chromium-bearing Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Quartz var. Cotterite | SiO2 |
| Si | ⓘ Muscovite var. Mariposite | K(Al,Cr)2(Al,Si)4O10(OH)2 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Augite var. Titanium-bearing Augite | (Ca,Na)(Mg,Ti, Fe,Al,)(Si,Al)2O6 |
| Si | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| Si | ⓘ Quartz var. Ferruginous Quartz | SiO2 |
| Si | ⓘ Olivine Group | M2SiO4 |
| Si | ⓘ Melilite Group | A2M(XSiO7) |
| Si | ⓘ Augite var. Ferroaugite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| P | Phosphorus | |
| P | ⓘ Beraunite | Fe63+(PO4)4O(OH)4 · 6H2O |
| P | ⓘ Brushite | Ca(PO3OH) · 2H2O |
| P | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| P | ⓘ Chalcosiderite | CuFe63+(PO4)4(OH)8 · 4H2O |
| P | ⓘ Churchite-(Y) | Y(PO4) · 2H2O |
| P | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| P | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Kidwellite | NaFe3+9+x(PO4)6(OH)11 · 3H2O, x = 0.33 |
| P | ⓘ Kintoreite | PbFe3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Koninckite | Fe3+PO4 · 3H2O |
| P | ⓘ Lazulite | MgAl2(PO4)2(OH)2 |
| P | ⓘ Lithiophilite | LiMn2+PO4 |
| P | ⓘ Monazite Group | REE(PO4) |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| P | ⓘ Phosphosiderite | FePO4 · 2H2O |
| P | ⓘ Planerite | Al6(PO4)2(PO3OH)2(OH)8 · 4H2O |
| P | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Strengite | FePO4 · 2H2O |
| P | ⓘ Struvite | (NH4)Mg(PO4) · 6H2O |
| P | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| P | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| P | ⓘ Variscite | AlPO4 · 2H2O |
| P | ⓘ Wavellite | Al3(PO4)2(OH)3 · 5H2O |
| P | ⓘ Merrillite | Ca9NaMg(PO4)7 |
| P | ⓘ Apatite var. Collophane | Ca5(PO4)3(Cl/F/OH) |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Aikinite | CuPbBiS3 |
| S | ⓘ Alloclasite | Co1-xFexAsS |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Anhydrite | CaSO4 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Argentotennantite-(Zn) | Ag6(Cu4Zn2)As4S12S |
| S | ⓘ Argyrodite | Ag8GeS6 |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Boulangerite | Pb5Sb4S11 |
| S | ⓘ Bournonite | PbCuSbS3 |
| S | ⓘ Boyleite | ZnSO4 · 4H2O |
| S | ⓘ Pyrite var. Bravoite | (Fe,Ni)S2 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| S | ⓘ Celestine | SrSO4 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcanthite | CuSO4 · 5H2O |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| S | ⓘ Cinnabar | HgS |
| S | ⓘ Cobaltite | CoAsS |
| S | ⓘ Cobaltpentlandite | Co9S8 |
| S | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| S | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| S | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| S | ⓘ Cosalite | Pb2Bi2S5 |
| S | ⓘ Covellite | CuS |
| S | ⓘ Cubanite | CuFe2S3 |
| S | ⓘ Cylindrite | Pb3Sn4FeSb2S14 |
| S | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| S | ⓘ Diaphorite | Ag3Pb2Sb3S8 |
| S | ⓘ Digenite | Cu9S5 |
| S | ⓘ Djurleite | Cu31S16 |
| S | ⓘ Dufrénoysite | Pb2As2S5 |
| S | ⓘ Enargite | Cu3AsS4 |
| S | ⓘ Famatinite | Cu3SbS4 |
| S | ⓘ Felsőbányaite | Al4(SO4)(OH)10 · 4H2O |
| S | ⓘ Franckeite | Fe2+(Pb,Sn2+)6Sn24+Sb2S14 |
| S | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| S | ⓘ Galena | PbS |
| S | ⓘ Geocronite | Pb14Sb6S23 |
| S | ⓘ Gersdorffite | NiAsS |
| S | ⓘ Gortdrumite | Cu24Fe2Hg9S23 |
| S | ⓘ Gratonite | Pb9As4S15 |
| S | ⓘ Greenockite | CdS |
| S | ⓘ Gudmundite | FeSbS |
| S | ⓘ Guitermanite | Pb10As6S19 (?) |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Halotrichite | Fe2+Al2(SO4)4 · 22H2O |
| S | ⓘ Hammarite | Cu2Pb2Bi4S9 |
| S | ⓘ Hawleyite | CdS |
| S | ⓘ Hidalgoite | PbAl3(AsO4)(SO4)(OH)6 |
| S | ⓘ Hydroniumjarosite | (H3O)Fe33+(SO4)2(OH)6 |
| S | ⓘ Jalpaite | Ag3CuS2 |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Jordanite | Pb14As6S23 |
| S | ⓘ Krupkaite | CuPbBi3S6 |
| S | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| S | ⓘ Linarite | PbCu(SO4)(OH)2 |
| S | ⓘ Lindströmite | Cu3Pb3Bi7S15 |
| S | ⓘ Mackinawite | FeS |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Matildite | AgBiS2 |
| S | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| S | ⓘ Meneghinite | Pb13CuSb7S24 |
| S | ⓘ Metacinnabar | HgS |
| S | ⓘ Metasideronatrite | Na2Fe(SO4)2(OH) · H2O |
| S | ⓘ Miargyrite | AgSbS2 |
| S | ⓘ Millerite | NiS |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Morenosite | NiSO4 · 7H2O |
| S | ⓘ Orpiment | As2S3 |
| S | ⓘ Orthoserpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| S | ⓘ Parnauite | Cu9(AsO4)2(SO4)(OH)10 · 7H2O |
| S | ⓘ Pearceite | [Ag6As2S7][Ag9CuS4] |
| S | ⓘ Pentlandite | (NixFey)Σ9S8 |
| S | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| S | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| S | ⓘ Alum-(K) | KAl(SO4)2 · 12H2O |
| S | ⓘ Proustite | Ag3AsS3 |
| S | ⓘ Pyrargyrite | Ag3SbS3 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Realgar | As4S4 |
| S | ⓘ Renierite | (Cu+,Zn)11Fe4(Ge4+,As5+)2S16 |
| S | ⓘ Rozenite | FeSO4 · 4H2O |
| S | ⓘ Seligmannite | PbCuAsS3 |
| S | ⓘ Semseyite | Pb9Sb8S21 |
| S | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| S | ⓘ Sideronatrite | Na2Fe(SO4)2(OH) · 3H2O |
| S | ⓘ Siegenite | CoNi2S4 |
| S | ⓘ Smithite | AgAsS2 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Spionkopite | Cu39S28 |
| S | ⓘ Stannite | Cu2FeSnS4 |
| S | ⓘ Stephanite | Ag5SbS4 |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Stromeyerite | AgCuS |
| S | ⓘ Native Sulphur | S8 |
| S | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| S | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Troilite | FeS |
| S | ⓘ Ullmannite | NiSbS |
| S | ⓘ Vaesite | NiS2 |
| S | ⓘ Wittichenite | Cu3BiS3 |
| S | ⓘ Woodwardite | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| S | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Wurtzite | (Zn,Fe)S |
| S | ⓘ Xanthoconite | Ag3AsS3 |
| S | ⓘ Yarrowite | Cu9S8 |
| S | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| S | ⓘ Redgillite | Cu6(SO4)(OH)10 · H2O |
| S | ⓘ Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| S | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| S | ⓘ Tennantite Subgroup var. Mercury-bearing Tennantite | Cu6[Cu4(Zn,Fe,Hg)2]As4S13 |
| S | ⓘ Pyrite var. Arsenic-bearing Pyrite | Fe(S,As)2 |
| S | ⓘ Tetrahedrite Group | M2(A6)M1(B4 C2)X3(D4)S1(Y12)S2(Z) |
| S | ⓘ Sphalerite var. Mercury-bearing Sphalerite | (Zn,Hg)S |
| S | ⓘ Unnamed (Pb Thiosulphate) | PbS2O3 |
| S | ⓘ Tennantite-(Zn) | Cu6(Cu4Zn2)As4S12S |
| Cl | Chlorine | |
| Cl | ⓘ Atacamite | Cu2(OH)3Cl |
| Cl | ⓘ Botallackite | Cu2(OH)3Cl |
| Cl | ⓘ Clinoatacamite | Cu2(OH)3Cl |
| Cl | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Cl | ⓘ Eudialyte | Na15Ca6Fe3Zr3Si(Si25O73)(O,OH,H2O)3(Cl,OH)2 |
| Cl | ⓘ Hedyphane | Ca2Pb3(AsO4)3Cl |
| Cl | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| Cl | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Cl | ⓘ Phosgenite | Pb2CO3Cl2 |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Cl | ⓘ Rustumite | Ca10(Si2O7)2(SiO4)(OH)2Cl2 |
| Cl | ⓘ Apatite var. Collophane | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| K | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| K | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| K | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Neptunite | KNa2Li(Fe2+)2Ti2[Si4O12]2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| K | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| K | ⓘ Polylithionite | KLi2Al(Si4O10)(F,OH)2 |
| K | ⓘ Alum-(K) | KAl(SO4)2 · 12H2O |
| K | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| K | ⓘ Stilpnomelane | K4Fe482+[Si64Al8]O164(OH)52 · nH2O |
| K | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Biotite var. Chromium-bearing Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Muscovite var. Mariposite | K(Al,Cr)2(Al,Si)4O10(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Ca | ⓘ Afwillite | Ca3[SiO4][SiO2(OH)2] · 2H2O |
| Ca | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Anhydrite | CaSO4 |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Anorthite | Ca(Al2Si2O8) |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Brushite | Ca(PO3OH) · 2H2O |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| Ca | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| Ca | ⓘ Cuspidine | Ca8(Si2O7)2F4 |
| Ca | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Eudialyte | Na15Ca6Fe3Zr3Si(Si25O73)(O,OH,H2O)3(Cl,OH)2 |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Hedyphane | Ca2Pb3(AsO4)3Cl |
| Ca | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Ca | ⓘ Killalaite | Ca6.4(H0.6Si2O7)2(OH)2 |
| Ca | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Ca | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| Ca | ⓘ Axinite-(Mn) | Ca2Mn2+Al2BSi4O15(OH) |
| Ca | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| Ca | ⓘ Minrecordite | CaZn(CO3)2 |
| Ca | ⓘ Monohydrocalcite | CaCO3 · H2O |
| Ca | ⓘ Monticellite | CaMg(SiO4) |
| Ca | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Ca | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Orthoserpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Ca | ⓘ Pectolite | NaCa2Si3O8(OH) |
| Ca | ⓘ Pharmacolite | Ca(HAsO4) · 2H2O |
| Ca | ⓘ Phaunouxite | Ca3(AsO4)2 · 11H2O |
| Ca | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Ca | ⓘ Rauenthalite | Ca3(AsO4)2 · 10H2O |
| Ca | ⓘ Rustumite | Ca10(Si2O7)2(SiO4)(OH)2Cl2 |
| Ca | ⓘ Scawtite | Ca7(Si3O9)2CO3 · 2H2O |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| Ca | ⓘ Spurrite | Ca5(SiO4)2(CO3) |
| Ca | ⓘ Tilleyite | Ca5(Si2O7)(CO3)2 |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| Ca | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Ca | ⓘ Wollastonite | Ca3(Si3O9) |
| Ca | ⓘ Xonotlite | Ca6(Si6O17)(OH)2 |
| Ca | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| Ca | ⓘ Merrillite | Ca9NaMg(PO4)7 |
| Ca | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Ca | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Ca | ⓘ Zálesíite | CaCu6(AsO4)2(AsO3OH)(OH)6 · 3H2O |
| Ca | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Apatite var. Collophane | Ca5(PO4)3(Cl/F/OH) |
| Ca | ⓘ Augite var. Titanium-bearing Augite | (Ca,Na)(Mg,Ti, Fe,Al,)(Si,Al)2O6 |
| Ca | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ca | ⓘ Augite var. Ferroaugite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ti | Titanium | |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Brannerite | UTi2O6 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Ti | ⓘ Neptunite | KNa2Li(Fe2+)2Ti2[Si4O12]2 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| Ti | ⓘ Magnetite var. Titanium-bearing Magnetite | Fe2+(Fe3+,Ti)2O4 |
| Ti | ⓘ Biotite var. Chromium-bearing Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Augite var. Titanium-bearing Augite | (Ca,Na)(Mg,Ti, Fe,Al,)(Si,Al)2O6 |
| Cr | Chromium | |
| Cr | ⓘ Chromite | Fe2+Cr23+O4 |
| Cr | ⓘ Eskolaite | Cr2O3 |
| Cr | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Cr | ⓘ Muscovite var. Mariposite | K(Al,Cr)2(Al,Si)4O10(OH)2 |
| Mn | Manganese | |
| Mn | ⓘ Asbolane | (Ni,Co)2-xMn4+(O,OH)4 · nH2O |
| Mn | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| Mn | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| Mn | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| Mn | ⓘ Hetaerolite | ZnMn2O4 |
| Mn | ⓘ Hollandite | Ba(Mn64+Mn23+)O16 |
| Mn | ⓘ Hetaerolite var. Hydrohetaerolite | Zn(Mn,◻)2(O,OH)4 |
| Mn | ⓘ Lithiophilite | LiMn2+PO4 |
| Mn | ⓘ Axinite-(Mn) | Ca2Mn2+Al2BSi4O15(OH) |
| Mn | ⓘ Manganite | Mn3+O(OH) |
| Mn | ⓘ Tantalite-(Mn) | Mn2+Ta2O6 |
| Mn | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Rhodochrosite | MnCO3 |
| Mn | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Mn | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Mn | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Fe | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Alloclasite | Co1-xFexAsS |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Beraunite | Fe63+(PO4)4O(OH)4 · 6H2O |
| Fe | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Pyrite var. Bravoite | (Fe,Ni)S2 |
| Fe | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| Fe | ⓘ Chalcosiderite | CuFe63+(PO4)4(OH)8 · 4H2O |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Fe | ⓘ Chromite | Fe2+Cr23+O4 |
| Fe | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| Fe | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| Fe | ⓘ Cubanite | CuFe2S3 |
| Fe | ⓘ Cylindrite | Pb3Sn4FeSb2S14 |
| Fe | ⓘ Delafossite | Cu+Fe3+O2 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Eudialyte | Na15Ca6Fe3Zr3Si(Si25O73)(O,OH,H2O)3(Cl,OH)2 |
| Fe | ⓘ Fayalite | Fe22+(SiO4) |
| Fe | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| Fe | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Franckeite | Fe2+(Pb,Sn2+)6Sn24+Sb2S14 |
| Fe | ⓘ Franklinite | Zn2+Fe23+O4 |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Gortdrumite | Cu24Fe2Hg9S23 |
| Fe | ⓘ Gudmundite | FeSbS |
| Fe | ⓘ Halotrichite | Fe2+Al2(SO4)4 · 22H2O |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Hercynite | Fe2+Al2O4 |
| Fe | ⓘ Hydroniumjarosite | (H3O)Fe33+(SO4)2(OH)6 |
| Fe | ⓘ Hypersthene | (Mg,Fe)SiO3 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Native Iron | Fe |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Native Iron var. Kamacite | (Fe,Ni) |
| Fe | ⓘ Kidwellite | NaFe3+9+x(PO4)6(OH)11 · 3H2O, x = 0.33 |
| Fe | ⓘ Kintoreite | PbFe3(PO4)(PO3OH)(OH)6 |
| Fe | ⓘ Koninckite | Fe3+PO4 · 3H2O |
| Fe | ⓘ Lepidocrocite | Fe3+O(OH) |
| Fe | ⓘ Löllingite | FeAs2 |
| Fe | ⓘ Mackinawite | FeS |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| Fe | ⓘ Metasideronatrite | Na2Fe(SO4)2(OH) · H2O |
| Fe | ⓘ Minnesotaite | Fe32+Si4O10(OH)2 |
| Fe | ⓘ Neptunite | KNa2Li(Fe2+)2Ti2[Si4O12]2 |
| Fe | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Fe | ⓘ Parasymplesite | Fe32+(AsO4)2 · 8H2O |
| Fe | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Fe | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| Fe | ⓘ Phosphosiderite | FePO4 · 2H2O |
| Fe | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Renierite | (Cu+,Zn)11Fe4(Ge4+,As5+)2S16 |
| Fe | ⓘ Rozenite | FeSO4 · 4H2O |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Sideronatrite | Na2Fe(SO4)2(OH) · 3H2O |
| Fe | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| Fe | ⓘ Stannite | Cu2FeSnS4 |
| Fe | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Fe | ⓘ Stilpnomelane | K4Fe482+[Si64Al8]O164(OH)52 · nH2O |
| Fe | ⓘ Strengite | FePO4 · 2H2O |
| Fe | ⓘ Taenite | (Ni,Fe) |
| Fe | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Fe | ⓘ Tetrataenite | FeNi |
| Fe | ⓘ Magnetite var. Titanium-bearing Magnetite | Fe2+(Fe3+,Ti)2O4 |
| Fe | ⓘ Troilite | FeS |
| Fe | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Fe | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Fe | ⓘ Wurtzite | (Zn,Fe)S |
| Fe | ⓘ Hematite var. Specularite | Fe2O3 |
| Fe | ⓘ Spinel var. Pleonaste | (Mg,Fe)Al2O4 |
| Fe | ⓘ Smolyaninovite | Co3Fe23+(AsO4)4 · 11H2O |
| Fe | ⓘ Fayalite-Forsterite Series | |
| Fe | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Fe | ⓘ Biotite var. Chromium-bearing Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| Fe | ⓘ Augite var. Titanium-bearing Augite | (Ca,Na)(Mg,Ti, Fe,Al,)(Si,Al)2O6 |
| Fe | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Fe | ⓘ Hematite var. Crucilite | Fe2O3 |
| Fe | ⓘ Tennantite Subgroup var. Mercury-bearing Tennantite | Cu6[Cu4(Zn,Fe,Hg)2]As4S13 |
| Fe | ⓘ Pyrite var. Arsenic-bearing Pyrite | Fe(S,As)2 |
| Fe | ⓘ Augite var. Ferroaugite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Co | Cobalt | |
| Co | ⓘ Alloclasite | Co1-xFexAsS |
| Co | ⓘ Asbolane | (Ni,Co)2-xMn4+(O,OH)4 · nH2O |
| Co | ⓘ Cobaltite | CoAsS |
| Co | ⓘ Cobaltpentlandite | Co9S8 |
| Co | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| Co | ⓘ Siegenite | CoNi2S4 |
| Co | ⓘ Skutterudite | CoAs3 |
| Co | ⓘ Smolyaninovite | Co3Fe23+(AsO4)4 · 11H2O |
| Ni | Nickel | |
| Ni | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| Ni | ⓘ Asbolane | (Ni,Co)2-xMn4+(O,OH)4 · nH2O |
| Ni | ⓘ Pyrite var. Bravoite | (Fe,Ni)S2 |
| Ni | ⓘ Breithauptite | NiSb |
| Ni | ⓘ Gersdorffite | NiAsS |
| Ni | ⓘ Native Iron var. Kamacite | (Fe,Ni) |
| Ni | ⓘ Millerite | NiS |
| Ni | ⓘ Morenosite | NiSO4 · 7H2O |
| Ni | ⓘ Nickeline | NiAs |
| Ni | ⓘ Pararammelsbergite | NiAs2 |
| Ni | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Ni | ⓘ Rammelsbergite | NiAs2 |
| Ni | ⓘ Siegenite | CoNi2S4 |
| Ni | ⓘ Taenite | (Ni,Fe) |
| Ni | ⓘ Tetrataenite | FeNi |
| Ni | ⓘ Ullmannite | NiSbS |
| Ni | ⓘ Vaesite | NiS2 |
| Cu | Copper | |
| Cu | ⓘ Aikinite | CuPbBiS3 |
| Cu | ⓘ Argentotennantite-(Zn) | Ag6(Cu4Zn2)As4S12S |
| Cu | ⓘ Atacamite | Cu2(OH)3Cl |
| Cu | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Botallackite | Cu2(OH)3Cl |
| Cu | ⓘ Bournonite | PbCuSbS3 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| Cu | ⓘ Chalcosiderite | CuFe63+(PO4)4(OH)8 · 4H2O |
| Cu | ⓘ Chalcomenite | CuSeO3 · 2H2O |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcanthite | CuSO4 · 5H2O |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Clinoclase | Cu3(AsO4)(OH)3 |
| Cu | ⓘ Clinoatacamite | Cu2(OH)3Cl |
| Cu | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| Cu | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Cu | ⓘ Cornwallite | Cu5(AsO4)2(OH)4 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cubanite | CuFe2S3 |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Delafossite | Cu+Fe3+O2 |
| Cu | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Cu | ⓘ Digenite | Cu9S5 |
| Cu | ⓘ Djurleite | Cu31S16 |
| Cu | ⓘ Enargite | Cu3AsS4 |
| Cu | ⓘ Famatinite | Cu3SbS4 |
| Cu | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Cu | ⓘ Gortdrumite | Cu24Fe2Hg9S23 |
| Cu | ⓘ Hammarite | Cu2Pb2Bi4S9 |
| Cu | ⓘ Jalpaite | Ag3CuS2 |
| Cu | ⓘ Krupkaite | CuPbBi3S6 |
| Cu | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| Cu | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Cu | ⓘ Lindströmite | Cu3Pb3Bi7S15 |
| Cu | ⓘ Liroconite | Cu2Al(AsO4)(OH)4 · 4H2O |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Meneghinite | Pb13CuSb7S24 |
| Cu | ⓘ Olivenite | Cu2(AsO4)(OH) |
| Cu | ⓘ Orthoserpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Cu | ⓘ Parnauite | Cu9(AsO4)2(SO4)(OH)10 · 7H2O |
| Cu | ⓘ Pearceite | [Ag6As2S7][Ag9CuS4] |
| Cu | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| Cu | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| Cu | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| Cu | ⓘ Renierite | (Cu+,Zn)11Fe4(Ge4+,As5+)2S16 |
| Cu | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Cu | ⓘ Seligmannite | PbCuAsS3 |
| Cu | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| Cu | ⓘ Spionkopite | Cu39S28 |
| Cu | ⓘ Stannite | Cu2FeSnS4 |
| Cu | ⓘ Strashimirite | Cu8(AsO4)4(OH)4 · 5H2O |
| Cu | ⓘ Stromeyerite | AgCuS |
| Cu | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Cu | ⓘ Tenorite | CuO |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Theisite | Cu5Zn5(AsO4,SbO4)2(OH)14 |
| Cu | ⓘ Cuprite var. Tile ore | Cu2O |
| Cu | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| Cu | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| Cu | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| Cu | ⓘ Wittichenite | Cu3BiS3 |
| Cu | ⓘ Woodwardite | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| Cu | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Yarrowite | Cu9S8 |
| Cu | ⓘ Zálesíite | CaCu6(AsO4)2(AsO3OH)(OH)6 · 3H2O |
| Cu | ⓘ Redgillite | Cu6(SO4)(OH)10 · H2O |
| Cu | ⓘ Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| Cu | ⓘ Tennantite Subgroup var. Mercury-bearing Tennantite | Cu6[Cu4(Zn,Fe,Hg)2]As4S13 |
| Cu | ⓘ Tennantite-(Zn) | Cu6(Cu4Zn2)As4S12S |
| Zn | Zinc | |
| Zn | ⓘ Adamite | Zn2(AsO4)(OH) |
| Zn | ⓘ Argentotennantite-(Zn) | Ag6(Cu4Zn2)As4S12S |
| Zn | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Zn | ⓘ Boyleite | ZnSO4 · 4H2O |
| Zn | ⓘ Franklinite | Zn2+Fe23+O4 |
| Zn | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Zn | ⓘ Hetaerolite | ZnMn2O4 |
| Zn | ⓘ Hetaerolite var. Hydrohetaerolite | Zn(Mn,◻)2(O,OH)4 |
| Zn | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| Zn | ⓘ Köttigite | Zn3(AsO4)2 · 8H2O |
| Zn | ⓘ Minrecordite | CaZn(CO3)2 |
| Zn | ⓘ Orthoserpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Zn | ⓘ Renierite | (Cu+,Zn)11Fe4(Ge4+,As5+)2S16 |
| Zn | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Zn | ⓘ Sauconite | Na0.3Zn3((Si,Al)4O10)(OH)2 · 4H2O |
| Zn | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| Zn | ⓘ Smithsonite | ZnCO3 |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Theisite | Cu5Zn5(AsO4,SbO4)2(OH)14 |
| Zn | ⓘ Willemite | Zn2SiO4 |
| Zn | ⓘ Wurtzite | (Zn,Fe)S |
| Zn | ⓘ Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| Zn | ⓘ Tennantite Subgroup var. Mercury-bearing Tennantite | Cu6[Cu4(Zn,Fe,Hg)2]As4S13 |
| Zn | ⓘ Sphalerite var. Mercury-bearing Sphalerite | (Zn,Hg)S |
| Zn | ⓘ Tennantite-(Zn) | Cu6(Cu4Zn2)As4S12S |
| Ge | Germanium | |
| Ge | ⓘ Argyrodite | Ag8GeS6 |
| Ge | ⓘ Renierite | (Cu+,Zn)11Fe4(Ge4+,As5+)2S16 |
| As | Arsenic | |
| As | ⓘ Adamite | Zn2(AsO4)(OH) |
| As | ⓘ Alloclasite | Co1-xFexAsS |
| As | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| As | ⓘ Arsenolite | As2O3 |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Argentotennantite-(Zn) | Ag6(Cu4Zn2)As4S12S |
| As | ⓘ Native Arsenic | As |
| As | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| As | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| As | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| As | ⓘ Clinoclase | Cu3(AsO4)(OH)3 |
| As | ⓘ Cobaltite | CoAsS |
| As | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| As | ⓘ Cornwallite | Cu5(AsO4)2(OH)4 |
| As | ⓘ Dufrénoysite | Pb2As2S5 |
| As | ⓘ Enargite | Cu3AsS4 |
| As | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| As | ⓘ Gersdorffite | NiAsS |
| As | ⓘ Gratonite | Pb9As4S15 |
| As | ⓘ Guitermanite | Pb10As6S19 (?) |
| As | ⓘ Hedyphane | Ca2Pb3(AsO4)3Cl |
| As | ⓘ Hidalgoite | PbAl3(AsO4)(SO4)(OH)6 |
| As | ⓘ Jordanite | Pb14As6S23 |
| As | ⓘ Köttigite | Zn3(AsO4)2 · 8H2O |
| As | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| As | ⓘ Liroconite | Cu2Al(AsO4)(OH)4 · 4H2O |
| As | ⓘ Löllingite | FeAs2 |
| As | ⓘ Mimetite | Pb5(AsO4)3Cl |
| As | ⓘ Nickeline | NiAs |
| As | ⓘ Olivenite | Cu2(AsO4)(OH) |
| As | ⓘ Orpiment | As2S3 |
| As | ⓘ Pararammelsbergite | NiAs2 |
| As | ⓘ Parasymplesite | Fe32+(AsO4)2 · 8H2O |
| As | ⓘ Parnauite | Cu9(AsO4)2(SO4)(OH)10 · 7H2O |
| As | ⓘ Pearceite | [Ag6As2S7][Ag9CuS4] |
| As | ⓘ Pharmacolite | Ca(HAsO4) · 2H2O |
| As | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| As | ⓘ Phaunouxite | Ca3(AsO4)2 · 11H2O |
| As | ⓘ Proustite | Ag3AsS3 |
| As | ⓘ Rammelsbergite | NiAs2 |
| As | ⓘ Rauenthalite | Ca3(AsO4)2 · 10H2O |
| As | ⓘ Realgar | As4S4 |
| As | ⓘ Renierite | (Cu+,Zn)11Fe4(Ge4+,As5+)2S16 |
| As | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| As | ⓘ Seligmannite | PbCuAsS3 |
| As | ⓘ Skutterudite | CoAs3 |
| As | ⓘ Smithite | AgAsS2 |
| As | ⓘ Strashimirite | Cu8(AsO4)4(OH)4 · 5H2O |
| As | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| As | ⓘ Theisite | Cu5Zn5(AsO4,SbO4)2(OH)14 |
| As | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| As | ⓘ Xanthoconite | Ag3AsS3 |
| As | ⓘ Zálesíite | CaCu6(AsO4)2(AsO3OH)(OH)6 · 3H2O |
| As | ⓘ Smolyaninovite | Co3Fe23+(AsO4)4 · 11H2O |
| As | ⓘ Tennantite Subgroup var. Mercury-bearing Tennantite | Cu6[Cu4(Zn,Fe,Hg)2]As4S13 |
| As | ⓘ Pyrite var. Arsenic-bearing Pyrite | Fe(S,As)2 |
| As | ⓘ Tennantite-(Zn) | Cu6(Cu4Zn2)As4S12S |
| Se | Selenium | |
| Se | ⓘ Chalcomenite | CuSeO3 · 2H2O |
| Se | ⓘ Clausthalite | PbSe |
| Se | ⓘ Kawazulite | Bi2Te2Se |
| Se | ⓘ Kurilite | Ag8Te3Se |
| Se | ⓘ Native Selenium | Se |
| Sr | Strontium | |
| Sr | ⓘ Celestine | SrSO4 |
| Sr | ⓘ Strontianite | SrCO3 |
| Y | Yttrium | |
| Y | ⓘ Churchite-(Y) | Y(PO4) · 2H2O |
| Zr | Zirconium | |
| Zr | ⓘ Eudialyte | Na15Ca6Fe3Zr3Si(Si25O73)(O,OH,H2O)3(Cl,OH)2 |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
| Nb | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Nb | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Mo | Molybdenum | |
| Mo | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| Mo | ⓘ Molybdenite | MoS2 |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Pd | Palladium | |
| Pd | ⓘ Stibiopalladinite | Pd5Sb2 |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Native Silver var. Amalgam | (Ag,Hg) |
| Ag | ⓘ Argentotennantite-(Zn) | Ag6(Cu4Zn2)As4S12S |
| Ag | ⓘ Argyrodite | Ag8GeS6 |
| Ag | ⓘ Diaphorite | Ag3Pb2Sb3S8 |
| Ag | ⓘ Native Gold var. Electrum | (Au,Ag) |
| Ag | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Ag | ⓘ Hessite | Ag2Te |
| Ag | ⓘ Jalpaite | Ag3CuS2 |
| Ag | ⓘ Native Silver var. Kongsbergite | (Ag,Hg) |
| Ag | ⓘ Kurilite | Ag8Te3Se |
| Ag | ⓘ Matildite | AgBiS2 |
| Ag | ⓘ Miargyrite | AgSbS2 |
| Ag | ⓘ Pearceite | [Ag6As2S7][Ag9CuS4] |
| Ag | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| Ag | ⓘ Proustite | Ag3AsS3 |
| Ag | ⓘ Pyrargyrite | Ag3SbS3 |
| Ag | ⓘ Native Silver | Ag |
| Ag | ⓘ Smithite | AgAsS2 |
| Ag | ⓘ Stephanite | Ag5SbS4 |
| Ag | ⓘ Stromeyerite | AgCuS |
| Ag | ⓘ Xanthoconite | Ag3AsS3 |
| Ag | ⓘ Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| Ag | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| Ag | ⓘ Native Silver var. Küstelite | Ag |
| Cd | Cadmium | |
| Cd | ⓘ Greenockite | CdS |
| Cd | ⓘ Hawleyite | CdS |
| Cd | ⓘ Otavite | CdCO3 |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sn | ⓘ Cylindrite | Pb3Sn4FeSb2S14 |
| Sn | ⓘ Franckeite | Fe2+(Pb,Sn2+)6Sn24+Sb2S14 |
| Sn | ⓘ Stannite | Cu2FeSnS4 |
| Sn | ⓘ Cassiterite var. Wood Tin | SnO2 |
| Sb | Antimony | |
| Sb | ⓘ Native Antimony | Sb |
| Sb | ⓘ Bindheimite | Pb2Sb2O6O |
| Sb | ⓘ Boulangerite | Pb5Sb4S11 |
| Sb | ⓘ Bournonite | PbCuSbS3 |
| Sb | ⓘ Breithauptite | NiSb |
| Sb | ⓘ Cylindrite | Pb3Sn4FeSb2S14 |
| Sb | ⓘ Diaphorite | Ag3Pb2Sb3S8 |
| Sb | ⓘ Famatinite | Cu3SbS4 |
| Sb | ⓘ Franckeite | Fe2+(Pb,Sn2+)6Sn24+Sb2S14 |
| Sb | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Sb | ⓘ Geocronite | Pb14Sb6S23 |
| Sb | ⓘ Gudmundite | FeSbS |
| Sb | ⓘ Meneghinite | Pb13CuSb7S24 |
| Sb | ⓘ Miargyrite | AgSbS2 |
| Sb | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| Sb | ⓘ Pyrargyrite | Ag3SbS3 |
| Sb | ⓘ Semseyite | Pb9Sb8S21 |
| Sb | ⓘ Stibiopalladinite | Pd5Sb2 |
| Sb | ⓘ Stephanite | Ag5SbS4 |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Sb | ⓘ Theisite | Cu5Zn5(AsO4,SbO4)2(OH)14 |
| Sb | ⓘ Ullmannite | NiSbS |
| Sb | ⓘ Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| Te | Tellurium | |
| Te | ⓘ Hessite | Ag2Te |
| Te | ⓘ Kawazulite | Bi2Te2Se |
| Te | ⓘ Kurilite | Ag8Te3Se |
| Te | ⓘ Native Tellurium | Te |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| Ba | ⓘ Hollandite | Ba(Mn64+Mn23+)O16 |
| Ba | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| Ba | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| Ba | ⓘ Brewsterite-Ba | Ba(Al2Si6)O16 · 5H2O |
| Ce | Cerium | |
| Ce | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| Ta | Tantalum | |
| Ta | ⓘ Tantalite-(Mn) | Mn2+Ta2O6 |
| Ta | ⓘ Microlite Group | A2-mTa2X6-wZ1-n |
| Ta | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
| Pt | Platinum | |
| Pt | ⓘ Native Platinum | Pt |
| Au | Gold | |
| Au | ⓘ Native Gold var. Electrum | (Au,Ag) |
| Au | ⓘ Native Gold | Au |
| Hg | Mercury | |
| Hg | ⓘ Native Silver var. Amalgam | (Ag,Hg) |
| Hg | ⓘ Cinnabar | HgS |
| Hg | ⓘ Gortdrumite | Cu24Fe2Hg9S23 |
| Hg | ⓘ Native Silver var. Kongsbergite | (Ag,Hg) |
| Hg | ⓘ Metacinnabar | HgS |
| Hg | ⓘ Tennantite Subgroup var. Mercury-bearing Tennantite | Cu6[Cu4(Zn,Fe,Hg)2]As4S13 |
| Hg | ⓘ Sphalerite var. Mercury-bearing Sphalerite | (Zn,Hg)S |
| Pb | Lead | |
| Pb | ⓘ Aikinite | CuPbBiS3 |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| Pb | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| Pb | ⓘ Bindheimite | Pb2Sb2O6O |
| Pb | ⓘ Boulangerite | Pb5Sb4S11 |
| Pb | ⓘ Bournonite | PbCuSbS3 |
| Pb | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Clausthalite | PbSe |
| Pb | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| Pb | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| Pb | ⓘ Cosalite | Pb2Bi2S5 |
| Pb | ⓘ Cylindrite | Pb3Sn4FeSb2S14 |
| Pb | ⓘ Diaphorite | Ag3Pb2Sb3S8 |
| Pb | ⓘ Dufrénoysite | Pb2As2S5 |
| Pb | ⓘ Dundasite | PbAl2(CO3)2(OH)4 · H2O |
| Pb | ⓘ Franckeite | Fe2+(Pb,Sn2+)6Sn24+Sb2S14 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Geocronite | Pb14Sb6S23 |
| Pb | ⓘ Gratonite | Pb9As4S15 |
| Pb | ⓘ Guitermanite | Pb10As6S19 (?) |
| Pb | ⓘ Hammarite | Cu2Pb2Bi4S9 |
| Pb | ⓘ Hedyphane | Ca2Pb3(AsO4)3Cl |
| Pb | ⓘ Hidalgoite | PbAl3(AsO4)(SO4)(OH)6 |
| Pb | ⓘ Jordanite | Pb14As6S23 |
| Pb | ⓘ Kintoreite | PbFe3(PO4)(PO3OH)(OH)6 |
| Pb | ⓘ Krupkaite | CuPbBi3S6 |
| Pb | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| Pb | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Pb | ⓘ Lindströmite | Cu3Pb3Bi7S15 |
| Pb | ⓘ Meneghinite | Pb13CuSb7S24 |
| Pb | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Pb | ⓘ Phosgenite | Pb2CO3Cl2 |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Pb | ⓘ Seligmannite | PbCuAsS3 |
| Pb | ⓘ Semseyite | Pb9Sb8S21 |
| Pb | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| Pb | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| Pb | ⓘ Unnamed (Pb Thiosulphate) | PbS2O3 |
| Bi | Bismuth | |
| Bi | ⓘ Aikinite | CuPbBiS3 |
| Bi | ⓘ Native Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Cosalite | Pb2Bi2S5 |
| Bi | ⓘ Hammarite | Cu2Pb2Bi4S9 |
| Bi | ⓘ Kawazulite | Bi2Te2Se |
| Bi | ⓘ Krupkaite | CuPbBi3S6 |
| Bi | ⓘ Lindströmite | Cu3Pb3Bi7S15 |
| Bi | ⓘ Matildite | AgBiS2 |
| Bi | ⓘ Wittichenite | Cu3BiS3 |
| U | Uranium | |
| U | ⓘ Brannerite | UTi2O6 |
| U | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| U | ⓘ Uraninite | UO2 |
Geochronology
Mineralization age: Mesoproterozoic to Carboniferous : 1093 ± 78 Ma to 314.44 ± 1 MaImportant note: This table is based only on rock and mineral ages recorded on mindat.org for this locality and is not necessarily a complete representation of the geochronology, but does give an indication of possible mineralization events relevant to this locality. As more age information is added this table may expand in the future. A break in the table simply indicates a lack of data entered here, not necessarily a break in the geologic sequence. Grey background entries are from different, related, localities.
| Geologic Time | Rocks, Minerals and Events | ||||||
|---|---|---|---|---|---|---|---|
| Phanerozoic | |||||||
| Paleozoic | |||||||
| Carboniferous | |||||||
| Pennsylvanian |
| ||||||
| Mississippian |
| ||||||
| Precambrian | |||||||
| Proterozoic | |||||||
| Mesoproterozoic | |||||||
| Stenian |
| ||||||
Fossils
There are 2077 fossil localities from the PaleoBioDB database within this region.These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 2077 |
|---|---|
| Youngest Fossil Listed | 0.01 Ma (Pleistocene) |
| Oldest Fossil Listed | 501 Ma (Cambrian) |
| Stratigraphic Units | Click here to view 85 stratigraphic units. |
| Fossils from Region | Click here to show the list. |
| Fossil Localities | Click to show 88 fossil localities |
- Paleozoic🐚 Ballyheigue
- Paleozoic🐚 Ballyheigue Locality
- Late/Upper Ordovician🐚 Clashford House Fm
- Silurian🐚 Devilsbit Mountain
- Paleozoic🐚 Hook Head
- Late/Upper Ordovician🐚 Lime Kiln Bay
- Paleozoic🐚 Sutton
- Connacht
- Leinster
- Carboniferous🐚 Athlone
- Late/Upper Ordovician🐚 Carrigadaggan
- Late/Upper Ordovician🐚 Kilbride
- Ordovician🐚 Raheen
- Carlow County
- Dublin County
- Carboniferous🐚 Curkeen Hill Quarry Buildup
- Paleozoic🐚 Feltrim Hill
- Carboniferous🐚 Hoare's Rock Buildup
- Paleozoic🐚 Kiln Point
- Carboniferous🐚 Milverton Quarry Buildup
- Carboniferous🐚 Popeshall Coast Buildup
- Carboniferous🐚 Popeshall Quarry Buildup
- Late/Upper Ordovician🐚 Portrane
- Carboniferous🐚 Salmon Hill Buildup
- Kildare County
- Leinster
- Kildare County
- Kilkenny County
- Longford County
- Meath County
- Offaly County
- Wexford County
- Munster
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Republic_of_Ireland |
|---|---|
| Wikidata ID: | Q27 |
| GeoNames ID: | 2963597 |
Localities in this Region
- ⭔Connacht
- ⭔Leinster
- ⭔Carlow County
- ⭔Dublin County
- ⭔Kildare County
- ⭔Kilkenny County
- ⭔Laois County
- Ballylehane Colliery
- Fleming's Colliery
- Geneva Colliery
- Gracefield Colliery
- Holly Park Colliery
- Kilgory Colliery
- Kilgory Opencast
- Modubea Colliery
- Modubeagh Colliery
- Mullaghmore Colliery
- Rossmore New Colliery
- Rossmore Old Colliery
- Sally's Bridge Colliery
- Towlerton Colliery
- Wolfhill a Colliery
- Wolfhill b Colliery
- ⭔Longford County
- ⭔Louth County
- ⭔Meath County
- ⭔Offaly County
- ⭔Westmeath County
- ⭔Wexford County
- Leinster
- ⭔Munster
- ⭔Clare County
- ⭔Cork County
- Blackrock
- ⭔Blarney - Macroom
- Castletown-Bearhaven Copper Mines
- Clonakilty
- ⭔Cobh Municipal District
- Crosshaven
- Glandore
- Kinsale
- Mallow
- Mizen Peninsula
- Owenahincha
- Rosscarbery
- Sheeps Head Peninsula
- Skibbereen
- ⭔The Municipal District of Bandon – Kinsale
- ⭔The Municipal District of East Cork
- ⭔The Municipal District of Fermoy
- The Municipal District of Kanturk – Mallow
- Tracton
- West Cork
- ⭔Kerry County
- ⭔Limerick County
- ⭔Tipperary County
- Ballinastick New Colliery
- Ballinastick Old Colliery
- Ballingarry Colliery
- Ballingarry old Colliery
- Ballynastick Colliery
- Ballynunty Colliery
- Ballyphilip Colliery
- Ballyphilip Opencast
- Boulea Colliery
- Coalbrook & Bolintlea Colliery
- Coalbrook Colliery
- Commons Colliery
- Commons No.2 Colliery
- Earl's Hill Colliery
- Foilacamin Colliery
- Foilacamin Opencast
- Gorteen a Colliery
- Gorteen b Colliery
- Hollyford Mine
- Kilfeacle Quarry
- Knockalonga Colliery
- Lickfinn Opencast
- Lisnamrock Colliery
- Mardyke Colliery
- Monard
- Mooresfort meteorite (Tipperary meteorite)
- Moyne
- Silvermines District
- Springfield Abbey
- The Commons Colliery
- ⭔Waterford County
- ⭔Ulster
Other Regions, Features and Areas that Intersect
Atlantic OceanOcean
British and Irish IslesGroup of Islands
Eurasian PlateTectonic Plate
- AvaloniaVolcanic Arc
- CaledonidesOrogenic Belt
- Laurentia ProvinceCraton
- Rheno-Hercynian BeltOrogenic Belt
EuropeContinent
Ireland
- Leinster
- Leinster BatholithBatholith
- Leinster pegmatite BeltMineral Belt
- Munster
- Cork County
- Beara PeninsulaPeninsula
- Cork County
- Wicklow MountainsMountain Range
Ireland (island)Island
North Atlantic Igneous ProvinceLarge Igneous Province
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Fettes, D. J. (1979) A metamorphic map of the British and Irish Caledonides. Geological Society, London, Special Publications, 8 (1). p.305-321. doi:10.1144/gsl.sp.1979.008.01.35
Kennan, Padhraig S. (1979) Plutonic rocks in the Irish Caledonides. Geological Society, London, Special Publications, 8 (1). p.705-711. doi:10.1144/gsl.sp.1979.008.01.85
Kennan, P. S.; Phillips, W. E. A.; Strogen, P. (1979) Pre-Caledonian basement to the paratectonic Caledonides in Ireland. Geological Society, London, Special Publications, 8 (1). p.157-161. doi:10.1144/gsl.sp.1979.008.01.15
Ryback, George, Nawaz, R., Farley, E. (1988) Seventh supplementary list of British Isles minerals (Irish) Mineralogical Magazine, 52 (365) 267-274
Plant, J. A.; Stone, P.; Mendum, J. R. (1999) Regional geochemistry, terrane analysis and metallogeny in the British Caledonides. Geological Society, London, Special Publications, 164 (1). p.109-125. doi:10.1144/gsl.sp.1999.164.01.06
Quick NavTopCommoditiesMineral ListRock TypesGeochronologyFossilsOther DatabasesLocalities in RegionOther RegionsReferences
Tynagh Mine, Killimor, Galway County, Connacht, Ireland